2 hete · 34bae68e7b
--- a/.env.example
+++ b/.env.example
@@ -0,0 +1,20 @@
 
				+# Solana RPC URL
			
 
				+SOL_ENDPOINT=https://api.mainnet-beta.solana.com
			
 
				+
			
 
				+# Local wallet private key (base58 encoded)
			
 
				+SOL_SECRET_KEY=
			
 
				+
			
 
				+# Jupiter API key (from https://portal.jup.ag/)
			
 
				+JUPITER_API_KEY=
			
 
				+
			
 
				+# Copy multiplier (1.0 = same as target, 2.0 = 2x, 0.5 = half)
			
 
				+COPY_MULTIPLIER=1.0
			
 
				+
			
 
				+# Max USD per copy operation (cap total position value)
			
 
				+COPY_MAX_USD=1000
			
 
				+
			
 
				+# Default slippage for copy operations (0.02 = 2%)
			
 
				+COPY_SLIPPAGE=0.02
			
 
				+
			
 
				+# Monitoring poll interval in milliseconds
			
 
				+MONITOR_POLL_INTERVAL=5000
			
--- a/.gitignore
+++ b/.gitignore
@@ -32,6 +32,12 @@ yarn-error.log*
 
				 
			
 
				 # env files (can opt-in for committing if needed)
			
 
				 .env*
			
 
				+!.env.example
			
 
				+
			
 
				+# database
			
 
				+/data/*.db
			
 
				+/data/*.db-wal
			
 
				+/data/*.db-shm
			
 
				 
			
 
				 # vercel
			
 
				 .vercel
			
--- a/.pnpm-approve-builds.json
+++ b/.pnpm-approve-builds.json
@@ -0,0 +1 @@
 
				+{"better-sqlite3": true, "bigint-buffer": true, "bufferutil": true, "utf-8-validate": true}
			
--- a/.prettierignore
+++ b/.prettierignore
@@ -0,0 +1,5 @@
 
				+node_modules
			
 
				+.next
			
 
				+dist
			
 
				+src/lib/clmm-sdk
			
 
				+pnpm-lock.yaml
			
--- a/.prettierrc
+++ b/.prettierrc
@@ -0,0 +1,7 @@
 
				+{
			
 
				+  "singleQuote": true,
			
 
				+  "semi": false,
			
 
				+  "printWidth": 100,
			
 
				+  "trailingComma": "all",
			
 
				+  "tabWidth": 2
			
 
				+}
			
--- a/app/globals.css
+++ b/app/globals.css
@@ -1,26 +0,0 @@
 
				-@import "tailwindcss";
			
 
				-
			
 
				-:root {
			
 
				-  --background: #ffffff;
			
 
				-  --foreground: #171717;
			
 
				-}
			
 
				-
			
 
				-@theme inline {
			
 
				-  --color-background: var(--background);
			
 
				-  --color-foreground: var(--foreground);
			
 
				-  --font-sans: var(--font-geist-sans);
			
 
				-  --font-mono: var(--font-geist-mono);
			
 
				-}
			
 
				-
			
 
				-@media (prefers-color-scheme: dark) {
			
 
				-  :root {
			
 
				-    --background: #0a0a0a;
			
 
				-    --foreground: #ededed;
			
 
				-  }
			
 
				-}
			
 
				-
			
 
				-body {
			
 
				-  background: var(--background);
			
 
				-  color: var(--foreground);
			
 
				-  font-family: Arial, Helvetica, sans-serif;
			
 
				-}
			
--- a/app/layout.tsx
+++ b/app/layout.tsx
@@ -1,34 +0,0 @@
 
				-import type { Metadata } from "next";
			
 
				-import { Geist, Geist_Mono } from "next/font/google";
			
 
				-import "./globals.css";
			
 
				-
			
 
				-const geistSans = Geist({
			
 
				-  variable: "--font-geist-sans",
			
 
				-  subsets: ["latin"],
			
 
				-});
			
 
				-
			
 
				-const geistMono = Geist_Mono({
			
 
				-  variable: "--font-geist-mono",
			
 
				-  subsets: ["latin"],
			
 
				-});
			
 
				-
			
 
				-export const metadata: Metadata = {
			
 
				-  title: "Create Next App",
			
 
				-  description: "Generated by create next app",
			
 
				-};
			
 
				-
			
 
				-export default function RootLayout({
			
 
				-  children,
			
 
				-}: Readonly<{
			
 
				-  children: React.ReactNode;
			
 
				-}>) {
			
 
				-  return (
			
 
				-    <html lang="en">
			
 
				-      <body
			
 
				-        className={`${geistSans.variable} ${geistMono.variable} antialiased`}
			
 
				-      >
			
 
				-        {children}
			
 
				-      </body>
			
 
				-    </html>
			
 
				-  );
			
 
				-}
			
--- a/app/page.tsx
+++ b/app/page.tsx
@@ -1,65 +0,0 @@
 
				-import Image from "next/image";
			
 
				-
			
 
				-export default function Home() {
			
 
				-  return (
			
 
				-    <div className="flex min-h-screen items-center justify-center bg-zinc-50 font-sans dark:bg-black">
			
 
				-      <main className="flex min-h-screen w-full max-w-3xl flex-col items-center justify-between py-32 px-16 bg-white dark:bg-black sm:items-start">
			
 
				-        <Image
			
 
				-          className="dark:invert"
			
 
				-          src="/next.svg"
			
 
				-          alt="Next.js logo"
			
 
				-          width={100}
			
 
				-          height={20}
			
 
				-          priority
			
 
				-        />
			
 
				-        <div className="flex flex-col items-center gap-6 text-center sm:items-start sm:text-left">
			
 
				-          <h1 className="max-w-xs text-3xl font-semibold leading-10 tracking-tight text-black dark:text-zinc-50">
			
 
				-            To get started, edit the page.tsx file.
			
 
				-          </h1>
			
 
				-          <p className="max-w-md text-lg leading-8 text-zinc-600 dark:text-zinc-400">
			
 
				-            Looking for a starting point or more instructions? Head over to{" "}
			
 
				-            <a
			
 
				-              href="https://vercel.com/templates?framework=next.js&utm_source=create-next-app&utm_medium=appdir-template-tw&utm_campaign=create-next-app"
			
 
				-              className="font-medium text-zinc-950 dark:text-zinc-50"
			
 
				-            >
			
 
				-              Templates
			
 
				-            </a>{" "}
			
 
				-            or the{" "}
			
 
				-            <a
			
 
				-              href="https://nextjs.org/learn?utm_source=create-next-app&utm_medium=appdir-template-tw&utm_campaign=create-next-app"
			
 
				-              className="font-medium text-zinc-950 dark:text-zinc-50"
			
 
				-            >
			
 
				-              Learning
			
 
				-            </a>{" "}
			
 
				-            center.
			
 
				-          </p>
			
 
				-        </div>
			
 
				-        <div className="flex flex-col gap-4 text-base font-medium sm:flex-row">
			
 
				-          <a
			
 
				-            className="flex h-12 w-full items-center justify-center gap-2 rounded-full bg-foreground px-5 text-background transition-colors hover:bg-[#383838] dark:hover:bg-[#ccc] md:w-[158px]"
			
 
				-            href="https://vercel.com/new?utm_source=create-next-app&utm_medium=appdir-template-tw&utm_campaign=create-next-app"
			
 
				-            target="_blank"
			
 
				-            rel="noopener noreferrer"
			
 
				-          >
			
 
				-            <Image
			
 
				-              className="dark:invert"
			
 
				-              src="/vercel.svg"
			
 
				-              alt="Vercel logomark"
			
 
				-              width={16}
			
 
				-              height={16}
			
 
				-            />
			
 
				-            Deploy Now
			
 
				-          </a>
			
 
				-          <a
			
 
				-            className="flex h-12 w-full items-center justify-center rounded-full border border-solid border-black/[.08] px-5 transition-colors hover:border-transparent hover:bg-black/[.04] dark:border-white/[.145] dark:hover:bg-[#1a1a1a] md:w-[158px]"
			
 
				-            href="https://nextjs.org/docs?utm_source=create-next-app&utm_medium=appdir-template-tw&utm_campaign=create-next-app"
			
 
				-            target="_blank"
			
 
				-            rel="noopener noreferrer"
			
 
				-          >
			
 
				-            Documentation
			
 
				-          </a>
			
 
				-        </div>
			
 
				-      </main>
			
 
				-    </div>
			
 
				-  );
			
 
				-}
			
--- a/data/.gitkeep
+++ b/data/.gitkeep
--- a/next.config.ts
+++ b/next.config.ts
@@ -1,7 +1,8 @@
 
				-import type { NextConfig } from "next";
			
 
				+import type { NextConfig } from 'next'
			
 
				 
			
 
				 const nextConfig: NextConfig = {
			
 
				-  /* config options here */
			
 
				-};
			
 
				+  serverExternalPackages: ['better-sqlite3'],
			
 
				+  turbopack: {},
			
 
				+}
			
 
				 
			
 
				-export default nextConfig;
			
 
				+export default nextConfig
			
--- a/package.json
+++ b/package.json
@@ -6,20 +6,37 @@
 
				     "dev": "next dev",
			
 
				     "build": "next build",
			
 
				     "start": "next start",
			
 
				-    "lint": "eslint"
			
 
				+    "lint": "eslint",
			
 
				+    "format": "prettier --write \"src/**/*.{ts,tsx,css}\""
			
 
				   },
			
 
				   "dependencies": {
			
 
				+    "@coral-xyz/anchor": "^0.31.1",
			
 
				+    "@noble/hashes": "^1.8.0",
			
 
				+    "@solana/buffer-layout": "^4.0.1",
			
 
				+    "@solana/spl-token": "^0.4.14",
			
 
				+    "@solana/web3.js": "^1.98.4",
			
 
				+    "better-sqlite3": "^11.10.0",
			
 
				+    "bn.js": "^5.2.3",
			
 
				+    "bs58": "^6.0.0",
			
 
				+    "decimal.js": "^10.6.0",
			
 
				+    "ky": "^1.14.3",
			
 
				+    "lodash-es": "^4.17.23",
			
 
				     "next": "16.1.6",
			
 
				     "react": "19.2.3",
			
 
				-    "react-dom": "19.2.3"
			
 
				+    "react-dom": "19.2.3",
			
 
				+    "swr": "^2.4.1"
			
 
				   },
			
 
				   "devDependencies": {
			
 
				     "@tailwindcss/postcss": "^4",
			
 
				+    "@types/better-sqlite3": "^7.6.13",
			
 
				+    "@types/bn.js": "^5.2.0",
			
 
				+    "@types/lodash-es": "^4.17.12",
			
 
				     "@types/node": "^20",
			
 
				     "@types/react": "^19",
			
 
				     "@types/react-dom": "^19",
			
 
				     "eslint": "^9",
			
 
				     "eslint-config-next": "16.1.6",
			
 
				+    "prettier": "^3.8.1",
			
 
				     "tailwindcss": "^4",
			
 
				     "typescript": "^5"
			
 
				   }
			
--- a/pnpm-lock.yaml
+++ b/pnpm-lock.yaml
--- a/pnpm-workspace.yaml
+++ b/pnpm-workspace.yaml
@@ -1,3 +1,11 @@
 
				+approveBuilds: true
			
 
				+
			
 
				+onlyBuiltDependencies:
			
 
				+  - better-sqlite3
			
 
				+  - bigint-buffer
			
 
				+  - bufferutil
			
 
				+  - utf-8-validate
			
 
				+
			
 
				 ignoredBuiltDependencies:
			
 
				   - sharp
			
 
				   - unrs-resolver
			
--- a/src/app/addresses/page.tsx
+++ b/src/app/addresses/page.tsx
@@ -0,0 +1,239 @@
 
				+'use client'
			
 
				+
			
 
				+import { useState } from 'react'
			
 
				+import useSWR from 'swr'
			
 
				+
			
 
				+const fetcher = (url: string) => fetch(url).then((r) => r.json())
			
 
				+
			
 
				+interface AddressRow {
			
 
				+  id: number
			
 
				+  address: string
			
 
				+  label: string | null
			
 
				+  enabled: number
			
 
				+  copy_multiplier: number | null
			
 
				+  copy_max_usd: number | null
			
 
				+  created_at: string
			
 
				+}
			
 
				+
			
 
				+function AddressItem({
			
 
				+  addr,
			
 
				+  onToggle,
			
 
				+  onDelete,
			
 
				+  onUpdate,
			
 
				+}: {
			
 
				+  addr: AddressRow
			
 
				+  onToggle: (id: number, enabled: boolean) => void
			
 
				+  onDelete: (id: number) => void
			
 
				+  onUpdate: () => void
			
 
				+}) {
			
 
				+  const [editing, setEditing] = useState(false)
			
 
				+  const [multiplier, setMultiplier] = useState(addr.copy_multiplier?.toString() ?? '')
			
 
				+  const [maxUsd, setMaxUsd] = useState(addr.copy_max_usd?.toString() ?? '')
			
 
				+  const [saving, setSaving] = useState(false)
			
 
				+
			
 
				+  const handleSave = async () => {
			
 
				+    setSaving(true)
			
 
				+    try {
			
 
				+      await fetch('/api/addresses', {
			
 
				+        method: 'PUT',
			
 
				+        headers: { 'Content-Type': 'application/json' },
			
 
				+        body: JSON.stringify({
			
 
				+          id: addr.id,
			
 
				+          copyMultiplier: multiplier || '',
			
 
				+          copyMaxUsd: maxUsd || '',
			
 
				+        }),
			
 
				+      })
			
 
				+      setEditing(false)
			
 
				+      onUpdate()
			
 
				+    } finally {
			
 
				+      setSaving(false)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  return (
			
 
				+    <div className="py-3 border-b border-zinc-800/50 last:border-0">
			
 
				+      <div className="flex items-center justify-between">
			
 
				+        <div className="flex-1 min-w-0">
			
 
				+          <div className="flex items-center gap-2">
			
 
				+            <code className="text-xs text-zinc-300 truncate">{addr.address}</code>
			
 
				+            {addr.label && <span className="text-xs text-zinc-500">({addr.label})</span>}
			
 
				+          </div>
			
 
				+          <div className="flex items-center gap-3 mt-1 text-[10px] text-zinc-500">
			
 
				+            <span>Added {new Date(addr.created_at + 'Z').toLocaleDateString()}</span>
			
 
				+            <span>
			
 
				+              Multiplier:{' '}
			
 
				+              <span className="text-zinc-400">
			
 
				+                {addr.copy_multiplier != null ? `${addr.copy_multiplier}x` : 'default'}
			
 
				+              </span>
			
 
				+            </span>
			
 
				+            <span>
			
 
				+              Max USD:{' '}
			
 
				+              <span className="text-zinc-400">
			
 
				+                {addr.copy_max_usd != null ? `$${addr.copy_max_usd}` : 'default'}
			
 
				+              </span>
			
 
				+            </span>
			
 
				+          </div>
			
 
				+        </div>
			
 
				+        <div className="flex items-center gap-2 ml-4">
			
 
				+          <button
			
 
				+            onClick={() => setEditing(!editing)}
			
 
				+            className="text-xs px-2 py-1 rounded bg-zinc-500/20 text-zinc-400 hover:bg-zinc-500/30"
			
 
				+          >
			
 
				+            {editing ? 'Cancel' : 'Settings'}
			
 
				+          </button>
			
 
				+          <button
			
 
				+            onClick={() => onToggle(addr.id, !addr.enabled)}
			
 
				+            className={`text-xs px-2 py-1 rounded ${
			
 
				+              addr.enabled ? 'bg-green-500/20 text-green-400' : 'bg-zinc-500/20 text-zinc-400'
			
 
				+            }`}
			
 
				+          >
			
 
				+            {addr.enabled ? 'Enabled' : 'Disabled'}
			
 
				+          </button>
			
 
				+          <button
			
 
				+            onClick={() => onDelete(addr.id)}
			
 
				+            className="text-xs px-2 py-1 rounded bg-red-500/20 text-red-400 hover:bg-red-500/30"
			
 
				+          >
			
 
				+            Delete
			
 
				+          </button>
			
 
				+        </div>
			
 
				+      </div>
			
 
				+      {editing && (
			
 
				+        <div className="mt-2 flex items-end gap-2 pl-1">
			
 
				+          <div>
			
 
				+            <label className="block text-[10px] text-zinc-500 mb-0.5">Multiplier</label>
			
 
				+            <input
			
 
				+              type="number"
			
 
				+              step="0.1"
			
 
				+              min="0.01"
			
 
				+              placeholder="default"
			
 
				+              value={multiplier}
			
 
				+              onChange={(e) => setMultiplier(e.target.value)}
			
 
				+              className="w-24 px-2 py-1 text-xs rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+            />
			
 
				+          </div>
			
 
				+          <div>
			
 
				+            <label className="block text-[10px] text-zinc-500 mb-0.5">Max USD</label>
			
 
				+            <input
			
 
				+              type="number"
			
 
				+              step="100"
			
 
				+              min="1"
			
 
				+              placeholder="default"
			
 
				+              value={maxUsd}
			
 
				+              onChange={(e) => setMaxUsd(e.target.value)}
			
 
				+              className="w-28 px-2 py-1 text-xs rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+            />
			
 
				+          </div>
			
 
				+          <button
			
 
				+            onClick={handleSave}
			
 
				+            disabled={saving}
			
 
				+            className="px-3 py-1 text-xs rounded bg-indigo-500 text-white hover:bg-indigo-400 disabled:opacity-50 transition-colors"
			
 
				+          >
			
 
				+            {saving ? 'Saving...' : 'Save'}
			
 
				+          </button>
			
 
				+          <span className="text-[10px] text-zinc-600">Leave empty to use global defaults</span>
			
 
				+        </div>
			
 
				+      )}
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
 
				+
			
 
				+export default function AddressesPage() {
			
 
				+  const { data: addresses, mutate } = useSWR('/api/addresses', fetcher, {
			
 
				+    refreshInterval: 5000,
			
 
				+  })
			
 
				+  const [newAddress, setNewAddress] = useState('')
			
 
				+  const [newLabel, setNewLabel] = useState('')
			
 
				+  const [adding, setAdding] = useState(false)
			
 
				+
			
 
				+  const handleAdd = async (e: React.FormEvent) => {
			
 
				+    e.preventDefault()
			
 
				+    if (!newAddress.trim()) return
			
 
				+
			
 
				+    setAdding(true)
			
 
				+    try {
			
 
				+      await fetch('/api/addresses', {
			
 
				+        method: 'POST',
			
 
				+        headers: { 'Content-Type': 'application/json' },
			
 
				+        body: JSON.stringify({ address: newAddress.trim(), label: newLabel.trim() || undefined }),
			
 
				+      })
			
 
				+      setNewAddress('')
			
 
				+      setNewLabel('')
			
 
				+      mutate()
			
 
				+    } finally {
			
 
				+      setAdding(false)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  const handleDelete = async (id: number) => {
			
 
				+    await fetch('/api/addresses', {
			
 
				+      method: 'DELETE',
			
 
				+      headers: { 'Content-Type': 'application/json' },
			
 
				+      body: JSON.stringify({ id }),
			
 
				+    })
			
 
				+    mutate()
			
 
				+  }
			
 
				+
			
 
				+  const handleToggle = async (id: number, enabled: boolean) => {
			
 
				+    await fetch('/api/addresses', {
			
 
				+      method: 'PATCH',
			
 
				+      headers: { 'Content-Type': 'application/json' },
			
 
				+      body: JSON.stringify({ id, enabled }),
			
 
				+    })
			
 
				+    mutate()
			
 
				+  }
			
 
				+
			
 
				+  return (
			
 
				+    <div className="space-y-6">
			
 
				+      <h2 className="text-lg font-semibold">Watched Addresses</h2>
			
 
				+
			
 
				+      <form
			
 
				+        onSubmit={handleAdd}
			
 
				+        className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4 space-y-3"
			
 
				+      >
			
 
				+        <h3 className="text-sm font-medium">Add Address</h3>
			
 
				+        <div className="flex gap-2">
			
 
				+          <input
			
 
				+            type="text"
			
 
				+            placeholder="Solana wallet address"
			
 
				+            value={newAddress}
			
 
				+            onChange={(e) => setNewAddress(e.target.value)}
			
 
				+            className="flex-1 px-3 py-1.5 text-sm rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+          />
			
 
				+          <input
			
 
				+            type="text"
			
 
				+            placeholder="Label (optional)"
			
 
				+            value={newLabel}
			
 
				+            onChange={(e) => setNewLabel(e.target.value)}
			
 
				+            className="w-40 px-3 py-1.5 text-sm rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+          />
			
 
				+          <button
			
 
				+            type="submit"
			
 
				+            disabled={adding || !newAddress.trim()}
			
 
				+            className="px-4 py-1.5 text-sm rounded bg-indigo-500 text-white hover:bg-indigo-400 disabled:opacity-50 transition-colors"
			
 
				+          >
			
 
				+            Add
			
 
				+          </button>
			
 
				+        </div>
			
 
				+      </form>
			
 
				+
			
 
				+      <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+        <h3 className="text-sm font-medium mb-3">Addresses ({addresses?.length || 0})</h3>
			
 
				+        {!addresses?.length ? (
			
 
				+          <p className="text-xs text-zinc-500">No addresses added yet</p>
			
 
				+        ) : (
			
 
				+          <div>
			
 
				+            {(addresses as AddressRow[]).map((addr) => (
			
 
				+              <AddressItem
			
 
				+                key={addr.id}
			
 
				+                addr={addr}
			
 
				+                onToggle={handleToggle}
			
 
				+                onDelete={handleDelete}
			
 
				+                onUpdate={() => mutate()}
			
 
				+              />
			
 
				+            ))}
			
 
				+          </div>
			
 
				+        )}
			
 
				+      </div>
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
--- a/src/app/api/addresses/route.ts
+++ b/src/app/api/addresses/route.ts
@@ -0,0 +1,95 @@
 
				+import { NextRequest, NextResponse } from 'next/server'
			
 
				+import {
			
 
				+  getWatchedAddresses,
			
 
				+  addWatchedAddress,
			
 
				+  removeWatchedAddress,
			
 
				+  toggleWatchedAddress,
			
 
				+  updateWatchedAddressSettings,
			
 
				+} from '@/lib/db/queries'
			
 
				+import { MonitorService } from '@/lib/monitor/index'
			
 
				+
			
 
				+export async function GET() {
			
 
				+  const addresses = getWatchedAddresses()
			
 
				+  return NextResponse.json(addresses)
			
 
				+}
			
 
				+
			
 
				+export async function POST(req: NextRequest) {
			
 
				+  const body = await req.json()
			
 
				+  const { address, label } = body
			
 
				+
			
 
				+  if (!address || typeof address !== 'string') {
			
 
				+    return NextResponse.json({ error: 'address is required' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  // Validate Solana address format (32-44 chars, base58)
			
 
				+  if (!/^[1-9A-HJ-NP-Za-km-z]{32,44}$/.test(address)) {
			
 
				+    return NextResponse.json({ error: 'Invalid Solana address' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  addWatchedAddress(address, label)
			
 
				+
			
 
				+  // Reload monitor addresses if running
			
 
				+  const monitor = MonitorService.getInstance()
			
 
				+  if (monitor.getStatus().running) {
			
 
				+    monitor.reloadAddresses()
			
 
				+  }
			
 
				+
			
 
				+  return NextResponse.json({ success: true })
			
 
				+}
			
 
				+
			
 
				+export async function DELETE(req: NextRequest) {
			
 
				+  const body = await req.json()
			
 
				+  const { id } = body
			
 
				+
			
 
				+  if (!id) {
			
 
				+    return NextResponse.json({ error: 'id is required' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  removeWatchedAddress(id)
			
 
				+
			
 
				+  const monitor = MonitorService.getInstance()
			
 
				+  if (monitor.getStatus().running) {
			
 
				+    monitor.reloadAddresses()
			
 
				+  }
			
 
				+
			
 
				+  return NextResponse.json({ success: true })
			
 
				+}
			
 
				+
			
 
				+export async function PATCH(req: NextRequest) {
			
 
				+  const body = await req.json()
			
 
				+  const { id, enabled } = body
			
 
				+
			
 
				+  if (!id || enabled === undefined) {
			
 
				+    return NextResponse.json({ error: 'id and enabled are required' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  toggleWatchedAddress(id, enabled)
			
 
				+
			
 
				+  const monitor = MonitorService.getInstance()
			
 
				+  if (monitor.getStatus().running) {
			
 
				+    monitor.reloadAddresses()
			
 
				+  }
			
 
				+
			
 
				+  return NextResponse.json({ success: true })
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * PUT /api/addresses - 更新地址的独立倍率和最大值设置
			
 
				+ * body: { id, copyMultiplier?, copyMaxUsd? }
			
 
				+ */
			
 
				+export async function PUT(req: NextRequest) {
			
 
				+  const body = await req.json()
			
 
				+  const { id, copyMultiplier, copyMaxUsd } = body
			
 
				+
			
 
				+  if (!id) {
			
 
				+    return NextResponse.json({ error: 'id is required' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  updateWatchedAddressSettings(id, {
			
 
				+    copyMultiplier:
			
 
				+      copyMultiplier !== undefined && copyMultiplier !== '' ? Number(copyMultiplier) : null,
			
 
				+    copyMaxUsd: copyMaxUsd !== undefined && copyMaxUsd !== '' ? Number(copyMaxUsd) : null,
			
 
				+  })
			
 
				+
			
 
				+  return NextResponse.json({ success: true })
			
 
				+}
			
--- a/src/app/api/history/route.ts
+++ b/src/app/api/history/route.ts
@@ -0,0 +1,9 @@
 
				+import { NextRequest, NextResponse } from 'next/server'
			
 
				+import { getCopyHistory } from '@/lib/db/queries'
			
 
				+
			
 
				+export async function GET(req: NextRequest) {
			
 
				+  const limit = parseInt(req.nextUrl.searchParams.get('limit') || '50', 10)
			
 
				+  const offset = parseInt(req.nextUrl.searchParams.get('offset') || '0', 10)
			
 
				+  const history = getCopyHistory(limit, offset)
			
 
				+  return NextResponse.json(history)
			
 
				+}
			
--- a/src/app/api/monitor/start/route.ts
+++ b/src/app/api/monitor/start/route.ts
@@ -0,0 +1,15 @@
 
				+import { NextResponse } from 'next/server'
			
 
				+import { MonitorService } from '@/lib/monitor/index'
			
 
				+
			
 
				+export async function POST() {
			
 
				+  try {
			
 
				+    const monitor = MonitorService.getInstance()
			
 
				+    await monitor.start()
			
 
				+    return NextResponse.json({ success: true, status: monitor.getStatus() })
			
 
				+  } catch (e) {
			
 
				+    return NextResponse.json(
			
 
				+      { error: e instanceof Error ? e.message : 'Unknown error' },
			
 
				+      { status: 500 },
			
 
				+    )
			
 
				+  }
			
 
				+}
			
--- a/src/app/api/monitor/status/route.ts
+++ b/src/app/api/monitor/status/route.ts
@@ -0,0 +1,7 @@
 
				+import { NextResponse } from 'next/server'
			
 
				+import { MonitorService } from '@/lib/monitor/index'
			
 
				+
			
 
				+export async function GET() {
			
 
				+  const monitor = MonitorService.getInstance()
			
 
				+  return NextResponse.json(monitor.getStatus())
			
 
				+}
			
--- a/src/app/api/monitor/stop/route.ts
+++ b/src/app/api/monitor/stop/route.ts
@@ -0,0 +1,15 @@
 
				+import { NextResponse } from 'next/server'
			
 
				+import { MonitorService } from '@/lib/monitor/index'
			
 
				+
			
 
				+export async function POST() {
			
 
				+  try {
			
 
				+    const monitor = MonitorService.getInstance()
			
 
				+    await monitor.stop()
			
 
				+    return NextResponse.json({ success: true, status: monitor.getStatus() })
			
 
				+  } catch (e) {
			
 
				+    return NextResponse.json(
			
 
				+      { error: e instanceof Error ? e.message : 'Unknown error' },
			
 
				+      { status: 500 },
			
 
				+    )
			
 
				+  }
			
 
				+}
			
--- a/src/app/api/positions/route.ts
+++ b/src/app/api/positions/route.ts
@@ -0,0 +1,120 @@
 
				+import { NextRequest, NextResponse } from 'next/server'
			
 
				+import {
			
 
				+  getPositionMappings,
			
 
				+  getPositionMappingById,
			
 
				+  deletePositionMapping,
			
 
				+  updatePositionMappingStatus,
			
 
				+} from '@/lib/db/queries'
			
 
				+import { CopyEngine } from '@/lib/copier/index'
			
 
				+import { getPoolInfoMap, getPoolLabel } from '@/lib/pool-info'
			
 
				+
			
 
				+// eslint-disable-next-line @typescript-eslint/no-require-imports
			
 
				+const { TickMath } = require('@/lib/clmm-sdk/dist/index.js')
			
 
				+
			
 
				+export async function GET(req: NextRequest) {
			
 
				+  const status = req.nextUrl.searchParams.get('status') || undefined
			
 
				+  const positions = getPositionMappings(status)
			
 
				+
			
 
				+  // Enrich positions with pool info and price range
			
 
				+  const poolMap = await getPoolInfoMap()
			
 
				+
			
 
				+  const enriched = positions.map((pos) => {
			
 
				+    const pool = poolMap.get(pos.pool_id)
			
 
				+    let poolLabel = ''
			
 
				+    let priceLower = ''
			
 
				+    let priceUpper = ''
			
 
				+
			
 
				+    if (pool) {
			
 
				+      poolLabel = getPoolLabel(pool)
			
 
				+      const decimalsA = pool.mintA.mintInfo.decimals
			
 
				+      const decimalsB = pool.mintB.mintInfo.decimals
			
 
				+      const baseIn = !pool.displayReversed
			
 
				+
			
 
				+      // Calculate price from tick using SDK TickMath
			
 
				+      try {
			
 
				+        const lower = TickMath.getPriceFromTick({
			
 
				+          tick: pos.tick_lower,
			
 
				+          decimalsA,
			
 
				+          decimalsB,
			
 
				+          baseIn,
			
 
				+        })
			
 
				+        const upper = TickMath.getPriceFromTick({
			
 
				+          tick: pos.tick_upper,
			
 
				+          decimalsA,
			
 
				+          decimalsB,
			
 
				+          baseIn,
			
 
				+        })
			
 
				+        priceLower = lower.toString()
			
 
				+        priceUpper = upper.toString()
			
 
				+      } catch {
			
 
				+        // Fallback: show tick values if price calculation fails
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    return {
			
 
				+      ...pos,
			
 
				+      pool_label: poolLabel,
			
 
				+      price_lower: priceLower,
			
 
				+      price_upper: priceUpper,
			
 
				+    }
			
 
				+  })
			
 
				+
			
 
				+  return NextResponse.json(enriched)
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * DELETE /api/positions?id=123 - 从数据库删除仓位映射（不上链）
			
 
				+ */
			
 
				+export async function DELETE(req: NextRequest) {
			
 
				+  const id = req.nextUrl.searchParams.get('id')
			
 
				+  if (!id) {
			
 
				+    return NextResponse.json({ error: 'Missing id parameter' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  const mapping = getPositionMappingById(Number(id))
			
 
				+  if (!mapping) {
			
 
				+    return NextResponse.json({ error: 'Position not found' }, { status: 404 })
			
 
				+  }
			
 
				+
			
 
				+  deletePositionMapping(Number(id))
			
 
				+  return NextResponse.json({ success: true })
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * POST /api/positions - 手动关仓（上链）
			
 
				+ * body: { id: number }
			
 
				+ */
			
 
				+export async function POST(req: NextRequest) {
			
 
				+  try {
			
 
				+    const body = await req.json()
			
 
				+    const { id } = body
			
 
				+
			
 
				+    if (!id) {
			
 
				+      return NextResponse.json({ error: 'Missing id' }, { status: 400 })
			
 
				+    }
			
 
				+
			
 
				+    const mapping = getPositionMappingById(Number(id))
			
 
				+    if (!mapping) {
			
 
				+      return NextResponse.json({ error: 'Position not found' }, { status: 404 })
			
 
				+    }
			
 
				+
			
 
				+    if (!mapping.our_nft_mint) {
			
 
				+      return NextResponse.json({ error: 'No NFT mint - position not yet created' }, { status: 400 })
			
 
				+    }
			
 
				+
			
 
				+    if (mapping.status === 'closed') {
			
 
				+      return NextResponse.json({ error: 'Position already closed' }, { status: 400 })
			
 
				+    }
			
 
				+
			
 
				+    const engine = new CopyEngine()
			
 
				+    const txid = await engine.manualClosePosition(mapping.our_nft_mint, mapping.pool_id)
			
 
				+
			
 
				+    updatePositionMappingStatus(mapping.target_nft_mint, 'closed')
			
 
				+
			
 
				+    return NextResponse.json({ success: true, txid })
			
 
				+  } catch (e) {
			
 
				+    const msg = e instanceof Error ? e.message : String(e)
			
 
				+    console.error('[API] Manual close position failed:', msg)
			
 
				+    return NextResponse.json({ error: msg }, { status: 500 })
			
 
				+  }
			
 
				+}
			
--- a/src/app/api/settings/route.ts
+++ b/src/app/api/settings/route.ts
@@ -0,0 +1,19 @@
 
				+import { NextRequest, NextResponse } from 'next/server'
			
 
				+import { getAllSettings, setSetting } from '@/lib/db/queries'
			
 
				+
			
 
				+export async function GET() {
			
 
				+  const settings = getAllSettings()
			
 
				+  return NextResponse.json(settings)
			
 
				+}
			
 
				+
			
 
				+export async function PUT(req: NextRequest) {
			
 
				+  const body = await req.json()
			
 
				+  const { key, value } = body
			
 
				+
			
 
				+  if (!key || value === undefined) {
			
 
				+    return NextResponse.json({ error: 'key and value are required' }, { status: 400 })
			
 
				+  }
			
 
				+
			
 
				+  setSetting(key, String(value))
			
 
				+  return NextResponse.json({ success: true })
			
 
				+}
			
--- a/src/app/api/wallet/balance/route.ts
+++ b/src/app/api/wallet/balance/route.ts
@@ -0,0 +1,65 @@
 
				+import { NextResponse } from 'next/server'
			
 
				+import { PublicKey, LAMPORTS_PER_SOL } from '@solana/web3.js'
			
 
				+import { getConnection } from '@/lib/solana/connection'
			
 
				+import { getUserAddress } from '@/lib/solana/wallet'
			
 
				+
			
 
				+const KNOWN_TOKENS: Record<string, { symbol: string; decimals: number }> = {
			
 
				+  EPjFWdd5AufqSSqeM2qN1xzybapC8G4wEGGkZwyTDt1v: { symbol: 'USDC', decimals: 6 },
			
 
				+  Es9vMFrzaCERmJfrF4H2FYD4KCoNkY11McCe8BenwNYB: { symbol: 'USDT', decimals: 6 },
			
 
				+  Bybit2vBJGhPF52GBdNaQfUJ6ZpThSgHBobjWZpLPb4B: { symbol: 'BBSOL', decimals: 9 },
			
 
				+}
			
 
				+
			
 
				+export async function GET() {
			
 
				+  try {
			
 
				+    const connection = getConnection()
			
 
				+    const userAddress = getUserAddress()
			
 
				+
			
 
				+    // Get SOL balance
			
 
				+    const solBalance = await connection.getBalance(userAddress)
			
 
				+
			
 
				+    // Get token balances
			
 
				+    const tokenAccounts = await connection.getParsedTokenAccountsByOwner(userAddress, {
			
 
				+      programId: new PublicKey('TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA'),
			
 
				+    })
			
 
				+
			
 
				+    // Also get Token-2022 accounts
			
 
				+    const token2022Accounts = await connection.getParsedTokenAccountsByOwner(userAddress, {
			
 
				+      programId: new PublicKey('TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb'),
			
 
				+    })
			
 
				+
			
 
				+    const allAccounts = [...tokenAccounts.value, ...token2022Accounts.value]
			
 
				+
			
 
				+    const tokens = allAccounts
			
 
				+      .map((acc) => {
			
 
				+        const info = acc.account.data.parsed.info
			
 
				+        const mint = info.mint as string
			
 
				+        const amount = info.tokenAmount.uiAmount as number
			
 
				+        const known = KNOWN_TOKENS[mint]
			
 
				+        return {
			
 
				+          mint,
			
 
				+          symbol: known?.symbol || mint.slice(0, 6) + '...',
			
 
				+          amount,
			
 
				+          decimals: info.tokenAmount.decimals as number,
			
 
				+          rawAmount: info.tokenAmount.amount as string,
			
 
				+        }
			
 
				+      })
			
 
				+      .filter((t) => t.amount > 0)
			
 
				+      .sort((a, b) => {
			
 
				+        // Known tokens first
			
 
				+        const aKnown = KNOWN_TOKENS[a.mint] ? 0 : 1
			
 
				+        const bKnown = KNOWN_TOKENS[b.mint] ? 0 : 1
			
 
				+        return aKnown - bKnown || b.amount - a.amount
			
 
				+      })
			
 
				+
			
 
				+    return NextResponse.json({
			
 
				+      address: userAddress.toBase58(),
			
 
				+      sol: solBalance / LAMPORTS_PER_SOL,
			
 
				+      tokens,
			
 
				+    })
			
 
				+  } catch (e) {
			
 
				+    return NextResponse.json(
			
 
				+      { error: e instanceof Error ? e.message : 'Failed to fetch balance' },
			
 
				+      { status: 500 },
			
 
				+    )
			
 
				+  }
			
 
				+}
			
--- a/src/app/favicon.ico
+++ b/src/app/favicon.ico
--- a/src/app/globals.css
+++ b/src/app/globals.css
@@ -0,0 +1,29 @@
 
				+@import 'tailwindcss';
			
 
				+
			
 
				+:root {
			
 
				+  --background: #0f1117;
			
 
				+  --foreground: #e4e4e7;
			
 
				+  --card: #1a1b23;
			
 
				+  --border: #27272a;
			
 
				+  --accent: #6366f1;
			
 
				+  --accent-hover: #818cf8;
			
 
				+  --success: #22c55e;
			
 
				+  --danger: #ef4444;
			
 
				+  --warning: #f59e0b;
			
 
				+  --muted: #71717a;
			
 
				+}
			
 
				+
			
 
				+@theme inline {
			
 
				+  --color-background: var(--background);
			
 
				+  --color-foreground: var(--foreground);
			
 
				+}
			
 
				+
			
 
				+body {
			
 
				+  background: var(--background);
			
 
				+  color: var(--foreground);
			
 
				+  font-family:
			
 
				+    'Inter',
			
 
				+    system-ui,
			
 
				+    -apple-system,
			
 
				+    sans-serif;
			
 
				+}
			
--- a/src/app/history/page.tsx
+++ b/src/app/history/page.tsx
@@ -0,0 +1,113 @@
 
				+'use client'
			
 
				+
			
 
				+import useSWR from 'swr'
			
 
				+
			
 
				+const fetcher = (url: string) => fetch(url).then((r) => r.json())
			
 
				+
			
 
				+export default function HistoryPage() {
			
 
				+  const { data } = useSWR('/api/history?limit=100', fetcher, { refreshInterval: 5000 })
			
 
				+
			
 
				+  const rows = data || []
			
 
				+
			
 
				+  return (
			
 
				+    <div className="space-y-6">
			
 
				+      <h2 className="text-lg font-semibold">Copy Trade History</h2>
			
 
				+
			
 
				+      <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+        {rows.length === 0 ? (
			
 
				+          <p className="text-xs text-zinc-500">No history yet</p>
			
 
				+        ) : (
			
 
				+          <div className="overflow-x-auto">
			
 
				+            <table className="w-full text-xs">
			
 
				+              <thead>
			
 
				+                <tr className="text-zinc-500 border-b border-[var(--border)]">
			
 
				+                  <th className="text-left py-2 pr-3">Time</th>
			
 
				+                  <th className="text-left py-2 pr-3">Operation</th>
			
 
				+                  <th className="text-left py-2 pr-3">Target</th>
			
 
				+                  <th className="text-left py-2 pr-3">Target TX</th>
			
 
				+                  <th className="text-left py-2 pr-3">Our TX</th>
			
 
				+                  <th className="text-left py-2 pr-3">Amount A</th>
			
 
				+                  <th className="text-left py-2 pr-3">Amount B</th>
			
 
				+                  <th className="text-left py-2 pr-3">Status</th>
			
 
				+                  <th className="text-left py-2">Error</th>
			
 
				+                </tr>
			
 
				+              </thead>
			
 
				+              <tbody>
			
 
				+                {rows.map(
			
 
				+                  (row: {
			
 
				+                    id: number
			
 
				+                    created_at: string
			
 
				+                    operation: string
			
 
				+                    target_address: string
			
 
				+                    target_tx_sig: string
			
 
				+                    our_tx_sig: string | null
			
 
				+                    our_amount_a: string | null
			
 
				+                    our_amount_b: string | null
			
 
				+                    status: string
			
 
				+                    error_message: string | null
			
 
				+                  }) => (
			
 
				+                    <tr key={row.id} className="border-b border-zinc-800/50">
			
 
				+                      <td className="py-2 pr-3 text-zinc-500 whitespace-nowrap">
			
 
				+                        {new Date(row.created_at + 'Z').toLocaleString()}
			
 
				+                      </td>
			
 
				+                      <td className="py-2 pr-3 whitespace-nowrap">{row.operation}</td>
			
 
				+                      <td className="py-2 pr-3 text-zinc-400">
			
 
				+                        {row.target_address.slice(0, 4)}...{row.target_address.slice(-4)}
			
 
				+                      </td>
			
 
				+                      <td className="py-2 pr-3">
			
 
				+                        <a
			
 
				+                          href={`https://solscan.io/tx/${row.target_tx_sig}`}
			
 
				+                          target="_blank"
			
 
				+                          rel="noopener noreferrer"
			
 
				+                          className="text-indigo-400 hover:underline"
			
 
				+                        >
			
 
				+                          {row.target_tx_sig.slice(0, 8)}...
			
 
				+                        </a>
			
 
				+                      </td>
			
 
				+                      <td className="py-2 pr-3">
			
 
				+                        {row.our_tx_sig ? (
			
 
				+                          <a
			
 
				+                            href={`https://solscan.io/tx/${row.our_tx_sig}`}
			
 
				+                            target="_blank"
			
 
				+                            rel="noopener noreferrer"
			
 
				+                            className="text-indigo-400 hover:underline"
			
 
				+                          >
			
 
				+                            {row.our_tx_sig.slice(0, 8)}...
			
 
				+                          </a>
			
 
				+                        ) : (
			
 
				+                          <span className="text-zinc-500">-</span>
			
 
				+                        )}
			
 
				+                      </td>
			
 
				+                      <td className="py-2 pr-3 text-zinc-400">{row.our_amount_a || '-'}</td>
			
 
				+                      <td className="py-2 pr-3 text-zinc-400">{row.our_amount_b || '-'}</td>
			
 
				+                      <td className="py-2 pr-3">
			
 
				+                        <span
			
 
				+                          className={`px-1.5 py-0.5 rounded text-[10px] ${
			
 
				+                            row.status === 'success'
			
 
				+                              ? 'bg-green-500/20 text-green-400'
			
 
				+                              : row.status === 'failed'
			
 
				+                                ? 'bg-red-500/20 text-red-400'
			
 
				+                                : row.status === 'executing'
			
 
				+                                  ? 'bg-yellow-500/20 text-yellow-400'
			
 
				+                                  : row.status === 'skipped'
			
 
				+                                    ? 'bg-zinc-500/20 text-zinc-400'
			
 
				+                                    : 'bg-blue-500/20 text-blue-400'
			
 
				+                          }`}
			
 
				+                        >
			
 
				+                          {row.status}
			
 
				+                        </span>
			
 
				+                      </td>
			
 
				+                      <td className="py-2 text-red-400 text-[10px] max-w-[200px] truncate">
			
 
				+                        {row.error_message || ''}
			
 
				+                      </td>
			
 
				+                    </tr>
			
 
				+                  ),
			
 
				+                )}
			
 
				+              </tbody>
			
 
				+            </table>
			
 
				+          </div>
			
 
				+        )}
			
 
				+      </div>
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
--- a/src/app/layout.tsx
+++ b/src/app/layout.tsx
@@ -0,0 +1,25 @@
 
				+import type { Metadata } from 'next'
			
 
				+import './globals.css'
			
 
				+import { Sidebar } from '@/components/layout/sidebar'
			
 
				+import { Header } from '@/components/layout/header'
			
 
				+
			
 
				+export const metadata: Metadata = {
			
 
				+  title: 'Byreal Copy Trade',
			
 
				+  description: 'CLMM Position Copy Trading System',
			
 
				+}
			
 
				+
			
 
				+export default function RootLayout({ children }: { children: React.ReactNode }) {
			
 
				+  return (
			
 
				+    <html lang="en">
			
 
				+      <body className="antialiased">
			
 
				+        <div className="flex min-h-screen">
			
 
				+          <Sidebar />
			
 
				+          <div className="flex-1 flex flex-col">
			
 
				+            <Header />
			
 
				+            <main className="flex-1 p-6">{children}</main>
			
 
				+          </div>
			
 
				+        </div>
			
 
				+      </body>
			
 
				+    </html>
			
 
				+  )
			
 
				+}
			
--- a/src/app/page.tsx
+++ b/src/app/page.tsx
@@ -0,0 +1,358 @@
 
				+'use client'
			
 
				+
			
 
				+import { useState } from 'react'
			
 
				+import useSWR from 'swr'
			
 
				+
			
 
				+const fetcher = (url: string) => fetch(url).then((r) => r.json())
			
 
				+
			
 
				+function StatusCard() {
			
 
				+  const { data: status, mutate } = useSWR('/api/monitor/status', fetcher, {
			
 
				+    refreshInterval: 3000,
			
 
				+  })
			
 
				+  const [error, setError] = useState<string | null>(null)
			
 
				+  const [loading, setLoading] = useState(false)
			
 
				+
			
 
				+  const handleStart = async () => {
			
 
				+    setError(null)
			
 
				+    setLoading(true)
			
 
				+    try {
			
 
				+      const res = await fetch('/api/monitor/start', { method: 'POST' })
			
 
				+      const data = await res.json()
			
 
				+      if (!res.ok) {
			
 
				+        setError(data.error || 'Failed to start')
			
 
				+      } else {
			
 
				+        mutate(data.status, { revalidate: false })
			
 
				+      }
			
 
				+    } catch (e) {
			
 
				+      setError(e instanceof Error ? e.message : 'Network error')
			
 
				+    } finally {
			
 
				+      setLoading(false)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  const handleStop = async () => {
			
 
				+    setError(null)
			
 
				+    setLoading(true)
			
 
				+    try {
			
 
				+      const res = await fetch('/api/monitor/stop', { method: 'POST' })
			
 
				+      const data = await res.json()
			
 
				+      if (!res.ok) {
			
 
				+        setError(data.error || 'Failed to stop')
			
 
				+      } else {
			
 
				+        mutate(data.status, { revalidate: false })
			
 
				+      }
			
 
				+    } catch (e) {
			
 
				+      setError(e instanceof Error ? e.message : 'Network error')
			
 
				+    } finally {
			
 
				+      setLoading(false)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  return (
			
 
				+    <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+      <div className="flex items-center justify-between mb-3">
			
 
				+        <h3 className="text-sm font-medium">Monitor Status</h3>
			
 
				+        <span
			
 
				+          className={`text-xs px-2 py-0.5 rounded-full ${
			
 
				+            status?.running ? 'bg-green-500/20 text-green-400' : 'bg-zinc-500/20 text-zinc-400'
			
 
				+          }`}
			
 
				+        >
			
 
				+          {status?.running ? 'Running' : 'Stopped'}
			
 
				+        </span>
			
 
				+      </div>
			
 
				+      <p className="text-xs text-zinc-500 mb-3">Watching {status?.watchedCount || 0} addresses</p>
			
 
				+      {error && (
			
 
				+        <p className="text-xs text-red-400 mb-2 bg-red-500/10 px-2 py-1 rounded">{error}</p>
			
 
				+      )}
			
 
				+      {status?.errors?.length > 0 && (
			
 
				+        <div className="mb-3 max-h-20 overflow-y-auto space-y-1">
			
 
				+          {status.errors.map((err: string, i: number) => (
			
 
				+            <p key={i} className="text-[10px] text-red-400/80 bg-red-500/5 px-2 py-0.5 rounded truncate" title={err}>
			
 
				+              {err}
			
 
				+            </p>
			
 
				+          ))}
			
 
				+        </div>
			
 
				+      )}
			
 
				+      <div className="flex gap-2">
			
 
				+        <button
			
 
				+          onClick={handleStart}
			
 
				+          disabled={status?.running || loading}
			
 
				+          className="px-3 py-1.5 text-xs rounded bg-indigo-500 text-white hover:bg-indigo-400 disabled:opacity-50 disabled:cursor-not-allowed transition-colors"
			
 
				+        >
			
 
				+          {loading && !status?.running ? 'Starting...' : 'Start'}
			
 
				+        </button>
			
 
				+        <button
			
 
				+          onClick={handleStop}
			
 
				+          disabled={!status?.running || loading}
			
 
				+          className="px-3 py-1.5 text-xs rounded bg-red-500/20 text-red-400 hover:bg-red-500/30 disabled:opacity-50 disabled:cursor-not-allowed transition-colors"
			
 
				+        >
			
 
				+          {loading && status?.running ? 'Stopping...' : 'Stop'}
			
 
				+        </button>
			
 
				+      </div>
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
 
				+
			
 
				+function WalletBalances() {
			
 
				+  const { data } = useSWR('/api/wallet/balance', fetcher, { refreshInterval: 15000 })
			
 
				+
			
 
				+  return (
			
 
				+    <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+      <h3 className="text-sm font-medium mb-3">Wallet Balances</h3>
			
 
				+      {data?.error ? (
			
 
				+        <p className="text-xs text-zinc-500">Configure SOL_SECRET_KEY to view balances</p>
			
 
				+      ) : (
			
 
				+        <div className="max-h-32 overflow-y-auto space-y-1.5">
			
 
				+          <div className="flex justify-between text-xs">
			
 
				+            <span className="text-zinc-500">SOL</span>
			
 
				+            <span>{data?.sol?.toFixed(4) || '...'}</span>
			
 
				+          </div>
			
 
				+          {data?.tokens?.map((t: { mint: string; symbol: string; amount: number }) => (
			
 
				+            <div key={t.mint} className="flex justify-between text-xs">
			
 
				+              <span className="text-zinc-500">{t.symbol}</span>
			
 
				+              <span>{t.amount.toFixed(4)}</span>
			
 
				+            </div>
			
 
				+          ))}
			
 
				+        </div>
			
 
				+      )}
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
 
				+
			
 
				+interface PositionRow {
			
 
				+  id: number
			
 
				+  target_address: string
			
 
				+  target_nft_mint: string
			
 
				+  our_nft_mint: string | null
			
 
				+  pool_id: string
			
 
				+  pool_label: string
			
 
				+  tick_lower: number
			
 
				+  tick_upper: number
			
 
				+  price_lower: string
			
 
				+  price_upper: string
			
 
				+  status: string
			
 
				+  created_at: string
			
 
				+  updated_at: string
			
 
				+}
			
 
				+
			
 
				+function formatPrice(price: string): string {
			
 
				+  if (!price) return ''
			
 
				+  const n = parseFloat(price)
			
 
				+  if (isNaN(n)) return price
			
 
				+  if (n >= 1000) return n.toFixed(2)
			
 
				+  if (n >= 1) return n.toFixed(4)
			
 
				+  if (n >= 0.0001) return n.toFixed(6)
			
 
				+  return n.toExponential(3)
			
 
				+}
			
 
				+
			
 
				+function ActivePositions() {
			
 
				+  const { data, mutate } = useSWR('/api/positions?status=active', fetcher, { refreshInterval: 5000 })
			
 
				+  const [closingId, setClosingId] = useState<number | null>(null)
			
 
				+
			
 
				+  const rows: PositionRow[] = data || []
			
 
				+
			
 
				+  const handleClose = async (row: PositionRow) => {
			
 
				+    if (!row.our_nft_mint) return
			
 
				+    if (
			
 
				+      !confirm(
			
 
				+        `关闭仓位 ${row.pool_label || row.pool_id.slice(0, 8)}?\n将移除全部流动性并swap回USDC。`,
			
 
				+      )
			
 
				+    )
			
 
				+      return
			
 
				+
			
 
				+    setClosingId(row.id)
			
 
				+    try {
			
 
				+      const res = await fetch('/api/positions', {
			
 
				+        method: 'POST',
			
 
				+        headers: { 'Content-Type': 'application/json' },
			
 
				+        body: JSON.stringify({ id: row.id }),
			
 
				+      })
			
 
				+      const data = await res.json()
			
 
				+      if (!res.ok) {
			
 
				+        alert(data.error || 'Close failed')
			
 
				+      } else {
			
 
				+        mutate()
			
 
				+      }
			
 
				+    } catch (e) {
			
 
				+      alert(e instanceof Error ? e.message : 'Close failed')
			
 
				+    } finally {
			
 
				+      setClosingId(null)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  return (
			
 
				+    <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+      <div className="flex items-center justify-between mb-3">
			
 
				+        <h3 className="text-sm font-medium">Active Positions</h3>
			
 
				+        <span className="text-xs text-zinc-500">{rows.length} open</span>
			
 
				+      </div>
			
 
				+      {rows.length === 0 ? (
			
 
				+        <p className="text-xs text-zinc-500">No active positions</p>
			
 
				+      ) : (
			
 
				+        <div className="space-y-2 max-h-64 overflow-y-auto">
			
 
				+          {rows.map((row) => (
			
 
				+            <div
			
 
				+              key={row.id}
			
 
				+              className="flex items-center justify-between gap-3 rounded-md bg-zinc-800/40 px-3 py-2"
			
 
				+            >
			
 
				+              <div className="min-w-0 flex-1 space-y-0.5">
			
 
				+                <div className="flex items-center gap-2 text-xs">
			
 
				+                  {row.pool_label ? (
			
 
				+                    <span className="font-medium text-zinc-200">{row.pool_label}</span>
			
 
				+                  ) : (
			
 
				+                    <span className="font-mono text-zinc-300">
			
 
				+                      {row.pool_id.slice(0, 6)}...{row.pool_id.slice(-4)}
			
 
				+                    </span>
			
 
				+                  )}
			
 
				+                  {row.price_lower && row.price_upper ? (
			
 
				+                    <span className="text-[10px] text-zinc-500">
			
 
				+                      {formatPrice(row.price_lower)} ~ {formatPrice(row.price_upper)}
			
 
				+                    </span>
			
 
				+                  ) : (
			
 
				+                    <span className="text-[10px] text-zinc-500">
			
 
				+                      [{row.tick_lower} ~ {row.tick_upper}]
			
 
				+                    </span>
			
 
				+                  )}
			
 
				+                </div>
			
 
				+                <div className="flex items-center gap-2 text-[10px] text-zinc-500">
			
 
				+                  <span>
			
 
				+                    Target:{' '}
			
 
				+                    <a
			
 
				+                      href={`https://solscan.io/account/${row.target_address}`}
			
 
				+                      target="_blank"
			
 
				+                      rel="noopener noreferrer"
			
 
				+                      className="text-indigo-400/70 hover:underline"
			
 
				+                    >
			
 
				+                      {row.target_address.slice(0, 4)}...{row.target_address.slice(-4)}
			
 
				+                    </a>
			
 
				+                  </span>
			
 
				+                  {row.our_nft_mint && (
			
 
				+                    <span>
			
 
				+                      NFT:{' '}
			
 
				+                      <a
			
 
				+                        href={`https://solscan.io/token/${row.our_nft_mint}`}
			
 
				+                        target="_blank"
			
 
				+                        rel="noopener noreferrer"
			
 
				+                        className="text-indigo-400/70 hover:underline"
			
 
				+                      >
			
 
				+                        {row.our_nft_mint.slice(0, 6)}...
			
 
				+                      </a>
			
 
				+                    </span>
			
 
				+                  )}
			
 
				+                </div>
			
 
				+              </div>
			
 
				+              <div className="flex items-center gap-2 shrink-0">
			
 
				+                {row.our_nft_mint && (
			
 
				+                  <button
			
 
				+                    onClick={() => handleClose(row)}
			
 
				+                    disabled={closingId === row.id}
			
 
				+                    className="px-2 py-0.5 text-[10px] rounded bg-orange-500/20 text-orange-400 hover:bg-orange-500/30 disabled:opacity-50 transition-colors"
			
 
				+                  >
			
 
				+                    {closingId === row.id ? 'Closing...' : 'Close'}
			
 
				+                  </button>
			
 
				+                )}
			
 
				+                <span className="px-1.5 py-0.5 rounded text-[10px] bg-green-500/20 text-green-400">
			
 
				+                  active
			
 
				+                </span>
			
 
				+              </div>
			
 
				+            </div>
			
 
				+          ))}
			
 
				+        </div>
			
 
				+      )}
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
 
				+
			
 
				+function RecentCopies() {
			
 
				+  const { data } = useSWR('/api/history?limit=10', fetcher, { refreshInterval: 5000 })
			
 
				+
			
 
				+  const rows = data || []
			
 
				+
			
 
				+  return (
			
 
				+    <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+      <h3 className="text-sm font-medium mb-3">Recent Copy Operations</h3>
			
 
				+      {rows.length === 0 ? (
			
 
				+        <p className="text-xs text-zinc-500">No copy operations yet</p>
			
 
				+      ) : (
			
 
				+        <div className="overflow-x-auto">
			
 
				+          <table className="w-full text-xs">
			
 
				+            <thead>
			
 
				+              <tr className="text-zinc-500 border-b border-[var(--border)]">
			
 
				+                <th className="text-left py-2 pr-3">Time</th>
			
 
				+                <th className="text-left py-2 pr-3">Operation</th>
			
 
				+                <th className="text-left py-2 pr-3">Target</th>
			
 
				+                <th className="text-left py-2 pr-3">Status</th>
			
 
				+                <th className="text-left py-2">TX</th>
			
 
				+              </tr>
			
 
				+            </thead>
			
 
				+            <tbody>
			
 
				+              {rows.map(
			
 
				+                (row: {
			
 
				+                  id: number
			
 
				+                  created_at: string
			
 
				+                  operation: string
			
 
				+                  target_address: string
			
 
				+                  status: string
			
 
				+                  our_tx_sig: string | null
			
 
				+                }) => (
			
 
				+                  <tr key={row.id} className="border-b border-zinc-800/50">
			
 
				+                    <td className="py-2 pr-3 text-zinc-500">
			
 
				+                      {new Date(row.created_at + 'Z').toLocaleTimeString()}
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3">{row.operation}</td>
			
 
				+                    <td className="py-2 pr-3 text-zinc-500">
			
 
				+                      {row.target_address.slice(0, 4)}...{row.target_address.slice(-4)}
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3">
			
 
				+                      <span
			
 
				+                        className={`px-1.5 py-0.5 rounded text-[10px] ${
			
 
				+                          row.status === 'success'
			
 
				+                            ? 'bg-green-500/20 text-green-400'
			
 
				+                            : row.status === 'failed'
			
 
				+                              ? 'bg-red-500/20 text-red-400'
			
 
				+                              : row.status === 'executing'
			
 
				+                                ? 'bg-yellow-500/20 text-yellow-400'
			
 
				+                                : 'bg-zinc-500/20 text-zinc-400'
			
 
				+                        }`}
			
 
				+                      >
			
 
				+                        {row.status}
			
 
				+                      </span>
			
 
				+                    </td>
			
 
				+                    <td className="py-2">
			
 
				+                      {row.our_tx_sig ? (
			
 
				+                        <a
			
 
				+                          href={`https://solscan.io/tx/${row.our_tx_sig}`}
			
 
				+                          target="_blank"
			
 
				+                          rel="noopener noreferrer"
			
 
				+                          className="text-indigo-400 hover:underline"
			
 
				+                        >
			
 
				+                          {row.our_tx_sig.slice(0, 8)}...
			
 
				+                        </a>
			
 
				+                      ) : (
			
 
				+                        <span className="text-zinc-500">-</span>
			
 
				+                      )}
			
 
				+                    </td>
			
 
				+                  </tr>
			
 
				+                ),
			
 
				+              )}
			
 
				+            </tbody>
			
 
				+          </table>
			
 
				+        </div>
			
 
				+      )}
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
 
				+
			
 
				+export default function DashboardPage() {
			
 
				+  return (
			
 
				+    <div className="space-y-6">
			
 
				+      <h2 className="text-lg font-semibold">Dashboard</h2>
			
 
				+      <div className="grid grid-cols-1 md:grid-cols-2 gap-4">
			
 
				+        <StatusCard />
			
 
				+        <WalletBalances />
			
 
				+      </div>
			
 
				+      <ActivePositions />
			
 
				+      <RecentCopies />
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
--- a/src/app/positions/page.tsx
+++ b/src/app/positions/page.tsx
@@ -0,0 +1,209 @@
 
				+'use client'
			
 
				+
			
 
				+import { useState } from 'react'
			
 
				+import useSWR from 'swr'
			
 
				+
			
 
				+const fetcher = (url: string) => fetch(url).then((r) => r.json())
			
 
				+
			
 
				+interface PositionRow {
			
 
				+  id: number
			
 
				+  target_address: string
			
 
				+  target_nft_mint: string
			
 
				+  our_nft_mint: string | null
			
 
				+  pool_id: string
			
 
				+  pool_label: string
			
 
				+  tick_lower: number
			
 
				+  tick_upper: number
			
 
				+  price_lower: string
			
 
				+  price_upper: string
			
 
				+  status: string
			
 
				+  created_at: string
			
 
				+}
			
 
				+
			
 
				+function formatPrice(price: string): string {
			
 
				+  if (!price) return ''
			
 
				+  const n = parseFloat(price)
			
 
				+  if (isNaN(n)) return price
			
 
				+  if (n >= 1000) return n.toFixed(2)
			
 
				+  if (n >= 1) return n.toFixed(4)
			
 
				+  if (n >= 0.0001) return n.toFixed(6)
			
 
				+  return n.toExponential(3)
			
 
				+}
			
 
				+
			
 
				+export default function PositionsPage() {
			
 
				+  const { data: positions, mutate } = useSWR('/api/positions', fetcher, { refreshInterval: 5000 })
			
 
				+  const [closingId, setClosingId] = useState<number | null>(null)
			
 
				+  const [deletingId, setDeletingId] = useState<number | null>(null)
			
 
				+  const [error, setError] = useState<string | null>(null)
			
 
				+
			
 
				+  const rows: PositionRow[] = positions || []
			
 
				+
			
 
				+  const handleClose = async (row: PositionRow) => {
			
 
				+    if (
			
 
				+      !confirm(
			
 
				+        `Close position ${row.our_nft_mint?.slice(0, 8)}...? This will remove all liquidity on-chain and swap tokens back to USDC.`,
			
 
				+      )
			
 
				+    ) {
			
 
				+      return
			
 
				+    }
			
 
				+    setClosingId(row.id)
			
 
				+    setError(null)
			
 
				+    try {
			
 
				+      const res = await fetch('/api/positions', {
			
 
				+        method: 'POST',
			
 
				+        headers: { 'Content-Type': 'application/json' },
			
 
				+        body: JSON.stringify({ id: row.id }),
			
 
				+      })
			
 
				+      const data = await res.json()
			
 
				+      if (!res.ok) {
			
 
				+        setError(data.error || 'Close failed')
			
 
				+      } else {
			
 
				+        mutate()
			
 
				+      }
			
 
				+    } catch (e) {
			
 
				+      setError(e instanceof Error ? e.message : 'Close failed')
			
 
				+    } finally {
			
 
				+      setClosingId(null)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  const handleDelete = async (row: PositionRow) => {
			
 
				+    if (
			
 
				+      !confirm(
			
 
				+        `Delete position mapping #${row.id}? This only removes the record from the database, not from the blockchain.`,
			
 
				+      )
			
 
				+    ) {
			
 
				+      return
			
 
				+    }
			
 
				+    setDeletingId(row.id)
			
 
				+    setError(null)
			
 
				+    try {
			
 
				+      const res = await fetch(`/api/positions?id=${row.id}`, { method: 'DELETE' })
			
 
				+      const data = await res.json()
			
 
				+      if (!res.ok) {
			
 
				+        setError(data.error || 'Delete failed')
			
 
				+      } else {
			
 
				+        mutate()
			
 
				+      }
			
 
				+    } catch (e) {
			
 
				+      setError(e instanceof Error ? e.message : 'Delete failed')
			
 
				+    } finally {
			
 
				+      setDeletingId(null)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  return (
			
 
				+    <div className="space-y-6">
			
 
				+      <h2 className="text-lg font-semibold">Position Mappings</h2>
			
 
				+
			
 
				+      {error && (
			
 
				+        <div className="rounded-lg border border-red-500/30 bg-red-500/10 p-3 text-xs text-red-400">
			
 
				+          {error}
			
 
				+          <button onClick={() => setError(null)} className="ml-2 underline">
			
 
				+            dismiss
			
 
				+          </button>
			
 
				+        </div>
			
 
				+      )}
			
 
				+
			
 
				+      <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4">
			
 
				+        {rows.length === 0 ? (
			
 
				+          <p className="text-xs text-zinc-500">No position mappings yet</p>
			
 
				+        ) : (
			
 
				+          <div className="overflow-x-auto">
			
 
				+            <table className="w-full text-xs">
			
 
				+              <thead>
			
 
				+                <tr className="text-zinc-500 border-b border-[var(--border)]">
			
 
				+                  <th className="text-left py-2 pr-3">Target</th>
			
 
				+                  <th className="text-left py-2 pr-3">Target NFT</th>
			
 
				+                  <th className="text-left py-2 pr-3">Our NFT</th>
			
 
				+                  <th className="text-left py-2 pr-3">Pool</th>
			
 
				+                  <th className="text-left py-2 pr-3">Price Range</th>
			
 
				+                  <th className="text-left py-2 pr-3">Status</th>
			
 
				+                  <th className="text-left py-2 pr-3">Created</th>
			
 
				+                  <th className="text-left py-2">Actions</th>
			
 
				+                </tr>
			
 
				+              </thead>
			
 
				+              <tbody>
			
 
				+                {rows.map((row) => (
			
 
				+                  <tr key={row.id} className="border-b border-zinc-800/50">
			
 
				+                    <td className="py-2 pr-3 text-zinc-400">
			
 
				+                      {row.target_address.slice(0, 4)}...{row.target_address.slice(-4)}
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3">
			
 
				+                      <a
			
 
				+                        href={`https://solscan.io/token/${row.target_nft_mint}`}
			
 
				+                        target="_blank"
			
 
				+                        rel="noopener noreferrer"
			
 
				+                        className="text-indigo-400 hover:underline"
			
 
				+                      >
			
 
				+                        {row.target_nft_mint.slice(0, 6)}...
			
 
				+                      </a>
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3">
			
 
				+                      {row.our_nft_mint ? (
			
 
				+                        <a
			
 
				+                          href={`https://solscan.io/token/${row.our_nft_mint}`}
			
 
				+                          target="_blank"
			
 
				+                          rel="noopener noreferrer"
			
 
				+                          className="text-indigo-400 hover:underline"
			
 
				+                        >
			
 
				+                          {row.our_nft_mint.slice(0, 6)}...
			
 
				+                        </a>
			
 
				+                      ) : (
			
 
				+                        <span className="text-zinc-500">pending</span>
			
 
				+                      )}
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3 text-zinc-400">
			
 
				+                      {row.pool_label || `${row.pool_id.slice(0, 6)}...`}
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3 text-zinc-400">
			
 
				+                      {row.price_lower && row.price_upper
			
 
				+                        ? `${formatPrice(row.price_lower)} ~ ${formatPrice(row.price_upper)}`
			
 
				+                        : `${row.tick_lower} ~ ${row.tick_upper}`}
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3">
			
 
				+                      <span
			
 
				+                        className={`px-1.5 py-0.5 rounded text-[10px] ${
			
 
				+                          row.status === 'active'
			
 
				+                            ? 'bg-green-500/20 text-green-400'
			
 
				+                            : row.status === 'closed'
			
 
				+                              ? 'bg-zinc-500/20 text-zinc-400'
			
 
				+                              : 'bg-red-500/20 text-red-400'
			
 
				+                        }`}
			
 
				+                      >
			
 
				+                        {row.status}
			
 
				+                      </span>
			
 
				+                    </td>
			
 
				+                    <td className="py-2 pr-3 text-zinc-500">
			
 
				+                      {new Date(row.created_at + 'Z').toLocaleDateString()}
			
 
				+                    </td>
			
 
				+                    <td className="py-2">
			
 
				+                      <div className="flex gap-1.5">
			
 
				+                        {row.status === 'active' && row.our_nft_mint && (
			
 
				+                          <button
			
 
				+                            onClick={() => handleClose(row)}
			
 
				+                            disabled={closingId === row.id}
			
 
				+                            className="px-2 py-0.5 text-[10px] rounded bg-orange-500/20 text-orange-400 hover:bg-orange-500/30 disabled:opacity-50 transition-colors"
			
 
				+                          >
			
 
				+                            {closingId === row.id ? 'Closing...' : 'Close'}
			
 
				+                          </button>
			
 
				+                        )}
			
 
				+                        <button
			
 
				+                          onClick={() => handleDelete(row)}
			
 
				+                          disabled={deletingId === row.id}
			
 
				+                          className="px-2 py-0.5 text-[10px] rounded bg-red-500/20 text-red-400 hover:bg-red-500/30 disabled:opacity-50 transition-colors"
			
 
				+                        >
			
 
				+                          {deletingId === row.id ? 'Deleting...' : 'Delete'}
			
 
				+                        </button>
			
 
				+                      </div>
			
 
				+                    </td>
			
 
				+                  </tr>
			
 
				+                ))}
			
 
				+              </tbody>
			
 
				+            </table>
			
 
				+          </div>
			
 
				+        )}
			
 
				+      </div>
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
--- a/src/app/settings/page.tsx
+++ b/src/app/settings/page.tsx
@@ -0,0 +1,177 @@
 
				+'use client'
			
 
				+
			
 
				+import { useState, useEffect } from 'react'
			
 
				+import useSWR from 'swr'
			
 
				+
			
 
				+const fetcher = (url: string) => fetch(url).then((r) => r.json())
			
 
				+
			
 
				+export default function SettingsPage() {
			
 
				+  const { data: settings, mutate } = useSWR('/api/settings', fetcher)
			
 
				+  const { data: wallet } = useSWR('/api/wallet/balance', fetcher)
			
 
				+
			
 
				+  const [multiplier, setMultiplier] = useState('1.0')
			
 
				+  const [maxUsd, setMaxUsd] = useState('1000')
			
 
				+  const [slippage, setSlippage] = useState('0.02')
			
 
				+  const [pollInterval, setPollInterval] = useState('5000')
			
 
				+  const [swapAfterClose, setSwapAfterClose] = useState(true)
			
 
				+  const [saving, setSaving] = useState(false)
			
 
				+
			
 
				+  useEffect(() => {
			
 
				+    if (settings) {
			
 
				+      if (settings.copy_multiplier) setMultiplier(settings.copy_multiplier)
			
 
				+      if (settings.copy_max_usd) setMaxUsd(settings.copy_max_usd)
			
 
				+      if (settings.copy_slippage) setSlippage(settings.copy_slippage)
			
 
				+      if (settings.monitor_poll_interval) setPollInterval(settings.monitor_poll_interval)
			
 
				+      if (settings.swap_after_close !== undefined) setSwapAfterClose(settings.swap_after_close !== 'false')
			
 
				+    }
			
 
				+  }, [settings])
			
 
				+
			
 
				+  const handleSave = async () => {
			
 
				+    setSaving(true)
			
 
				+    try {
			
 
				+      await Promise.all([
			
 
				+        fetch('/api/settings', {
			
 
				+          method: 'PUT',
			
 
				+          headers: { 'Content-Type': 'application/json' },
			
 
				+          body: JSON.stringify({ key: 'copy_multiplier', value: multiplier }),
			
 
				+        }),
			
 
				+        fetch('/api/settings', {
			
 
				+          method: 'PUT',
			
 
				+          headers: { 'Content-Type': 'application/json' },
			
 
				+          body: JSON.stringify({ key: 'copy_max_usd', value: maxUsd }),
			
 
				+        }),
			
 
				+        fetch('/api/settings', {
			
 
				+          method: 'PUT',
			
 
				+          headers: { 'Content-Type': 'application/json' },
			
 
				+          body: JSON.stringify({ key: 'copy_slippage', value: slippage }),
			
 
				+        }),
			
 
				+        fetch('/api/settings', {
			
 
				+          method: 'PUT',
			
 
				+          headers: { 'Content-Type': 'application/json' },
			
 
				+          body: JSON.stringify({ key: 'monitor_poll_interval', value: pollInterval }),
			
 
				+        }),
			
 
				+        fetch('/api/settings', {
			
 
				+          method: 'PUT',
			
 
				+          headers: { 'Content-Type': 'application/json' },
			
 
				+          body: JSON.stringify({ key: 'swap_after_close', value: String(swapAfterClose) }),
			
 
				+        }),
			
 
				+      ])
			
 
				+      mutate()
			
 
				+    } finally {
			
 
				+      setSaving(false)
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  return (
			
 
				+    <div className="space-y-6">
			
 
				+      <h2 className="text-lg font-semibold">Settings</h2>
			
 
				+
			
 
				+      <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4 space-y-4">
			
 
				+        <h3 className="text-sm font-medium">Wallet Info</h3>
			
 
				+        <div className="text-xs space-y-1">
			
 
				+          <div className="flex gap-2">
			
 
				+            <span className="text-zinc-500 w-20">Address:</span>
			
 
				+            <code className="text-zinc-300">{wallet?.address || 'Not configured'}</code>
			
 
				+          </div>
			
 
				+          <div className="flex gap-2">
			
 
				+            <span className="text-zinc-500 w-20">SOL:</span>
			
 
				+            <span>{wallet?.sol?.toFixed(4) || '-'}</span>
			
 
				+          </div>
			
 
				+        </div>
			
 
				+      </div>
			
 
				+
			
 
				+      <div className="rounded-lg border border-[var(--border)] bg-[var(--card)] p-4 space-y-4">
			
 
				+        <h3 className="text-sm font-medium">Copy Trading Parameters (Global Defaults)</h3>
			
 
				+        <p className="text-[10px] text-zinc-600">
			
 
				+          These are global defaults. Each watched address can override Multiplier and Max USD in the
			
 
				+          Addresses page.
			
 
				+        </p>
			
 
				+        <div className="space-y-3">
			
 
				+          <div>
			
 
				+            <label className="block text-xs text-zinc-500 mb-1">
			
 
				+              Default Multiplier (1.0 = same as target, 2.0 = 2x, 0.5 = half)
			
 
				+            </label>
			
 
				+            <input
			
 
				+              type="number"
			
 
				+              step="0.1"
			
 
				+              min="0.01"
			
 
				+              max="100"
			
 
				+              value={multiplier}
			
 
				+              onChange={(e) => setMultiplier(e.target.value)}
			
 
				+              className="w-48 px-3 py-1.5 text-sm rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+            />
			
 
				+          </div>
			
 
				+          <div>
			
 
				+            <label className="block text-xs text-zinc-500 mb-1">
			
 
				+              Default Max USD per Copy (cap total position value in USD)
			
 
				+            </label>
			
 
				+            <input
			
 
				+              type="number"
			
 
				+              step="100"
			
 
				+              min="1"
			
 
				+              max="1000000"
			
 
				+              value={maxUsd}
			
 
				+              onChange={(e) => setMaxUsd(e.target.value)}
			
 
				+              className="w-48 px-3 py-1.5 text-sm rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+            />
			
 
				+          </div>
			
 
				+          <div>
			
 
				+            <label className="block text-xs text-zinc-500 mb-1">
			
 
				+              Slippage Tolerance (0.02 = 2%)
			
 
				+            </label>
			
 
				+            <input
			
 
				+              type="number"
			
 
				+              step="0.01"
			
 
				+              min="0.001"
			
 
				+              max="0.5"
			
 
				+              value={slippage}
			
 
				+              onChange={(e) => setSlippage(e.target.value)}
			
 
				+              className="w-48 px-3 py-1.5 text-sm rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+            />
			
 
				+          </div>
			
 
				+          <div>
			
 
				+            <label className="block text-xs text-zinc-500 mb-1">Poll Interval (ms)</label>
			
 
				+            <input
			
 
				+              type="number"
			
 
				+              step="1000"
			
 
				+              min="1000"
			
 
				+              max="60000"
			
 
				+              value={pollInterval}
			
 
				+              onChange={(e) => setPollInterval(e.target.value)}
			
 
				+              className="w-48 px-3 py-1.5 text-sm rounded border border-[var(--border)] bg-[var(--background)] text-[var(--foreground)] focus:outline-none focus:border-indigo-500"
			
 
				+            />
			
 
				+          </div>
			
 
				+          <div className="flex items-center gap-3">
			
 
				+            <button
			
 
				+              type="button"
			
 
				+              onClick={() => setSwapAfterClose(!swapAfterClose)}
			
 
				+              className={`relative inline-flex h-5 w-9 items-center rounded-full transition-colors ${
			
 
				+                swapAfterClose ? 'bg-indigo-500' : 'bg-zinc-600'
			
 
				+              }`}
			
 
				+            >
			
 
				+              <span
			
 
				+                className={`inline-block h-3.5 w-3.5 rounded-full bg-white transition-transform ${
			
 
				+                  swapAfterClose ? 'translate-x-4.5' : 'translate-x-0.5'
			
 
				+                }`}
			
 
				+              />
			
 
				+            </button>
			
 
				+            <label className="text-xs text-zinc-500">
			
 
				+              Swap tokens back to USDC after closing position
			
 
				+            </label>
			
 
				+          </div>
			
 
				+        </div>
			
 
				+        <button
			
 
				+          onClick={handleSave}
			
 
				+          disabled={saving}
			
 
				+          className="px-4 py-1.5 text-sm rounded bg-indigo-500 text-white hover:bg-indigo-400 disabled:opacity-50 transition-colors"
			
 
				+        >
			
 
				+          {saving ? 'Saving...' : 'Save Settings'}
			
 
				+        </button>
			
 
				+        <p className="text-[10px] text-zinc-600">
			
 
				+          Note: Changes take effect on the next copy operation. Env variables (SOL_ENDPOINT,
			
 
				+          SOL_SECRET_KEY, JUPITER_API_KEY) must be set in .env.local.
			
 
				+        </p>
			
 
				+      </div>
			
 
				+    </div>
			
 
				+  )
			
 
				+}
			
--- a/src/components/layout/header.tsx
+++ b/src/components/layout/header.tsx
@@ -0,0 +1,25 @@
 
				+'use client'
			
 
				+
			
 
				+import useSWR from 'swr'
			
 
				+
			
 
				+const fetcher = (url: string) => fetch(url).then((r) => r.json())
			
 
				+
			
 
				+export function Header() {
			
 
				+  const { data } = useSWR('/api/wallet/balance', fetcher, { refreshInterval: 30000 })
			
 
				+
			
 
				+  return (
			
 
				+    <header className="border-b border-[var(--border)] px-6 py-3 flex items-center justify-between bg-[var(--card)]">
			
 
				+      <h2 className="text-sm font-medium">Copy Trading Dashboard</h2>
			
 
				+      <div className="flex items-center gap-4 text-xs">
			
 
				+        {data?.address && (
			
 
				+          <span className="text-[var(--muted)]">
			
 
				+            {data.address.slice(0, 4)}...{data.address.slice(-4)}
			
 
				+          </span>
			
 
				+        )}
			
 
				+        {data?.sol !== undefined && (
			
 
				+          <span className="text-[var(--foreground)]">{data.sol.toFixed(4)} SOL</span>
			
 
				+        )}
			
 
				+      </div>
			
 
				+    </header>
			
 
				+  )
			
 
				+}
			
--- a/src/components/layout/sidebar.tsx
+++ b/src/components/layout/sidebar.tsx
@@ -0,0 +1,43 @@
 
				+'use client'
			
 
				+
			
 
				+import Link from 'next/link'
			
 
				+import { usePathname } from 'next/navigation'
			
 
				+
			
 
				+const NAV_ITEMS = [
			
 
				+  { href: '/', label: 'Dashboard' },
			
 
				+  { href: '/addresses', label: 'Watched Addresses' },
			
 
				+  { href: '/positions', label: 'Positions' },
			
 
				+  { href: '/history', label: 'History' },
			
 
				+  { href: '/settings', label: 'Settings' },
			
 
				+]
			
 
				+
			
 
				+export function Sidebar() {
			
 
				+  const pathname = usePathname()
			
 
				+
			
 
				+  return (
			
 
				+    <aside className="w-56 min-h-screen border-r border-[var(--border)] bg-[var(--card)] p-4 flex flex-col">
			
 
				+      <div className="mb-8">
			
 
				+        <h1 className="text-lg font-bold text-[var(--accent)]">Byreal Copy Trade</h1>
			
 
				+        <p className="text-xs text-[var(--muted)] mt-1">CLMM Position Copier</p>
			
 
				+      </div>
			
 
				+      <nav className="flex flex-col gap-1">
			
 
				+        {NAV_ITEMS.map((item) => {
			
 
				+          const active = pathname === item.href
			
 
				+          return (
			
 
				+            <Link
			
 
				+              key={item.href}
			
 
				+              href={item.href}
			
 
				+              className={`px-3 py-2 rounded text-sm transition-colors ${
			
 
				+                active
			
 
				+                  ? 'bg-[var(--accent)] text-white'
			
 
				+                  : 'text-[var(--muted)] hover:text-[var(--foreground)] hover:bg-[var(--border)]'
			
 
				+              }`}
			
 
				+            >
			
 
				+              {item.label}
			
 
				+            </Link>
			
 
				+          )
			
 
				+        })}
			
 
				+      </nav>
			
 
				+    </aside>
			
 
				+  )
			
 
				+}
			
--- a/src/lib/clmm-sdk/.gitignore
+++ b/src/lib/clmm-sdk/.gitignore
@@ -0,0 +1,52 @@
 
				+# compiled output
			
 
				+dist
			
 
				+tmp
			
 
				+out-tsc
			
 
				+
			
 
				+# dependencies
			
 
				+node_modules
			
 
				+output
			
 
				+
			
 
				+# IDEs and editors
			
 
				+/.idea
			
 
				+.project
			
 
				+.classpath
			
 
				+.c9/
			
 
				+*.launch
			
 
				+.settings/
			
 
				+*.sublime-workspace
			
 
				+
			
 
				+# IDE - VSCode
			
 
				+.vscode/*
			
 
				+!.vscode/settings.json
			
 
				+!.vscode/tasks.json
			
 
				+!.vscode/launch.json
			
 
				+!.vscode/extensions.json
			
 
				+
			
 
				+# misc
			
 
				+/.sass-cache
			
 
				+/connect.lock
			
 
				+/coverage
			
 
				+/libpeerconnection.log
			
 
				+npm-debug.log
			
 
				+yarn-error.log
			
 
				+testem.log
			
 
				+/typings
			
 
				+
			
 
				+# System Files
			
 
				+.DS_Store
			
 
				+Thumbs.db
			
 
				+
			
 
				+
			
 
				+test-output
			
 
				+
			
 
				+.env.local
			
 
				+.env
			
 
				+
			
 
				+vite.config.*.timestamp*
			
 
				+vitest.config.*.timestamp*
			
 
				+
			
 
				+.cursor/mcp.json
			
 
				+
			
 
				+.cursor/rules/nx-rules.mdc
			
 
				+.github/instructions/nx.instructions.md
			
--- a/src/lib/clmm-sdk/.prettierignore
+++ b/src/lib/clmm-sdk/.prettierignore
@@ -0,0 +1,10 @@
 
				+# 忽略以下文件夹不被 Prettier 格式化
			
 
				+node_modules
			
 
				+/dist
			
 
				+/.next
			
 
				+/out
			
 
				+/tmp
			
 
				+/coverage
			
 
				+/.nx/cache
			
 
				+/.nx/workspace-data
			
 
				+pnpm-lock.yaml
			
--- a/src/lib/clmm-sdk/.prettierrc
+++ b/src/lib/clmm-sdk/.prettierrc
@@ -0,0 +1,4 @@
 
				+{
			
 
				+  "singleQuote": true,
			
 
				+  "printWidth": 120
			
 
				+}
			
--- a/src/lib/clmm-sdk/README.md
+++ b/src/lib/clmm-sdk/README.md
@@ -0,0 +1,58 @@
 
				+# byreal-clmm-sdk
			
 
				+
			
 
				+## Install
			
 
				+
			
 
				+```bash
			
 
				+yarn
			
 
				+```
			
 
				+
			
 
				+## Running Playground Code
			
 
				+
			
 
				+```bash
			
 
				+bun run src/playgrounds/xxxx.ts
			
 
				+```
			
 
				+
			
 
				+Tips: When running examples in playgrounds, you need to set the private key in .env
			
 
				+
			
 
				+## Running Unit Tests
			
 
				+
			
 
				+```bash
			
 
				+yarn vitest
			
 
				+```
			
 
				+
			
 
				+## Build
			
 
				+
			
 
				+```bash
			
 
				+yarn build
			
 
				+```
			
 
				+
			
 
				+## Utility functions
			
 
				+
			
 
				+```ts
			
 
				+// price -> tick
			
 
				+SqrtPriceMath.getTickFromPrice;
			
 
				+// tick -> sqrtPriceX64
			
 
				+SqrtPriceMath.getSqrtPriceX64FromTick;
			
 
				+// sqrtPriceX64 -> price
			
 
				+SqrtPriceMath.sqrtPriceX64ToPrice;
			
 
				+
			
 
				+// price -> sqrtPriceX64
			
 
				+SqrtPriceMath.priceToSqrtPriceX64;
			
 
				+
			
 
				+// sqrtPriceX64 -> tick
			
 
				+SqrtPriceMath.getTickFromSqrtPriceX64;
			
 
				+
			
 
				+// price -> tick
			
 
				+SqrtPriceMath.getTickFromPrice;
			
 
				+
			
 
				+// tick -> price
			
 
				+TickMath.getPriceFromTick;
			
 
				+
			
 
				+// price -> tick
			
 
				+// price -> sqrtPriceX64
			
 
				+// price -> roundedPrice
			
 
				+TickMath.getTickAlignedPriceDetails;
			
 
				+
			
 
				+// Calculate the position address from the nft address
			
 
				+getPdaPersonalPositionAddress;
			
 
				+```
			
--- a/src/lib/clmm-sdk/package.json
+++ b/src/lib/clmm-sdk/package.json
@@ -0,0 +1,36 @@
 
				+{
			
 
				+  "name": "@byreal/clmm-sdk",
			
 
				+  "version": "0.0.1",
			
 
				+  "private": true,
			
 
				+  "main": "./dist/index.js",
			
 
				+  "module": "./dist/index.js",
			
 
				+  "types": "./dist/index.d.ts",
			
 
				+  "exports": {
			
 
				+    "./package.json": "./package.json",
			
 
				+    ".": {
			
 
				+      "types": "./dist/index.d.ts",
			
 
				+      "import": "./dist/index.js",
			
 
				+      "default": "./dist/index.js"
			
 
				+    }
			
 
				+  },
			
 
				+  "scripts": {
			
 
				+    "test": "vitest",
			
 
				+    "build": "tsc"
			
 
				+  },
			
 
				+  "dependencies": {
			
 
				+    "@coral-xyz/anchor": "^0.31.1",
			
 
				+    "@noble/hashes": "^1.8.0",
			
 
				+    "@solana/buffer-layout": "^4.0.1",
			
 
				+    "@solana/spl-token": "^0.4.13",
			
 
				+    "@solana/web3.js": "^1.98.2",
			
 
				+    "bn.js": "^5.2.1",
			
 
				+    "bs58": "^6.0.0",
			
 
				+    "decimal.js": "^10.5.0",
			
 
				+    "dotenv": "^16.5.0",
			
 
				+    "ky": "^1.8.1",
			
 
				+    "lodash-es": "^4.17.21",
			
 
				+    "tslib": "^2.3.0",
			
 
				+    "typescript": "~5.7.2",
			
 
				+    "vitest": "^3.0.9"
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/calculate.ts
+++ b/src/lib/clmm-sdk/src/calculate.ts
@@ -0,0 +1,80 @@
 
				+// Various calculations
			
 
				+
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { MAX_TICK, MIN_TICK, PoolUtils, SqrtPriceMath, TickMath } from './instructions/index.js';
			
 
				+
			
 
				+/**
			
 
				+ * Calculate tick-aligned price range
			
 
				+ * @param poolInfo
			
 
				+ * @param startPrice
			
 
				+ * @param endPrice
			
 
				+ * @returns
			
 
				+ */
			
 
				+export function calculateTickAlignedPriceRange(info: {
			
 
				+  tickSpacing: number;
			
 
				+  mintDecimalsA: number;
			
 
				+  mintDecimalsB: number;
			
 
				+  startPrice: string | number;
			
 
				+  endPrice: string | number;
			
 
				+}) {
			
 
				+  const priceInTickLower = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(info.startPrice),
			
 
				+    info.tickSpacing,
			
 
				+    info.mintDecimalsA,
			
 
				+    info.mintDecimalsB
			
 
				+  );
			
 
				+  const priceInTickUpper = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(info.endPrice),
			
 
				+    info.tickSpacing,
			
 
				+    info.mintDecimalsA,
			
 
				+    info.mintDecimalsB
			
 
				+  );
			
 
				+  return {
			
 
				+    priceInTickLower,
			
 
				+    priceInTickUpper,
			
 
				+  };
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+  Using the following process, reassemble a function that takes a tick + tickSpacing and returns a new price
			
 
				+
			
 
				+// tick + tickSpacing -> sqrtPriceX64
			
 
				+SqrtPriceMath.getSqrtPriceX64FromTick;
			
 
				+// sqrtPriceX64 -> price
			
 
				+SqrtPriceMath.sqrtPriceX64ToPrice;
			
 
				+ */
			
 
				+
			
 
				+export function calculatePriceFromTick(
			
 
				+  tick: number | string,
			
 
				+  mintDecimalsA: number,
			
 
				+  mintDecimalsB: number,
			
 
				+  tickSpacing: number | string
			
 
				+) {
			
 
				+  let tickWithSpacing = Number(tick) + Number(tickSpacing);
			
 
				+
			
 
				+  // If tickWithSpacing is out of MIN_TICK and MAX_TICK range, use the nearest max or min tick
			
 
				+  if (tickWithSpacing < MIN_TICK || tickWithSpacing > MAX_TICK) {
			
 
				+    console.warn(`!!! tickWithSpacing ${tickWithSpacing} is out of range, using the nearest tick !!!`);
			
 
				+    tickWithSpacing = Number(tick);
			
 
				+  }
			
 
				+  const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickWithSpacing);
			
 
				+  const price = SqrtPriceMath.sqrtPriceX64ToPrice(sqrtPriceX64, mintDecimalsA, mintDecimalsB);
			
 
				+  return {
			
 
				+    price: price.toString(),
			
 
				+    tick: tickWithSpacing,
			
 
				+  };
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the available price range from a TickSpacing, returns an object containing min and max prices
			
 
				+ * @param tickSpacing
			
 
				+ * @returns
			
 
				+ */
			
 
				+export function calculatePriceRangeFromTickSpacing(tickSpacing: number, mintDecimalsA: number, mintDecimalsB: number) {
			
 
				+  const { minTickBoundary, maxTickBoundary } = PoolUtils.tickRange(tickSpacing);
			
 
				+  return {
			
 
				+    min: calculatePriceFromTick(minTickBoundary, mintDecimalsA, mintDecimalsB, tickSpacing),
			
 
				+    max: calculatePriceFromTick(maxTickBoundary, mintDecimalsA, mintDecimalsB, tickSpacing),
			
 
				+  };
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/commonModels.ts
+++ b/src/lib/clmm-sdk/src/client/apis/commonModels.ts
@@ -0,0 +1,6 @@
 
				+export interface IDynamicFeeResp {
			
 
				+  extreme: number;
			
 
				+  high: number;
			
 
				+  low: number;
			
 
				+  medium: number;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/index.ts
+++ b/src/lib/clmm-sdk/src/client/apis/index.ts
@@ -0,0 +1,89 @@
 
				+import { IDynamicFeeResp } from './commonModels.js';
			
 
				+import { createApiInstance, ApiInstance } from './ky.js';
			
 
				+import { IPoolsByIdsReq, IPoolsReq, IPoolsResp } from './poolsModels.js';
			
 
				+import { IMyPositionsReq, IMyPositionsResp } from './positionModels.js';
			
 
				+import { ITick, ITickReq } from './tickModels.js';
			
 
				+
			
 
				+export type Cluster = 'mainnet' | 'devnet';
			
 
				+
			
 
				+export const API_URLS = {
			
 
				+  BASE_HOST: 'https://your-api-host.com',
			
 
				+  // ========= swap scenario =========
			
 
				+  // Price inquiry
			
 
				+  SWAP: 'swap',
			
 
				+  // ========= Others =========
			
 
				+
			
 
				+  // Get pool information
			
 
				+  POOL_INFO_LIST: 'dex/v1/pools/info/list',
			
 
				+  POOL_INFO_BY_IDS: 'dex/v1/pools/info/ids',
			
 
				+
			
 
				+  // Get user positions
			
 
				+  MY_POSITIONS: 'dex/v1/position/list',
			
 
				+
			
 
				+  // Get tick information
			
 
				+  TICK: 'router/v1/query-service/list-line-position',
			
 
				+
			
 
				+  // Dynamic fees
			
 
				+  DYNAMIC_FEE: 'dex/v1/main/auto-fee',
			
 
				+};
			
 
				+
			
 
				+export type ApiConfigInfo = Partial<typeof API_URLS>;
			
 
				+
			
 
				+export interface IApiParams {
			
 
				+  cluster: Cluster;
			
 
				+  timeout: number;
			
 
				+  urlConfigs: ApiConfigInfo;
			
 
				+}
			
 
				+
			
 
				+export class Api {
			
 
				+  public cluster: Cluster;
			
 
				+
			
 
				+  public api: ApiInstance;
			
 
				+
			
 
				+  public urlConfigs: ApiConfigInfo = API_URLS;
			
 
				+
			
 
				+  constructor(params?: IApiParams) {
			
 
				+    const { cluster = 'mainnet', timeout = 10000, urlConfigs } = params || {};
			
 
				+
			
 
				+    this.cluster = cluster;
			
 
				+    this.urlConfigs = {
			
 
				+      ...API_URLS,
			
 
				+      ...urlConfigs,
			
 
				+    };
			
 
				+
			
 
				+    this.api = createApiInstance(this.urlConfigs.BASE_HOST || API_URLS.BASE_HOST, timeout);
			
 
				+  }
			
 
				+
			
 
				+  async getPools(params: IPoolsReq) {
			
 
				+    const data = await this.api.get<IPoolsResp>(`${this.urlConfigs.POOL_INFO_LIST || API_URLS.POOL_INFO_LIST}`, {
			
 
				+      params,
			
 
				+    });
			
 
				+    return data;
			
 
				+  }
			
 
				+
			
 
				+  async getPoolsByIds(params: IPoolsByIdsReq) {
			
 
				+    const result = await this.api.get<IPoolsResp>(`${this.urlConfigs.POOL_INFO_BY_IDS || API_URLS.POOL_INFO_BY_IDS}`, {
			
 
				+      params,
			
 
				+    });
			
 
				+    return result;
			
 
				+  }
			
 
				+
			
 
				+  async getMyPositions(params: IMyPositionsReq) {
			
 
				+    const data = await this.api.get<IMyPositionsResp>(`${this.urlConfigs.MY_POSITIONS || API_URLS.MY_POSITIONS}`, {
			
 
				+      params,
			
 
				+    });
			
 
				+    return data;
			
 
				+  }
			
 
				+
			
 
				+  async getTicks(params: ITickReq) {
			
 
				+    const data = await this.api.get<ITick[]>(this.urlConfigs.TICK || API_URLS.TICK, {
			
 
				+      params,
			
 
				+    });
			
 
				+    return data;
			
 
				+  }
			
 
				+
			
 
				+  async getDynamicFee() {
			
 
				+    const data = await this.api.get<IDynamicFeeResp>(this.urlConfigs.DYNAMIC_FEE || API_URLS.DYNAMIC_FEE);
			
 
				+    return data;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/ky.ts
+++ b/src/lib/clmm-sdk/src/client/apis/ky.ts
@@ -0,0 +1,107 @@
 
				+import ky, { Input, Options, KyInstance } from 'ky';
			
 
				+
			
 
				+export class RequestError extends Error {
			
 
				+  code?: number;
			
 
				+  url?: string;
			
 
				+  constructor(message: string, code?: number, url?: string) {
			
 
				+    super(message);
			
 
				+    this.code = code;
			
 
				+    this.url = url;
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+function handleResponseData(data: any, url?: string) {
			
 
				+  const retCode = data?.ret_code ?? data?.retCode;
			
 
				+  if (retCode === 0) {
			
 
				+    return {
			
 
				+      // FIXME temporary adaptation for swap, will be modified later
			
 
				+      data: data.result.data || data.result,
			
 
				+      retCode: data.result.code || retCode,
			
 
				+      retMsg: data.result.msg,
			
 
				+      // FIXME temporary adaptation for swap, will be modified later
			
 
				+      success: data.result.success || true,
			
 
				+    };
			
 
				+  } else {
			
 
				+    throw new RequestError(data?.ret_msg || data?.retMsg || 'Unknown error', data?.ret_code || data?.retCode, url);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export interface IApiInstanceResp<T> {
			
 
				+  data: T;
			
 
				+  retCode: number;
			
 
				+  retMsg: string;
			
 
				+  success: boolean;
			
 
				+}
			
 
				+
			
 
				+export type ApiInstance = {
			
 
				+  get<T>(input: Input, options?: Options & { params?: Record<string, any> }): Promise<IApiInstanceResp<T>>;
			
 
				+  post<T>(input: Input, options?: Options): Promise<IApiInstanceResp<T>>;
			
 
				+  put<T>(input: Input, options?: Options): Promise<IApiInstanceResp<T>>;
			
 
				+  delete<T>(input: Input, options?: Options): Promise<IApiInstanceResp<T>>;
			
 
				+  _kyInstance: KyInstance;
			
 
				+  _ky: KyInstance;
			
 
				+};
			
 
				+
			
 
				+/**
			
 
				+ * 
			
 
				+ * // GET
			
 
				+const { data } = await api.get('your/path', { searchParams: { foo: 1 } });
			
 
				+
			
 
				+// POST
			
 
				+const { data } = await api.post('your/path', { json: { foo: 1 } });
			
 
				+
			
 
				+// PUT
			
 
				+const { data } = await api.put('your/path', { json: { foo: 1 } });
			
 
				+
			
 
				+// DELETE
			
 
				+const { data } = await api.delete('your/path');
			
 
				+ * 
			
 
				+ * @param baseURL 
			
 
				+ * @param timeout 
			
 
				+ * @returns 
			
 
				+ */
			
 
				+export function createApiInstance(baseURL: string, timeout = 10000): ApiInstance {
			
 
				+  const kyInstance = ky.create({
			
 
				+    prefixUrl: baseURL,
			
 
				+    timeout,
			
 
				+    hooks: {
			
 
				+      afterResponse: [
			
 
				+        async (_request, _options, response) => {
			
 
				+          const data = await response.clone().json();
			
 
				+          const resp = handleResponseData(data, response.url);
			
 
				+          // Key: wrap into Response object
			
 
				+          return new Response(JSON.stringify(resp), {
			
 
				+            status: response.status,
			
 
				+            statusText: response.statusText,
			
 
				+            headers: response.headers,
			
 
				+          });
			
 
				+        },
			
 
				+      ],
			
 
				+    },
			
 
				+  });
			
 
				+
			
 
				+  // Common request method
			
 
				+  async function request<T>(input: Input, options?: Options): Promise<IApiInstanceResp<T>> {
			
 
				+    const result = await kyInstance(input, options).json<IApiInstanceResp<T>>();
			
 
				+    return result;
			
 
				+  }
			
 
				+
			
 
				+  return {
			
 
				+    get: <T>(input: Input, options?: Options & { params?: Record<string, any> }) => {
			
 
				+      let finalOptions = { method: 'get', ...options } as Options;
			
 
				+      if (options?.params) {
			
 
				+        finalOptions = {
			
 
				+          ...finalOptions,
			
 
				+          searchParams: options.params,
			
 
				+        };
			
 
				+        delete (finalOptions as any).params;
			
 
				+      }
			
 
				+      return request<T>(input, finalOptions);
			
 
				+    },
			
 
				+    post: <T>(input: Input, options?: Options) => request<T>(input, { method: 'post', ...options }),
			
 
				+    put: <T>(input: Input, options?: Options) => request<T>(input, { method: 'put', ...options }),
			
 
				+    delete: <T>(input: Input, options?: Options) => request<T>(input, { method: 'delete', ...options }),
			
 
				+    _kyInstance: kyInstance,
			
 
				+    _ky: ky,
			
 
				+  };
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/poolsModels.ts
+++ b/src/lib/clmm-sdk/src/client/apis/poolsModels.ts
@@ -0,0 +1,87 @@
 
				+export enum PoolCategory {
			
 
				+  DEFAULT = 'default',
			
 
				+  STABLES = 'stables',
			
 
				+  RESET_LAUNCH_PAD = 'resetLaunchPad',
			
 
				+}
			
 
				+export interface PoolReward {
			
 
				+  address: string;
			
 
				+  apr: string;
			
 
				+  dailyAmount: string;
			
 
				+  decimals: number;
			
 
				+  endTimestamp: number;
			
 
				+  logoURI: string;
			
 
				+  name: string;
			
 
				+  price: string;
			
 
				+  symbol: string;
			
 
				+}
			
 
				+
			
 
				+export interface IPoolsReq {
			
 
				+  // ids?: string[];
			
 
				+  category?: PoolCategory;
			
 
				+  sortField?: 'tvl' | 'volumeUsd24h' | 'feeUsd24h' | 'apr24h';
			
 
				+  sortType?: 'asc' | 'desc';
			
 
				+  incentiveOnly?: boolean; // todo: field to be determined, need to confirm with server
			
 
				+  page: number;
			
 
				+  pageSize: number;
			
 
				+}
			
 
				+
			
 
				+export interface IPoolsResp {
			
 
				+  list: PoolInfo[];
			
 
				+  total: number;
			
 
				+}
			
 
				+
			
 
				+export interface IPoolsByIdsReq {
			
 
				+  ids: string[];
			
 
				+}
			
 
				+
			
 
				+export type IPoolsByIdsResp = IPoolsResp;
			
 
				+
			
 
				+export interface Mint {
			
 
				+  address: string;
			
 
				+  decimals: number;
			
 
				+  logoURI: string;
			
 
				+  name: string;
			
 
				+  symbol: string;
			
 
				+  programId: string;
			
 
				+  price: string;
			
 
				+  priceChange24h: string;
			
 
				+  tvl: string;
			
 
				+  volumeUsd24h: string;
			
 
				+}
			
 
				+
			
 
				+export interface PoolInfo {
			
 
				+  poolAddress: string;
			
 
				+  programId: string;
			
 
				+  feeRate: string;
			
 
				+  mintA: Mint;
			
 
				+  mintB: Mint;
			
 
				+  mintAVaultAddress: string;
			
 
				+  mintBVaultAddress: string;
			
 
				+  mintAmountA: string;
			
 
				+  mintAmountB: string;
			
 
				+  openTime: string;
			
 
				+  config: {
			
 
				+    defaultRange: number;
			
 
				+    defaultRangePoint: number[];
			
 
				+    fundFeeRate: string;
			
 
				+    id: string;
			
 
				+    index: number;
			
 
				+    protocolFeeRate: string;
			
 
				+    tickSpacing: number;
			
 
				+    tradeFeeRate: string;
			
 
				+  };
			
 
				+  apr24h: string;
			
 
				+  apr24hChange: string;
			
 
				+  feeUsd24h: string;
			
 
				+  apr7d: string;
			
 
				+  feeUsd7d: string;
			
 
				+  volumeUsd24h: string;
			
 
				+  tvl: string;
			
 
				+  ratio: string; // tokenB per tokenA
			
 
				+  day: {
			
 
				+    ratioHigh: string;
			
 
				+    ratioLow: string;
			
 
				+  };
			
 
				+  category?: PoolCategory;
			
 
				+  rewards?: PoolReward[];
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/positionModels.ts
+++ b/src/lib/clmm-sdk/src/client/apis/positionModels.ts
@@ -0,0 +1,22 @@
 
				+import { PoolInfo } from './poolsModels.js';
			
 
				+export interface IMyPositionsReq {
			
 
				+  userAddress: string;
			
 
				+}
			
 
				+
			
 
				+export interface IMyPositionsResp {
			
 
				+  positions: IPosition[];
			
 
				+  poolMap: IPoolMap;
			
 
				+}
			
 
				+
			
 
				+export interface IPosition {
			
 
				+  activeBurnNft: boolean; // If the NFT is actively destroyed in the case of non-reduction of liquidity, the position is still there, but the deposit tokens cannot be withdrawn
			
 
				+  lpNftMintAddress: string;
			
 
				+  lpNftTokenAddress: string;
			
 
				+  lpProviderAddress: string;
			
 
				+  personalPositionAddress: string;
			
 
				+  poolAddress: string;
			
 
				+}
			
 
				+
			
 
				+export interface IPoolMap {
			
 
				+  [address: string]: PoolInfo;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/swapModels.ts
+++ b/src/lib/clmm-sdk/src/client/apis/swapModels.ts
@@ -0,0 +1,43 @@
 
				+/**
			
 
				+ * Swap request interface, used to handle token swaps
			
 
				+ *
			
 
				+ * @property {string} inputMint - Input token contract address
			
 
				+ * @property {string} outputMint - Output token contract address
			
 
				+ * @property {string} amount - Swap amount, unit is Lamport
			
 
				+ * @property {('in'|'out')} swapMode - Swap mode, 'in' means fixed input amount, 'out' means fixed output amount
			
 
				+ * @property {string} slippageBps - Slippage tolerance, in basis points (1 basis point = 0.01%)
			
 
				+ * @property {string} computeUnitPriceMicroLamports - Compute unit price, unit is microLamport
			
 
				+ * @property {string} [quoteOnly] - Whether to only get quotes without executing transactions
			
 
				+ * @property {string} [userPublicKey] - User wallet address
			
 
				+ */
			
 
				+export interface ISwapRequest {
			
 
				+  inputMint: string;
			
 
				+  outputMint: string;
			
 
				+  amount: string;
			
 
				+  swapMode: 'in' | 'out';
			
 
				+  slippageBps: string;
			
 
				+  computeUnitPriceMicroLamports: string;
			
 
				+  quoteOnly?: string;
			
 
				+  userPublicKey?: string;
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * 交换响应接口，包含交换结果信息
			
 
				+ *
			
 
				+ * @property {string} [transaction] - 构建后的交易编码
			
 
				+ * @property {string} inputMint - 输入代币合约地址
			
 
				+ * @property {string} outputMint - 输出代币合约地址
			
 
				+ * @property {string} outMount - 输出数量
			
 
				+ * @property {string} otherAmountThreshold - 最少收到数量
			
 
				+ * @property {number} priceImpactPct - 价格影响百分比
			
 
				+ * @property {string} inMount - 输入数量
			
 
				+ */
			
 
				+export interface ISwapResponse {
			
 
				+  transaction?: string;
			
 
				+  inputMint: string;
			
 
				+  outputMint: string;
			
 
				+  outMount: string;
			
 
				+  otherAmountThreshold: string;
			
 
				+  priceImpactPct: number;
			
 
				+  inMount: string;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/apis/tickModels.ts
+++ b/src/lib/clmm-sdk/src/client/apis/tickModels.ts
@@ -0,0 +1,10 @@
 
				+export interface ITickReq {
			
 
				+  poolId: string;
			
 
				+}
			
 
				+
			
 
				+export interface ITick {
			
 
				+  tick: number;
			
 
				+  price: string;
			
 
				+  originalPrice: string;
			
 
				+  liquidity: string;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/chain/index.ts
+++ b/src/lib/clmm-sdk/src/client/chain/index.ts
@@ -0,0 +1,1382 @@
 
				+import {
			
 
				+  TOKEN_PROGRAM_ID,
			
 
				+  NATIVE_MINT,
			
 
				+  createInitializeAccountInstruction,
			
 
				+  createCloseAccountInstruction,
			
 
				+  createAssociatedTokenAccountIdempotentInstruction,
			
 
				+  AccountLayout,
			
 
				+  MintLayout,
			
 
				+  TOKEN_2022_PROGRAM_ID,
			
 
				+} from '@solana/spl-token';
			
 
				+import { Connection, PublicKey, VersionedTransaction, SystemProgram, TransactionInstruction } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { BYREAL_CLMM_PROGRAM_ID, U64_IGNORE_RANGE, MEMO_PROGRAM_ID } from '../../constants.js';
			
 
				+import {
			
 
				+  IPoolLayoutWithId,
			
 
				+  IPersonalPositionLayout,
			
 
				+  PositionUtils,
			
 
				+  RawDataUtils,
			
 
				+  SqrtPriceMath,
			
 
				+  TickArrayLayout,
			
 
				+  TickMath,
			
 
				+  TickUtils,
			
 
				+  Instruction,
			
 
				+  getATAAddress,
			
 
				+  ITokenInfo,
			
 
				+  getPdaMintExAccount,
			
 
				+  getPdaTickArrayAddress,
			
 
				+  PoolUtils,
			
 
				+  getTickArrayBitmapExtension,
			
 
				+  getTickArrayInfo,
			
 
				+  getPdaExBitmapAccount,
			
 
				+  MIN_SQRT_PRICE_X64,
			
 
				+  MAX_SQRT_PRICE_X64,
			
 
				+  TickArrayUtils,
			
 
				+  TickArrayContainer,
			
 
				+} from '../../instructions/index';
			
 
				+import { generatePubKey } from '../../utils/generatePubKey';
			
 
				+import { makeTransaction, sendTransaction, estimateComputeUnits, DEFAULT_COMPUTE_UNIT_PRICE } from '../../utils/index';
			
 
				+
			
 
				+import {
			
 
				+  IAddLiquidityParams,
			
 
				+  IClosePositionParams,
			
 
				+  ICollectFeesParams,
			
 
				+  ICreatePoolParams,
			
 
				+  IQuoteSwapExactOutParams,
			
 
				+  IQuoteSwapExactOutReturn,
			
 
				+  ISwapExactOutParams,
			
 
				+  ICreatePositionParams,
			
 
				+  IDecreaseFullLiquidityParams,
			
 
				+  IDecreaseLiquidityParams,
			
 
				+  IInstructionReturn,
			
 
				+  ParamsWithSignerCallback,
			
 
				+  ICollectAllFeesParams,
			
 
				+  SignerCallback,
			
 
				+  IGetPositionInfoByNftMintReturn,
			
 
				+  ICalculateCreatePositionFee,
			
 
				+  IQouteSwapParams,
			
 
				+  IQouteSwapReturn,
			
 
				+  ISwapParams,
			
 
				+} from './models';
			
 
				+import {
			
 
				+  alignPriceToTickPrice,
			
 
				+  calculateApr,
			
 
				+  calculateRewardApr,
			
 
				+  calculateRangeAprs,
			
 
				+  getAmountAFromAmountB,
			
 
				+  getAmountBFromAmountA,
			
 
				+  getTokenProgramId,
			
 
				+} from './utils';
			
 
				+
			
 
				+/*
			
 
				+ * Chain class: Encapsulates chain-level operations related to CLMM (Concentrated Liquidity Market Maker)
			
 
				+
			
 
				+ * Includes position, pool, token information retrieval, liquidity operations, fee collection, etc.
			
 
				+ * Mainly depends on Solana web3.js, @solana/spl-token instruction tools
			
 
				+ */
			
 
				+export class Chain {
			
 
				+  public connection: Connection;
			
 
				+  public programId: PublicKey;
			
 
				+  // Cache rent fee calculation results
			
 
				+  private rentFeeCache: { [key: number]: number } = {};
			
 
				+
			
 
				+  /**
			
 
				+   * Constructor
			
 
				+   * @param params.connection Solana chain connection object
			
 
				+   * @param params.programId CLMM program ID, default is CLMM_PROGRAM_ID
			
 
				+   */
			
 
				+  constructor(params: { connection: Connection; programId?: PublicKey }) {
			
 
				+    const { connection, programId = BYREAL_CLMM_PROGRAM_ID } = params;
			
 
				+    this.connection = connection;
			
 
				+    this.programId = programId;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get all CLMM position information for a specified account
			
 
				+   * @param userAddress User wallet address
			
 
				+   * @returns Promise<IPersonalPositionLayout[]> Position information list
			
 
				+   */
			
 
				+  public async getRawPositionInfoListByUserAddress(userAddress: PublicKey): Promise<IPersonalPositionLayout[]> {
			
 
				+    return RawDataUtils.getRawPositionInfoListByUserAddress({
			
 
				+      connection: this.connection,
			
 
				+      programId: this.programId,
			
 
				+      userAddress,
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get the corresponding position information based on the NFT mint address
			
 
				+   * @param nftMint NFT mint address
			
 
				+   * @returns Promise<IPersonalPositionLayout | null> Position information
			
 
				+   */
			
 
				+  public async getRawPositionInfoByNftMint(nftMint: PublicKey): Promise<IPersonalPositionLayout | null> {
			
 
				+    return RawDataUtils.getRawPositionInfoByNftMint({
			
 
				+      connection: this.connection,
			
 
				+      programId: this.programId,
			
 
				+      nftMint,
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get the corresponding pool information based on the pool address
			
 
				+   * @param poolId Pool address or PublicKey
			
 
				+   * @returns Promise<IPoolLayoutWithId> Pool information
			
 
				+   */
			
 
				+  public async getRawPoolInfoByPoolId(poolId: string | PublicKey): Promise<IPoolLayoutWithId> {
			
 
				+    const poolInfo = await RawDataUtils.getRawPoolInfoByPoolId({
			
 
				+      connection: this.connection,
			
 
				+      poolId,
			
 
				+    });
			
 
				+    if (!poolInfo) throw new Error(`pool info not found, poolId: ${String(poolId)}`);
			
 
				+    return poolInfo;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get the corresponding token information based on the token mint address
			
 
				+   * @param mintAddress Token mint address
			
 
				+   * @returns Promise<...> Token information
			
 
				+   */
			
 
				+  public async getRawTokenInfoByMint(
			
 
				+    mintAddress: PublicKey
			
 
				+  ): Promise<(ReturnType<typeof MintLayout.decode> & { owner: PublicKey }) | null> {
			
 
				+    const tokenInfo = await RawDataUtils.getRawTokenInfoByMint({
			
 
				+      connection: this.connection,
			
 
				+      mintAddress,
			
 
				+    });
			
 
				+    if (!tokenInfo) throw new Error(`token info not found, mintAddress: ${String(mintAddress)}`);
			
 
				+    return tokenInfo;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get the simplified token information (including address, precision, and programId)
			
 
				+   * @param mintAddress Token mint address
			
 
				+   * @returns Promise<ITokenInfo>
			
 
				+   */
			
 
				+  public async getTokenInfoByMint(mintAddress: PublicKey): Promise<ITokenInfo> {
			
 
				+    const tokenInfo = await this.getRawTokenInfoByMint(mintAddress);
			
 
				+    if (!tokenInfo) throw new Error(`token info not found, mintAddress: ${String(mintAddress)}`);
			
 
				+    return {
			
 
				+      address: mintAddress.toBase58(),
			
 
				+      decimals: tokenInfo.decimals,
			
 
				+      programId: tokenInfo.owner.toBase58(),
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get the detailed position information, including price range, token amount, fee, etc.
			
 
				+   * @param nftMint NFT mint address
			
 
				+   * @returns Promise<{...}> Detailed position information
			
 
				+   */
			
 
				+  public async getPositionInfoByNftMint(nftMint: PublicKey): Promise<IGetPositionInfoByNftMintReturn | null> {
			
 
				+    const rawPositionInfo = await this.getRawPositionInfoByNftMint(nftMint);
			
 
				+    if (!rawPositionInfo) return null;
			
 
				+    const rawPoolInfo = await this.getRawPoolInfoByPoolId(rawPositionInfo.poolId);
			
 
				+    const { mintDecimalsA, mintDecimalsB, tickSpacing, programId } = rawPoolInfo;
			
 
				+
			
 
				+    // Calculate the price corresponding to tickLower/tickUpper
			
 
				+    const priceLower = TickMath.getPriceFromTick({
			
 
				+      tick: rawPositionInfo.tickLower,
			
 
				+      decimalsA: mintDecimalsA,
			
 
				+      decimalsB: mintDecimalsB,
			
 
				+    });
			
 
				+    const priceUpper = TickMath.getPriceFromTick({
			
 
				+      tick: rawPositionInfo.tickUpper,
			
 
				+      decimalsA: mintDecimalsA,
			
 
				+      decimalsB: mintDecimalsB,
			
 
				+    });
			
 
				+    // Calculate the actual token amount held in the position
			
 
				+    const { amountA, amountB } = PositionUtils.getAmountsFromLiquidity({
			
 
				+      poolInfo: rawPoolInfo,
			
 
				+      ownerPosition: rawPositionInfo,
			
 
				+      liquidity: rawPositionInfo.liquidity,
			
 
				+      slippage: 0,
			
 
				+      add: false,
			
 
				+      epochInfo: await this.connection.getEpochInfo(),
			
 
				+    });
			
 
				+    // Calculate the amount of tokens displayed on the UI
			
 
				+    const [pooledAmountA, pooledAmountB] = [
			
 
				+      new Decimal(amountA.amount.toString()).div(10 ** mintDecimalsA),
			
 
				+      new Decimal(amountB.amount.toString()).div(10 ** mintDecimalsB),
			
 
				+    ];
			
 
				+    // Get the tickArray address
			
 
				+    const [tickLowerArrayAddress, tickUpperArrayAddress] = [
			
 
				+      TickUtils.getTickArrayAddressByTick(
			
 
				+        new PublicKey(programId),
			
 
				+        new PublicKey(rawPositionInfo.poolId),
			
 
				+        rawPositionInfo.tickLower,
			
 
				+        tickSpacing
			
 
				+      ),
			
 
				+      TickUtils.getTickArrayAddressByTick(
			
 
				+        new PublicKey(programId),
			
 
				+        new PublicKey(rawPositionInfo.poolId),
			
 
				+        rawPositionInfo.tickUpper,
			
 
				+        tickSpacing
			
 
				+      ),
			
 
				+    ];
			
 
				+    // Get the tickArray data
			
 
				+    const tickArrayRes = await this.connection.getMultipleAccountsInfo([tickLowerArrayAddress, tickUpperArrayAddress]);
			
 
				+    if (!tickArrayRes[0] || !tickArrayRes[1]) throw new Error('tick data not found');
			
 
				+
			
 
				+    // Parse as containers (supports both fixed and dynamic tick arrays)
			
 
				+    const tickArrayLowerContainer = TickArrayUtils.parseTickArrayContainer(tickArrayRes[0].data, tickLowerArrayAddress);
			
 
				+    const tickArrayUpperContainer = TickArrayUtils.parseTickArrayContainer(tickArrayRes[1].data, tickUpperArrayAddress);
			
 
				+
			
 
				+    // Get the tick state using container helper
			
 
				+    const tickLowerState = TickArrayUtils.getTickStateFromContainer(
			
 
				+      tickArrayLowerContainer,
			
 
				+      rawPositionInfo.tickLower,
			
 
				+      rawPoolInfo.tickSpacing
			
 
				+    );
			
 
				+    const tickUpperState = TickArrayUtils.getTickStateFromContainer(
			
 
				+      tickArrayUpperContainer,
			
 
				+      rawPositionInfo.tickUpper,
			
 
				+      rawPoolInfo.tickSpacing
			
 
				+    );
			
 
				+
			
 
				+    // Validate tick states
			
 
				+    if (!tickLowerState || !tickUpperState) {
			
 
				+      throw new Error('Tick state not found in tick array');
			
 
				+    }
			
 
				+
			
 
				+    // Calculate the fee (original logic unchanged)
			
 
				+    const tokenFees = PositionUtils.getPositionFees(rawPoolInfo, rawPositionInfo, tickLowerState, tickUpperState);
			
 
				+    // Filter out abnormal fees
			
 
				+    const [tokenFeeAmountA, tokenFeeAmountB] = [
			
 
				+      tokenFees.tokenFeeAmountA.gte(new BN(0)) && tokenFees.tokenFeeAmountA.lt(U64_IGNORE_RANGE)
			
 
				+        ? tokenFees.tokenFeeAmountA
			
 
				+        : new BN(0),
			
 
				+      tokenFees.tokenFeeAmountB.gte(new BN(0)) && tokenFees.tokenFeeAmountB.lt(U64_IGNORE_RANGE)
			
 
				+        ? tokenFees.tokenFeeAmountB
			
 
				+        : new BN(0),
			
 
				+    ];
			
 
				+    return {
			
 
				+      priceLower,
			
 
				+      priceUpper,
			
 
				+      uiPriceLower: priceLower.toFixed(mintDecimalsA),
			
 
				+      uiPriceUpper: priceUpper.toFixed(mintDecimalsB),
			
 
				+      tokenA: {
			
 
				+        address: rawPoolInfo.mintA,
			
 
				+        decimals: rawPoolInfo.mintDecimalsA,
			
 
				+        amount: amountA.amount,
			
 
				+        feeAmount: tokenFeeAmountA,
			
 
				+        uiAmount: pooledAmountA.toString(),
			
 
				+        uiFeeAmount: new Decimal(tokenFeeAmountA.toString())
			
 
				+          .dividedBy(new Decimal(10).pow(mintDecimalsA))
			
 
				+          .toFixed(mintDecimalsA),
			
 
				+      },
			
 
				+      tokenB: {
			
 
				+        address: rawPoolInfo.mintB,
			
 
				+        decimals: rawPoolInfo.mintDecimalsB,
			
 
				+        amount: amountB.amount,
			
 
				+        feeAmount: tokenFeeAmountB,
			
 
				+        uiAmount: pooledAmountB.toString(),
			
 
				+        uiFeeAmount: new Decimal(tokenFeeAmountB.toString())
			
 
				+          .dividedBy(new Decimal(10).pow(mintDecimalsB))
			
 
				+          .toFixed(mintDecimalsB),
			
 
				+      },
			
 
				+      rawPositionInfo,
			
 
				+      rawPoolInfo,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Create position instructions on the chain (does not directly send transactions)
			
 
				+   * @param params Parameters required for creating a position
			
 
				+   * @returns IInstructionReturn Contains instructions, signers, and transaction objects
			
 
				+   */
			
 
				+  public async createPositionInstructions(params: ICreatePositionParams): Promise<IInstructionReturn> {
			
 
				+    const { userAddress, poolInfo, tickLower, tickUpper, base, baseAmount, otherAmountMax, transactionOptions, refererPosition } =
			
 
				+      params;
			
 
				+    const { mintA, mintB } = poolInfo;
			
 
				+
			
 
				+    // Calculate the actual required tokenA/B amount
			
 
				+    const amountA = base === 'MintA' ? baseAmount : otherAmountMax;
			
 
				+    const amountB = base === 'MintB' ? baseAmount : otherAmountMax;
			
 
				+
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA,
			
 
				+      mintB,
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+    });
			
 
				+
			
 
				+    // Generate position creation instructions
			
 
				+    const { instructions: positionInstructions, signers: positionSigners } =
			
 
				+      await Instruction.openPositionFromBaseInstruction({
			
 
				+        poolInfo,
			
 
				+        ownerInfo: {
			
 
				+          feePayer: userAddress,
			
 
				+          wallet: userAddress,
			
 
				+          tokenAccountA,
			
 
				+          tokenAccountB,
			
 
				+        },
			
 
				+        tickLower,
			
 
				+        tickUpper,
			
 
				+        base,
			
 
				+        baseAmount,
			
 
				+        otherAmountMax,
			
 
				+        withMetadata: 'create',
			
 
				+      });
			
 
				+
			
 
				+    // Merge all instructions: ATA creation → pre → position → end
			
 
				+    const instructions = [
			
 
				+      ...preInstructions, // SOL/WSOL handling
			
 
				+      ...positionInstructions, // Position creation
			
 
				+      ...endInstructions, // Cleanup
			
 
				+    ];
			
 
				+
			
 
				+    // Add memo instruction for referer position if provided
			
 
				+    if (refererPosition) {
			
 
				+      const memoText = `referer_position=${refererPosition}`;
			
 
				+      const memoInstruction = new TransactionInstruction({
			
 
				+        programId: MEMO_PROGRAM_ID,
			
 
				+        keys: [{ pubkey: userAddress, isSigner: true, isWritable: false }],
			
 
				+        data: Buffer.from(memoText, 'utf-8'),
			
 
				+      });
			
 
				+      instructions.push(memoInstruction);
			
 
				+    }
			
 
				+
			
 
				+    const signers = [...positionSigners];
			
 
				+
			
 
				+    // Construct transaction object
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+      signers,
			
 
				+      options: transactionOptions,
			
 
				+    });
			
 
				+
			
 
				+    return {
			
 
				+      instructions,
			
 
				+      signers,
			
 
				+      nftAddress: positionSigners[0].publicKey.toString(),
			
 
				+      transaction,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Calculate the rent fee required for creating a position
			
 
				+   *
			
 
				+   * @param params Parameters required for creating a position and options
			
 
				+   */
			
 
				+  public async calculateCreatePositionFee(
			
 
				+    params: ICreatePositionParams & {
			
 
				+      useCache?: boolean; // Whether to use cache, if true, the rent fee will not be recalculated through rpc; default is true
			
 
				+    }
			
 
				+  ): Promise<ICalculateCreatePositionFee> {
			
 
				+    const {
			
 
				+      userAddress,
			
 
				+      poolInfo,
			
 
				+      tickLower,
			
 
				+      tickUpper,
			
 
				+      base,
			
 
				+      baseAmount,
			
 
				+      otherAmountMax,
			
 
				+      transactionOptions,
			
 
				+      useCache = true,
			
 
				+    } = params;
			
 
				+
			
 
				+    const computeUnitPrice = transactionOptions?.computeUnitPrice || DEFAULT_COMPUTE_UNIT_PRICE;
			
 
				+
			
 
				+    // Define account size constants (this is fixed hardcode)
			
 
				+    const ACCOUNT_SIZES = {
			
 
				+      NFT_MINT: 480,
			
 
				+      NFT_HOLDER: 170,
			
 
				+      PERSONAL_POSITION: 281,
			
 
				+      TICK_ARRAY: 10240,
			
 
				+    };
			
 
				+
			
 
				+    const { programId, poolId, tickSpacing } = poolInfo;
			
 
				+    const tickArrayLowerStartIndex = TickUtils.getTickArrayStartIndexByTick(tickLower, tickSpacing);
			
 
				+    const tickArrayUpperStartIndex = TickUtils.getTickArrayStartIndexByTick(tickUpper, tickSpacing);
			
 
				+    const { publicKey: tickArrayLower } = getPdaTickArrayAddress(programId, poolId, tickArrayLowerStartIndex);
			
 
				+    const { publicKey: tickArrayUpper } = getPdaTickArrayAddress(programId, poolId, tickArrayUpperStartIndex);
			
 
				+
			
 
				+    const [
			
 
				+      blockhashData,
			
 
				+      tickArrayLowerInfo,
			
 
				+      tickArrayUpperInfo,
			
 
				+      nftMintRentLamports,
			
 
				+      nftHolderRentLamports,
			
 
				+      personalPositionRentLamports,
			
 
				+      tickArrayRentLamports,
			
 
				+    ] = await Promise.all([
			
 
				+      this.connection.getLatestBlockhash(),
			
 
				+      this.connection.getAccountInfo(tickArrayLower),
			
 
				+      this.connection.getAccountInfo(tickArrayUpper),
			
 
				+      this.estimateRentFee(ACCOUNT_SIZES.NFT_MINT, useCache),
			
 
				+      this.estimateRentFee(ACCOUNT_SIZES.NFT_HOLDER, useCache),
			
 
				+      this.estimateRentFee(ACCOUNT_SIZES.PERSONAL_POSITION, useCache),
			
 
				+      this.estimateRentFee(ACCOUNT_SIZES.TICK_ARRAY, useCache),
			
 
				+    ]);
			
 
				+
			
 
				+    // Check if the tick array exists
			
 
				+    const isTickArrayLowerExists = !!tickArrayLowerInfo;
			
 
				+    const isTickArrayUpperExists = !!tickArrayUpperInfo;
			
 
				+
			
 
				+    // Prepare instructions to estimate compute units
			
 
				+    const { mintA, mintB } = poolInfo;
			
 
				+    const amountA = base === 'MintA' ? baseAmount : otherAmountMax;
			
 
				+    const amountB = base === 'MintB' ? baseAmount : otherAmountMax;
			
 
				+
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA,
			
 
				+      mintB,
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+    });
			
 
				+
			
 
				+    let positionInstructions: TransactionInstruction[] = [];
			
 
				+
			
 
				+    // Try to generate position creation instructions
			
 
				+    try {
			
 
				+      const { instructions } = await Instruction.openPositionFromBaseInstruction({
			
 
				+        poolInfo,
			
 
				+        ownerInfo: {
			
 
				+          feePayer: userAddress,
			
 
				+          wallet: userAddress,
			
 
				+          tokenAccountA,
			
 
				+          tokenAccountB,
			
 
				+        },
			
 
				+        tickLower,
			
 
				+        tickUpper,
			
 
				+        base,
			
 
				+        baseAmount,
			
 
				+        otherAmountMax,
			
 
				+        withMetadata: 'create',
			
 
				+      });
			
 
				+      positionInstructions = instructions;
			
 
				+    } catch {
			
 
				+      // console.error('error ==> ', error);
			
 
				+    }
			
 
				+
			
 
				+    // Estimate compute units and transaction fees
			
 
				+    const computeUnits = await estimateComputeUnits(
			
 
				+      this.connection,
			
 
				+      [...preInstructions, ...positionInstructions, ...endInstructions],
			
 
				+      userAddress,
			
 
				+      blockhashData.blockhash
			
 
				+    );
			
 
				+
			
 
				+    // 1 SOL = 10^9 lamports, 1 lamport = 10^6 microLamports
			
 
				+    const transactionNetFee = (computeUnits * computeUnitPrice) / 10 ** 15;
			
 
				+
			
 
				+    const refundableFees = (nftMintRentLamports + nftHolderRentLamports + personalPositionRentLamports) / 10 ** 9;
			
 
				+
			
 
				+    // Unrefundable fees include transaction fees and newly created shared tick array accounts
			
 
				+    let createTickFee = 0;
			
 
				+
			
 
				+    if (!isTickArrayLowerExists) {
			
 
				+      createTickFee += tickArrayRentLamports / 10 ** 9;
			
 
				+    }
			
 
				+    if (!isTickArrayUpperExists) {
			
 
				+      createTickFee += tickArrayRentLamports / 10 ** 9;
			
 
				+    }
			
 
				+
			
 
				+    return {
			
 
				+      unRefundableFees: transactionNetFee + createTickFee, // Unrefundable fees
			
 
				+      transactionNetFee, // Transaction network fee
			
 
				+      refundableFees, // Refundable fees
			
 
				+      createTickFee, // Create tick array account fee
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Create a new position and send a transaction
			
 
				+   * @param params Parameters required for creating a position, including a signature callback
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async createPosition(params: ParamsWithSignerCallback<ICreatePositionParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.createPositionInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Close the specified position (only when the liquidity is 0, it can be closed)
			
 
				+   * @param params.userAddress User wallet address
			
 
				+   * @param params.nftMint NFT mint address
			
 
				+   * @returns IInstructionReturn Contains instructions and transaction objects
			
 
				+   */
			
 
				+  public async closePositionInstructions(params: IClosePositionParams): Promise<IInstructionReturn> {
			
 
				+    const { userAddress, nftMint } = params;
			
 
				+    // Get position detailed information
			
 
				+    const positionInfo = await this.getPositionInfoByNftMint(nftMint);
			
 
				+    if (!positionInfo) throw new Error('Position not found');
			
 
				+    const mintA = positionInfo.rawPoolInfo.mintA;
			
 
				+    const mintB = positionInfo.rawPoolInfo.mintB;
			
 
				+    // Handle SOL/WSOL packaging
			
 
				+    const { preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA,
			
 
				+      mintB,
			
 
				+    });
			
 
				+    // Generate close position instructions
			
 
				+    const { instructions: closeInstructions } = await Instruction.closePositionInstruction({
			
 
				+      programId: this.programId,
			
 
				+      nftMint,
			
 
				+      ownerWallet: userAddress,
			
 
				+    });
			
 
				+    // Merge all instructions
			
 
				+    const instructions = [...preInstructions, ...closeInstructions, ...endInstructions];
			
 
				+    // Construct transaction object
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+    });
			
 
				+    return {
			
 
				+      instructions,
			
 
				+      transaction,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Close the specified position and send a transaction
			
 
				+   * @param params.userAddress User wallet address
			
 
				+   * @param params.nftMint NFT mint address
			
 
				+   * @param params.signerCallback Signature callback
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async closePosition(params: {
			
 
				+    userAddress: PublicKey;
			
 
				+    nftMint: PublicKey;
			
 
				+    signerCallback: SignerCallback;
			
 
				+  }): Promise<string> {
			
 
				+    const { userAddress, nftMint, signerCallback } = params;
			
 
				+    const { transaction } = await this.closePositionInstructions({
			
 
				+      userAddress,
			
 
				+      nftMint,
			
 
				+    });
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Partially remove position liquidity, generate chain instructions
			
 
				+   * @param params Contains user, position, removed liquidity amount, slippage, etc.
			
 
				+   * @returns IInstructionReturn
			
 
				+   */
			
 
				+  public async decreaseLiquidityInstructions(params: IDecreaseLiquidityParams): Promise<IInstructionReturn> {
			
 
				+    // Slippage is set to 2% by default
			
 
				+    const { userAddress, nftMint, liquidity, slippage = 0.02 } = params;
			
 
				+    // Get position raw information
			
 
				+    const positionInfo = await this.getRawPositionInfoByNftMint(nftMint);
			
 
				+    if (!positionInfo) throw new Error('Position not found');
			
 
				+    // Check if the removed liquidity amount is valid
			
 
				+    if (liquidity.gt(positionInfo.liquidity)) throw new Error('Liquidity is greater than position liquidity');
			
 
				+    // Get pool information
			
 
				+    const poolInfo = await this.getRawPoolInfoByPoolId(positionInfo.poolId);
			
 
				+    // Handle SOL/WSOL packaging
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA: poolInfo.mintA,
			
 
				+      mintB: poolInfo.mintB,
			
 
				+    });
			
 
				+    // Calculate the expected token amount after removing liquidity (considering slippage)
			
 
				+    const { amountSlippageA, amountSlippageB } = PositionUtils.getAmountsFromLiquidity({
			
 
				+      poolInfo,
			
 
				+      ownerPosition: positionInfo,
			
 
				+      liquidity,
			
 
				+      slippage,
			
 
				+      add: false,
			
 
				+      epochInfo: await this.connection.getEpochInfo(),
			
 
				+    });
			
 
				+    // Calculate the minimum accepted token amount
			
 
				+    const amountMinA = amountSlippageA.amount;
			
 
				+    const amountMinB = amountSlippageB.amount;
			
 
				+    // Generate remove liquidity instructions
			
 
				+    const { instructions: decreaseInstructions } = await Instruction.decreaseLiquidityInstructions({
			
 
				+      poolInfo,
			
 
				+      ownerPosition: positionInfo,
			
 
				+      ownerInfo: {
			
 
				+        wallet: userAddress,
			
 
				+        tokenAccountA,
			
 
				+        tokenAccountB,
			
 
				+      },
			
 
				+      liquidity,
			
 
				+      amountMinA,
			
 
				+      amountMinB,
			
 
				+    });
			
 
				+    // Merge all instructions
			
 
				+    const instructions = [...preInstructions, ...decreaseInstructions, ...endInstructions];
			
 
				+    // Construct transaction object
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+    });
			
 
				+    return {
			
 
				+      instructions,
			
 
				+      transaction,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Partially remove position liquidity and send a transaction
			
 
				+   * @param params Contains signature callback, etc.
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async decreaseLiquidity(params: ParamsWithSignerCallback<IDecreaseLiquidityParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.decreaseLiquidityInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Remove all position liquidity (optional to automatically close position)
			
 
				+   * @param params.closePosition Whether to close position automatically
			
 
				+   * @param params Other parameters are the same as decreaseLiquidityInstructions
			
 
				+   * @returns IInstructionReturn
			
 
				+   */
			
 
				+  public async decreaseFullLiquidityInstructions(params: IDecreaseFullLiquidityParams): Promise<IInstructionReturn> {
			
 
				+    // Slippage is set to 2% by default
			
 
				+    const { userAddress, nftMint, closePosition = true, slippage = 0.02 } = params;
			
 
				+    // Get position raw information
			
 
				+    const positionInfo = await this.getRawPositionInfoByNftMint(nftMint);
			
 
				+    if (!positionInfo) throw new Error('Position not found');
			
 
				+    // Get pool information
			
 
				+    const poolInfo = await this.getRawPoolInfoByPoolId(positionInfo.poolId);
			
 
				+    // Handle SOL/WSOL packaging
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA: poolInfo.mintA,
			
 
				+      mintB: poolInfo.mintB,
			
 
				+    });
			
 
				+    // Use all position liquidity
			
 
				+    const liquidity = positionInfo.liquidity;
			
 
				+    // Calculate the expected token amount after removing liquidity (considering slippage)
			
 
				+    const { amountSlippageA, amountSlippageB } = PositionUtils.getAmountsFromLiquidity({
			
 
				+      poolInfo,
			
 
				+      ownerPosition: positionInfo,
			
 
				+      liquidity,
			
 
				+      slippage,
			
 
				+      add: false, // When reducing liquidity, set to false
			
 
				+      epochInfo: await this.connection.getEpochInfo(),
			
 
				+    });
			
 
				+    // Minimum token amount after slippage adjustment
			
 
				+    const amountMinA = amountSlippageA.amount;
			
 
				+    const amountMinB = amountSlippageB.amount;
			
 
				+    // Generate remove liquidity instructions
			
 
				+    const { instructions: decreaseInstructions } = await Instruction.decreaseLiquidityInstructions({
			
 
				+      poolInfo,
			
 
				+      ownerPosition: positionInfo,
			
 
				+      ownerInfo: {
			
 
				+        wallet: userAddress,
			
 
				+        tokenAccountA,
			
 
				+        tokenAccountB,
			
 
				+      },
			
 
				+      liquidity,
			
 
				+      amountMinA,
			
 
				+      amountMinB,
			
 
				+    });
			
 
				+    // Merge all instructions
			
 
				+    const instructions = [...preInstructions, ...decreaseInstructions, ...endInstructions];
			
 
				+    // If you need to close the position, append the close instruction
			
 
				+    if (closePosition) {
			
 
				+      const { instructions: closeInstructions } = await Instruction.closePositionInstruction({
			
 
				+        programId: this.programId,
			
 
				+        nftMint,
			
 
				+        ownerWallet: userAddress,
			
 
				+      });
			
 
				+      instructions.push(...closeInstructions);
			
 
				+    }
			
 
				+    // Construct transaction object
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+    });
			
 
				+    return {
			
 
				+      instructions,
			
 
				+      transaction,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Remove all position liquidity and send a transaction
			
 
				+   * @param params Contains signature callback, etc.
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async decreaseFullLiquidity(params: ParamsWithSignerCallback<IDecreaseFullLiquidityParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.decreaseFullLiquidityInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Collect fees for a single position (essentially removing 0 liquidity)
			
 
				+   * @param params Contains user, position, etc.
			
 
				+   * @returns IInstructionReturn
			
 
				+   */
			
 
				+  public async collectFeesInstructions(params: ICollectFeesParams): Promise<IInstructionReturn> {
			
 
				+    const { userAddress, nftMint } = params;
			
 
				+    // Reuse the decreaseLiquidity function, pass in liquidity as 0
			
 
				+    return await this.decreaseLiquidityInstructions({
			
 
				+      userAddress,
			
 
				+      nftMint,
			
 
				+      liquidity: new BN(0),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Collect fees for all positions of a user, automatically batch to avoid exceeding transaction size limit
			
 
				+   * @param params.userAddress User wallet address
			
 
				+   * @param params.nftMintList NFT mint list
			
 
				+   * @returns { instructionsList, transactions } Batch instructions and transaction objects
			
 
				+   */
			
 
				+  public async collectAllPositionFeesInstructions(params: ICollectAllFeesParams): Promise<{
			
 
				+    instructionsList: TransactionInstruction[][];
			
 
				+    transactions: VersionedTransaction[];
			
 
				+  }> {
			
 
				+    const { userAddress, nftMintList } = params;
			
 
				+    // Cache pool information to avoid duplicate requests
			
 
				+    const poolInfoMap: Map<string, IPoolLayoutWithId> = new Map();
			
 
				+    const allInstructions: TransactionInstruction[][] = [];
			
 
				+    // let currentInstructions: TransactionInstruction[] = [];
			
 
				+    // Get rent exemption lamports
			
 
				+    const rentExemptLamports = await this.estimateRentFee(AccountLayout.span);
			
 
				+    for (const nftMint of nftMintList) {
			
 
				+      try {
			
 
				+        const positionInfo = await this.getRawPositionInfoByNftMint(nftMint);
			
 
				+        if (!positionInfo) throw new Error(`Position not found: ${nftMint.toBase58()}`);
			
 
				+        const poolId = positionInfo.poolId.toBase58();
			
 
				+        // Get or cache pool information
			
 
				+        if (!poolInfoMap.has(poolId)) {
			
 
				+          poolInfoMap.set(poolId, await this.getRawPoolInfoByPoolId(positionInfo.poolId));
			
 
				+        }
			
 
				+        const poolInfo = poolInfoMap.get(poolId);
			
 
				+        if (!poolInfo) throw new Error(`Pool not found: ${poolId}`);
			
 
				+        // Handle SOL/WSOL related
			
 
				+        const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+          userAddress,
			
 
				+          mintA: poolInfo.mintA,
			
 
				+          mintB: poolInfo.mintB,
			
 
				+          rentExemptLamports,
			
 
				+        });
			
 
				+        // Generate instructions to collect fees (essentially removing 0 liquidity)
			
 
				+        const { instructions: decreaseInstructions } = await Instruction.decreaseLiquidityInstructions({
			
 
				+          poolInfo,
			
 
				+          ownerPosition: positionInfo,
			
 
				+          ownerInfo: {
			
 
				+            wallet: userAddress,
			
 
				+            tokenAccountA,
			
 
				+            tokenAccountB,
			
 
				+          },
			
 
				+          liquidity: new BN(0),
			
 
				+          amountMinA: new BN(0),
			
 
				+          amountMinB: new BN(0),
			
 
				+        });
			
 
				+        // All instructions for the current NFT
			
 
				+        const nftInstructions = [...preInstructions, ...decreaseInstructions, ...endInstructions];
			
 
				+
			
 
				+        // Check if adding this NFT's instructions will exceed the transaction size limit
			
 
				+        // const tempInstructions = [...currentInstructions, ...nftInstructions];
			
 
				+        // const isValidSize = checkV0TxSize({
			
 
				+        //   instructions: tempInstructions,
			
 
				+        //   payer: userAddress,
			
 
				+        // });
			
 
				+        // if (!isValidSize && currentInstructions.length > 0) {
			
 
				+        // If adding will exceed the limit and there are existing instructions, save the current batch and start a new batch
			
 
				+        allInstructions.push(nftInstructions);
			
 
				+        // currentInstructions = nftInstructions;
			
 
				+        // } else {
			
 
				+        //   // If it doesn't exceed the limit or the current batch is empty, add to the current batch
			
 
				+        //   currentInstructions.push(...nftInstructions);
			
 
				+        // }
			
 
				+      } catch (error) {
			
 
				+        console.error('[collectAllPositionFeesInstructions] Collect position fees failed:', {
			
 
				+          nftMint: nftMint.toBase58(),
			
 
				+          error,
			
 
				+        });
			
 
				+      }
			
 
				+    }
			
 
				+    // Ensure the last batch of instructions is also added
			
 
				+    // if (currentInstructions.length > 0) {
			
 
				+    //   allInstructions.push(currentInstructions);
			
 
				+    // }
			
 
				+    // Create a transaction for each batch of instructions
			
 
				+    const transactions: VersionedTransaction[] = [];
			
 
				+    for (const instructions of allInstructions) {
			
 
				+      try {
			
 
				+        const transaction = await makeTransaction({
			
 
				+          connection: this.connection,
			
 
				+          payerPublicKey: userAddress,
			
 
				+          instructions,
			
 
				+        });
			
 
				+        transactions.push(transaction);
			
 
				+      } catch (error) {
			
 
				+        console.error('[collectAllPositionFeesInstructions] Create transaction failed:', error);
			
 
				+      }
			
 
				+    }
			
 
				+    return { instructionsList: allInstructions, transactions };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Collect fees for a single position and send a transaction
			
 
				+   * @param params Contains signature callback, etc.
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async collectFees(params: ParamsWithSignerCallback<ICollectFeesParams>): Promise<string> {
			
 
				+    try {
			
 
				+      const { signerCallback } = params;
			
 
				+      const { transaction } = await this.collectFeesInstructions(params);
			
 
				+      return await sendTransaction({
			
 
				+        connection: this.connection,
			
 
				+        signTx: async () => await signerCallback(transaction),
			
 
				+      });
			
 
				+    } catch (error) {
			
 
				+      console.warn('collectFees failed:', error);
			
 
				+      throw error;
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Add liquidity to an existing position, generate chain instructions
			
 
				+   * @param params Contains user, position, liquidity amount, etc.
			
 
				+   * @returns IInstructionReturn
			
 
				+   */
			
 
				+  public async addLiquidityInstructions(params: IAddLiquidityParams): Promise<IInstructionReturn> {
			
 
				+    const { userAddress, nftMint, base, baseAmount, otherAmountMax, computeBudgetOptions = {} } = params;
			
 
				+    // Get position raw information
			
 
				+    const ownerPosition = await this.getRawPositionInfoByNftMint(nftMint);
			
 
				+    if (!ownerPosition) throw new Error('Position not found');
			
 
				+    // Get pool information
			
 
				+    const poolInfo = await this.getRawPoolInfoByPoolId(ownerPosition.poolId);
			
 
				+    // Calculate the required amount
			
 
				+    const amountA = base === 'MintA' ? baseAmount : otherAmountMax;
			
 
				+    const amountB = base === 'MintB' ? baseAmount : otherAmountMax;
			
 
				+    // Handle SOL/WSOL packaging
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA: poolInfo.mintA,
			
 
				+      mintB: poolInfo.mintB,
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+    });
			
 
				+    // Generate add liquidity instructions
			
 
				+    const { instructions: increaseInstructions } = await Instruction.increasePositionFromBaseInstructions({
			
 
				+      poolInfo,
			
 
				+      ownerPosition,
			
 
				+      ownerInfo: {
			
 
				+        wallet: userAddress,
			
 
				+        tokenAccountA,
			
 
				+        tokenAccountB,
			
 
				+      },
			
 
				+      base,
			
 
				+      baseAmount,
			
 
				+      otherAmountMax,
			
 
				+    });
			
 
				+    // Merge all instructions
			
 
				+    const instructions = [...preInstructions, ...increaseInstructions, ...endInstructions];
			
 
				+    // Construct transaction object
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+      options: {
			
 
				+        ...computeBudgetOptions,
			
 
				+      },
			
 
				+    });
			
 
				+    return {
			
 
				+      instructions,
			
 
				+      transaction,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Add liquidity to an existing position and send a transaction
			
 
				+   * @param params Contains signature callback, etc.
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async addLiquidity(params: ParamsWithSignerCallback<IAddLiquidityParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.addLiquidityInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Create pool instructions
			
 
				+   * @param params Create pool parameters
			
 
				+   * @returns IInstructionReturn
			
 
				+   */
			
 
				+  public async createPoolInstructions(params: ICreatePoolParams): Promise<IInstructionReturn> {
			
 
				+    const { userAddress, poolManager, openTime, mintA, mintB, ammConfigId, initialPrice } = params;
			
 
				+    // Convert price to BN format
			
 
				+    const initialPriceDecimal = new Decimal(initialPrice);
			
 
				+    const initialPriceX64 = SqrtPriceMath.priceToSqrtPriceX64(initialPriceDecimal, mintA.decimals, mintB.decimals);
			
 
				+    const mintAAddress = new PublicKey(mintA.address);
			
 
				+    const mintBAddress = new PublicKey(mintB.address);
			
 
				+    // Handle Token-2022 extension account
			
 
				+    const extendMintAccount: PublicKey[] = [];
			
 
				+    const fetchAccounts: PublicKey[] = [];
			
 
				+    if (mintA.programId === TOKEN_2022_PROGRAM_ID.toBase58()) {
			
 
				+      fetchAccounts.push(getPdaMintExAccount(this.programId, mintAAddress).publicKey);
			
 
				+    }
			
 
				+    if (mintB.programId === TOKEN_2022_PROGRAM_ID.toBase58()) {
			
 
				+      fetchAccounts.push(getPdaMintExAccount(this.programId, mintBAddress).publicKey);
			
 
				+    }
			
 
				+
			
 
				+    // Verify account existence
			
 
				+    if (fetchAccounts.length > 0) {
			
 
				+      const extMintRes = await this.connection.getMultipleAccountsInfo(fetchAccounts);
			
 
				+      extMintRes.forEach((r, idx) => {
			
 
				+        if (r) extendMintAccount.push(fetchAccounts[idx]);
			
 
				+      });
			
 
				+    }
			
 
				+
			
 
				+    // Generate pool creation instructions
			
 
				+    const { instructions } = await Instruction.createPoolInstruction({
			
 
				+      programId: this.programId,
			
 
				+      owner: userAddress,
			
 
				+      poolManager,
			
 
				+      mintA,
			
 
				+      mintB,
			
 
				+      ammConfigId,
			
 
				+      initialPriceX64,
			
 
				+      openTime,
			
 
				+      extendMintAccount,
			
 
				+    });
			
 
				+    // Construct transaction object
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+    });
			
 
				+    return {
			
 
				+      instructions,
			
 
				+      transaction,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Create a new pool and send a transaction
			
 
				+   * @param params Contains signature callback, etc.
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async createPool(params: ParamsWithSignerCallback<ICreatePoolParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.createPoolInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  public async qouteSwap(params: IQouteSwapParams): Promise<IQouteSwapReturn> {
			
 
				+    // Slippage is set to 2% by default
			
 
				+    const {
			
 
				+      poolInfo,
			
 
				+      inputTokenMint,
			
 
				+      amountIn,
			
 
				+      priceLimit = new Decimal(0),
			
 
				+      slippage = 0.02,
			
 
				+      catchLiquidityInsufficient,
			
 
				+    } = params;
			
 
				+
			
 
				+    let sqrtPriceLimitX64: BN;
			
 
				+    const isInputMintA = inputTokenMint.toBase58() === poolInfo.mintA.toBase58();
			
 
				+
			
 
				+    // TODO: Consider fee calculation for token2022 in the future
			
 
				+
			
 
				+    if (priceLimit.equals(new Decimal(0))) {
			
 
				+      sqrtPriceLimitX64 = isInputMintA ? MIN_SQRT_PRICE_X64.add(new BN(1)) : MAX_SQRT_PRICE_X64.sub(new BN(1));
			
 
				+    } else {
			
 
				+      sqrtPriceLimitX64 = SqrtPriceMath.priceToSqrtPriceX64(priceLimit, poolInfo.mintDecimalsA, poolInfo.mintDecimalsB);
			
 
				+    }
			
 
				+
			
 
				+    const exBitmapInfo = await getTickArrayBitmapExtension(this.programId, poolInfo.poolId, this.connection);
			
 
				+
			
 
				+    const ammConfig = await RawDataUtils.getRawAmmConfigByConfigId({
			
 
				+      connection: this.connection,
			
 
				+      configId: poolInfo.ammConfig,
			
 
				+    });
			
 
				+
			
 
				+    const tickArrayInfo = await getTickArrayInfo({
			
 
				+      connection: this.connection,
			
 
				+      poolInfo,
			
 
				+      exBitmapInfo,
			
 
				+    });
			
 
				+
			
 
				+    if (!exBitmapInfo || !ammConfig) throw new Error('Failed to get tick array bitmap extension or amm config');
			
 
				+
			
 
				+    const { allTrade, expectedAmountOut, remainingAccounts, executionPrice, feeAmount } =
			
 
				+      await PoolUtils.getOutputAmountAndRemainAccounts({
			
 
				+        poolInfo,
			
 
				+        exBitmapInfo,
			
 
				+        ammConfig,
			
 
				+        tickArrayInfo,
			
 
				+        inputTokenMint,
			
 
				+        inputAmount: amountIn,
			
 
				+        sqrtPriceLimitX64,
			
 
				+        catchLiquidityInsufficient,
			
 
				+      });
			
 
				+
			
 
				+    const minAmountOut = expectedAmountOut
			
 
				+      .mul(new BN(Math.floor((1 - slippage) * 10000000000)))
			
 
				+      .div(new BN(10000000000));
			
 
				+
			
 
				+    return {
			
 
				+      allTrade,
			
 
				+      isInputMintA,
			
 
				+      amountIn,
			
 
				+      expectedAmountOut,
			
 
				+      minAmountOut,
			
 
				+      remainingAccounts,
			
 
				+      executionPrice,
			
 
				+      feeAmount,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  public async swapInstructions(params: ISwapParams): Promise<IInstructionReturn> {
			
 
				+    const { poolInfo, quoteReturn, userAddress } = params;
			
 
				+
			
 
				+    // Determine amounts based on which token is input
			
 
				+    const amountA = quoteReturn.isInputMintA ? quoteReturn.amountIn : new BN(0);
			
 
				+    const amountB = !quoteReturn.isInputMintA ? quoteReturn.amountIn : new BN(0);
			
 
				+
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA: poolInfo.mintA,
			
 
				+      mintB: poolInfo.mintB,
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+    });
			
 
				+
			
 
				+    const exBitmapAddress = getPdaExBitmapAccount(poolInfo.programId, poolInfo.poolId).publicKey;
			
 
				+
			
 
				+    // quoteReturn.isBaseIn
			
 
				+    const { instructions: swapInstruction } = await Instruction.swapBaseInInstruction({
			
 
				+      poolInfo,
			
 
				+      ownerInfo: {
			
 
				+        wallet: userAddress,
			
 
				+        tokenAccountA,
			
 
				+        tokenAccountB,
			
 
				+      },
			
 
				+      amount: quoteReturn.amountIn,
			
 
				+      // The minimum output amount after slippage calculation is passed here
			
 
				+      otherAmountThreshold: quoteReturn.minAmountOut,
			
 
				+      sqrtPriceLimitX64: quoteReturn.executionPrice,
			
 
				+      isInputMintA: quoteReturn.isInputMintA,
			
 
				+      tickArray: quoteReturn.remainingAccounts,
			
 
				+      exTickArrayBitmap: exBitmapAddress,
			
 
				+    });
			
 
				+
			
 
				+    const instructions = [...preInstructions, ...swapInstruction, ...endInstructions];
			
 
				+
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+    });
			
 
				+
			
 
				+    return {
			
 
				+      transaction,
			
 
				+      instructions,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Create swap exact out instructions
			
 
				+   * @param params Contains pool info, quote return, and user address
			
 
				+   * @returns IInstructionReturn
			
 
				+   */
			
 
				+  public async swapExactOutInstructions(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    quoteReturn: IQuoteSwapExactOutReturn;
			
 
				+    userAddress: PublicKey;
			
 
				+  }): Promise<IInstructionReturn> {
			
 
				+    const { poolInfo, quoteReturn, userAddress } = params;
			
 
				+
			
 
				+    // For exact output, we need to determine input amounts
			
 
				+    // If outputting tokenA, we input tokenB
			
 
				+    // If outputting tokenB, we input tokenA
			
 
				+    const isInputMintA = !quoteReturn.isOutputMintA;
			
 
				+    const amountA = isInputMintA ? quoteReturn.maxAmountIn : new BN(0);
			
 
				+    const amountB = !isInputMintA ? quoteReturn.maxAmountIn : new BN(0);
			
 
				+
			
 
				+    const { tokenAccountA, tokenAccountB, preInstructions, endInstructions } = await this.handleTokenAccount({
			
 
				+      userAddress,
			
 
				+      mintA: poolInfo.mintA,
			
 
				+      mintB: poolInfo.mintB,
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+    });
			
 
				+
			
 
				+    const exBitmapAddress = getPdaExBitmapAccount(poolInfo.programId, poolInfo.poolId).publicKey;
			
 
				+
			
 
				+    // For exact output, we need to use swapBaseOutInstruction
			
 
				+    const { instructions: swapInstruction } = await Instruction.swapBaseOutInstruction({
			
 
				+      poolInfo,
			
 
				+      ownerInfo: {
			
 
				+        wallet: userAddress,
			
 
				+        tokenAccountA,
			
 
				+        tokenAccountB,
			
 
				+      },
			
 
				+      amount: quoteReturn.amountOut,
			
 
				+      // The maximum input amount (including slippage) is passed here
			
 
				+      otherAmountThreshold: quoteReturn.maxAmountIn,
			
 
				+      sqrtPriceLimitX64: quoteReturn.executionPrice,
			
 
				+      isOutputMintA: quoteReturn.isOutputMintA,
			
 
				+      tickArray: quoteReturn.remainingAccounts,
			
 
				+      exTickArrayBitmap: exBitmapAddress,
			
 
				+    });
			
 
				+
			
 
				+    const instructions = [...preInstructions, ...swapInstruction, ...endInstructions];
			
 
				+
			
 
				+    const transaction = await makeTransaction({
			
 
				+      connection: this.connection,
			
 
				+      payerPublicKey: userAddress,
			
 
				+      instructions,
			
 
				+    });
			
 
				+
			
 
				+    return {
			
 
				+      transaction,
			
 
				+      instructions,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  public async swap(params: ParamsWithSignerCallback<ISwapParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.swapInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Execute swap exact out transaction
			
 
				+   * @param params Contains signature callback, etc.
			
 
				+   * @returns Promise<string> Transaction signature
			
 
				+   */
			
 
				+  public async swapExactOut(params: ParamsWithSignerCallback<ISwapExactOutParams>): Promise<string> {
			
 
				+    const { signerCallback } = params;
			
 
				+    const { transaction } = await this.swapExactOutInstructions(params);
			
 
				+    return sendTransaction({
			
 
				+      connection: this.connection,
			
 
				+      signTx: () => signerCallback(transaction),
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Quote swap exact output - calculate required input amount for desired output
			
 
				+   * @param params Quote parameters including output amount and slippage
			
 
				+   * @returns Quote result with expected input amount and other swap details
			
 
				+   */
			
 
				+  public async quoteSwapExactOut(params: IQuoteSwapExactOutParams): Promise<IQuoteSwapExactOutReturn> {
			
 
				+    const {
			
 
				+      poolInfo,
			
 
				+      outputTokenMint,
			
 
				+      amountOut,
			
 
				+      priceLimit = new Decimal(0),
			
 
				+      slippage = 0.02,
			
 
				+      catchLiquidityInsufficient,
			
 
				+    } = params;
			
 
				+
			
 
				+    let sqrtPriceLimitX64: BN;
			
 
				+    const isOutputMintA = outputTokenMint.toBase58() === poolInfo.mintA.toBase58();
			
 
				+
			
 
				+    // For exact output, we need to determine if we're inputting token A or B
			
 
				+    // If outputting A, we input B (zeroForOne = false)
			
 
				+    // If outputting B, we input A (zeroForOne = true)
			
 
				+    const zeroForOne = !isOutputMintA;
			
 
				+
			
 
				+    if (priceLimit.equals(new Decimal(0))) {
			
 
				+      sqrtPriceLimitX64 = zeroForOne ? MIN_SQRT_PRICE_X64.add(new BN(1)) : MAX_SQRT_PRICE_X64.sub(new BN(1));
			
 
				+    } else {
			
 
				+      sqrtPriceLimitX64 = SqrtPriceMath.priceToSqrtPriceX64(priceLimit, poolInfo.mintDecimalsA, poolInfo.mintDecimalsB);
			
 
				+    }
			
 
				+
			
 
				+    const exBitmapInfo = await getTickArrayBitmapExtension(this.programId, poolInfo.poolId, this.connection);
			
 
				+
			
 
				+    const ammConfig = await RawDataUtils.getRawAmmConfigByConfigId({
			
 
				+      connection: this.connection,
			
 
				+      configId: poolInfo.ammConfig,
			
 
				+    });
			
 
				+
			
 
				+    const tickArrayInfo = await getTickArrayInfo({
			
 
				+      connection: this.connection,
			
 
				+      poolInfo,
			
 
				+      exBitmapInfo,
			
 
				+    });
			
 
				+
			
 
				+    if (!exBitmapInfo || !ammConfig) throw new Error('Failed to get tick array bitmap extension or amm config');
			
 
				+
			
 
				+    const { allTrade, expectedAmountIn, remainingAccounts, executionPrice, feeAmount } =
			
 
				+      await PoolUtils.getInputAmountAndRemainAccounts({
			
 
				+        poolInfo,
			
 
				+        exBitmapInfo,
			
 
				+        ammConfig,
			
 
				+        tickArrayInfo,
			
 
				+        outputTokenMint,
			
 
				+        outputAmount: amountOut,
			
 
				+        sqrtPriceLimitX64,
			
 
				+        catchLiquidityInsufficient,
			
 
				+      });
			
 
				+
			
 
				+    // For exact output, we calculate max input amount with slippage
			
 
				+    // This is the maximum amount user is willing to pay
			
 
				+    const maxAmountIn = expectedAmountIn.mul(new BN(Math.ceil((1 + slippage) * 10000000000))).div(new BN(10000000000));
			
 
				+
			
 
				+    return {
			
 
				+      allTrade,
			
 
				+      isOutputMintA,
			
 
				+      amountOut,
			
 
				+      expectedAmountIn,
			
 
				+      maxAmountIn,
			
 
				+      remainingAccounts,
			
 
				+      executionPrice,
			
 
				+      feeAmount,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Handle SOL/WSOL packaging logic, automatically generate related instructions
			
 
				+   *
			
 
				+   * @param params.userAddress User wallet address
			
 
				+   * @param params.mintA Pool tokenA mint
			
 
				+   * @param params.mintB Pool tokenB mint
			
 
				+   * @param params.amountA Optional, tokenA quantity
			
 
				+   * @param params.amountB Optional, tokenB quantity
			
 
				+   * @param params.rentExemptLamports Optional, WSOL account rent exemption lamports
			
 
				+   * @returns tokenAccountA/B, pre-instructions, post-instructions
			
 
				+   */
			
 
				+  private async handleTokenAccount(params: {
			
 
				+    userAddress: PublicKey;
			
 
				+    mintA: PublicKey;
			
 
				+    mintB: PublicKey;
			
 
				+    amountA?: BN;
			
 
				+    amountB?: BN;
			
 
				+    rentExemptLamports?: number;
			
 
				+  }): Promise<{
			
 
				+    tokenAccountA: PublicKey;
			
 
				+    tokenAccountB: PublicKey;
			
 
				+    tokenProgramIdA: PublicKey;
			
 
				+    tokenProgramIdB: PublicKey;
			
 
				+    preInstructions: TransactionInstruction[];
			
 
				+    endInstructions: TransactionInstruction[];
			
 
				+  }> {
			
 
				+    const { userAddress, mintA, mintB, amountA, amountB } = params;
			
 
				+    // Check if there is SOL involved
			
 
				+    const isTokenASOL = mintA.toString() === NATIVE_MINT.toString();
			
 
				+    const isTokenBSOL = mintB.toString() === NATIVE_MINT.toString();
			
 
				+    // Default to use ATA account
			
 
				+    const tokenProgramIdA = await getTokenProgramId(this.connection, mintA);
			
 
				+    const tokenProgramIdB = await getTokenProgramId(this.connection, mintB);
			
 
				+    let tokenAccountA = getATAAddress(userAddress, mintA, tokenProgramIdA).publicKey;
			
 
				+    let tokenAccountB = getATAAddress(userAddress, mintB, tokenProgramIdB).publicKey;
			
 
				+    const preInstructions: TransactionInstruction[] = [];
			
 
				+    const endInstructions: TransactionInstruction[] = [];
			
 
				+
			
 
				+    if (!isTokenASOL) {
			
 
				+      const accA = await this.connection.getAccountInfo(tokenAccountA);
			
 
				+      if (!accA) {
			
 
				+        preInstructions.push(
			
 
				+          createAssociatedTokenAccountIdempotentInstruction(
			
 
				+            userAddress,
			
 
				+            tokenAccountA,
			
 
				+            userAddress,
			
 
				+            mintA,
			
 
				+            tokenProgramIdA
			
 
				+          )
			
 
				+        );
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    if (!isTokenBSOL) {
			
 
				+      const accB = await this.connection.getAccountInfo(tokenAccountB);
			
 
				+      if (!accB) {
			
 
				+        preInstructions.push(
			
 
				+          createAssociatedTokenAccountIdempotentInstruction(
			
 
				+            userAddress,
			
 
				+            tokenAccountB,
			
 
				+            userAddress,
			
 
				+            mintB,
			
 
				+            tokenProgramIdB
			
 
				+          )
			
 
				+        );
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    if (!isTokenASOL && !isTokenBSOL) {
			
 
				+      return { tokenAccountA, tokenAccountB, preInstructions, endInstructions, tokenProgramIdA, tokenProgramIdB };
			
 
				+    }
			
 
				+    // Handle SOL -> WSOL packaging
			
 
				+    if (isTokenASOL || isTokenBSOL) {
			
 
				+      const newAccount = generatePubKey({
			
 
				+        fromPublicKey: userAddress,
			
 
				+        programId: TOKEN_PROGRAM_ID,
			
 
				+      });
			
 
				+      const wsolAccount = newAccount.publicKey;
			
 
				+      const rentExemptLamports = params.rentExemptLamports || (await this.estimateRentFee(AccountLayout.span));
			
 
				+      // Calculate how much SOL is needed
			
 
				+      let amountNeeded = 0;
			
 
				+      if (isTokenASOL && amountA) {
			
 
				+        amountNeeded = amountA.toNumber();
			
 
				+      } else if (isTokenBSOL && amountB) {
			
 
				+        amountNeeded = amountB.toNumber();
			
 
				+      }
			
 
				+
			
 
				+      // Create WSOL account
			
 
				+      preInstructions.push(
			
 
				+        SystemProgram.createAccountWithSeed({
			
 
				+          fromPubkey: userAddress,
			
 
				+          basePubkey: userAddress,
			
 
				+          seed: newAccount.seed,
			
 
				+          newAccountPubkey: wsolAccount,
			
 
				+          space: AccountLayout.span,
			
 
				+          lamports: rentExemptLamports + amountNeeded,
			
 
				+          programId: TOKEN_PROGRAM_ID,
			
 
				+        })
			
 
				+      );
			
 
				+      // Initialize WSOL account
			
 
				+      preInstructions.push(createInitializeAccountInstruction(wsolAccount, NATIVE_MINT, userAddress));
			
 
				+      // Add instructions to close WSOL account
			
 
				+      endInstructions.push(createCloseAccountInstruction(wsolAccount, userAddress, userAddress, []));
			
 
				+      // Update the corresponding token account
			
 
				+      if (isTokenASOL) {
			
 
				+        tokenAccountA = wsolAccount;
			
 
				+      }
			
 
				+      if (isTokenBSOL) {
			
 
				+        tokenAccountB = wsolAccount;
			
 
				+      }
			
 
				+    }
			
 
				+    return { tokenAccountA, tokenAccountB, preInstructions, endInstructions, tokenProgramIdA, tokenProgramIdB };
			
 
				+  }
			
 
				+
			
 
				+  private async estimateRentFee(space: number, useCache = true): Promise<number> {
			
 
				+    if (useCache && this.rentFeeCache[space] !== undefined) {
			
 
				+      return this.rentFeeCache[space];
			
 
				+    }
			
 
				+    const lamports = await this.connection.getMinimumBalanceForRentExemption(space);
			
 
				+    this.rentFeeCache[space] = lamports;
			
 
				+    return lamports;
			
 
				+  }
			
 
				+
			
 
				+  public calculateApr = calculateApr;
			
 
				+  public calculateRewardApr = calculateRewardApr;
			
 
				+  public calculateRangeAprs = calculateRangeAprs;
			
 
				+  public alignPriceToTickPrice = alignPriceToTickPrice;
			
 
				+  public getAmountBFromAmountA = getAmountBFromAmountA;
			
 
				+  public getAmountAFromAmountB = getAmountAFromAmountB;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/chain/models.ts
+++ b/src/lib/clmm-sdk/src/client/chain/models.ts
@@ -0,0 +1,178 @@
 
				+import { PublicKey, Signer, TransactionInstruction, VersionedTransaction } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import {
			
 
				+  IPersonalPositionLayout,
			
 
				+  IPoolLayoutWithId,
			
 
				+  ITokenInfo,
			
 
				+  TickArrayBitmapExtensionType,
			
 
				+} from '../../instructions/index.js';
			
 
				+import { IMakeTransactionOptions } from '../../utils/index.js';
			
 
				+
			
 
				+export type SignerCallback = (transaction: VersionedTransaction) => Promise<VersionedTransaction>;
			
 
				+
			
 
				+export type ParamsWithSignerCallback<T> = T & {
			
 
				+  signerCallback: SignerCallback;
			
 
				+};
			
 
				+
			
 
				+export interface IInstructionReturn {
			
 
				+  instructions: TransactionInstruction[];
			
 
				+  signers?: Signer[];
			
 
				+  transaction: VersionedTransaction;
			
 
				+  nftAddress?: string;
			
 
				+}
			
 
				+
			
 
				+export interface ICreatePositionParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  poolInfo: IPoolLayoutWithId;
			
 
				+  tickLower: number;
			
 
				+  tickUpper: number;
			
 
				+  base: 'MintA' | 'MintB';
			
 
				+  baseAmount: BN;
			
 
				+  otherAmountMax: BN;
			
 
				+  transactionOptions?: IMakeTransactionOptions;
			
 
				+  refererPosition?: PublicKey;
			
 
				+}
			
 
				+
			
 
				+export interface IClosePositionParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  nftMint: PublicKey;
			
 
				+}
			
 
				+
			
 
				+export interface IDecreaseLiquidityParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  nftMint: PublicKey;
			
 
				+  liquidity: BN;
			
 
				+  slippage?: number;
			
 
				+}
			
 
				+
			
 
				+export interface IDecreaseFullLiquidityParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  nftMint: PublicKey;
			
 
				+  closePosition?: boolean;
			
 
				+  slippage?: number;
			
 
				+}
			
 
				+
			
 
				+export interface IAddLiquidityParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  nftMint: PublicKey;
			
 
				+  base: 'MintA' | 'MintB';
			
 
				+  baseAmount: BN;
			
 
				+  otherAmountMax: BN;
			
 
				+  computeBudgetOptions?: IComputeBudgetOptions;
			
 
				+}
			
 
				+
			
 
				+export interface ICreatePoolParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  poolManager: PublicKey;
			
 
				+  mintA: ITokenInfo;
			
 
				+  mintB: ITokenInfo;
			
 
				+  ammConfigId: PublicKey;
			
 
				+  initialPrice: number;
			
 
				+  openTime?: BN;
			
 
				+  computeBudgetOptions?: IComputeBudgetOptions;
			
 
				+}
			
 
				+
			
 
				+export interface ICollectFeesParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  nftMint: PublicKey;
			
 
				+}
			
 
				+
			
 
				+export interface ICollectAllFeesParams {
			
 
				+  userAddress: PublicKey;
			
 
				+  nftMintList: PublicKey[];
			
 
				+}
			
 
				+
			
 
				+export interface IGetPositionInfoByNftMintReturn {
			
 
				+  priceLower: Decimal;
			
 
				+  priceUpper: Decimal;
			
 
				+  uiPriceLower: string;
			
 
				+  uiPriceUpper: string;
			
 
				+  tokenA: {
			
 
				+    address: PublicKey;
			
 
				+    decimals: number;
			
 
				+    amount: BN;
			
 
				+    feeAmount: BN;
			
 
				+    uiAmount: string;
			
 
				+    uiFeeAmount: string;
			
 
				+  };
			
 
				+  tokenB: {
			
 
				+    address: PublicKey;
			
 
				+    decimals: number;
			
 
				+    amount: BN;
			
 
				+    feeAmount: BN;
			
 
				+    uiAmount: string;
			
 
				+    uiFeeAmount: string;
			
 
				+  };
			
 
				+  rawPositionInfo: IPersonalPositionLayout;
			
 
				+  rawPoolInfo: IPoolLayoutWithId;
			
 
				+}
			
 
				+
			
 
				+export interface ICalculateCreatePositionFee {
			
 
				+  transactionNetFee: number; // Transaction fee
			
 
				+  refundableFees: number; // Refundable fees (NFT minting fee + NFT holder fee + personal position fee)
			
 
				+  unRefundableFees: number; // Unrefundable fees (Newly created tick array account + transaction fee)
			
 
				+
			
 
				+  createTickFee: number; // Create tick array account fee
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * maxFee and exactFee are mutually exclusive
			
 
				+ */
			
 
				+export type IComputeBudgetOptions =
			
 
				+  | { maxFee: number; exactFee?: never; computeUnitPrice?: number }
			
 
				+  | { maxFee?: never; exactFee: number; computeUnitPrice?: never }
			
 
				+  | { maxFee?: undefined; exactFee?: undefined; computeUnitPrice?: number };
			
 
				+
			
 
				+export interface IQouteSwapParams {
			
 
				+  poolInfo: IPoolLayoutWithId;
			
 
				+  inputTokenMint: PublicKey;
			
 
				+  amountIn: BN;
			
 
				+  slippage?: number;
			
 
				+  priceLimit?: Decimal;
			
 
				+  catchLiquidityInsufficient?: boolean;
			
 
				+}
			
 
				+
			
 
				+export interface IQouteSwapReturn {
			
 
				+  allTrade: boolean;
			
 
				+  amountIn: BN;
			
 
				+  isInputMintA: boolean;
			
 
				+  expectedAmountOut: BN;
			
 
				+  minAmountOut: BN;
			
 
				+  remainingAccounts: PublicKey[];
			
 
				+  executionPrice: BN;
			
 
				+  feeAmount: BN;
			
 
				+}
			
 
				+
			
 
				+export interface ISwapParams {
			
 
				+  poolInfo: IPoolLayoutWithId;
			
 
				+  userAddress: PublicKey;
			
 
				+  quoteReturn: IQouteSwapReturn;
			
 
				+}
			
 
				+
			
 
				+export interface ISwapExactOutParams {
			
 
				+  poolInfo: IPoolLayoutWithId;
			
 
				+  userAddress: PublicKey;
			
 
				+  quoteReturn: IQuoteSwapExactOutReturn;
			
 
				+}
			
 
				+
			
 
				+export interface IQuoteSwapExactOutParams {
			
 
				+  poolInfo: IPoolLayoutWithId;
			
 
				+  outputTokenMint: PublicKey;
			
 
				+  amountOut: BN;
			
 
				+  slippage?: number;
			
 
				+  priceLimit?: Decimal;
			
 
				+  catchLiquidityInsufficient?: boolean;
			
 
				+}
			
 
				+
			
 
				+export interface IQuoteSwapExactOutReturn {
			
 
				+  allTrade: boolean;
			
 
				+  amountOut: BN;
			
 
				+  isOutputMintA: boolean;
			
 
				+  expectedAmountIn: BN;
			
 
				+  maxAmountIn: BN;
			
 
				+  remainingAccounts: PublicKey[];
			
 
				+  executionPrice: BN;
			
 
				+  feeAmount: BN;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/chain/utils.ts
+++ b/src/lib/clmm-sdk/src/client/chain/utils.ts
@@ -0,0 +1,408 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import {
			
 
				+  IPoolLayout,
			
 
				+  IPoolLayoutWithId,
			
 
				+  LiquidityMath,
			
 
				+  PoolUtils,
			
 
				+  SqrtPriceMath,
			
 
				+  TickMath,
			
 
				+} from '../../instructions/index.js';
			
 
				+import { TOKEN_2022_PROGRAM_ID, TOKEN_PROGRAM_ID } from '@solana/spl-token';
			
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+/**
			
 
				+ * Used to round the price to the corresponding tick when creating a position
			
 
				+ * @param price Input price
			
 
				+ * @param poolInfo Pool information
			
 
				+ * @returns Decimal rounded price
			
 
				+ */
			
 
				+export function alignPriceToTickPrice(price: Decimal, poolInfo: IPoolLayout): Decimal {
			
 
				+  const { price: roundedPrice } = TickMath.getTickAlignedPriceDetails(
			
 
				+    price,
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  return roundedPrice;
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the amount of tokenB needed to be invested after the specified tokenA amount has been invested
			
 
				+ * @param params.priceLower Lower price
			
 
				+ * @param params.priceUpper Upper price
			
 
				+ * @param params.amountA Amount of tokenA to be invested
			
 
				+ * @param params.poolInfo Pool information
			
 
				+ * @returns BN amount of tokenB to be invested
			
 
				+ */
			
 
				+export function getAmountBFromAmountA(params: {
			
 
				+  priceLower: Decimal | number | string;
			
 
				+  priceUpper: Decimal | number | string;
			
 
				+  amountA: BN;
			
 
				+  poolInfo: IPoolLayout;
			
 
				+}): BN {
			
 
				+  // console.log('[clmm sdk] getAmountBFromAmountA fn params:', JSON.stringify(params, null, 2));
			
 
				+  const { priceLower, priceUpper, amountA, poolInfo } = params;
			
 
				+
			
 
				+  const priceLowerDecimal = alignPriceToTickPrice(new Decimal(priceLower), poolInfo);
			
 
				+  const priceUpperDecimal = alignPriceToTickPrice(new Decimal(priceUpper), poolInfo);
			
 
				+
			
 
				+  const sqrtPriceX64A = SqrtPriceMath.priceToSqrtPriceX64(
			
 
				+    priceLowerDecimal,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  const sqrtPriceX64B = SqrtPriceMath.priceToSqrtPriceX64(
			
 
				+    priceUpperDecimal,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+
			
 
				+  const amountB = LiquidityMath.getAmountBFromAmountA(sqrtPriceX64A, sqrtPriceX64B, poolInfo.sqrtPriceX64, amountA);
			
 
				+
			
 
				+  return amountB;
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the amount of tokenA needed to be invested after the specified tokenB amount has been invested
			
 
				+ * @param params.priceLower Lower price
			
 
				+ * @param params.priceUpper Upper price
			
 
				+ * @param params.amountB Amount of tokenB to be invested
			
 
				+ * @param params.poolInfo Pool information
			
 
				+ * @returns BN amount of tokenA to be invested
			
 
				+ */
			
 
				+export function getAmountAFromAmountB(params: {
			
 
				+  priceLower: Decimal | number | string;
			
 
				+  priceUpper: Decimal | number | string;
			
 
				+  amountB: BN;
			
 
				+  poolInfo: IPoolLayout;
			
 
				+}): BN {
			
 
				+  const { priceLower, priceUpper, amountB, poolInfo } = params;
			
 
				+
			
 
				+  const priceLowerDecimal = alignPriceToTickPrice(new Decimal(priceLower), poolInfo);
			
 
				+  const priceUpperDecimal = alignPriceToTickPrice(new Decimal(priceUpper), poolInfo);
			
 
				+
			
 
				+  const sqrtPriceX64A = SqrtPriceMath.priceToSqrtPriceX64(
			
 
				+    priceLowerDecimal,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  const sqrtPriceX64B = SqrtPriceMath.priceToSqrtPriceX64(
			
 
				+    priceUpperDecimal,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+
			
 
				+  return LiquidityMath.getAmountAFromAmountB(sqrtPriceX64A, sqrtPriceX64B, poolInfo.sqrtPriceX64, amountB);
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the expected annualized return rate of adding liquidity (APR)
			
 
				+ */
			
 
				+export function calculateApr(params: {
			
 
				+  volume24h: number; // 24h volume in USD
			
 
				+  feeRate: number; // Fee rate, e.g. 0.003 means 0.3%
			
 
				+  positionUsdValue: number; // USD value of the tokens invested by the user
			
 
				+  amountA: BN; // Amount of tokenA invested
			
 
				+  amountB: BN; // Amount of tokenB invested
			
 
				+  tickLower: number; // Tick corresponding to the lower price
			
 
				+  tickUpper: number; // Tick corresponding to the upper price
			
 
				+  poolInfo: IPoolLayoutWithId; // Pool information
			
 
				+  existLiquidity?: BN; // Existing liquidity (required when adding liquidity)
			
 
				+  scene?: 'create' | 'add' | 'exist'; // Calculation scenario, create, add, exist
			
 
				+}): number {
			
 
				+  // console.log('[clmm sdk] calculateApr fn params:', JSON.stringify(params, null, 2));
			
 
				+  const {
			
 
				+    volume24h,
			
 
				+    feeRate,
			
 
				+    positionUsdValue,
			
 
				+    amountA,
			
 
				+    amountB,
			
 
				+    tickLower,
			
 
				+    tickUpper,
			
 
				+    poolInfo,
			
 
				+    scene = 'exist',
			
 
				+    existLiquidity = new BN(0),
			
 
				+  } = params;
			
 
				+
			
 
				+  return _calculateApr({
			
 
				+    fee24hUsdValue: volume24h * feeRate,
			
 
				+    positionUsdValue,
			
 
				+    amountA,
			
 
				+    amountB,
			
 
				+    tickLower,
			
 
				+    tickUpper,
			
 
				+    poolInfo,
			
 
				+    scene,
			
 
				+    existLiquidity,
			
 
				+  });
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the expected annualized return rate of reward
			
 
				+ */
			
 
				+export function calculateRewardApr(params: {
			
 
				+  reward24hUsdValue: number; // Reward received in 24h
			
 
				+  positionUsdValue: number; // USD value of the tokens invested by the user
			
 
				+  amountA: BN; // Amount of tokenA invested
			
 
				+  amountB: BN; // Amount of tokenB invested
			
 
				+  tickLower: number; // Tick corresponding to the lower price
			
 
				+  tickUpper: number; // Tick corresponding to the upper price
			
 
				+  poolInfo: IPoolLayoutWithId; // Pool information
			
 
				+  existLiquidity?: BN; // Existing liquidity (required when adding liquidity)
			
 
				+  scene?: 'create' | 'add' | 'exist'; // Calculation scenario, create, add, exist
			
 
				+}): number {
			
 
				+  const {
			
 
				+    reward24hUsdValue,
			
 
				+    positionUsdValue,
			
 
				+    amountA,
			
 
				+    amountB,
			
 
				+    tickLower,
			
 
				+    tickUpper,
			
 
				+    poolInfo,
			
 
				+    scene = 'exist',
			
 
				+    existLiquidity = new BN(0),
			
 
				+  } = params;
			
 
				+
			
 
				+  return _calculateApr({
			
 
				+    fee24hUsdValue: reward24hUsdValue,
			
 
				+    positionUsdValue,
			
 
				+    amountA,
			
 
				+    amountB,
			
 
				+    tickLower,
			
 
				+    tickUpper,
			
 
				+    poolInfo,
			
 
				+    scene,
			
 
				+    existLiquidity,
			
 
				+  });
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the expected annualized return rate of adding liquidity (APR)
			
 
				+ *
			
 
				+ */
			
 
				+export function _calculateApr(params: {
			
 
				+  fee24hUsdValue: number; // 24h fee or reward received
			
 
				+  positionUsdValue: number; // USD value of the tokens invested by the user
			
 
				+  amountA: BN; // Amount of tokenA invested
			
 
				+  amountB: BN; // Amount of tokenB invested
			
 
				+  tickLower: number; // Tick corresponding to the lower price
			
 
				+  tickUpper: number; // Tick corresponding to the upper price
			
 
				+  poolInfo: IPoolLayoutWithId; // Pool information
			
 
				+  existLiquidity?: BN; // Existing liquidity (required when adding liquidity)
			
 
				+  scene?: 'create' | 'add' | 'exist'; // Calculation scenario, create, add, exist
			
 
				+}): number {
			
 
				+  const {
			
 
				+    fee24hUsdValue,
			
 
				+    positionUsdValue,
			
 
				+    amountA,
			
 
				+    amountB,
			
 
				+    tickLower,
			
 
				+    tickUpper,
			
 
				+    poolInfo,
			
 
				+    scene = 'exist',
			
 
				+    existLiquidity = new BN(0),
			
 
				+  } = params;
			
 
				+
			
 
				+  // Get the active liquidity of the pool
			
 
				+  const poolActiveLiquidity = poolInfo.liquidity;
			
 
				+
			
 
				+  // Calculate the sqrtPrice of the price range
			
 
				+  const sqrtPriceCurrentX64 = poolInfo.sqrtPriceX64;
			
 
				+  const sqrtPriceLowerX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickLower);
			
 
				+  const sqrtPriceUpperX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickUpper);
			
 
				+
			
 
				+  // Calculate the active liquidity of the user
			
 
				+  const userActiveLiquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+    sqrtPriceCurrentX64,
			
 
				+    sqrtPriceLowerX64,
			
 
				+    sqrtPriceUpperX64,
			
 
				+    amountA,
			
 
				+    amountB
			
 
				+  );
			
 
				+
			
 
				+  // Check if the current price is within the user's range
			
 
				+  const isInRange = poolInfo.tickCurrent >= tickLower && poolInfo.tickCurrent < tickUpper;
			
 
				+
			
 
				+  // If not in range, active liquidity is 0
			
 
				+  if (!isInRange) {
			
 
				+    return 0;
			
 
				+  }
			
 
				+
			
 
				+  if (poolActiveLiquidity.isZero()) {
			
 
				+    return 0;
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the annualized return rate
			
 
				+  // Formula source: https://uponly.larksuite.com/wiki/GznTwz3kGi3D0ikaLp8uDlYcsKd?fromScene=spaceOverview
			
 
				+  // For creating liquidity: (Volume * FeeRate / Position) * (userAL / (AL + userAL)) * 365 * 100
			
 
				+  // For adding liquidity: (Volume * FeeRate / Position) * ((userAL + addAL) / (AL + addAL)) * 365 * 100
			
 
				+  // For existing positions: (Volume * FeeRate / Position) * (userAL / AL) * 365 * 100
			
 
				+  const fee24hDec = new Decimal(fee24hUsdValue);
			
 
				+  const positionUsdValueDec = new Decimal(positionUsdValue);
			
 
				+  const userActiveLiquidityDec = new Decimal(userActiveLiquidity.toString());
			
 
				+  const poolActiveLiquidityDec = new Decimal(poolActiveLiquidity.toString());
			
 
				+  const existLiquidityDec = new Decimal(existLiquidity.toString());
			
 
				+
			
 
				+  // Daily return rate
			
 
				+  const dailyReturn = fee24hDec.div(positionUsdValueDec);
			
 
				+
			
 
				+  // Calculate the liquidity share using Decimal
			
 
				+  let liquidityShare: Decimal;
			
 
				+  if (scene === 'create') {
			
 
				+    liquidityShare = userActiveLiquidityDec.div(poolActiveLiquidityDec.plus(userActiveLiquidityDec));
			
 
				+  } else if (scene === 'add') {
			
 
				+    liquidityShare = existLiquidityDec
			
 
				+      .plus(userActiveLiquidityDec)
			
 
				+      .div(poolActiveLiquidityDec.plus(userActiveLiquidityDec));
			
 
				+  } else {
			
 
				+    liquidityShare = userActiveLiquidityDec.div(poolActiveLiquidityDec);
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the annualized return rate
			
 
				+  const apr = dailyReturn.mul(liquidityShare).mul(365).mul(100).toNumber();
			
 
				+
			
 
				+  return apr;
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Calculate the annualized return rate for different price ranges
			
 
				+ * Calculate APR for different price ranges based on the percentage offset from the current price
			
 
				+ *
			
 
				+ * @param params Calculation parameters
			
 
				+ * @returns Mapping of annualized return rates for different price ranges, using -1 to represent the full range
			
 
				+ */
			
 
				+export function calculateRangeAprs(params: {
			
 
				+  percentRanges: number[]; // Price range percentage list, e.g. [1, 5, 10, 20, 50]
			
 
				+  volume24h: number; // 24h volume in USD
			
 
				+  feeRate: number; // Fee rate, e.g. 0.003 means 0.3%
			
 
				+  tokenAPriceUsd: number; // USD value of tokenA
			
 
				+  tokenBPriceUsd: number; // USD value of tokenB
			
 
				+  poolInfo: IPoolLayoutWithId; // Pool information
			
 
				+}): Record<number, number> {
			
 
				+  const { percentRanges, volume24h, feeRate, tokenAPriceUsd, tokenBPriceUsd, poolInfo } = params;
			
 
				+
			
 
				+  // Get the current price, liquidity and sample liquidity
			
 
				+  const currentPrice = TickMath.getPriceFromTick({
			
 
				+    tick: poolInfo.tickCurrent,
			
 
				+    decimalsA: poolInfo.mintDecimalsA,
			
 
				+    decimalsB: poolInfo.mintDecimalsB,
			
 
				+  });
			
 
				+
			
 
				+  const poolLiquidity = poolInfo.liquidity;
			
 
				+  const _sampleLiquidity = poolLiquidity.div(new BN(10000));
			
 
				+  const _minLiquidity = new BN(1000);
			
 
				+  const liquidityToUse = _sampleLiquidity.lt(_minLiquidity) ? _minLiquidity : _sampleLiquidity;
			
 
				+
			
 
				+  // Result mapping
			
 
				+  const result: Record<number, number> = {};
			
 
				+
			
 
				+  const { minTickBoundary, maxTickBoundary } = PoolUtils.tickRange(poolInfo.tickSpacing);
			
 
				+
			
 
				+  // Calculate APR for each range
			
 
				+  for (const range of percentRanges) {
			
 
				+    let tickLower: number;
			
 
				+    let tickUpper: number;
			
 
				+
			
 
				+    if (range === -1) {
			
 
				+      tickLower = minTickBoundary;
			
 
				+      tickUpper = maxTickBoundary;
			
 
				+    } else {
			
 
				+      const lowerPriceRatio = new Decimal(1).minus(new Decimal(range).div(100));
			
 
				+      const upperPriceRatio = new Decimal(1).plus(new Decimal(range).div(100));
			
 
				+      const lowerPrice = currentPrice.mul(lowerPriceRatio);
			
 
				+      const upperPrice = currentPrice.mul(upperPriceRatio);
			
 
				+
			
 
				+      tickLower = TickMath.getTickWithPriceAndTickspacing(
			
 
				+        lowerPrice,
			
 
				+        poolInfo.tickSpacing,
			
 
				+        poolInfo.mintDecimalsA,
			
 
				+        poolInfo.mintDecimalsB
			
 
				+      );
			
 
				+
			
 
				+      tickUpper = TickMath.getTickWithPriceAndTickspacing(
			
 
				+        upperPrice,
			
 
				+        poolInfo.tickSpacing,
			
 
				+        poolInfo.mintDecimalsA,
			
 
				+        poolInfo.mintDecimalsB
			
 
				+      );
			
 
				+    }
			
 
				+
			
 
				+    // Ensure that lower and upper are at least 1 tickSpacing apart
			
 
				+    if (tickLower >= tickUpper) {
			
 
				+      tickLower = Math.max(minTickBoundary, poolInfo.tickCurrent - poolInfo.tickSpacing);
			
 
				+      tickUpper = Math.min(maxTickBoundary, poolInfo.tickCurrent + poolInfo.tickSpacing);
			
 
				+    }
			
 
				+
			
 
				+    // Calculate the square root of the price (X64 format)
			
 
				+    const sqrtPriceCurrentX64 = poolInfo.sqrtPriceX64;
			
 
				+    const sqrtPriceLowerX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickLower);
			
 
				+    const sqrtPriceUpperX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickUpper);
			
 
				+
			
 
				+    // Calculate the corresponding token amounts based on the liquidity
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceLowerX64,
			
 
				+      sqrtPriceUpperX64,
			
 
				+      liquidityToUse,
			
 
				+      false // Do not round up
			
 
				+    );
			
 
				+
			
 
				+    // Calculate the USD value of the tokens
			
 
				+    const tokenAUsdAmount = new Decimal(amountA.toString())
			
 
				+      .div(new Decimal(10).pow(poolInfo.mintDecimalsA))
			
 
				+      .mul(tokenAPriceUsd);
			
 
				+
			
 
				+    const tokenBUsdAmount = new Decimal(amountB.toString())
			
 
				+      .div(new Decimal(10).pow(poolInfo.mintDecimalsB))
			
 
				+      .mul(tokenBPriceUsd);
			
 
				+
			
 
				+    // Calculate the total investment value
			
 
				+    const positionUsdValue = tokenAUsdAmount.plus(tokenBUsdAmount);
			
 
				+
			
 
				+    // If the USD value is too small, set a minimum value to avoid division issues
			
 
				+    const effectivePositionUsdValue = positionUsdValue.lt(0.01) ? new Decimal(0.01) : positionUsdValue;
			
 
				+
			
 
				+    // Calculate the actual annualized return rate
			
 
				+    const apr = calculateApr({
			
 
				+      volume24h,
			
 
				+      feeRate,
			
 
				+      positionUsdValue: effectivePositionUsdValue.toNumber(),
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+      tickLower,
			
 
				+      tickUpper,
			
 
				+      poolInfo,
			
 
				+      scene: 'create',
			
 
				+    });
			
 
				+
			
 
				+    result[range] = apr;
			
 
				+  }
			
 
				+
			
 
				+  return result;
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * 获取 mint 对应的 token program ID
			
 
				+ */
			
 
				+export async function getTokenProgramId(connection: Connection, mintAddress: PublicKey): Promise<PublicKey> {
			
 
				+  try {
			
 
				+    const mintAccountInfo = await connection.getAccountInfo(mintAddress);
			
 
				+    if (!mintAccountInfo) {
			
 
				+      throw new Error(`Mint account not found: ${mintAddress.toBase58()}`);
			
 
				+    }
			
 
				+
			
 
				+    // 检查 mint 账户的 owner 来确定使用的是哪个 token program
			
 
				+    if (mintAccountInfo.owner.equals(TOKEN_2022_PROGRAM_ID)) {
			
 
				+      return TOKEN_2022_PROGRAM_ID;
			
 
				+    } else if (mintAccountInfo.owner.equals(TOKEN_PROGRAM_ID)) {
			
 
				+      return TOKEN_PROGRAM_ID;
			
 
				+    } else {
			
 
				+      throw new Error(`Unknown token program for mint: ${mintAddress.toBase58()}`);
			
 
				+    }
			
 
				+  } catch (error) {
			
 
				+    console.warn(`Failed to get token program for ${mintAddress.toBase58()}, defaulting to TOKEN_PROGRAM_ID`);
			
 
				+    return TOKEN_PROGRAM_ID;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/index.ts
+++ b/src/lib/clmm-sdk/src/client/index.ts
@@ -0,0 +1,84 @@
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { BYREAL_CLMM_PROGRAM_ID } from '../constants.js';
			
 
				+import { IPoolLayoutWithId } from '../instructions/models.js';
			
 
				+
			
 
				+import { Api, IApiParams } from './apis/index.js';
			
 
				+import { IPoolsReq, IPoolsByIdsReq } from './apis/poolsModels.js';
			
 
				+import { IMyPositionsReq } from './apis/positionModels.js';
			
 
				+import { ITickReq } from './apis/tickModels.js';
			
 
				+import { Chain } from './chain/index.js';
			
 
				+import { ICollectFeesParams } from './chain/models.js';
			
 
				+import { ParamsWithSignerCallback } from './chain/models.js';
			
 
				+import { CLMMClient } from './liquidity/clmm.js';
			
 
				+import { Token } from './token.js';
			
 
				+
			
 
				+export class SdkClient {
			
 
				+  public api: Api;
			
 
				+  public chain: Chain;
			
 
				+  public clmmClient: CLMMClient;
			
 
				+  public connection: Connection;
			
 
				+  public programId: PublicKey;
			
 
				+  public token: Token;
			
 
				+
			
 
				+  constructor(params: { connection: Connection; programId?: PublicKey; apiConfig?: IApiParams }) {
			
 
				+    const { connection, programId = BYREAL_CLMM_PROGRAM_ID, apiConfig } = params;
			
 
				+    this.connection = connection;
			
 
				+    this.programId = programId;
			
 
				+    this.api = new Api(apiConfig);
			
 
				+    this.chain = new Chain({ connection, programId });
			
 
				+    this.clmmClient = new CLMMClient({ chain: this.chain });
			
 
				+    this.token = new Token(connection);
			
 
				+  }
			
 
				+
			
 
				+  // Get pool list
			
 
				+  async getPools(req: IPoolsReq) {
			
 
				+    return this.api.getPools(req);
			
 
				+  }
			
 
				+
			
 
				+  // Get pool details by ids
			
 
				+  async getPoolsByIds(req: IPoolsByIdsReq) {
			
 
				+    const result = await this.api.getPoolsByIds(req);
			
 
				+
			
 
				+    return result;
			
 
				+  }
			
 
				+
			
 
				+  // Get user positions
			
 
				+  async getMyPositions(req: IMyPositionsReq) {
			
 
				+    return this.api.getMyPositions(req);
			
 
				+  }
			
 
				+
			
 
				+  // Collect single position fees
			
 
				+  collectFees(params: ParamsWithSignerCallback<ICollectFeesParams>) {
			
 
				+    return this.chain.collectFees(params);
			
 
				+  }
			
 
				+
			
 
				+  // Get tick information
			
 
				+  async getTicks(req: ITickReq) {
			
 
				+    return this.api.getTicks(req);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   *
			
 
				+   * @param id Pool address
			
 
				+   * @returns
			
 
				+   */
			
 
				+  async getRawPoolInfoByPoolId(id: string): Promise<IPoolLayoutWithId> {
			
 
				+    return this.chain.getRawPoolInfoByPoolId(id);
			
 
				+  }
			
 
				+
			
 
				+  async getPositionNftMintListByUserAddress(userAddress: PublicKey): Promise<PublicKey[]> {
			
 
				+    const positionList = await this.chain.getRawPositionInfoListByUserAddress(userAddress);
			
 
				+    return positionList.map((position) => position.nftMint);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export * from './chain/index.js';
			
 
				+export * from './chain/models.js';
			
 
				+export * from './apis/index.js';
			
 
				+export * from './apis/ky.js';
			
 
				+export * from './liquidity/clmm.js';
			
 
				+export * from './apis/poolsModels.js';
			
 
				+export * from './apis/swapModels.js';
			
 
				+export * from './apis/positionModels.js';
			
 
				+export * from './apis/tickModels.js';
			
--- a/src/lib/clmm-sdk/src/client/liquidity/abstract.ts
+++ b/src/lib/clmm-sdk/src/client/liquidity/abstract.ts
@@ -0,0 +1,42 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { Chain } from '../chain/index.js';
			
 
				+import { IInstructionReturn } from '../chain/models.js';
			
 
				+
			
 
				+export abstract class AbstractLiquidityClient {
			
 
				+  protected _chain: Chain;
			
 
				+
			
 
				+  constructor(params: { chain: Chain }) {
			
 
				+    this._chain = params.chain;
			
 
				+  }
			
 
				+  /**
			
 
				+   * Create a position
			
 
				+   * @param opts
			
 
				+   * @returns
			
 
				+   */
			
 
				+  abstract createPosition(opts: any): Promise<IInstructionReturn>;
			
 
				+
			
 
				+  /**
			
 
				+   * Add liquidity
			
 
				+   * @param userAddress
			
 
				+   * @param nftMint
			
 
				+   * @returns
			
 
				+   */
			
 
				+  abstract addLiquidity(opts: any): Promise<IInstructionReturn>;
			
 
				+
			
 
				+  /**
			
 
				+   * Decrease liquidity
			
 
				+   * @param walletAddress
			
 
				+   * @param nftMint
			
 
				+   * @param decreasePercentage
			
 
				+   * @returns
			
 
				+   */
			
 
				+  abstract decreaseLiquidity(walletAddress: PublicKey, nftMint: string, decreasePercentage: number): Promise<any>;
			
 
				+
			
 
				+  /**
			
 
				+   * Remove all liquidity
			
 
				+   * @param userAddress
			
 
				+   * @param nftMint
			
 
				+   */
			
 
				+  abstract removeFullLiquidity(userAddress: string, nftMint: string): Promise<any>;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/liquidity/clmm.ts
+++ b/src/lib/clmm-sdk/src/client/liquidity/clmm.ts
@@ -0,0 +1,76 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { Chain } from '../chain/index.js';
			
 
				+import { IAddLiquidityParams } from '../chain/models.js';
			
 
				+
			
 
				+import { AbstractLiquidityClient } from './abstract.js';
			
 
				+import { ICLMMCreatePositionOptions } from './types.js';
			
 
				+
			
 
				+export class CLMMClient extends AbstractLiquidityClient {
			
 
				+  constructor(params: { chain: Chain }) {
			
 
				+    super(params);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Create a position
			
 
				+   * @param options
			
 
				+   * @returns
			
 
				+   */
			
 
				+  async createPosition(options: ICLMMCreatePositionOptions) {
			
 
				+    return this._chain.createPositionInstructions({
			
 
				+      userAddress: options.walletAddress,
			
 
				+      poolInfo: options.rpcPoolInfo,
			
 
				+      tickLower: options.tickLower,
			
 
				+      tickUpper: options.tickUpper,
			
 
				+      base: options.baseType,
			
 
				+      baseAmount: options.baseTokenAmount,
			
 
				+      otherAmountMax: options.quoteTokenAmount,
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  async addLiquidity(options: IAddLiquidityParams) {
			
 
				+    return this._chain.addLiquidityInstructions(options);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Decrease liquidity
			
 
				+   * @param nftMint
			
 
				+   * @returns
			
 
				+   */
			
 
				+  async decreaseLiquidity(walletAddress: PublicKey, nftMint: string, decreasePercentage: number) {
			
 
				+    const _nftMint = new PublicKey(nftMint);
			
 
				+    const positionInfo = await this._chain.getRawPositionInfoByNftMint(_nftMint);
			
 
				+
			
 
				+    if (!positionInfo) {
			
 
				+      throw new Error('Position not found');
			
 
				+    }
			
 
				+
			
 
				+    const { liquidity } = positionInfo;
			
 
				+    const liquidityToDecrease = liquidity.mul(new BN(decreasePercentage)).div(new BN(100));
			
 
				+
			
 
				+    const params = {
			
 
				+      userAddress: walletAddress,
			
 
				+      nftMint: _nftMint,
			
 
				+      liquidity: liquidityToDecrease,
			
 
				+    };
			
 
				+
			
 
				+    const { transaction } = await this._chain.decreaseLiquidityInstructions(params);
			
 
				+    return transaction;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Remove all liquidity
			
 
				+   * @param userAddress
			
 
				+   * @param nftMint
			
 
				+   */
			
 
				+  async removeFullLiquidity(userAddress: string, nftMint: string) {
			
 
				+    const _nftMint = new PublicKey(nftMint);
			
 
				+
			
 
				+    const { transaction } = await this._chain.decreaseFullLiquidityInstructions({
			
 
				+      userAddress: new PublicKey(userAddress),
			
 
				+      nftMint: _nftMint,
			
 
				+    });
			
 
				+    return transaction;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/liquidity/types.ts
+++ b/src/lib/clmm-sdk/src/client/liquidity/types.ts
@@ -0,0 +1,14 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { IPoolLayoutWithId } from '../../instructions/index.js';
			
 
				+
			
 
				+export interface ICLMMCreatePositionOptions {
			
 
				+  walletAddress: PublicKey;
			
 
				+  rpcPoolInfo: IPoolLayoutWithId;
			
 
				+  baseTokenAmount: BN;
			
 
				+  quoteTokenAmount: BN;
			
 
				+  tickLower: number;
			
 
				+  tickUpper: number;
			
 
				+  baseType: 'MintA' | 'MintB';
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/client/token.ts
+++ b/src/lib/clmm-sdk/src/client/token.ts
@@ -0,0 +1,105 @@
 
				+import {
			
 
				+  TOKEN_PROGRAM_ID,
			
 
				+  TOKEN_2022_PROGRAM_ID,
			
 
				+  getAssociatedTokenAddress,
			
 
				+  getMint,
			
 
				+  AccountLayout,
			
 
				+} from '@solana/spl-token';
			
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { isToken2022 } from '../utils/token.js';
			
 
				+
			
 
				+export class Token {
			
 
				+  private readonly _connection: Connection;
			
 
				+
			
 
				+  constructor(connection: Connection) {
			
 
				+    this._connection = connection;
			
 
				+  }
			
 
				+
			
 
				+  async isToken2022(mintAddress: string) {
			
 
				+    return isToken2022(mintAddress, this._connection);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Detect token type and get balance
			
 
				+   * @param walletAddress Wallet address
			
 
				+   * @param tokenMintAddress Token Mint address
			
 
				+   * @returns Promise object containing balance and whether it is Token-2022
			
 
				+   */
			
 
				+  async detectTokenTypeAndGetBalance(
			
 
				+    walletAddress: string,
			
 
				+    tokenMintAddress: string
			
 
				+  ): Promise<{ balance: number; isToken2022: boolean }> {
			
 
				+    const walletPublicKey = new PublicKey(walletAddress);
			
 
				+    const mintPublicKey = new PublicKey(tokenMintAddress);
			
 
				+
			
 
				+    // Compatible with native SOL
			
 
				+    if (tokenMintAddress === 'So11111111111111111111111111111111111111112') {
			
 
				+      const accountInfo = await this._connection.getAccountInfo(walletPublicKey);
			
 
				+      if (accountInfo) {
			
 
				+        const balance = Number(accountInfo.lamports) / Math.pow(10, 9); // SOL精度固定9位
			
 
				+        return { balance, isToken2022: false };
			
 
				+      }
			
 
				+      return { balance: 0, isToken2022: false };
			
 
				+    }
			
 
				+
			
 
				+    // First try to query as Token-2022
			
 
				+    try {
			
 
				+      const mint = await getMint(this._connection, mintPublicKey, 'confirmed', TOKEN_2022_PROGRAM_ID);
			
 
				+      const tokenAccount = await getAssociatedTokenAddress(
			
 
				+        mintPublicKey,
			
 
				+        walletPublicKey,
			
 
				+        false,
			
 
				+        TOKEN_2022_PROGRAM_ID
			
 
				+      );
			
 
				+
			
 
				+      const accountInfo = await this._connection.getAccountInfo(tokenAccount);
			
 
				+      if (accountInfo) {
			
 
				+        // Parse account data to get balance
			
 
				+        const data = AccountLayout.decode(accountInfo.data);
			
 
				+        const balance = Number(data.amount) / Math.pow(10, mint.decimals);
			
 
				+        return { balance, isToken2022: true };
			
 
				+      }
			
 
				+    } catch (error) {
			
 
				+      // If it is not Token-2022, try to query as a standard SPL Token
			
 
				+      console.log('Not a Token-2022, trying standard SPL Token...');
			
 
				+    }
			
 
				+
			
 
				+    // Try to query as a standard SPL Token
			
 
				+    try {
			
 
				+      const mint = await getMint(this._connection, mintPublicKey, 'confirmed', TOKEN_PROGRAM_ID);
			
 
				+      const tokenAccount = await getAssociatedTokenAddress(mintPublicKey, walletPublicKey, false, TOKEN_PROGRAM_ID);
			
 
				+
			
 
				+      const accountInfo = await this._connection.getAccountInfo(tokenAccount);
			
 
				+      if (accountInfo) {
			
 
				+        const data = AccountLayout.decode(accountInfo.data);
			
 
				+        const balance = Number(data.amount) / Math.pow(10, mint.decimals);
			
 
				+        return { balance, isToken2022: false };
			
 
				+      }
			
 
				+    } catch (error) {
			
 
				+      console.error('Error detecting token type:', error);
			
 
				+    }
			
 
				+
			
 
				+    return { balance: 0, isToken2022: false };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Batch detect token type and get balance
			
 
				+   * @param walletAddress Wallet address
			
 
				+   * @param tokenMintAddresses Token Mint address array
			
 
				+   * @returns Promise<{ tokenMintAddress: string; balance: number; isToken2022: boolean }[]>
			
 
				+   */
			
 
				+  async batchDetectTokenTypeAndGetBalance(
			
 
				+    walletAddress: string,
			
 
				+    tokenMintAddresses: string[]
			
 
				+  ): Promise<{ tokenMintAddress: string; balance: number; isToken2022: boolean }[]> {
			
 
				+    // Concurrent processing of all tokens
			
 
				+    const results = await Promise.all(
			
 
				+      tokenMintAddresses.map(async (tokenMintAddress) => {
			
 
				+        const res = await this.detectTokenTypeAndGetBalance(walletAddress, tokenMintAddress);
			
 
				+        return { tokenMintAddress, ...res };
			
 
				+      })
			
 
				+    );
			
 
				+    return results;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/constants.ts
+++ b/src/lib/clmm-sdk/src/constants.ts
@@ -0,0 +1,30 @@
 
				+import { PublicKey, SystemProgram } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+// Number of price points contained in each tick array
			
 
				+export const TICK_ARRAY_SIZE = 60;
			
 
				+// Size of tick array bitmap, used to track which tick arrays have been initialized
			
 
				+export const TICK_ARRAY_BITMAP_SIZE = 512;
			
 
				+// Size of extended tick array bitmap, used to handle additional liquidity ranges
			
 
				+export const EXTENSION_TICKARRAY_BITMAP_SIZE = 14;
			
 
				+
			
 
				+// Dynamic Tick Array constants
			
 
				+// Struct length: 208 bytes
			
 
				+// Header length: 8 (discriminator) + 208 (struct) = 216 bytes
			
 
				+export const DYN_TICK_ARRAY_STRUCT_LEN = 208;
			
 
				+export const DYN_TICK_ARRAY_HEADER_LEN = 216;
			
 
				+// TickState size: 168 bytes
			
 
				+export const TICK_STATE_LEN = 168;
			
 
				+
			
 
				+export const U64_IGNORE_RANGE = new BN('18446744073700000000');
			
 
				+
			
 
				+export const BYREAL_CLMM_PROGRAM_ID = new PublicKey('REALQqNEomY6cQGZJUGwywTBD2UmDT32rZcNnfxQ5N2');
			
 
				+
			
 
				+export const MEMO_PROGRAM_ID = new PublicKey('MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr');
			
 
				+export const RENT_PROGRAM_ID = new PublicKey('SysvarRent111111111111111111111111111111111');
			
 
				+export const CLOCK_PROGRAM_ID = new PublicKey('SysvarC1ock11111111111111111111111111111111');
			
 
				+export const METADATA_PROGRAM_ID = new PublicKey('metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s');
			
 
				+export const INSTRUCTION_PROGRAM_ID = new PublicKey('Sysvar1nstructions1111111111111111111111111');
			
 
				+export const WSOLMint = new PublicKey('So11111111111111111111111111111111111111112');
			
 
				+export const SOLMint = PublicKey.default;
			
 
				+export const SYSTEM_PROGRAM_ID = SystemProgram.programId;
			
--- a/src/lib/clmm-sdk/src/index.ts
+++ b/src/lib/clmm-sdk/src/index.ts
@@ -0,0 +1,5 @@
 
				+export * from './constants.js';
			
 
				+export * from './instructions/index.js';
			
 
				+export * from './client/index.js';
			
 
				+export * from './utils/index.js';
			
 
				+export * from './calculate.js';
			
--- a/src/lib/clmm-sdk/src/instructions/baseInstruction.ts
+++ b/src/lib/clmm-sdk/src/instructions/baseInstruction.ts
@@ -0,0 +1,1203 @@
 
				+import * as anchor from '@coral-xyz/anchor';
			
 
				+import { Program } from '@coral-xyz/anchor';
			
 
				+import { TOKEN_PROGRAM_ID } from '@solana/spl-token';
			
 
				+import { TOKEN_2022_PROGRAM_ID } from '@solana/spl-token';
			
 
				+import { PublicKey, TransactionInstruction, Connection, clusterApiUrl } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { BYREAL_CLMM_PROGRAM_ID } from '../constants.js';
			
 
				+
			
 
				+import ByrealClmmIDL from './target/idl/byreal_amm_v3.json';
			
 
				+import { ByrealClmm } from './target/types/byreal_amm_v3.js';
			
 
				+
			
 
				+export const getAmmV3Program = (programId: PublicKey): Program<ByrealClmm> => {
			
 
				+  // Create a read-only provider, no wallet needed
			
 
				+  const provider = new anchor.AnchorProvider(
			
 
				+    new Connection(clusterApiUrl('mainnet-beta'), 'confirmed'),
			
 
				+    {} as any, // Empty wallet object, since only instruction creation is needed
			
 
				+    { commitment: 'confirmed' }
			
 
				+  );
			
 
				+
			
 
				+  if (programId.toBase58() === BYREAL_CLMM_PROGRAM_ID.toBase58()) {
			
 
				+    return new Program<ByrealClmm>(ByrealClmmIDL as any, provider);
			
 
				+  }
			
 
				+
			
 
				+  throw new Error('[getAmmV3Program error]: Invalid program id');
			
 
				+};
			
 
				+
			
 
				+export class BaseInstruction {
			
 
				+  static async createPoolInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolCreator: PublicKey,
			
 
				+    poolManager: PublicKey,
			
 
				+    ammConfigId: PublicKey,
			
 
				+    mintA: PublicKey,
			
 
				+    mintProgramIdA: PublicKey,
			
 
				+    mintB: PublicKey,
			
 
				+    mintProgramIdB: PublicKey,
			
 
				+    sqrtPriceX64: BN,
			
 
				+    openTime?: BN,
			
 
				+    extendMintAccount?: PublicKey[]
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const _openTime = openTime || new BN(0);
			
 
				+
			
 
				+    const instruction = program.methods.createPool(sqrtPriceX64, _openTime).accounts({
			
 
				+      poolCreator,
			
 
				+      poolManager,
			
 
				+      ammConfig: ammConfigId,
			
 
				+      tokenMint0: mintA,
			
 
				+      tokenMint1: mintB,
			
 
				+      tokenProgram0: mintProgramIdA,
			
 
				+      tokenProgram1: mintProgramIdB,
			
 
				+    });
			
 
				+
			
 
				+    // If there are additional mint accounts, add them as remaining accounts
			
 
				+    if (extendMintAccount && extendMintAccount.length > 0) {
			
 
				+      instruction.remainingAccounts(
			
 
				+        extendMintAccount.map((k) => ({
			
 
				+          pubkey: k,
			
 
				+          isSigner: false,
			
 
				+          isWritable: false,
			
 
				+        }))
			
 
				+      );
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async openPositionFromLiquidityInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftMint: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    metadataAccount: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    tokenVaultA: PublicKey,
			
 
				+    tokenVaultB: PublicKey,
			
 
				+    tokenMintA: PublicKey,
			
 
				+    tokenMintB: PublicKey,
			
 
				+
			
 
				+    tickLowerIndex: number,
			
 
				+    tickUpperIndex: number,
			
 
				+    tickArrayLowerStartIndex: number,
			
 
				+    tickArrayUpperStartIndex: number,
			
 
				+    liquidity: BN,
			
 
				+    amountMaxA: BN,
			
 
				+    amountMaxB: BN,
			
 
				+    withMetadata: 'create' | 'no-create',
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .openPositionV2(
			
 
				+        tickLowerIndex,
			
 
				+        tickUpperIndex,
			
 
				+        tickArrayLowerStartIndex,
			
 
				+        tickArrayUpperStartIndex,
			
 
				+        liquidity,
			
 
				+        amountMaxA,
			
 
				+        amountMaxB,
			
 
				+        withMetadata === 'create',
			
 
				+        null // Set baseFlag to null, since this is based on liquidity
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        payer,
			
 
				+        positionNftOwner,
			
 
				+        positionNftMint,
			
 
				+        positionNftAccount,
			
 
				+        metadataAccount,
			
 
				+        poolState: poolId,
			
 
				+        protocolPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        personalPosition,
			
 
				+        tokenAccount0: ownerTokenAccountA,
			
 
				+        tokenAccount1: ownerTokenAccountB,
			
 
				+        tokenVault0: tokenVaultA,
			
 
				+        tokenVault1: tokenVaultB,
			
 
				+        vault0Mint: tokenMintA,
			
 
				+        vault1Mint: tokenMintB,
			
 
				+      });
			
 
				+
			
 
				+    // If there are additional tick array bitmaps, add them as remaining accounts
			
 
				+    if (exTickArrayBitmap) {
			
 
				+      instruction.remainingAccounts([{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }]);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async openPositionFromLiquidityInstruction22(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftMint: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    tokenVaultA: PublicKey,
			
 
				+    tokenVaultB: PublicKey,
			
 
				+    tokenMintA: PublicKey,
			
 
				+    tokenMintB: PublicKey,
			
 
				+
			
 
				+    tickLowerIndex: number,
			
 
				+    tickUpperIndex: number,
			
 
				+    tickArrayLowerStartIndex: number,
			
 
				+    tickArrayUpperStartIndex: number,
			
 
				+    liquidity: BN,
			
 
				+    amountMaxA: BN,
			
 
				+    amountMaxB: BN,
			
 
				+    withMetadata: 'create' | 'no-create',
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .openPositionWithToken22Nft(
			
 
				+        tickLowerIndex,
			
 
				+        tickUpperIndex,
			
 
				+        tickArrayLowerStartIndex,
			
 
				+        tickArrayUpperStartIndex,
			
 
				+        liquidity,
			
 
				+        amountMaxA,
			
 
				+        amountMaxB,
			
 
				+        withMetadata === 'create',
			
 
				+        null
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        payer,
			
 
				+        positionNftOwner,
			
 
				+        positionNftMint,
			
 
				+        positionNftAccount,
			
 
				+        poolState: poolId,
			
 
				+        // Here we need to manually pass in the generated PDA account, because anchor auto-generation uses little endian, while raydium's contract uses big endian (tick_lower_index.to_be_bytes()), using anchor auto-generation will cause errors;
			
 
				+        protocolPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        personalPosition,
			
 
				+
			
 
				+        tokenAccount0: ownerTokenAccountA,
			
 
				+        tokenAccount1: ownerTokenAccountB,
			
 
				+        tokenVault0: tokenVaultA,
			
 
				+        tokenVault1: tokenVaultB,
			
 
				+        vault0Mint: tokenMintA,
			
 
				+        vault1Mint: tokenMintB,
			
 
				+      });
			
 
				+
			
 
				+    // If there are additional tick array bitmaps, add them as remaining accounts
			
 
				+    if (exTickArrayBitmap) {
			
 
				+      instruction.remainingAccounts([{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }]);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async openPositionFromBaseInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftMint: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    metadataAccount: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    tokenVaultA: PublicKey,
			
 
				+    tokenVaultB: PublicKey,
			
 
				+    tokenMintA: PublicKey,
			
 
				+    tokenMintB: PublicKey,
			
 
				+
			
 
				+    tickLowerIndex: number,
			
 
				+    tickUpperIndex: number,
			
 
				+    tickArrayLowerStartIndex: number,
			
 
				+    tickArrayUpperStartIndex: number,
			
 
				+
			
 
				+    withMetadata: 'create' | 'no-create',
			
 
				+    base: 'MintA' | 'MintB',
			
 
				+    baseAmount: BN,
			
 
				+    otherAmountMax: BN,
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .openPositionV2(
			
 
				+        tickLowerIndex,
			
 
				+        tickUpperIndex,
			
 
				+        tickArrayLowerStartIndex,
			
 
				+        tickArrayUpperStartIndex,
			
 
				+        new BN(0), // Set liquidity to 0, since this is based on base amount
			
 
				+        base === 'MintA' ? baseAmount : otherAmountMax, // amount0Max
			
 
				+        base === 'MintA' ? otherAmountMax : baseAmount, // amount1Max
			
 
				+        withMetadata === 'create',
			
 
				+        base === 'MintA' // baseFlag
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        payer,
			
 
				+        positionNftOwner,
			
 
				+        positionNftMint,
			
 
				+        positionNftAccount,
			
 
				+        metadataAccount,
			
 
				+        poolState: poolId,
			
 
				+        protocolPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        personalPosition,
			
 
				+        tokenAccount0: ownerTokenAccountA,
			
 
				+        tokenAccount1: ownerTokenAccountB,
			
 
				+        tokenVault0: tokenVaultA,
			
 
				+        tokenVault1: tokenVaultB,
			
 
				+        vault0Mint: tokenMintA,
			
 
				+        vault1Mint: tokenMintB,
			
 
				+      });
			
 
				+
			
 
				+    // If there are additional tick array bitmaps, add them as remaining accounts
			
 
				+    if (exTickArrayBitmap) {
			
 
				+      instruction.remainingAccounts([{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }]);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async openPositionFromBaseInstruction22(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftMint: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    tokenVaultA: PublicKey,
			
 
				+    tokenVaultB: PublicKey,
			
 
				+    tokenMintA: PublicKey,
			
 
				+    tokenMintB: PublicKey,
			
 
				+
			
 
				+    tickLowerIndex: number,
			
 
				+    tickUpperIndex: number,
			
 
				+    tickArrayLowerStartIndex: number,
			
 
				+    tickArrayUpperStartIndex: number,
			
 
				+
			
 
				+    withMetadata: 'create' | 'no-create',
			
 
				+    base: 'MintA' | 'MintB',
			
 
				+    baseAmount: BN,
			
 
				+    otherAmountMax: BN,
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .openPositionWithToken22Nft(
			
 
				+        tickLowerIndex,
			
 
				+        tickUpperIndex,
			
 
				+        tickArrayLowerStartIndex,
			
 
				+        tickArrayUpperStartIndex,
			
 
				+        new BN(0), // Set liquidity to 0, since this is based on base amount
			
 
				+        base === 'MintA' ? baseAmount : otherAmountMax, // amountMaxA
			
 
				+        base === 'MintA' ? otherAmountMax : baseAmount, // amountMaxB
			
 
				+        withMetadata === 'create',
			
 
				+        base === 'MintA' // baseFlag
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        payer,
			
 
				+        positionNftOwner,
			
 
				+        positionNftMint,
			
 
				+        positionNftAccount,
			
 
				+        poolState: poolId,
			
 
				+        // Here we need to manually pass in the generated PDA account, because anchor auto-generation uses little endian; while raydium's contract uses big endian (tick_lower_index.to_be_bytes())
			
 
				+        protocolPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        personalPosition,
			
 
				+
			
 
				+        tokenAccount0: ownerTokenAccountA,
			
 
				+        tokenAccount1: ownerTokenAccountB,
			
 
				+        tokenVault0: tokenVaultA,
			
 
				+        tokenVault1: tokenVaultB,
			
 
				+        vault0Mint: tokenMintA,
			
 
				+        vault1Mint: tokenMintB,
			
 
				+      });
			
 
				+
			
 
				+    // If there are additional tick array bitmaps, add them as remaining accounts
			
 
				+    if (exTickArrayBitmap) {
			
 
				+      instruction.remainingAccounts([{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }]);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async closePositionInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftMint: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    nft2022?: boolean
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.closePosition().accounts({
			
 
				+      nftOwner: positionNftOwner,
			
 
				+      positionNftMint,
			
 
				+      positionNftAccount,
			
 
				+      tokenProgram: nft2022 ? TOKEN_2022_PROGRAM_ID : TOKEN_PROGRAM_ID,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async increasePositionFromLiquidityInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+
			
 
				+    poolId: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    mintVaultA: PublicKey,
			
 
				+    mintVaultB: PublicKey,
			
 
				+    mintMintA: PublicKey,
			
 
				+    mintMintB: PublicKey,
			
 
				+
			
 
				+    liquidity: BN,
			
 
				+    amountMaxA: BN,
			
 
				+    amountMaxB: BN,
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .increaseLiquidityV2(
			
 
				+        liquidity,
			
 
				+        amountMaxA,
			
 
				+        amountMaxB,
			
 
				+        null // Set baseFlag to null, since this is based on liquidity instruction
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        nftOwner: positionNftOwner,
			
 
				+        nftAccount: positionNftAccount,
			
 
				+        poolState: poolId,
			
 
				+        protocolPosition,
			
 
				+        personalPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        tokenAccount0: ownerTokenAccountA,
			
 
				+        tokenAccount1: ownerTokenAccountB,
			
 
				+        tokenVault0: mintVaultA,
			
 
				+        tokenVault1: mintVaultB,
			
 
				+        vault0Mint: mintMintA,
			
 
				+        vault1Mint: mintMintB,
			
 
				+      });
			
 
				+
			
 
				+    // If there are additional tick array bitmaps, add them as remaining accounts
			
 
				+    if (exTickArrayBitmap) {
			
 
				+      instruction.remainingAccounts([{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }]);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async increasePositionFromBaseInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+
			
 
				+    poolId: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    mintVaultA: PublicKey,
			
 
				+    mintVaultB: PublicKey,
			
 
				+    mintMintA: PublicKey,
			
 
				+    mintMintB: PublicKey,
			
 
				+
			
 
				+    base: 'MintA' | 'MintB',
			
 
				+    baseAmount: BN,
			
 
				+    otherAmountMax: BN,
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .increaseLiquidityV2(
			
 
				+        new BN(0), // Set liquidity to 0, since this is based on base amount
			
 
				+        base === 'MintA' ? baseAmount : otherAmountMax, // amount0Max
			
 
				+        base === 'MintA' ? otherAmountMax : baseAmount, // amount1Max
			
 
				+        base === 'MintA' // baseFlag
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        nftOwner: positionNftOwner,
			
 
				+        nftAccount: positionNftAccount,
			
 
				+        poolState: poolId,
			
 
				+        protocolPosition,
			
 
				+        personalPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        tokenAccount0: ownerTokenAccountA,
			
 
				+        tokenAccount1: ownerTokenAccountB,
			
 
				+        tokenVault0: mintVaultA,
			
 
				+        tokenVault1: mintVaultB,
			
 
				+        vault0Mint: mintMintA,
			
 
				+        vault1Mint: mintMintB,
			
 
				+      });
			
 
				+
			
 
				+    // If there are additional tick array bitmaps, add them as remaining accounts
			
 
				+    if (exTickArrayBitmap) {
			
 
				+      instruction.remainingAccounts([{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }]);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async decreaseLiquidityInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+
			
 
				+    poolId: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    ownerTokenAccountA: PublicKey,
			
 
				+    ownerTokenAccountB: PublicKey,
			
 
				+    mintVaultA: PublicKey,
			
 
				+    mintVaultB: PublicKey,
			
 
				+    mintMintA: PublicKey,
			
 
				+    mintMintB: PublicKey,
			
 
				+    rewardAccounts: {
			
 
				+      poolRewardVault: PublicKey;
			
 
				+      ownerRewardVault: PublicKey;
			
 
				+      rewardMint: PublicKey;
			
 
				+    }[],
			
 
				+
			
 
				+    liquidity: BN,
			
 
				+    amountMinA: BN,
			
 
				+    amountMinB: BN,
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.decreaseLiquidityV2(liquidity, amountMinA, amountMinB).accountsPartial({
			
 
				+      nftOwner: positionNftOwner,
			
 
				+      nftAccount: positionNftAccount,
			
 
				+      personalPosition,
			
 
				+      poolState: poolId,
			
 
				+      protocolPosition,
			
 
				+      tokenVault0: mintVaultA,
			
 
				+      tokenVault1: mintVaultB,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      recipientTokenAccount0: ownerTokenAccountA,
			
 
				+      recipientTokenAccount1: ownerTokenAccountB,
			
 
				+      vault0Mint: mintMintA,
			
 
				+      vault1Mint: mintMintB,
			
 
				+    });
			
 
				+
			
 
				+    // Build remaining accounts
			
 
				+    const remainingAccounts = [
			
 
				+      ...(exTickArrayBitmap ? [{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }] : []),
			
 
				+      ...rewardAccounts
			
 
				+        .map((i) => [
			
 
				+          { pubkey: i.poolRewardVault, isSigner: false, isWritable: true },
			
 
				+          { pubkey: i.ownerRewardVault, isSigner: false, isWritable: true },
			
 
				+          { pubkey: i.rewardMint, isSigner: false, isWritable: false },
			
 
				+        ])
			
 
				+        .flat(),
			
 
				+    ];
			
 
				+
			
 
				+    if (remainingAccounts.length > 0) {
			
 
				+      instruction.remainingAccounts(remainingAccounts);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async swapInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    ammConfigId: PublicKey,
			
 
				+    inputTokenAccount: PublicKey,
			
 
				+    outputTokenAccount: PublicKey,
			
 
				+    inputVault: PublicKey,
			
 
				+    outputVault: PublicKey,
			
 
				+    inputMint: PublicKey,
			
 
				+    outputMint: PublicKey,
			
 
				+    tickArray: PublicKey[],
			
 
				+    observationId: PublicKey,
			
 
				+
			
 
				+    amount: BN,
			
 
				+    otherAmountThreshold: BN,
			
 
				+    sqrtPriceLimitX64: BN,
			
 
				+    isBaseInput: boolean,
			
 
				+
			
 
				+    exTickArrayBitmap?: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.swapV2(amount, otherAmountThreshold, sqrtPriceLimitX64, isBaseInput).accounts({
			
 
				+      payer,
			
 
				+      ammConfig: ammConfigId,
			
 
				+      poolState: poolId,
			
 
				+      inputTokenAccount,
			
 
				+      outputTokenAccount,
			
 
				+      inputVault,
			
 
				+      outputVault,
			
 
				+      observationState: observationId,
			
 
				+      inputVaultMint: inputMint,
			
 
				+      outputVaultMint: outputMint,
			
 
				+    });
			
 
				+
			
 
				+    // Build remaining accounts
			
 
				+    const remainingAccounts = [
			
 
				+      ...(exTickArrayBitmap ? [{ pubkey: exTickArrayBitmap, isSigner: false, isWritable: true }] : []),
			
 
				+      ...tickArray.map((i) => ({
			
 
				+        pubkey: i,
			
 
				+        isSigner: false,
			
 
				+        isWritable: true,
			
 
				+      })),
			
 
				+    ];
			
 
				+
			
 
				+    if (remainingAccounts.length > 0) {
			
 
				+      instruction.remainingAccounts(remainingAccounts);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async initRewardInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    rewardFunder: PublicKey,
			
 
				+    funderTokenAccount: PublicKey,
			
 
				+    ammConfigId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    rewardMint: PublicKey,
			
 
				+    rewardProgramId: PublicKey,
			
 
				+
			
 
				+    openTime: number,
			
 
				+    endTime: number,
			
 
				+    emissionsPerSecondX64: BN
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .initializeReward({
			
 
				+        openTime: new BN(openTime),
			
 
				+        endTime: new BN(endTime),
			
 
				+        emissionsPerSecondX64,
			
 
				+      })
			
 
				+      .accounts({
			
 
				+        rewardFunder,
			
 
				+        funderTokenAccount,
			
 
				+        ammConfig: ammConfigId,
			
 
				+        poolState: poolId,
			
 
				+        rewardTokenMint: rewardMint,
			
 
				+        rewardTokenProgram: rewardProgramId,
			
 
				+      });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async setRewardInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    authority: PublicKey,
			
 
				+    ammConfigId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+
			
 
				+    rewardIndex: number,
			
 
				+    emissionsPerSecondX64: BN,
			
 
				+    openTime: number,
			
 
				+    endTime: number
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .setRewardParams(rewardIndex, emissionsPerSecondX64, new BN(openTime), new BN(endTime))
			
 
				+      .accounts({
			
 
				+        authority,
			
 
				+        ammConfig: ammConfigId,
			
 
				+        poolState: poolId,
			
 
				+      });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async collectRewardInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    rewardFunder: PublicKey,
			
 
				+    funderTokenAccount: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    rewardVault: PublicKey,
			
 
				+    rewardMint: PublicKey,
			
 
				+
			
 
				+    rewardIndex: number
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.collectRemainingRewards(rewardIndex).accounts({
			
 
				+      rewardFunder,
			
 
				+      funderTokenAccount,
			
 
				+      poolState: poolId,
			
 
				+      rewardTokenVault: rewardVault,
			
 
				+      rewardVaultMint: rewardMint,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async createAmmConfigInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    owner: PublicKey,
			
 
				+    ammConfigId: PublicKey,
			
 
				+    index: number,
			
 
				+    tickSpacing: number,
			
 
				+    tradeFeeRate: number,
			
 
				+    protocolFeeRate: number,
			
 
				+    fundFeeRate: number
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .createAmmConfig(index, tickSpacing, tradeFeeRate, protocolFeeRate, fundFeeRate)
			
 
				+      .accountsPartial({
			
 
				+        owner,
			
 
				+        ammConfig: ammConfigId,
			
 
				+      });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async updateAmmConfigInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    ammConfigId: PublicKey,
			
 
				+    owner: PublicKey,
			
 
				+    param: number,
			
 
				+    value: number
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.updateAmmConfig(param, value).accounts({
			
 
				+      owner,
			
 
				+      ammConfig: ammConfigId,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async updatePoolStatusInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    authority: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    status: number
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.updatePoolStatus(status).accounts({
			
 
				+      poolState,
			
 
				+      authority,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async createSupportMintAssociatedInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    owner: PublicKey,
			
 
				+    tokenMint: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.createSupportMintAssociated().accounts({
			
 
				+      owner,
			
 
				+      tokenMint,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async createOperationAccountInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    owner: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.createOperationAccount().accounts({
			
 
				+      owner,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async updateOperationAccountInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    owner: PublicKey,
			
 
				+    param: number,
			
 
				+    keys: PublicKey[]
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.updateOperationAccount(param, keys).accounts({
			
 
				+      owner,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async transferRewardOwnerInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    authority: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    newOwner: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.transferRewardOwner(newOwner).accounts({
			
 
				+      poolState,
			
 
				+      authority,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async updateRewardInfosInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolState: PublicKey
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.updateRewardInfos().accounts({
			
 
				+      poolState,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async collectProtocolFeeInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    tokenVault0: PublicKey,
			
 
				+    tokenVault1: PublicKey,
			
 
				+    vault0Mint: PublicKey,
			
 
				+    vault1Mint: PublicKey,
			
 
				+
			
 
				+    amount0Requested: BN,
			
 
				+    amount1Requested: BN
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.collectProtocolFee(amount0Requested, amount1Requested).accounts({
			
 
				+      poolState,
			
 
				+      tokenVault0,
			
 
				+      tokenVault1,
			
 
				+      vault0Mint,
			
 
				+      vault1Mint,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async collectFundFeeInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    tokenVault0: PublicKey,
			
 
				+    tokenVault1: PublicKey,
			
 
				+    vault0Mint: PublicKey,
			
 
				+    vault1Mint: PublicKey,
			
 
				+
			
 
				+    amount0Requested: BN,
			
 
				+    amount1Requested: BN
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.collectFundFee(amount0Requested, amount1Requested).accounts({
			
 
				+      poolState,
			
 
				+      tokenVault0,
			
 
				+      tokenVault1,
			
 
				+      vault0Mint,
			
 
				+      vault1Mint,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async _legacy_openPosition(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    positionNftOwner: PublicKey,
			
 
				+    positionNftMint: PublicKey,
			
 
				+    positionNftAccount: PublicKey,
			
 
				+    metadataAccount: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    tokenAccount0: PublicKey,
			
 
				+    tokenAccount1: PublicKey,
			
 
				+    tokenVault0: PublicKey,
			
 
				+    tokenVault1: PublicKey,
			
 
				+
			
 
				+    tickLowerIndex: number,
			
 
				+    tickUpperIndex: number,
			
 
				+    tickArrayLowerStartIndex: number,
			
 
				+    tickArrayUpperStartIndex: number,
			
 
				+    liquidity: BN,
			
 
				+    amount0Max: BN,
			
 
				+    amount1Max: BN,
			
 
				+
			
 
				+    remainingAccounts?: {
			
 
				+      pubkey: PublicKey;
			
 
				+      isSigner: boolean;
			
 
				+      isWritable: boolean;
			
 
				+    }[]
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods
			
 
				+      .openPosition(
			
 
				+        tickLowerIndex,
			
 
				+        tickUpperIndex,
			
 
				+        tickArrayLowerStartIndex,
			
 
				+        tickArrayUpperStartIndex,
			
 
				+        liquidity,
			
 
				+        amount0Max,
			
 
				+        amount1Max
			
 
				+      )
			
 
				+      .accountsPartial({
			
 
				+        payer,
			
 
				+        positionNftOwner,
			
 
				+        positionNftMint,
			
 
				+        positionNftAccount,
			
 
				+        metadataAccount,
			
 
				+        poolState,
			
 
				+        protocolPosition,
			
 
				+        tickArrayLower,
			
 
				+        tickArrayUpper,
			
 
				+        personalPosition,
			
 
				+        tokenAccount0,
			
 
				+        tokenAccount1,
			
 
				+        tokenVault0,
			
 
				+        tokenVault1,
			
 
				+      });
			
 
				+
			
 
				+    // Add remaining accounts
			
 
				+    if (remainingAccounts && remainingAccounts.length > 0) {
			
 
				+      instruction.remainingAccounts(remainingAccounts);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async _legacy_increaseLiquidity(
			
 
				+    programId: PublicKey,
			
 
				+    nftOwner: PublicKey,
			
 
				+    nftAccount: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    tokenAccount0: PublicKey,
			
 
				+    tokenAccount1: PublicKey,
			
 
				+    tokenVault0: PublicKey,
			
 
				+    tokenVault1: PublicKey,
			
 
				+
			
 
				+    liquidity: BN,
			
 
				+    amount0Max: BN,
			
 
				+    amount1Max: BN,
			
 
				+
			
 
				+    remainingAccounts?: {
			
 
				+      pubkey: PublicKey;
			
 
				+      isSigner: boolean;
			
 
				+      isWritable: boolean;
			
 
				+    }[]
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.increaseLiquidity(liquidity, amount0Max, amount1Max).accountsPartial({
			
 
				+      nftOwner,
			
 
				+      nftAccount,
			
 
				+      poolState,
			
 
				+      protocolPosition,
			
 
				+      personalPosition,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      tokenAccount0,
			
 
				+      tokenAccount1,
			
 
				+      tokenVault0,
			
 
				+      tokenVault1,
			
 
				+    });
			
 
				+
			
 
				+    // Add remaining accounts
			
 
				+    if (remainingAccounts && remainingAccounts.length > 0) {
			
 
				+      instruction.remainingAccounts(remainingAccounts);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async _legacy_decreaseLiquidity(
			
 
				+    programId: PublicKey,
			
 
				+    nftOwner: PublicKey,
			
 
				+    nftAccount: PublicKey,
			
 
				+    personalPosition: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    protocolPosition: PublicKey,
			
 
				+    tokenVaultA: PublicKey,
			
 
				+    tokenVaultB: PublicKey,
			
 
				+    tickArrayLower: PublicKey,
			
 
				+    tickArrayUpper: PublicKey,
			
 
				+    recipientTokenAccountA: PublicKey,
			
 
				+    recipientTokenAccountB: PublicKey,
			
 
				+
			
 
				+    liquidity: BN,
			
 
				+    amountAMin: BN,
			
 
				+    amountBMin: BN,
			
 
				+
			
 
				+    remainingAccounts?: {
			
 
				+      pubkey: PublicKey;
			
 
				+      isSigner: boolean;
			
 
				+      isWritable: boolean;
			
 
				+    }[]
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.decreaseLiquidity(liquidity, amountAMin, amountBMin).accountsPartial({
			
 
				+      nftOwner,
			
 
				+      nftAccount,
			
 
				+      personalPosition,
			
 
				+      poolState,
			
 
				+      protocolPosition,
			
 
				+      tokenVault0: tokenVaultA,
			
 
				+      tokenVault1: tokenVaultB,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      recipientTokenAccount0: recipientTokenAccountA,
			
 
				+      recipientTokenAccount1: recipientTokenAccountB,
			
 
				+    });
			
 
				+
			
 
				+    // Add remaining accounts
			
 
				+    if (remainingAccounts && remainingAccounts.length > 0) {
			
 
				+      instruction.remainingAccounts(remainingAccounts);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async _legacy_swap(
			
 
				+    programId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    ammConfig: PublicKey,
			
 
				+    poolState: PublicKey,
			
 
				+    inputTokenAccount: PublicKey,
			
 
				+    outputTokenAccount: PublicKey,
			
 
				+    inputVault: PublicKey,
			
 
				+    outputVault: PublicKey,
			
 
				+    observationState: PublicKey,
			
 
				+    tickArray: PublicKey[],
			
 
				+
			
 
				+    amount: BN,
			
 
				+    otherAmountThreshold: BN,
			
 
				+    sqrtPriceLimitX64: BN,
			
 
				+    isBaseInput: boolean,
			
 
				+
			
 
				+    remainingAccounts?: {
			
 
				+      pubkey: PublicKey;
			
 
				+      isSigner: boolean;
			
 
				+      isWritable: boolean;
			
 
				+    }[]
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    // First tick array as required account, the rest as remaining accounts
			
 
				+    const [firstTickArray, ...restTickArrays] = tickArray;
			
 
				+
			
 
				+    const instruction = program.methods.swap(amount, otherAmountThreshold, sqrtPriceLimitX64, isBaseInput).accounts({
			
 
				+      payer,
			
 
				+      ammConfig,
			
 
				+      poolState,
			
 
				+      inputTokenAccount,
			
 
				+      outputTokenAccount,
			
 
				+      inputVault,
			
 
				+      outputVault,
			
 
				+      observationState,
			
 
				+      tickArray: firstTickArray,
			
 
				+    });
			
 
				+
			
 
				+    // Build remaining accounts, including remaining tick arrays and additional accounts
			
 
				+    const allRemainingAccounts = [
			
 
				+      ...restTickArrays.map((pubkey) => ({
			
 
				+        pubkey,
			
 
				+        isSigner: false,
			
 
				+        isWritable: true,
			
 
				+      })),
			
 
				+      ...(remainingAccounts || []),
			
 
				+    ];
			
 
				+
			
 
				+    if (allRemainingAccounts.length > 0) {
			
 
				+      instruction.remainingAccounts(allRemainingAccounts);
			
 
				+    }
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  // Initialize admin group
			
 
				+  static async initAmmAdminGroupInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    params: {
			
 
				+      feeKeeper: PublicKey;
			
 
				+      rewardConfigManager: PublicKey;
			
 
				+      rewardClaimManager: PublicKey;
			
 
				+      poolManager: PublicKey;
			
 
				+      emergencyManager: PublicKey;
			
 
				+      normalManager: PublicKey;
			
 
				+    }
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.initAmmAdminGroup({
			
 
				+      feeKeeper: params.feeKeeper,
			
 
				+      rewardConfigManager: params.rewardConfigManager,
			
 
				+      rewardClaimManager: params.rewardClaimManager,
			
 
				+      poolManager: params.poolManager,
			
 
				+      emergencyManager: params.emergencyManager,
			
 
				+      normalManager: params.normalManager,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  // Update admin group
			
 
				+  static async updateAmmAdminGroupInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    params: {
			
 
				+      feeKeeper?: PublicKey;
			
 
				+      rewardConfigManager?: PublicKey;
			
 
				+      rewardClaimManager?: PublicKey;
			
 
				+      poolManager?: PublicKey;
			
 
				+      emergencyManager?: PublicKey;
			
 
				+      normalManager?: PublicKey;
			
 
				+    }
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.updateAmmAdminGroup({
			
 
				+      feeKeeper: params.feeKeeper ?? null,
			
 
				+      rewardConfigManager: params.rewardConfigManager ?? null,
			
 
				+      rewardClaimManager: params.rewardClaimManager ?? null,
			
 
				+      poolManager: params.poolManager ?? null,
			
 
				+      emergencyManager: params.emergencyManager ?? null,
			
 
				+      normalManager: params.normalManager ?? null,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  // New chain-off reward related instructions
			
 
				+  static async depositOffchainRewardInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    payer: PublicKey,
			
 
				+    authority: PublicKey,
			
 
				+    tokenMint: PublicKey,
			
 
				+    payerTokenAccount: PublicKey,
			
 
				+    tokenProgram: PublicKey,
			
 
				+    amount: BN
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.depositOffchainReward(amount).accountsPartial({
			
 
				+      payer,
			
 
				+      poolId,
			
 
				+      authority,
			
 
				+      tokenMint,
			
 
				+      payerTokenAccount,
			
 
				+      tokenProgram,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async claimOffchainRewardInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    claimer: PublicKey,
			
 
				+    authority: PublicKey,
			
 
				+    tokenMint: PublicKey,
			
 
				+    claimerTokenAccount: PublicKey,
			
 
				+    tokenProgram: PublicKey,
			
 
				+    amount: BN
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.claimOffchainReward(amount).accountsPartial({
			
 
				+      claimer,
			
 
				+      authority,
			
 
				+      poolId,
			
 
				+      tokenMint,
			
 
				+      claimerTokenAccount,
			
 
				+      tokenProgram,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+
			
 
				+  static async withdrawOffchainRewardInstruction(
			
 
				+    programId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    authority: PublicKey,
			
 
				+    tokenMint: PublicKey,
			
 
				+    receiverTokenAccount: PublicKey,
			
 
				+    tokenProgram: PublicKey,
			
 
				+    amount: BN
			
 
				+  ): Promise<TransactionInstruction> {
			
 
				+    const program = getAmmV3Program(programId);
			
 
				+
			
 
				+    const instruction = program.methods.withdrawOffchainReward(amount).accountsPartial({
			
 
				+      authority,
			
 
				+      tokenMint,
			
 
				+      poolId,
			
 
				+      receiverTokenAccount,
			
 
				+      tokenProgram,
			
 
				+    });
			
 
				+
			
 
				+    return await instruction.instruction();
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/constants.ts
+++ b/src/lib/clmm-sdk/src/instructions/constants.ts
@@ -0,0 +1,41 @@
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+export const ZERO = new BN(0);
			
 
				+export const ONE = new BN(1);
			
 
				+export const NEGATIVE_ONE = new BN(-1);
			
 
				+
			
 
				+export const Q64 = new BN(1).shln(64);
			
 
				+export const Q128 = new BN(1).shln(128);
			
 
				+
			
 
				+export const MaxU64 = Q64.sub(ONE);
			
 
				+
			
 
				+export const U64Resolution = 64;
			
 
				+
			
 
				+export const MaxUint128 = Q128.subn(1);
			
 
				+
			
 
				+export const MIN_TICK = -443636;
			
 
				+export const MAX_TICK = -MIN_TICK;
			
 
				+
			
 
				+export const MIN_SQRT_PRICE_X64: BN = new BN('4295048016');
			
 
				+export const MAX_SQRT_PRICE_X64: BN = new BN('79226673521066979257578248091');
			
 
				+
			
 
				+export const MIN_SQRT_PRICE_X64_ADD_ONE: BN = new BN('4295048017');
			
 
				+export const MAX_SQRT_PRICE_X64_SUB_ONE: BN = new BN('79226673521066979257578248090');
			
 
				+
			
 
				+export const BIT_PRECISION = 16;
			
 
				+export const LOG_B_2_X32 = '59543866431248';
			
 
				+export const LOG_B_P_ERR_MARGIN_LOWER_X64 = '184467440737095516';
			
 
				+export const LOG_B_P_ERR_MARGIN_UPPER_X64 = '15793534762490258745';
			
 
				+
			
 
				+export const FEE_RATE_DENOMINATOR = new BN(10).pow(new BN(6));
			
 
				+
			
 
				+export enum Fee {
			
 
				+  rate_500 = 500, //  500 / 10e6 = 0.0005
			
 
				+  rate_3000 = 3000, // 3000/ 10e6 = 0.003
			
 
				+  rate_10000 = 10000, // 10000 /10e6 = 0.01
			
 
				+}
			
 
				+export const TICK_SPACINGS: { [amount in Fee]: number } = {
			
 
				+  [Fee.rate_500]: 10,
			
 
				+  [Fee.rate_3000]: 60,
			
 
				+  [Fee.rate_10000]: 200,
			
 
				+};
			
--- a/src/lib/clmm-sdk/src/instructions/getRawData.ts
+++ b/src/lib/clmm-sdk/src/instructions/getRawData.ts
@@ -0,0 +1,155 @@
 
				+import { MintLayout } from '@solana/spl-token';
			
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import {
			
 
				+  AmmConfigLayout,
			
 
				+  IAmmConfigLayout,
			
 
				+  IObservationLayout,
			
 
				+  IPersonalPositionLayout,
			
 
				+  ObservationLayout,
			
 
				+  PersonalPositionLayout,
			
 
				+  PoolLayout,
			
 
				+} from './layout.js';
			
 
				+import { IPoolLayoutWithId } from './models.js';
			
 
				+import { getPdaPersonalPositionAddress } from './pda.js';
			
 
				+import { fetchWalletTokenAccounts } from './utils/fetchWalletTokenAccounts.js';
			
 
				+import { SqrtPriceMath } from './utils/index.js';
			
 
				+
			
 
				+export class RawDataUtils {
			
 
				+  /**
			
 
				+   * Get position list for specified account
			
 
				+   */
			
 
				+  static async getRawPositionInfoListByUserAddress(params: {
			
 
				+    connection: Connection;
			
 
				+    programId: PublicKey;
			
 
				+    userAddress: PublicKey;
			
 
				+  }): Promise<IPersonalPositionLayout[]> {
			
 
				+    const { connection, programId, userAddress } = params;
			
 
				+    const { rawTokenAccountInfos } = await fetchWalletTokenAccounts(connection, userAddress);
			
 
				+    const balanceMints = rawTokenAccountInfos.filter((acc) => acc.accountInfo.amount.eq(new BN(1)));
			
 
				+    const allPositionKey = balanceMints.map(
			
 
				+      (acc) => getPdaPersonalPositionAddress(new PublicKey(programId), acc.accountInfo.mint).publicKey
			
 
				+    );
			
 
				+
			
 
				+    const accountInfo = await connection.getMultipleAccountsInfo(allPositionKey);
			
 
				+    const allPosition: IPersonalPositionLayout[] = [];
			
 
				+    accountInfo.forEach((positionRes) => {
			
 
				+      if (!positionRes) return;
			
 
				+      const position = PersonalPositionLayout.decode(positionRes.data);
			
 
				+      allPosition.push(position);
			
 
				+    });
			
 
				+
			
 
				+    return allPosition;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get position information from specified position list
			
 
				+   */
			
 
				+  static async getRawPositionInfoByNftMint(params: {
			
 
				+    connection: Connection;
			
 
				+    programId: PublicKey;
			
 
				+    nftMint: PublicKey;
			
 
				+  }): Promise<IPersonalPositionLayout | null> {
			
 
				+    const { connection, programId, nftMint } = params;
			
 
				+    const positionKey = getPdaPersonalPositionAddress(new PublicKey(programId), nftMint).publicKey;
			
 
				+    const positionRes = await connection.getAccountInfo(positionKey);
			
 
				+    if (!positionRes) return null;
			
 
				+    const position = PersonalPositionLayout.decode(positionRes.data);
			
 
				+    return position;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get on-chain information for a single CLMM pool
			
 
				+   */
			
 
				+  static async getRawPoolInfoByPoolId(params: {
			
 
				+    connection: Connection;
			
 
				+    poolId: string | PublicKey;
			
 
				+  }): Promise<IPoolLayoutWithId | null> {
			
 
				+    const { connection, poolId } = params;
			
 
				+    const poolPublicKey = new PublicKey(poolId);
			
 
				+
			
 
				+    const accountInfo = await connection.getAccountInfo(poolPublicKey);
			
 
				+
			
 
				+    if (!accountInfo || !accountInfo.data) return null;
			
 
				+
			
 
				+    const poolRawInfo = PoolLayout.decode(accountInfo.data);
			
 
				+
			
 
				+    const currentPrice = SqrtPriceMath.sqrtPriceX64ToPrice(
			
 
				+      poolRawInfo.sqrtPriceX64,
			
 
				+      poolRawInfo.mintDecimalsA,
			
 
				+      poolRawInfo.mintDecimalsB
			
 
				+    ).toNumber();
			
 
				+
			
 
				+    return {
			
 
				+      ...poolRawInfo,
			
 
				+      currentPrice,
			
 
				+      programId: accountInfo.owner,
			
 
				+      poolId: poolPublicKey,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get on-chain information for specified token
			
 
				+   */
			
 
				+  static async getRawTokenInfoByMint(params: {
			
 
				+    connection: Connection;
			
 
				+    mintAddress: PublicKey;
			
 
				+  }): Promise<(ReturnType<typeof MintLayout.decode> & { owner: PublicKey }) | null> {
			
 
				+    const { connection, mintAddress } = params;
			
 
				+    const accountInfo = await connection.getAccountInfo(mintAddress);
			
 
				+    if (!accountInfo || !accountInfo.data) return null;
			
 
				+    const tokenInfo = MintLayout.decode(accountInfo.data);
			
 
				+    return {
			
 
				+      ...tokenInfo,
			
 
				+      owner: accountInfo.owner,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get AMM configuration on-chain information
			
 
				+   */
			
 
				+  static async getRawAmmConfigByConfigId(params: {
			
 
				+    connection: Connection;
			
 
				+    configId: string | PublicKey;
			
 
				+  }): Promise<(IAmmConfigLayout & { configId: PublicKey; owner: PublicKey }) | null> {
			
 
				+    const { connection, configId } = params;
			
 
				+    const configPublicKey = new PublicKey(configId);
			
 
				+
			
 
				+    const accountInfo = await connection.getAccountInfo(configPublicKey);
			
 
				+
			
 
				+    if (!accountInfo || !accountInfo.data) return null;
			
 
				+
			
 
				+    const configRawInfo = AmmConfigLayout.decode(accountInfo.data);
			
 
				+
			
 
				+    return {
			
 
				+      ...configRawInfo,
			
 
				+      configId: configPublicKey,
			
 
				+      owner: accountInfo.owner,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get observation account on-chain information
			
 
				+   * Observation account is used to record historical data of price changes in the pool
			
 
				+   */
			
 
				+  static async getRawObservationByObservationId(params: {
			
 
				+    connection: Connection;
			
 
				+    observationId: string | PublicKey;
			
 
				+  }): Promise<(IObservationLayout & { observationId: PublicKey; owner: PublicKey }) | null> {
			
 
				+    const { connection, observationId } = params;
			
 
				+    const observationPublicKey = new PublicKey(observationId);
			
 
				+
			
 
				+    const accountInfo = await connection.getAccountInfo(observationPublicKey);
			
 
				+
			
 
				+    if (!accountInfo || !accountInfo.data) return null;
			
 
				+
			
 
				+    const observationRawInfo = ObservationLayout.decode(accountInfo.data);
			
 
				+
			
 
				+    return {
			
 
				+      ...observationRawInfo,
			
 
				+      observationId: observationPublicKey,
			
 
				+      owner: accountInfo.owner,
			
 
				+    };
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/index.ts
+++ b/src/lib/clmm-sdk/src/instructions/index.ts
@@ -0,0 +1,8 @@
 
				+export * from './utils/index.js';
			
 
				+export * from './constants.js';
			
 
				+export * from './baseInstruction.js';
			
 
				+export * from './instruction.js';
			
 
				+export * from './models.js';
			
 
				+export * from './layout.js';
			
 
				+export * from './pda.js';
			
 
				+export * from './getRawData.js';
			
--- a/src/lib/clmm-sdk/src/instructions/instruction.ts
+++ b/src/lib/clmm-sdk/src/instructions/instruction.ts
@@ -0,0 +1,547 @@
 
				+import { TOKEN_2022_PROGRAM_ID } from '@solana/spl-token';
			
 
				+import { Keypair, PublicKey, Signer, TransactionInstruction } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { BaseInstruction } from './baseInstruction.js';
			
 
				+import { IPersonalPositionLayout } from './layout.js';
			
 
				+import { IPoolLayoutWithId, ITokenInfo } from './models.js';
			
 
				+import {
			
 
				+  getATAAddress,
			
 
				+  getPdaExBitmapAccount,
			
 
				+  getPdaPersonalPositionAddress,
			
 
				+  getPdaProtocolPositionAddress,
			
 
				+  getPdaTickArrayAddress,
			
 
				+} from './pda.js';
			
 
				+import { PoolUtils } from './utils/poolUtils.js';
			
 
				+import { TickUtils } from './utils/tick.js';
			
 
				+
			
 
				+export class Instruction {
			
 
				+  static async createPoolInstruction(props: {
			
 
				+    programId: PublicKey;
			
 
				+    owner: PublicKey;
			
 
				+    poolManager: PublicKey;
			
 
				+    mintA: ITokenInfo;
			
 
				+    mintB: ITokenInfo;
			
 
				+    ammConfigId: PublicKey;
			
 
				+    initialPriceX64: BN;
			
 
				+    openTime?: BN;
			
 
				+    extendMintAccount?: PublicKey[];
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] createPoolInstruction fn params:', JSON.stringify(props, null, 2));
			
 
				+
			
 
				+    const { programId, owner, poolManager, mintA, mintB, ammConfigId, initialPriceX64, extendMintAccount, openTime } =
			
 
				+      props;
			
 
				+
			
 
				+    const mintAAddress = new PublicKey(mintA.address);
			
 
				+    const mintBAddress = new PublicKey(mintB.address);
			
 
				+
			
 
				+    const instruction = await BaseInstruction.createPoolInstruction(
			
 
				+      programId,
			
 
				+      owner,
			
 
				+      poolManager,
			
 
				+      ammConfigId,
			
 
				+      mintAAddress,
			
 
				+      new PublicKey(mintA.programId),
			
 
				+      mintBAddress,
			
 
				+      new PublicKey(mintB.programId),
			
 
				+      initialPriceX64,
			
 
				+      openTime,
			
 
				+      extendMintAccount
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async openPositionFromLiquidityInstruction(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerInfo: {
			
 
				+      feePayer: PublicKey;
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+    };
			
 
				+    tickLower: number;
			
 
				+    tickUpper: number;
			
 
				+    liquidity: BN;
			
 
				+    amountMaxA: BN;
			
 
				+    amountMaxB: BN;
			
 
				+    withMetadata: 'create' | 'no-create';
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+    signers: Signer[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] openPositionFromLiquidityInstruction fn params:', JSON.stringify(params, null, 2));
			
 
				+
			
 
				+    const { poolInfo, ownerInfo, tickLower, tickUpper, liquidity, amountMaxA, amountMaxB, withMetadata } = params;
			
 
				+    const signers: Signer[] = [];
			
 
				+
			
 
				+    const { programId, poolId, tickSpacing } = poolInfo;
			
 
				+
			
 
				+    const keypair = Keypair.generate();
			
 
				+    signers.push(keypair);
			
 
				+    const nftMintAccount = keypair.publicKey;
			
 
				+
			
 
				+    const tickArrayLowerStartIndex = TickUtils.getTickArrayStartIndexByTick(tickLower, tickSpacing);
			
 
				+    const tickArrayUpperStartIndex = TickUtils.getTickArrayStartIndexByTick(tickUpper, tickSpacing);
			
 
				+
			
 
				+    const { publicKey: tickArrayLower } = getPdaTickArrayAddress(programId, poolId, tickArrayLowerStartIndex);
			
 
				+    const { publicKey: tickArrayUpper } = getPdaTickArrayAddress(programId, poolId, tickArrayUpperStartIndex);
			
 
				+
			
 
				+    const { publicKey: positionNftAccount } = getATAAddress(ownerInfo.wallet, nftMintAccount, TOKEN_2022_PROGRAM_ID);
			
 
				+
			
 
				+    const { publicKey: personalPosition } = getPdaPersonalPositionAddress(programId, nftMintAccount);
			
 
				+    const { publicKey: protocolPosition } = getPdaProtocolPositionAddress(programId, poolId, tickLower, tickUpper);
			
 
				+
			
 
				+    const instruction = await BaseInstruction.openPositionFromLiquidityInstruction22(
			
 
				+      programId,
			
 
				+      ownerInfo.feePayer,
			
 
				+      poolId,
			
 
				+      ownerInfo.wallet,
			
 
				+      nftMintAccount,
			
 
				+      positionNftAccount,
			
 
				+      protocolPosition,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      personalPosition,
			
 
				+      ownerInfo.tokenAccountA,
			
 
				+      ownerInfo.tokenAccountB,
			
 
				+      poolInfo.vaultA,
			
 
				+      poolInfo.vaultB,
			
 
				+      poolInfo.mintA,
			
 
				+      poolInfo.mintB,
			
 
				+      tickLower,
			
 
				+      tickUpper,
			
 
				+      tickArrayLowerStartIndex,
			
 
				+      tickArrayUpperStartIndex,
			
 
				+      liquidity,
			
 
				+      amountMaxA,
			
 
				+      amountMaxB,
			
 
				+      withMetadata,
			
 
				+      PoolUtils.isOverflowDefaultTickarrayBitmap(tickSpacing, [tickArrayLowerStartIndex, tickArrayUpperStartIndex])
			
 
				+        ? getPdaExBitmapAccount(programId, poolId).publicKey
			
 
				+        : undefined
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      signers,
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async openPositionFromBaseInstruction(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerInfo: {
			
 
				+      feePayer: PublicKey;
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+    };
			
 
				+    tickLower: number;
			
 
				+    tickUpper: number;
			
 
				+    base: 'MintA' | 'MintB';
			
 
				+    baseAmount: BN;
			
 
				+    otherAmountMax: BN;
			
 
				+    withMetadata: 'create' | 'no-create';
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+    signers: Signer[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] openPositionFromBaseInstruction fn params:', JSON.stringify(params, null, 2));
			
 
				+
			
 
				+    const { poolInfo, ownerInfo, tickLower, tickUpper, base, baseAmount, otherAmountMax, withMetadata } = params;
			
 
				+    const signers: Signer[] = [];
			
 
				+
			
 
				+    const { programId, poolId, tickSpacing } = poolInfo;
			
 
				+
			
 
				+    const keypair = Keypair.generate();
			
 
				+    signers.push(keypair);
			
 
				+    const nftMintAccount = keypair.publicKey;
			
 
				+
			
 
				+    const tickArrayLowerStartIndex = TickUtils.getTickArrayStartIndexByTick(tickLower, tickSpacing);
			
 
				+    const tickArrayUpperStartIndex = TickUtils.getTickArrayStartIndexByTick(tickUpper, tickSpacing);
			
 
				+
			
 
				+    const { publicKey: tickArrayLower } = getPdaTickArrayAddress(programId, poolId, tickArrayLowerStartIndex);
			
 
				+    const { publicKey: tickArrayUpper } = getPdaTickArrayAddress(programId, poolId, tickArrayUpperStartIndex);
			
 
				+
			
 
				+    const { publicKey: positionNftAccount } = getATAAddress(ownerInfo.wallet, nftMintAccount, TOKEN_2022_PROGRAM_ID);
			
 
				+    const { publicKey: personalPosition } = getPdaPersonalPositionAddress(programId, nftMintAccount);
			
 
				+    const { publicKey: protocolPosition } = getPdaProtocolPositionAddress(programId, poolId, tickLower, tickUpper);
			
 
				+
			
 
				+    const instruction = await BaseInstruction.openPositionFromBaseInstruction22(
			
 
				+      programId,
			
 
				+      ownerInfo.feePayer,
			
 
				+      poolId,
			
 
				+      ownerInfo.wallet,
			
 
				+      nftMintAccount,
			
 
				+      positionNftAccount,
			
 
				+      protocolPosition,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      personalPosition,
			
 
				+      ownerInfo.tokenAccountA,
			
 
				+      ownerInfo.tokenAccountB,
			
 
				+      poolInfo.vaultA,
			
 
				+      poolInfo.vaultB,
			
 
				+      poolInfo.mintA,
			
 
				+      poolInfo.mintB,
			
 
				+      tickLower,
			
 
				+      tickUpper,
			
 
				+      tickArrayLowerStartIndex,
			
 
				+      tickArrayUpperStartIndex,
			
 
				+      withMetadata,
			
 
				+      base,
			
 
				+      baseAmount,
			
 
				+      otherAmountMax,
			
 
				+      PoolUtils.isOverflowDefaultTickarrayBitmap(tickSpacing, [tickArrayLowerStartIndex, tickArrayUpperStartIndex])
			
 
				+        ? getPdaExBitmapAccount(programId, poolId).publicKey
			
 
				+        : undefined
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+      signers,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async closePositionInstruction(params: {
			
 
				+    programId: PublicKey;
			
 
				+    nftMint: PublicKey;
			
 
				+    ownerWallet: PublicKey;
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] closePositionInstruction fn params:', JSON.stringify(params, null, 2));
			
 
				+
			
 
				+    const { programId, nftMint, ownerWallet } = params;
			
 
				+    const positionNftAccount = getATAAddress(ownerWallet, nftMint, TOKEN_2022_PROGRAM_ID).publicKey;
			
 
				+
			
 
				+    const instruction = await BaseInstruction.closePositionInstruction(
			
 
				+      programId,
			
 
				+      ownerWallet,
			
 
				+      nftMint,
			
 
				+      positionNftAccount,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async increasePositionFromLiquidityInstructions(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerPosition: IPersonalPositionLayout;
			
 
				+    ownerInfo: {
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+    };
			
 
				+
			
 
				+    liquidity: BN;
			
 
				+    amountMaxA: BN;
			
 
				+    amountMaxB: BN;
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] increasePositionFromLiquidityInstructions fn params:', JSON.stringify(params, null, 2));
			
 
				+
			
 
				+    const { poolInfo, ownerPosition, ownerInfo, liquidity, amountMaxA, amountMaxB } = params;
			
 
				+    const { programId, poolId, tickSpacing } = poolInfo;
			
 
				+
			
 
				+    const tickArrayLowerStartIndex = TickUtils.getTickArrayStartIndexByTick(ownerPosition.tickLower, tickSpacing);
			
 
				+    const tickArrayUpperStartIndex = TickUtils.getTickArrayStartIndexByTick(ownerPosition.tickUpper, tickSpacing);
			
 
				+
			
 
				+    const { publicKey: tickArrayLower } = getPdaTickArrayAddress(programId, poolId, tickArrayLowerStartIndex);
			
 
				+    const { publicKey: tickArrayUpper } = getPdaTickArrayAddress(programId, poolId, tickArrayUpperStartIndex);
			
 
				+
			
 
				+    const { publicKey: positionNftAccount } = getATAAddress(
			
 
				+      ownerInfo.wallet,
			
 
				+      ownerPosition.nftMint,
			
 
				+      TOKEN_2022_PROGRAM_ID
			
 
				+    );
			
 
				+
			
 
				+    const { publicKey: personalPosition } = getPdaPersonalPositionAddress(programId, ownerPosition.nftMint);
			
 
				+    const { publicKey: protocolPosition } = getPdaProtocolPositionAddress(
			
 
				+      programId,
			
 
				+      poolId,
			
 
				+      ownerPosition.tickLower,
			
 
				+      ownerPosition.tickUpper
			
 
				+    );
			
 
				+
			
 
				+    const instruction = await BaseInstruction.increasePositionFromLiquidityInstruction(
			
 
				+      programId,
			
 
				+      ownerInfo.wallet,
			
 
				+      positionNftAccount,
			
 
				+      personalPosition,
			
 
				+      poolId,
			
 
				+      protocolPosition,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      ownerInfo.tokenAccountA,
			
 
				+      ownerInfo.tokenAccountB,
			
 
				+      poolInfo.vaultA,
			
 
				+      poolInfo.vaultB,
			
 
				+      poolInfo.mintA,
			
 
				+      poolInfo.mintB,
			
 
				+      liquidity,
			
 
				+      amountMaxA,
			
 
				+      amountMaxB,
			
 
				+      PoolUtils.isOverflowDefaultTickarrayBitmap(tickSpacing, [tickArrayLowerStartIndex, tickArrayUpperStartIndex])
			
 
				+        ? getPdaExBitmapAccount(programId, poolId).publicKey
			
 
				+        : undefined
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async increasePositionFromBaseInstructions(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerPosition: IPersonalPositionLayout;
			
 
				+    ownerInfo: {
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+    };
			
 
				+    base: 'MintA' | 'MintB';
			
 
				+    baseAmount: BN;
			
 
				+    otherAmountMax: BN;
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] increasePositionFromBaseInstructions fn params:', JSON.stringify(params, null, 2));
			
 
				+
			
 
				+    const { poolInfo, ownerPosition, ownerInfo, base, baseAmount, otherAmountMax } = params;
			
 
				+    const { programId, poolId, tickSpacing } = poolInfo;
			
 
				+
			
 
				+    const tickArrayLowerStartIndex = TickUtils.getTickArrayStartIndexByTick(ownerPosition.tickLower, tickSpacing);
			
 
				+    const tickArrayUpperStartIndex = TickUtils.getTickArrayStartIndexByTick(ownerPosition.tickUpper, tickSpacing);
			
 
				+
			
 
				+    const { publicKey: tickArrayLower } = getPdaTickArrayAddress(programId, poolId, tickArrayLowerStartIndex);
			
 
				+    const { publicKey: tickArrayUpper } = getPdaTickArrayAddress(programId, poolId, tickArrayUpperStartIndex);
			
 
				+
			
 
				+    const { publicKey: positionNftAccount } = getATAAddress(
			
 
				+      ownerInfo.wallet,
			
 
				+      ownerPosition.nftMint,
			
 
				+      TOKEN_2022_PROGRAM_ID
			
 
				+    );
			
 
				+
			
 
				+    const { publicKey: personalPosition } = getPdaPersonalPositionAddress(programId, ownerPosition.nftMint);
			
 
				+    const { publicKey: protocolPosition } = getPdaProtocolPositionAddress(
			
 
				+      programId,
			
 
				+      poolId,
			
 
				+      ownerPosition.tickLower,
			
 
				+      ownerPosition.tickUpper
			
 
				+    );
			
 
				+
			
 
				+    const instruction = await BaseInstruction.increasePositionFromBaseInstruction(
			
 
				+      programId,
			
 
				+      ownerInfo.wallet,
			
 
				+      positionNftAccount,
			
 
				+      personalPosition,
			
 
				+      poolId,
			
 
				+      protocolPosition,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      ownerInfo.tokenAccountA,
			
 
				+      ownerInfo.tokenAccountB,
			
 
				+      poolInfo.vaultA,
			
 
				+      poolInfo.vaultB,
			
 
				+      poolInfo.mintA,
			
 
				+      poolInfo.mintB,
			
 
				+      base,
			
 
				+      baseAmount,
			
 
				+      otherAmountMax,
			
 
				+      PoolUtils.isOverflowDefaultTickarrayBitmap(tickSpacing, [tickArrayLowerStartIndex, tickArrayUpperStartIndex])
			
 
				+        ? getPdaExBitmapAccount(programId, poolId).publicKey
			
 
				+        : undefined
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async decreaseLiquidityInstructions(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerPosition: IPersonalPositionLayout;
			
 
				+    ownerInfo: {
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+      // rewardAccounts: PublicKey[];
			
 
				+    };
			
 
				+    liquidity: BN;
			
 
				+    amountMinA: BN;
			
 
				+    amountMinB: BN;
			
 
				+  }): Promise<{
			
 
				+    instructions: TransactionInstruction[];
			
 
				+  }> {
			
 
				+    // console.log('[clmm sdk] decreaseLiquidityInstructions fn params:', JSON.stringify(params, null, 2));
			
 
				+
			
 
				+    const { poolInfo, ownerPosition, ownerInfo, liquidity, amountMinA, amountMinB } = params;
			
 
				+    const { programId, poolId, tickSpacing } = poolInfo;
			
 
				+
			
 
				+    const tickArrayLowerStartIndex = TickUtils.getTickArrayStartIndexByTick(ownerPosition.tickLower, tickSpacing);
			
 
				+    const tickArrayUpperStartIndex = TickUtils.getTickArrayStartIndexByTick(ownerPosition.tickUpper, tickSpacing);
			
 
				+
			
 
				+    const { publicKey: tickArrayLower } = getPdaTickArrayAddress(programId, poolId, tickArrayLowerStartIndex);
			
 
				+    const { publicKey: tickArrayUpper } = getPdaTickArrayAddress(programId, poolId, tickArrayUpperStartIndex);
			
 
				+    const { publicKey: positionNftAccount } = getATAAddress(
			
 
				+      ownerInfo.wallet,
			
 
				+      ownerPosition.nftMint,
			
 
				+      TOKEN_2022_PROGRAM_ID
			
 
				+    );
			
 
				+    const { publicKey: personalPosition } = getPdaPersonalPositionAddress(programId, ownerPosition.nftMint);
			
 
				+    const { publicKey: protocolPosition } = getPdaProtocolPositionAddress(
			
 
				+      programId,
			
 
				+      poolId,
			
 
				+      ownerPosition.tickLower,
			
 
				+      ownerPosition.tickUpper
			
 
				+    );
			
 
				+
			
 
				+    const rewardAccounts = poolInfo.rewardInfos
			
 
				+      .filter((info) => !info.openTime.isZero() && !info.tokenMint.equals(PublicKey.default))
			
 
				+      .map((rewardInfo) => ({
			
 
				+        poolRewardVault: rewardInfo.tokenVault,
			
 
				+        ownerRewardVault: getATAAddress(ownerInfo.wallet, rewardInfo.tokenMint).publicKey,
			
 
				+        rewardMint: rewardInfo.tokenMint,
			
 
				+      }));
			
 
				+
			
 
				+    const instruction = await BaseInstruction.decreaseLiquidityInstruction(
			
 
				+      programId,
			
 
				+      ownerInfo.wallet,
			
 
				+      positionNftAccount,
			
 
				+      personalPosition,
			
 
				+      poolId,
			
 
				+      protocolPosition,
			
 
				+      tickArrayLower,
			
 
				+      tickArrayUpper,
			
 
				+      ownerInfo.tokenAccountA,
			
 
				+      ownerInfo.tokenAccountB,
			
 
				+      poolInfo.vaultA,
			
 
				+      poolInfo.vaultB,
			
 
				+      poolInfo.mintA,
			
 
				+      poolInfo.mintB,
			
 
				+      rewardAccounts,
			
 
				+
			
 
				+      liquidity,
			
 
				+      amountMinA,
			
 
				+      amountMinB,
			
 
				+      PoolUtils.isOverflowDefaultTickarrayBitmap(tickSpacing, [tickArrayLowerStartIndex, tickArrayUpperStartIndex])
			
 
				+        ? getPdaExBitmapAccount(programId, poolId).publicKey
			
 
				+        : undefined
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async swapBaseInInstruction(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerInfo: {
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+    };
			
 
				+    amount: BN;
			
 
				+    otherAmountThreshold: BN;
			
 
				+    sqrtPriceLimitX64: BN;
			
 
				+    isInputMintA: boolean;
			
 
				+    exTickArrayBitmap?: PublicKey;
			
 
				+    tickArray: PublicKey[];
			
 
				+  }) {
			
 
				+    const {
			
 
				+      poolInfo,
			
 
				+      ownerInfo,
			
 
				+      amount,
			
 
				+      otherAmountThreshold,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      exTickArrayBitmap,
			
 
				+      tickArray,
			
 
				+      isInputMintA,
			
 
				+    } = params;
			
 
				+
			
 
				+    const instruction = await BaseInstruction.swapInstruction(
			
 
				+      poolInfo.programId,
			
 
				+      ownerInfo.wallet,
			
 
				+      poolInfo.poolId,
			
 
				+      poolInfo.ammConfig,
			
 
				+      isInputMintA ? ownerInfo.tokenAccountA : ownerInfo.tokenAccountB,
			
 
				+      isInputMintA ? ownerInfo.tokenAccountB : ownerInfo.tokenAccountA,
			
 
				+      isInputMintA ? poolInfo.vaultA : poolInfo.vaultB,
			
 
				+      isInputMintA ? poolInfo.vaultB : poolInfo.vaultA,
			
 
				+      isInputMintA ? poolInfo.mintA : poolInfo.mintB,
			
 
				+      isInputMintA ? poolInfo.mintB : poolInfo.mintA,
			
 
				+      tickArray,
			
 
				+      poolInfo.observationId,
			
 
				+      amount,
			
 
				+      otherAmountThreshold,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      true,
			
 
				+      exTickArrayBitmap
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  static async swapBaseOutInstruction(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    ownerInfo: {
			
 
				+      wallet: PublicKey;
			
 
				+      tokenAccountA: PublicKey;
			
 
				+      tokenAccountB: PublicKey;
			
 
				+    };
			
 
				+    amount: BN;
			
 
				+    otherAmountThreshold: BN;
			
 
				+    sqrtPriceLimitX64: BN;
			
 
				+    isOutputMintA: boolean;
			
 
				+    exTickArrayBitmap?: PublicKey;
			
 
				+    tickArray: PublicKey[];
			
 
				+  }) {
			
 
				+    const {
			
 
				+      poolInfo,
			
 
				+      ownerInfo,
			
 
				+      amount,
			
 
				+      otherAmountThreshold,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      exTickArrayBitmap,
			
 
				+      tickArray,
			
 
				+      isOutputMintA,
			
 
				+    } = params;
			
 
				+
			
 
				+    // For exact output, input and output are reversed
			
 
				+    // If output is mintA, then input is mintB
			
 
				+    const instruction = await BaseInstruction.swapInstruction(
			
 
				+      poolInfo.programId,
			
 
				+      ownerInfo.wallet,
			
 
				+      poolInfo.poolId,
			
 
				+      poolInfo.ammConfig,
			
 
				+      isOutputMintA ? ownerInfo.tokenAccountB : ownerInfo.tokenAccountA,
			
 
				+      isOutputMintA ? ownerInfo.tokenAccountA : ownerInfo.tokenAccountB,
			
 
				+      isOutputMintA ? poolInfo.vaultB : poolInfo.vaultA,
			
 
				+      isOutputMintA ? poolInfo.vaultA : poolInfo.vaultB,
			
 
				+      isOutputMintA ? poolInfo.mintB : poolInfo.mintA,
			
 
				+      isOutputMintA ? poolInfo.mintA : poolInfo.mintB,
			
 
				+      tickArray,
			
 
				+      poolInfo.observationId,
			
 
				+      amount,
			
 
				+      otherAmountThreshold,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      false, // isBaseInput = false for exact output
			
 
				+      exTickArrayBitmap
			
 
				+    );
			
 
				+
			
 
				+    return {
			
 
				+      instructions: [instruction],
			
 
				+    };
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/layout.ts
+++ b/src/lib/clmm-sdk/src/instructions/layout.ts
@@ -0,0 +1,255 @@
 
				+import { TICK_ARRAY_SIZE, EXTENSION_TICKARRAY_BITMAP_SIZE } from '../constants.js';
			
 
				+
			
 
				+import {
			
 
				+  blob,
			
 
				+  bool,
			
 
				+  i128,
			
 
				+  i64,
			
 
				+  publicKey,
			
 
				+  s32,
			
 
				+  seq,
			
 
				+  struct,
			
 
				+  u128,
			
 
				+  u16,
			
 
				+  u32,
			
 
				+  u64,
			
 
				+  u8,
			
 
				+} from './libs/marshmallow/index.js';
			
 
				+
			
 
				+/**
			
 
				+ * @description Pool configuration layout
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/EdPxg8QaeFSrTYqdWJn6Kezwy9McWncTYueD9eMGCuzR#anchorData
			
 
				+ */
			
 
				+export const AmmConfigLayout = struct([
			
 
				+  blob(8),
			
 
				+  u8('bump'),
			
 
				+  u16('index'),
			
 
				+  publicKey('owner'),
			
 
				+  u32('protocolFeeRate'),
			
 
				+  u32('tradeFeeRate'),
			
 
				+  u16('tickSpacing'),
			
 
				+  u32('fundFeeRate'),
			
 
				+  u32('padding'),
			
 
				+  publicKey('fundOwner'),
			
 
				+]);
			
 
				+
			
 
				+export type IAmmConfigLayout = ReturnType<typeof AmmConfigLayout.decode>;
			
 
				+
			
 
				+/**
			
 
				+ * @description Observation account layout
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/AA5RaVvyGyZgtmAsJJHT5ZVBxVPtAXuYaMwfgeFJW4Mk#anchorData
			
 
				+ */
			
 
				+export const ObservationLayout = struct([
			
 
				+  blob(8),
			
 
				+  bool('initialized'),
			
 
				+  u64('recentEpoch'),
			
 
				+  u16('observationIndex'),
			
 
				+  publicKey('poolId'),
			
 
				+  seq(struct([u32('blockTimestamp'), i64('tickCumulative'), seq(u64(), 4)]), 100, 'observations'),
			
 
				+]);
			
 
				+
			
 
				+export type IObservationLayout = ReturnType<typeof ObservationLayout.decode>;
			
 
				+
			
 
				+/**
			
 
				+ * @description Pool information layout
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/CYbD9RaToYMtWKA7QZyoLahnHdWq553Vm62Lh6qWtuxq#anchorData
			
 
				+ */
			
 
				+export const PoolLayout = struct([
			
 
				+  blob(8),
			
 
				+  u8('bump'),
			
 
				+  publicKey('ammConfig'),
			
 
				+  publicKey('creator'),
			
 
				+  publicKey('mintA'),
			
 
				+  publicKey('mintB'),
			
 
				+  publicKey('vaultA'),
			
 
				+  publicKey('vaultB'),
			
 
				+  publicKey('observationId'),
			
 
				+  u8('mintDecimalsA'),
			
 
				+  u8('mintDecimalsB'),
			
 
				+  u16('tickSpacing'),
			
 
				+  u128('liquidity'),
			
 
				+  u128('sqrtPriceX64'),
			
 
				+  s32('tickCurrent'),
			
 
				+  u32(),
			
 
				+  u128('feeGrowthGlobalX64A'),
			
 
				+  u128('feeGrowthGlobalX64B'),
			
 
				+  u64('protocolFeesTokenA'),
			
 
				+  u64('protocolFeesTokenB'),
			
 
				+
			
 
				+  u128('swapInAmountTokenA'),
			
 
				+  u128('swapOutAmountTokenB'),
			
 
				+  u128('swapInAmountTokenB'),
			
 
				+  u128('swapOutAmountTokenA'),
			
 
				+
			
 
				+  u8('status'),
			
 
				+
			
 
				+  seq(u8(), 7, ''),
			
 
				+
			
 
				+  seq(
			
 
				+    struct([
			
 
				+      u8('rewardState'),
			
 
				+      u64('openTime'),
			
 
				+      u64('endTime'),
			
 
				+      u64('lastUpdateTime'),
			
 
				+      u128('emissionsPerSecondX64'),
			
 
				+      u64('rewardTotalEmissioned'),
			
 
				+      u64('rewardClaimed'),
			
 
				+      publicKey('tokenMint'),
			
 
				+      publicKey('tokenVault'),
			
 
				+      publicKey('creator'),
			
 
				+      u128('rewardGrowthGlobalX64'),
			
 
				+    ]),
			
 
				+    3,
			
 
				+    'rewardInfos'
			
 
				+  ),
			
 
				+  seq(u64(), 16, 'tickArrayBitmap'),
			
 
				+
			
 
				+  u64('totalFeesTokenA'),
			
 
				+  u64('totalFeesClaimedTokenA'),
			
 
				+  u64('totalFeesTokenB'),
			
 
				+  u64('totalFeesClaimedTokenB'),
			
 
				+
			
 
				+  u64('fundFeesTokenA'),
			
 
				+  u64('fundFeesTokenB'),
			
 
				+
			
 
				+  u64('openTime'),
			
 
				+  u64('recentEpoch'),
			
 
				+
			
 
				+  u8('decayFeeFlag'),
			
 
				+  u8('decayFeeInitFeeRate'),
			
 
				+  u8('decayFeeDecreaseRate'),
			
 
				+  u8('decayFeeDecreaseInterval'),
			
 
				+  seq(u8(), 4, 'padding1_1'),
			
 
				+  seq(u64(), 23, 'padding1'),
			
 
				+  seq(u64(), 32, 'padding2'),
			
 
				+]);
			
 
				+
			
 
				+export type IPoolLayout = ReturnType<typeof PoolLayout.decode>;
			
 
				+
			
 
				+/**
			
 
				+ * @description Personal position information layout
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/CLYRosA3oGsx6WjuebDYmEL3kukTCSsncmYU6at8nDsn#anchorData
			
 
				+ */
			
 
				+export const PersonalPositionLayout = struct([
			
 
				+  blob(8),
			
 
				+  u8('bump'),
			
 
				+  publicKey('nftMint'),
			
 
				+  publicKey('poolId'),
			
 
				+
			
 
				+  s32('tickLower'),
			
 
				+  s32('tickUpper'),
			
 
				+  u128('liquidity'),
			
 
				+  u128('feeGrowthInsideLastX64A'),
			
 
				+  u128('feeGrowthInsideLastX64B'),
			
 
				+  u64('tokenFeesOwedA'),
			
 
				+  u64('tokenFeesOwedB'),
			
 
				+
			
 
				+  seq(struct([u128('growthInsideLastX64'), u64('rewardAmountOwed')]), 3, 'rewardInfos'),
			
 
				+]);
			
 
				+
			
 
				+export type IPersonalPositionLayout = ReturnType<typeof PersonalPositionLayout.decode>;
			
 
				+
			
 
				+/**
			
 
				+ * @description Protocol position information layout, used to track liquidity within specific price ranges
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/38GUhmh7vPyWStAV3YKEEYPHrLk2Mnw5jvaUQkMGS1hb#anchorData
			
 
				+ */
			
 
				+export const ProtocolPositionLayout = struct([
			
 
				+  blob(8),
			
 
				+  u8('bump'),
			
 
				+  publicKey('poolId'),
			
 
				+  s32('tickLowerIndex'),
			
 
				+  s32('tickUpperIndex'),
			
 
				+  u128('liquidity'),
			
 
				+  u128('feeGrowthInsideLastX64A'),
			
 
				+  u128('feeGrowthInsideLastX64B'),
			
 
				+  u64('tokenFeesOwedA'),
			
 
				+  u64('tokenFeesOwedB'),
			
 
				+  seq(u128(), 3, 'rewardGrowthInside'),
			
 
				+]);
			
 
				+
			
 
				+/**
			
 
				+ * @description Price tick array layout
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/4vGLPwfohNUd2o4NwZPMx7q8AH98DQ9Eth5tS1p8dew1#anchorData
			
 
				+ */
			
 
				+/**
			
 
				+ * @description TickState layout (168 bytes)
			
 
				+ */
			
 
				+export const TickStateLayout = struct([
			
 
				+  s32('tick'),
			
 
				+  i128('liquidityNet'),
			
 
				+  u128('liquidityGross'),
			
 
				+  u128('feeGrowthOutsideX64A'),
			
 
				+  u128('feeGrowthOutsideX64B'),
			
 
				+  seq(u128(), 3, 'rewardGrowthsOutsideX64'),
			
 
				+  seq(u32(), 13, ''),
			
 
				+]);
			
 
				+
			
 
				+export type ITickStateLayout = ReturnType<typeof TickStateLayout.decode>;
			
 
				+
			
 
				+export const TickArrayLayout = struct([
			
 
				+  blob(8),
			
 
				+  publicKey('poolId'),
			
 
				+  s32('startTickIndex'),
			
 
				+  seq(TickStateLayout, TICK_ARRAY_SIZE, 'ticks'),
			
 
				+  u8('initializedTickCount'),
			
 
				+]);
			
 
				+
			
 
				+export type ITickArrayLayout = ReturnType<typeof TickArrayLayout.decode>;
			
 
				+
			
 
				+/**
			
 
				+ * @description Dynamic Tick Array layout
			
 
				+ *
			
 
				+ * Dynamic tick arrays use a sparse storage model with a mapping table (tick_offset_index)
			
 
				+ * to track which logical tick positions have allocated TickStates.
			
 
				+ * This allows for more efficient memory usage compared to fixed tick arrays.
			
 
				+ *
			
 
				+ * Struct size: 208 bytes (32+4+4+60+1+1+2+8+96)
			
 
				+ * Header size: 216 bytes (8 discriminator + 208 struct)
			
 
				+ * Followed by dynamic number of TickStates (max 60, each 168 bytes)
			
 
				+ */
			
 
				+export const DynTickArrayLayout = struct([
			
 
				+  blob(8), // discriminator (8 bytes)
			
 
				+  publicKey('poolId'), // 32 bytes
			
 
				+  s32('startTickIndex'), // 4 bytes
			
 
				+  blob(4, 'padding0'), // 4 bytes
			
 
				+  seq(u8(), TICK_ARRAY_SIZE, 'tickOffsetIndex'), // 60 bytes - Mapping table: offset -> physical position + 1
			
 
				+  u8('allocTickCount'), // 1 byte - Number of allocated ticks
			
 
				+  u8('initializedTickCount'), // 1 byte - Number of initialized ticks
			
 
				+  blob(2, 'padding1'), // 2 bytes
			
 
				+  u64('recentEpoch'), // 8 bytes
			
 
				+  blob(96, 'padding2'), // 96 bytes
			
 
				+]);
			
 
				+
			
 
				+export type IDynTickArrayLayout = ReturnType<typeof DynTickArrayLayout.decode>;
			
 
				+
			
 
				+/**
			
 
				+ * @description Price tick array bitmap extension layout
			
 
				+ *
			
 
				+ * @example https://solscan.io/account/DoPuiZfJu7sypqwR4eiU7C5TMcmmiFoU4HaF5SoD8mRy#anchorData
			
 
				+ */
			
 
				+export const TickArrayBitmapExtensionLayout = struct([
			
 
				+  blob(8),
			
 
				+  publicKey('poolId'),
			
 
				+  seq(seq(u64(), 8), EXTENSION_TICKARRAY_BITMAP_SIZE, 'positiveTickArrayBitmap'),
			
 
				+  seq(seq(u64(), 8), EXTENSION_TICKARRAY_BITMAP_SIZE, 'negativeTickArrayBitmap'),
			
 
				+]);
			
 
				+
			
 
				+export const SPLTokenAccountLayout = struct([
			
 
				+  publicKey('mint'),
			
 
				+  publicKey('owner'),
			
 
				+  u64('amount'),
			
 
				+  u32('delegateOption'),
			
 
				+  publicKey('delegate'),
			
 
				+  u8('state'),
			
 
				+  u32('isNativeOption'),
			
 
				+  u64('isNative'),
			
 
				+  u64('delegatedAmount'),
			
 
				+  u32('closeAuthorityOption'),
			
 
				+  publicKey('closeAuthority'),
			
 
				+]);
			
--- a/src/lib/clmm-sdk/src/instructions/libs/marshmallow/bufferLayout.ts
+++ b/src/lib/clmm-sdk/src/instructions/libs/marshmallow/bufferLayout.ts
@@ -0,0 +1,211 @@
 
				+import {
			
 
				+  bits as _bits,
			
 
				+  BitStructure as _BitStructure,
			
 
				+  blob as _blob,
			
 
				+  Blob as _Blob,
			
 
				+  cstr as _cstr,
			
 
				+  f32 as _f32,
			
 
				+  f32be as _f32be,
			
 
				+  f64 as _f64,
			
 
				+  f64be as _f64be,
			
 
				+  greedy as _greedy,
			
 
				+  Layout as _Layout,
			
 
				+  ns64 as _ns64,
			
 
				+  ns64be as _ns64be,
			
 
				+  nu64 as _nu64,
			
 
				+  nu64be as _nu64be,
			
 
				+  offset as _offset,
			
 
				+  s16 as _s16,
			
 
				+  s16be as _s16be,
			
 
				+  s24 as _s24,
			
 
				+  s24be as _s24be,
			
 
				+  s32 as _s32,
			
 
				+  s32be as _s32be,
			
 
				+  s40 as _s40,
			
 
				+  s40be as _s40be,
			
 
				+  s48 as _s48,
			
 
				+  s48be as _s48be,
			
 
				+  s8 as _s8,
			
 
				+  seq as _seq,
			
 
				+  struct as _struct,
			
 
				+  Structure as _Structure,
			
 
				+  u16 as _u16,
			
 
				+  u16be as _u16be,
			
 
				+  u24 as _u24,
			
 
				+  u24be as _u24be,
			
 
				+  u32 as _u32,
			
 
				+  u32be as _u32be,
			
 
				+  u40 as _u40,
			
 
				+  u40be as _u40be,
			
 
				+  u48 as _u48,
			
 
				+  u48be as _u48be,
			
 
				+  u8 as _u8,
			
 
				+  UInt as _UInt,
			
 
				+  union as _union,
			
 
				+  Union as _Union,
			
 
				+  unionLayoutDiscriminator as _unionLayoutDiscriminator,
			
 
				+  utf8 as _utf8,
			
 
				+} from '@solana/buffer-layout';
			
 
				+
			
 
				+//#region ------------------- Layout -------------------
			
 
				+export interface Layout<T = any, P = ''> {
			
 
				+  span: number;
			
 
				+  property?: P;
			
 
				+  decode(b: Buffer, offset?: number): T;
			
 
				+  encode(src: T, b: Buffer, offset?: number): number;
			
 
				+  getSpan(b: Buffer, offset?: number): number;
			
 
				+  replicate<AP extends string>(name: AP): Layout<T, AP>;
			
 
				+}
			
 
				+export interface LayoutConstructor {
			
 
				+  new <T, P>(): Layout<T, P>; // for class extends syntex
			
 
				+  new <T, P>(span?: T, property?: P): Layout<T, P>;
			
 
				+  readonly prototype: Layout;
			
 
				+}
			
 
				+export const Layout = _Layout as unknown as LayoutConstructor;
			
 
				+//#endregion
			
 
				+
			
 
				+//#region ------------------- Structure -------------------
			
 
				+// eslint-disable-next-line @typescript-eslint/no-unused-vars
			
 
				+export interface Structure<T = any, P = '', DecodeSchema extends { [key: string]: any } = any>
			
 
				+  extends Layout<DecodeSchema, P> {
			
 
				+  span: number;
			
 
				+  decode(b: Buffer, offset?: number): DecodeSchema;
			
 
				+  layoutFor<AP extends string>(property: AP): Layout<DecodeSchema[AP]>;
			
 
				+  offsetOf<AP extends string>(property: AP): number;
			
 
				+}
			
 
				+interface StructureConstructor {
			
 
				+  new <T = any, P = '', DecodeSchema extends { [key: string]: any } = any>(): Structure<T, P, DecodeSchema>;
			
 
				+  new <T = any, P = '', DecodeSchema extends { [key: string]: any } = any>(
			
 
				+    fields: T,
			
 
				+    property?: P,
			
 
				+    decodePrefixes?: boolean
			
 
				+  ): Structure<T, P, DecodeSchema>;
			
 
				+}
			
 
				+export const Structure = _Structure as unknown as StructureConstructor;
			
 
				+//#endregion
			
 
				+
			
 
				+//#region ------------------- Union -------------------
			
 
				+export interface Union<UnionSchema extends { [key: string]: any } = any> extends Layout {
			
 
				+  registry: object;
			
 
				+  decode(b: Buffer, offset?: number): Partial<UnionSchema>;
			
 
				+  addVariant(
			
 
				+    variant: number,
			
 
				+    layout: Structure<any, any, Partial<UnionSchema>> | Layout<any, keyof UnionSchema>,
			
 
				+    property?: string
			
 
				+  ): any /* TEMP: code in Layout.js 1809 */;
			
 
				+}
			
 
				+interface UnionConstructor {
			
 
				+  new <UnionSchema extends { [key: string]: any } = any>(): Union<UnionSchema>;
			
 
				+  new <UnionSchema extends { [key: string]: any } = any>(
			
 
				+    discr: Layout<any, any>,
			
 
				+    defaultLayout: Layout<any, any>,
			
 
				+    property?: string
			
 
				+  ): Union<UnionSchema>;
			
 
				+}
			
 
				+export const Union = _Union as unknown as UnionConstructor;
			
 
				+//#endregion
			
 
				+
			
 
				+//#region ------------------- BitStructure -------------------
			
 
				+export type BitStructure<T = unknown /* TEMP */, P = ''> = Layout<T, P>;
			
 
				+interface BitStructureConstructor {
			
 
				+  new (...params: any[]): BitStructure;
			
 
				+}
			
 
				+export const BitStructure = _BitStructure as BitStructureConstructor;
			
 
				+//#endregion
			
 
				+
			
 
				+//#region ------------------- UInt -------------------
			
 
				+export type UInt<T = any, P = ''> = Layout<T, P>;
			
 
				+interface UIntConstructor {
			
 
				+  new <T, P>(span?: T, property?: P): UInt<T, P>;
			
 
				+}
			
 
				+export const UInt = _UInt as UIntConstructor;
			
 
				+//#endregion
			
 
				+
			
 
				+//#region ------------------- Blob -------------------
			
 
				+export type Blob<P extends string = ''> = Layout<Buffer, P>;
			
 
				+interface BlobConstructor {
			
 
				+  new (...params: ConstructorParameters<LayoutConstructor>): Blob;
			
 
				+}
			
 
				+export const Blob = _Blob as unknown as BlobConstructor;
			
 
				+//#endregion
			
 
				+
			
 
				+export const greedy = _greedy as <P extends string = ''>(elementSpan?: number, property?: P) => Layout<number, P>;
			
 
				+export const u8 = _u8 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u16 = _u16 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u24 = _u24 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u32 = _u32 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u40 = _u40 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u48 = _u48 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const nu64 = _nu64 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u16be = _u16be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u24be = _u24be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u32be = _u32be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u40be = _u40be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const u48be = _u48be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const nu64be = _nu64be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s8 = _s8 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s16 = _s16 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s24 = _s24 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s32 = _s32 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s40 = _s40 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s48 = _s48 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const ns64 = _ns64 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s16be = _s16be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s24be = _s24be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s32be = _s32be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s40be = _s40be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const s48be = _s48be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const ns64be = _ns64be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const f32 = _f32 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const f32be = _f32be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const f64 = _f64 as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+export const f64be = _f64be as <P extends string = ''>(property?: P) => Layout<number, P>;
			
 
				+
			
 
				+export const struct = _struct as <T, P extends string = ''>(
			
 
				+  fields: T,
			
 
				+  property?: P,
			
 
				+  decodePrefixes?: boolean
			
 
				+) => T extends Layout<infer Value, infer Property>[]
			
 
				+  ? Structure<
			
 
				+      Value,
			
 
				+      P,
			
 
				+      {
			
 
				+        [K in Exclude<Extract<Property, string>, ''>]: Extract<T[number], Layout<any, K>> extends Layout<infer V, any>
			
 
				+          ? V
			
 
				+          : any;
			
 
				+      }
			
 
				+    >
			
 
				+  : any;
			
 
				+
			
 
				+export const seq = _seq as unknown as <T, P>(
			
 
				+  elementLayout: Layout<T, string>,
			
 
				+  count: number | Layout<number, string>,
			
 
				+  property?: P
			
 
				+) => Layout<T[]>;
			
 
				+export const union = _union as <UnionSchema extends { [key: string]: any } = any>(
			
 
				+  discr: Layout<any, any>,
			
 
				+  defaultLayout?: any,
			
 
				+  property?: string
			
 
				+) => Union<UnionSchema>;
			
 
				+export const unionLayoutDiscriminator = _unionLayoutDiscriminator as <P extends string = ''>(
			
 
				+  layout: Layout<any, P>,
			
 
				+  property?: P
			
 
				+) => any;
			
 
				+export const blob = _blob as unknown as <P extends string = ''>(
			
 
				+  length: number | Layout<number, P>,
			
 
				+  property?: P
			
 
				+) => Blob<P>;
			
 
				+export const cstr = _cstr as <P extends string = ''>(property?: P) => Layout<string, P>;
			
 
				+export const utf8 = _utf8 as <P extends string = ''>(maxSpan: number, property?: P) => Layout<string, P>;
			
 
				+export const bits = _bits as unknown as <T, P extends string = ''>(
			
 
				+  word: Layout<T>,
			
 
				+  msb?: boolean,
			
 
				+  property?: P
			
 
				+) => BitStructure<T, P>;
			
 
				+export const offset = _offset as unknown as <T, P extends string = ''>(
			
 
				+  layout: Layout<T, P>,
			
 
				+  offset?: number,
			
 
				+  property?: P
			
 
				+) => Layout<T, P>;
			
 
				+
			
 
				+export type GetStructureSchema<T extends Structure> = T extends Structure<any, any, infer S> ? S : unknown;
			
--- a/src/lib/clmm-sdk/src/instructions/libs/marshmallow/index.ts
+++ b/src/lib/clmm-sdk/src/instructions/libs/marshmallow/index.ts
@@ -0,0 +1,374 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import {
			
 
				+  bits,
			
 
				+  blob,
			
 
				+  Blob,
			
 
				+  Layout,
			
 
				+  offset as _offset,
			
 
				+  seq as _seq,
			
 
				+  Structure as _Structure,
			
 
				+  u32 as _u32,
			
 
				+  u8 as _u8,
			
 
				+  UInt,
			
 
				+  union as _union,
			
 
				+  Union as _Union,
			
 
				+} from './bufferLayout.js';
			
 
				+
			
 
				+export * from './bufferLayout.js';
			
 
				+export { blob };
			
 
				+
			
 
				+export class BNLayout<P extends string = ''> extends Layout<BN, P> {
			
 
				+  blob: Layout<Buffer>;
			
 
				+  signed: boolean;
			
 
				+
			
 
				+  constructor(span: number, signed: boolean, property?: P) {
			
 
				+    super(span, property);
			
 
				+    this.blob = blob(span);
			
 
				+    this.signed = signed;
			
 
				+  }
			
 
				+
			
 
				+  /** @override */
			
 
				+  override decode(b: Buffer, offset = 0): BN {
			
 
				+    const num = new BN(this.blob.decode(b, offset), 10, 'le');
			
 
				+    if (this.signed) {
			
 
				+      return num.fromTwos(this.span * 8).clone();
			
 
				+    }
			
 
				+    return num;
			
 
				+  }
			
 
				+
			
 
				+  /** @override */
			
 
				+  override encode(src: BN, b: Buffer, offset = 0): number {
			
 
				+    if (typeof src === 'number') src = new BN(src); // src will pass a number accidently in union
			
 
				+    if (this.signed) {
			
 
				+      src = src.toTwos(this.span * 8);
			
 
				+    }
			
 
				+    return this.blob.encode(src.toArrayLike(Buffer, 'le', this.span), b, offset);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export class WideBits<P extends string = ''> extends Layout<Record<string, boolean>, P> {
			
 
				+  _lower: any;
			
 
				+  _upper: any;
			
 
				+  constructor(property?: P) {
			
 
				+    //@ts-expect-error type wrong for super()'s type different from extends , but it desn't matter
			
 
				+    super(8, property);
			
 
				+    this._lower = bits(_u32(), false);
			
 
				+    this._upper = bits(_u32(), false);
			
 
				+  }
			
 
				+
			
 
				+  addBoolean(property: string): void {
			
 
				+    if (this._lower.fields.length < 32) {
			
 
				+      this._lower.addBoolean(property);
			
 
				+    } else {
			
 
				+      this._upper.addBoolean(property);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  override decode(b: Buffer, offset = 0): Record<string, boolean> {
			
 
				+    const lowerDecoded = this._lower.decode(b, offset);
			
 
				+    const upperDecoded = this._upper.decode(b, offset + this._lower.span);
			
 
				+    return { ...lowerDecoded, ...upperDecoded };
			
 
				+  }
			
 
				+
			
 
				+  override encode(src: any /* TEMP */, b: Buffer, offset = 0): any {
			
 
				+    return this._lower.encode(src, b, offset) + this._upper.encode(src, b, offset + this._lower.span);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export function u8<P extends string = ''>(property?: P): UInt<number, P> {
			
 
				+  return new UInt(1, property);
			
 
				+}
			
 
				+
			
 
				+export function u32<P extends string = ''>(property?: P): UInt<number, P> {
			
 
				+  return new UInt(4, property);
			
 
				+}
			
 
				+
			
 
				+export function u64<P extends string = ''>(property?: P): BNLayout<P> {
			
 
				+  return new BNLayout(8, false, property);
			
 
				+}
			
 
				+
			
 
				+export function u128<P extends string = ''>(property?: P): BNLayout<P> {
			
 
				+  return new BNLayout(16, false, property);
			
 
				+}
			
 
				+
			
 
				+export function i8<P extends string = ''>(property?: P): BNLayout<P> {
			
 
				+  return new BNLayout(1, true, property);
			
 
				+}
			
 
				+
			
 
				+export function i64<P extends string = ''>(property?: P): BNLayout<P> {
			
 
				+  return new BNLayout(8, true, property);
			
 
				+}
			
 
				+
			
 
				+export function i128<P extends string = ''>(property?: P): BNLayout<P> {
			
 
				+  return new BNLayout(16, true, property);
			
 
				+}
			
 
				+
			
 
				+export class WrappedLayout<T, U, P extends string = ''> extends Layout<U, P> {
			
 
				+  layout: Layout<T>;
			
 
				+  decoder: (data: T) => U;
			
 
				+  encoder: (src: U) => T;
			
 
				+
			
 
				+  constructor(layout: Layout<T>, decoder: (data: T) => U, encoder: (src: U) => T, property?: P) {
			
 
				+    //@ts-expect-error type wrong for super()'s type different from extends , but it desn't matter
			
 
				+    super(layout.span, property);
			
 
				+    this.layout = layout;
			
 
				+    this.decoder = decoder;
			
 
				+    this.encoder = encoder;
			
 
				+  }
			
 
				+
			
 
				+  override decode(b: Buffer, offset?: number): U {
			
 
				+    return this.decoder(this.layout.decode(b, offset));
			
 
				+  }
			
 
				+
			
 
				+  override encode(src: U, b: Buffer, offset?: number): number {
			
 
				+    return this.layout.encode(this.encoder(src), b, offset);
			
 
				+  }
			
 
				+
			
 
				+  override getSpan(b: Buffer, offset?: number): number {
			
 
				+    return this.layout.getSpan(b, offset);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export function publicKey<P extends string = ''>(property?: P): Layout<PublicKey, P> {
			
 
				+  return new WrappedLayout(
			
 
				+    blob(32),
			
 
				+    (b: Buffer) => new PublicKey(b),
			
 
				+    (key: PublicKey) => key.toBuffer(),
			
 
				+    property
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+export class OptionLayout<T, P> extends Layout<T | null, P> {
			
 
				+  layout: Layout<T>;
			
 
				+  discriminator: Layout<number>;
			
 
				+
			
 
				+  constructor(layout: Layout<T>, property?: P) {
			
 
				+    //@ts-expect-error type wrong for super()'s type different from extends , but it desn't matter
			
 
				+    super(-1, property);
			
 
				+    this.layout = layout;
			
 
				+    this.discriminator = _u8();
			
 
				+  }
			
 
				+
			
 
				+  override encode(src: T | null, b: Buffer, offset = 0): number {
			
 
				+    if (src === null || src === undefined) {
			
 
				+      return this.discriminator.encode(0, b, offset);
			
 
				+    }
			
 
				+    this.discriminator.encode(1, b, offset);
			
 
				+    return this.layout.encode(src, b, offset + 1) + 1;
			
 
				+  }
			
 
				+
			
 
				+  override decode(b: Buffer, offset = 0): T | null {
			
 
				+    const discriminator = this.discriminator.decode(b, offset);
			
 
				+    if (discriminator === 0) {
			
 
				+      return null;
			
 
				+    } else if (discriminator === 1) {
			
 
				+      return this.layout.decode(b, offset + 1);
			
 
				+    }
			
 
				+    throw new Error('Invalid option ' + this.property);
			
 
				+  }
			
 
				+
			
 
				+  override getSpan(b: Buffer, offset = 0): number {
			
 
				+    const discriminator = this.discriminator.decode(b, offset);
			
 
				+    if (discriminator === 0) {
			
 
				+      return 1;
			
 
				+    } else if (discriminator === 1) {
			
 
				+      return this.layout.getSpan(b, offset + 1) + 1;
			
 
				+    }
			
 
				+    throw new Error('Invalid option ' + this.property);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export function option<T, P extends string = ''>(layout: Layout<T>, property?: P): Layout<T | null, P> {
			
 
				+  return new OptionLayout<T, P>(layout, property);
			
 
				+}
			
 
				+
			
 
				+export function bool<P extends string = ''>(property?: P): Layout<boolean, P> {
			
 
				+  return new WrappedLayout(_u8(), decodeBool, encodeBool, property);
			
 
				+}
			
 
				+
			
 
				+export function decodeBool(value: number): boolean {
			
 
				+  if (value === 0) {
			
 
				+    return false;
			
 
				+  } else if (value === 1) {
			
 
				+    return true;
			
 
				+  }
			
 
				+  throw new Error('Invalid bool: ' + value);
			
 
				+}
			
 
				+
			
 
				+export function encodeBool(value: boolean): number {
			
 
				+  return value ? 1 : 0;
			
 
				+}
			
 
				+
			
 
				+export function vec<T, P extends string = ''>(elementLayout: Layout<T>, property?: P): Layout<T[], P> {
			
 
				+  const length = _u32('length');
			
 
				+  const layout: Layout<{ values: T[] }> = struct([
			
 
				+    length,
			
 
				+    seq(elementLayout, _offset(length, -length.span), 'values'),
			
 
				+  ]) as any; // Something I don't know
			
 
				+  return new WrappedLayout(
			
 
				+    layout,
			
 
				+    ({ values }) => values,
			
 
				+    (values) => ({ values }),
			
 
				+    property
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+export function tagged<T, P extends string = ''>(tag: BN, layout: Layout<T>, property?: P): Layout<T, P> {
			
 
				+  const wrappedLayout: Layout<{ tag: BN; data: T }> = struct([u64('tag'), layout.replicate('data')]) as any; // Something I don't know
			
 
				+
			
 
				+  function decodeTag({ tag: receivedTag, data }: { tag: BN; data: T }): T {
			
 
				+    if (!receivedTag.eq(tag)) {
			
 
				+      throw new Error('Invalid tag, expected: ' + tag.toString('hex') + ', got: ' + receivedTag.toString('hex'));
			
 
				+    }
			
 
				+    return data;
			
 
				+  }
			
 
				+
			
 
				+  return new WrappedLayout(wrappedLayout, decodeTag, (data) => ({ tag, data }), property);
			
 
				+}
			
 
				+
			
 
				+export function vecU8<P extends string = ''>(property?: P): Layout<Buffer, P> {
			
 
				+  const length = _u32('length');
			
 
				+  const layout: Layout<{ data: Buffer }> = struct([length, blob(_offset(length, -length.span), 'data')]) as any; // Something I don't know
			
 
				+  return new WrappedLayout(
			
 
				+    layout,
			
 
				+    ({ data }) => data,
			
 
				+    (data) => ({ data }),
			
 
				+    property
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+export function str<P extends string = ''>(property?: P): Layout<string, P> {
			
 
				+  return new WrappedLayout(
			
 
				+    vecU8(),
			
 
				+    (data) => data.toString('utf-8'),
			
 
				+    (s) => Buffer.from(s, 'utf-8'),
			
 
				+    property
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+export interface EnumLayout<T, P extends string = ''> extends Layout<T, P> {
			
 
				+  registry: Record<string, Layout<any>>;
			
 
				+}
			
 
				+
			
 
				+export function rustEnum<T, P extends string = ''>(variants: Layout<any>[], property?: P): EnumLayout<T, P> {
			
 
				+  const unionLayout = _union(_u8(), property);
			
 
				+  variants.forEach((variant, index) => unionLayout.addVariant(index, variant, variant.property));
			
 
				+  return unionLayout as any; // ?why use UnionLayout? This must be a fault
			
 
				+}
			
 
				+
			
 
				+export function array<T, P extends string = ''>(
			
 
				+  elementLayout: Layout<T>,
			
 
				+  length: number,
			
 
				+  property?: P
			
 
				+): Layout<T[], P> {
			
 
				+  const layout = struct([seq(elementLayout, length, 'values')]) as any as Layout<{ values: T[] }>; // Something I don't know
			
 
				+  return new WrappedLayout(
			
 
				+    layout,
			
 
				+    ({ values }) => values,
			
 
				+    (values) => ({ values }),
			
 
				+    property
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+export class Structure<T, P, D extends { [key: string]: any }> extends _Structure<T, P, D> {
			
 
				+  /** @override */
			
 
				+  override decode(b: Buffer, offset?: number): D {
			
 
				+    return super.decode(b, offset);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export function struct<T, P extends string = ''>(
			
 
				+  fields: T,
			
 
				+  property?: P,
			
 
				+  decodePrefixes?: boolean
			
 
				+): T extends Layout<infer Value, infer Property>[]
			
 
				+  ? Structure<
			
 
				+      Value,
			
 
				+      P,
			
 
				+      {
			
 
				+        [K in Exclude<Extract<Property, string>, ''>]: Extract<T[number], Layout<any, K>> extends Layout<infer V, any>
			
 
				+          ? V
			
 
				+          : any;
			
 
				+      }
			
 
				+    >
			
 
				+  : any {
			
 
				+  //@ts-expect-error this type is not quite satisfied the define, but, never no need to worry about.
			
 
				+  return new Structure(fields, property, decodePrefixes);
			
 
				+}
			
 
				+
			
 
				+export type GetLayoutSchemaFromStructure<T extends Structure<any, any, any>> = T extends Structure<any, any, infer S>
			
 
				+  ? S
			
 
				+  : any;
			
 
				+export type GetStructureFromLayoutSchema<S extends { [key: string]: any }> = Structure<any, any, S>;
			
 
				+
			
 
				+export class Union<Schema extends { [key: string]: any }> extends _Union<Schema> {
			
 
				+  encodeInstruction(instruction: any): Buffer {
			
 
				+    const instructionMaxSpan = Math.max(...Object.values(this.registry).map((r) => r.span));
			
 
				+    const b = Buffer.alloc(instructionMaxSpan);
			
 
				+    return b.slice(0, this.encode(instruction, b));
			
 
				+  }
			
 
				+
			
 
				+  decodeInstruction(instruction: any): Partial<Schema> {
			
 
				+    return this.decode(instruction);
			
 
				+  }
			
 
				+}
			
 
				+export function union<UnionSchema extends { [key: string]: any } = any>(
			
 
				+  discr: any,
			
 
				+  defaultLayout?: any,
			
 
				+  property?: string
			
 
				+): Union<UnionSchema> {
			
 
				+  return new Union(discr, defaultLayout, property);
			
 
				+}
			
 
				+
			
 
				+class Zeros extends Blob {
			
 
				+  override decode(b: Buffer, offset: number): Buffer {
			
 
				+    const slice = super.decode(b, offset);
			
 
				+    if (!slice.every((v) => v === 0)) {
			
 
				+      throw new Error('nonzero padding bytes');
			
 
				+    }
			
 
				+    return slice;
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export function zeros(length: number): Zeros {
			
 
				+  return new Zeros(length);
			
 
				+}
			
 
				+
			
 
				+export function seq<T, P extends string = '', AnotherP extends string = ''>(
			
 
				+  elementLayout: Layout<T, P>,
			
 
				+  count: number | BN | Layout<BN | number, P>,
			
 
				+  property?: AnotherP
			
 
				+): Layout<T[], AnotherP> {
			
 
				+  let parsedCount: number;
			
 
				+  const superCount =
			
 
				+    typeof count === 'number'
			
 
				+      ? count
			
 
				+      : BN.isBN(count)
			
 
				+      ? count.toNumber()
			
 
				+      : new Proxy(count as unknown as Layout<number> /* pretend to be Layout<number> */, {
			
 
				+          get(target, property): any {
			
 
				+            if (!parsedCount) {
			
 
				+              // get count in targetLayout. note that count may be BN
			
 
				+              const countProperty = Reflect.get(target, 'count');
			
 
				+
			
 
				+              // let targetLayout's  property:count be a number
			
 
				+              parsedCount = BN.isBN(countProperty) ? countProperty.toNumber() : countProperty;
			
 
				+
			
 
				+              // record the count
			
 
				+              Reflect.set(target, 'count', parsedCount);
			
 
				+            }
			
 
				+            return Reflect.get(target, property);
			
 
				+          },
			
 
				+          set(target, property, value): any {
			
 
				+            if (property === 'count') {
			
 
				+              parsedCount = value;
			
 
				+            }
			
 
				+            return Reflect.set(target, property, value);
			
 
				+          },
			
 
				+        });
			
 
				+
			
 
				+  // @ts-expect-error force type
			
 
				+  return _seq(elementLayout, superCount, property);
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/models.ts
+++ b/src/lib/clmm-sdk/src/instructions/models.ts
@@ -0,0 +1,63 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { IPoolLayout } from './layout.js';
			
 
				+
			
 
				+// Get transfer amount and fee
			
 
				+export interface IGetTransferAmountFee {
			
 
				+  amount: BN;
			
 
				+  fee: BN | undefined;
			
 
				+  expirationTime: number | undefined;
			
 
				+}
			
 
				+
			
 
				+// Transfer fee configuration
			
 
				+export interface TransferFeeDataBaseType {
			
 
				+  transferFeeConfigAuthority: string;
			
 
				+  withdrawWithheldAuthority: string;
			
 
				+  withheldAmount: string;
			
 
				+  olderTransferFee: {
			
 
				+    epoch: string;
			
 
				+    maximumFee: string;
			
 
				+    transferFeeBasisPoints: number;
			
 
				+  };
			
 
				+  newerTransferFee: {
			
 
				+    epoch: string;
			
 
				+    maximumFee: string;
			
 
				+    transferFeeBasisPoints: number;
			
 
				+  };
			
 
				+}
			
 
				+
			
 
				+// Token information
			
 
				+export interface ITokenInfo {
			
 
				+  decimals: number;
			
 
				+  address: string;
			
 
				+  programId: string;
			
 
				+  // extensions: {
			
 
				+  //   feeConfig: TransferFeeDataBaseType;
			
 
				+  // };
			
 
				+}
			
 
				+
			
 
				+export type IPoolLayoutWithId = IPoolLayout & {
			
 
				+  currentPrice: number;
			
 
				+  programId: PublicKey;
			
 
				+  poolId: PublicKey;
			
 
				+};
			
 
				+
			
 
				+export interface IAccountInfo {
			
 
				+  pubkey: PublicKey;
			
 
				+  isSigner: boolean;
			
 
				+  isWritable: boolean;
			
 
				+}
			
 
				+
			
 
				+// Pool information (to be completed and improved)
			
 
				+// export interface IPoolInfo {
			
 
				+//   id: string;
			
 
				+//   programId: string;
			
 
				+//   tickSpacing: number;
			
 
				+//   tickCurrent: number;
			
 
				+//   sqrtPriceX64: BN;
			
 
				+//   mintA: ITokenInfo;
			
 
				+//   mintB: ITokenInfo;
			
 
				+//   vaultA: PublicKey;
			
 
				+//   vaultB: PublicKey;
			
 
				+// }
			
--- a/src/lib/clmm-sdk/src/instructions/pda.ts
+++ b/src/lib/clmm-sdk/src/instructions/pda.ts
@@ -0,0 +1,131 @@
 
				+import { TOKEN_PROGRAM_ID } from '@solana/spl-token';
			
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { i32ToBytes, u16ToBytes } from './utils/binaryUtils.js';
			
 
				+import { findProgramAddress } from './utils/index.js';
			
 
				+
			
 
				+export const AMM_CONFIG_SEED = Buffer.from('amm_config', 'utf8');
			
 
				+export const POOL_SEED = Buffer.from('pool', 'utf8');
			
 
				+export const POOL_VAULT_SEED = Buffer.from('pool_vault', 'utf8');
			
 
				+export const POOL_REWARD_VAULT_SEED = Buffer.from('pool_reward_vault', 'utf8');
			
 
				+export const POSITION_SEED = Buffer.from('position', 'utf8');
			
 
				+export const TICK_ARRAY_SEED = Buffer.from('tick_array', 'utf8');
			
 
				+export const OPERATION_SEED = Buffer.from('operation', 'utf8');
			
 
				+export const POOL_TICK_ARRAY_BITMAP_SEED = Buffer.from('pool_tick_array_bitmap_extension', 'utf8');
			
 
				+export const OBSERVATION_SEED = Buffer.from('observation', 'utf8');
			
 
				+export const SUPPORT_MINT_SEED = Buffer.from('support_mint', 'utf8');
			
 
				+
			
 
				+export function getPdaAmmConfigId(
			
 
				+  programId: PublicKey,
			
 
				+  index: number
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([AMM_CONFIG_SEED, u16ToBytes(index)], programId);
			
 
				+}
			
 
				+
			
 
				+export function getPdaPoolId(
			
 
				+  programId: PublicKey,
			
 
				+  ammConfigId: PublicKey,
			
 
				+  mintA: PublicKey,
			
 
				+  mintB: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([POOL_SEED, ammConfigId.toBuffer(), mintA.toBuffer(), mintB.toBuffer()], programId);
			
 
				+}
			
 
				+
			
 
				+export function getPdaPoolVaultId(
			
 
				+  programId: PublicKey,
			
 
				+  poolId: PublicKey,
			
 
				+  vaultMint: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([POOL_VAULT_SEED, poolId.toBuffer(), vaultMint.toBuffer()], programId);
			
 
				+}
			
 
				+
			
 
				+export function getPdaTickArrayAddress(
			
 
				+  programId: PublicKey,
			
 
				+  poolId: PublicKey,
			
 
				+  startIndex: number
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([TICK_ARRAY_SEED, poolId.toBuffer(), i32ToBytes(startIndex)], programId);
			
 
				+}
			
 
				+
			
 
				+export function getPdaProtocolPositionAddress(
			
 
				+  programId: PublicKey,
			
 
				+  poolId: PublicKey,
			
 
				+  tickLower: number,
			
 
				+  tickUpper: number
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress(
			
 
				+    [POSITION_SEED, poolId.toBuffer(), i32ToBytes(tickLower), i32ToBytes(tickUpper)],
			
 
				+    programId
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+export function getPdaPersonalPositionAddress(
			
 
				+  programId: PublicKey,
			
 
				+  nftMint: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([POSITION_SEED, nftMint.toBuffer()], programId);
			
 
				+}
			
 
				+
			
 
				+export function getPdaExBitmapAccount(
			
 
				+  programId: PublicKey,
			
 
				+  poolId: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([POOL_TICK_ARRAY_BITMAP_SEED, poolId.toBuffer()], programId);
			
 
				+}
			
 
				+
			
 
				+export function getPdaObservationAccount(
			
 
				+  programId: PublicKey,
			
 
				+  poolId: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([OBSERVATION_SEED, poolId.toBuffer()], programId);
			
 
				+}
			
 
				+
			
 
				+// New PDA seed, used to support mint extensions (e.g. token 2022)
			
 
				+export function getPdaMintExAccount(
			
 
				+  programId: PublicKey,
			
 
				+  mintAddress: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress([SUPPORT_MINT_SEED, mintAddress.toBuffer()], programId);
			
 
				+}
			
 
				+
			
 
				+// Get ATA address
			
 
				+export function getATAAddress(
			
 
				+  owner: PublicKey,
			
 
				+  mint: PublicKey,
			
 
				+  programId?: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  return findProgramAddress(
			
 
				+    [owner.toBuffer(), (programId ?? TOKEN_PROGRAM_ID).toBuffer(), mint.toBuffer()],
			
 
				+    new PublicKey('ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL')
			
 
				+  );
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/target/idl/byreal_amm_v3.json
+++ b/src/lib/clmm-sdk/src/instructions/target/idl/byreal_amm_v3.json
@@ -0,0 +1,7242 @@
 
				+{
			
 
				+  "address": "REALQqNEomY6cQGZJUGwywTBD2UmDT32rZcNnfxQ5N2",
			
 
				+  "metadata": {
			
 
				+    "name": "byreal_clmm",
			
 
				+    "version": "0.1.0",
			
 
				+    "spec": "0.1.0",
			
 
				+    "description": "Anchor client and source for Byreal concentrated liquidity AMM"
			
 
				+  },
			
 
				+  "instructions": [
			
 
				+    {
			
 
				+      "name": "claim_offchain_reward",
			
 
				+      "docs": [
			
 
				+        "claim offchain reward from the pool"
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        195,
			
 
				+        87,
			
 
				+        221,
			
 
				+        149,
			
 
				+        141,
			
 
				+        195,
			
 
				+        146,
			
 
				+        19
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "claimer",
			
 
				+          "docs": [
			
 
				+            "the address who claim the offchain reward."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "authority",
			
 
				+          "docs": [
			
 
				+            "The authority make decision that who can claim the offchain reward."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "Initialize amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_id",
			
 
				+          "docs": [
			
 
				+            "the pool id, which is the pool state account."
			
 
				+          ],
			
 
				+          "relations": [
			
 
				+            "reward_config"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_mint"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "claimer_token_account",
			
 
				+          "docs": [
			
 
				+            ""
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_vault_token_account",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "reward_config"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_program"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_config",
			
 
				+          "docs": [
			
 
				+            "The offchain reward config account, it also is the reward vault account."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  102,
			
 
				+                  102,
			
 
				+                  99,
			
 
				+                  104,
			
 
				+                  97,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  114,
			
 
				+                  101,
			
 
				+                  119,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  100
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_id"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Spl token program or token program 2022"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "close_position",
			
 
				+      "docs": [
			
 
				+        "Close the user's position and NFT account. If the NFT mint belongs to token2022, it will also be closed and the funds returned to the NFT owner.",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        123,
			
 
				+        134,
			
 
				+        81,
			
 
				+        0,
			
 
				+        49,
			
 
				+        68,
			
 
				+        98,
			
 
				+        98
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "nft_owner",
			
 
				+          "docs": [
			
 
				+            "The position nft owner"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_mint",
			
 
				+          "docs": [
			
 
				+            "Mint address bound to the personal position."
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_account",
			
 
				+          "docs": [
			
 
				+            "User token account where position NFT be minted to"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_mint"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "docs": [
			
 
				+            "System program to close the position state account"
			
 
				+          ],
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Token/Token2022 program to close token/mint account"
			
 
				+          ]
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": []
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "collect_fund_fee",
			
 
				+      "docs": [
			
 
				+        "Collect the fund fee accrued to the pool",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `amount_0_requested` - The maximum amount of token_0 to send, can be 0 to collect fees in only token_1",
			
 
				+        "* `amount_1_requested` - The maximum amount of token_1 to send, can be 0 to collect fees in only token_0",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        167,
			
 
				+        138,
			
 
				+        78,
			
 
				+        149,
			
 
				+        223,
			
 
				+        194,
			
 
				+        6,
			
 
				+        126
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions.",
			
 
				+            "anyone can collect fee, but only fee-manager in admin group can receive fee"
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Pool state stores accumulated protocol fee amount"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_0_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_1_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_0",
			
 
				+          "docs": [
			
 
				+            "The address that receives the collected token_0 protocol fees"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "admin_group.fee_keeper",
			
 
				+                "account": "AmmAdminGroup"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "vault_0_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_1",
			
 
				+          "docs": [
			
 
				+            "The address that receives the collected token_1 protocol fees"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "admin_group.fee_keeper",
			
 
				+                "account": "AmmAdminGroup"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "vault_1_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "The SPL program to perform token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "The SPL program 2022 to perform token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount_0_requested",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_requested",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "collect_protocol_fee",
			
 
				+      "docs": [
			
 
				+        "Collect the protocol fee accrued to the pool",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `amount_0_requested` - The maximum amount of token_0 to send, can be 0 to collect fees in only token_1",
			
 
				+        "* `amount_1_requested` - The maximum amount of token_1 to send, can be 0 to collect fees in only token_0",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        136,
			
 
				+        136,
			
 
				+        252,
			
 
				+        221,
			
 
				+        194,
			
 
				+        66,
			
 
				+        126,
			
 
				+        89
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions.",
			
 
				+            "anyone can collect fee, but only fee-manager in admin group can receive fee"
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Pool state stores accumulated protocol fee amount"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_0_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_1_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_0",
			
 
				+          "docs": [
			
 
				+            "The address that receives the collected token_0 protocol fees"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "admin_group.fee_keeper",
			
 
				+                "account": "AmmAdminGroup"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "vault_0_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_1",
			
 
				+          "docs": [
			
 
				+            "The address that receives the collected token_1 protocol fees"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "admin_group.fee_keeper",
			
 
				+                "account": "AmmAdminGroup"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "vault_1_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "The SPL program to perform token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "The SPL program 2022 to perform token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount_0_requested",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_requested",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "collect_remaining_rewards",
			
 
				+      "docs": [
			
 
				+        "Collect remaining reward token for reward founder",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `reward_index` - the index to reward info",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        18,
			
 
				+        237,
			
 
				+        166,
			
 
				+        197,
			
 
				+        34,
			
 
				+        16,
			
 
				+        213,
			
 
				+        144
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "reward_funder",
			
 
				+          "docs": [
			
 
				+            "The founder who init reward info previously"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "funder_token_account",
			
 
				+          "docs": [
			
 
				+            "The funder's reward token account"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Set reward for this pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_token_vault",
			
 
				+          "docs": [
			
 
				+            "Reward vault transfer remaining token to founder token account"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_vault_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of reward token vault"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "Token program 2022"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "memo_program",
			
 
				+          "docs": [
			
 
				+            "memo program"
			
 
				+          ],
			
 
				+          "address": "MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "reward_index",
			
 
				+          "type": "u8"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "create_amm_config",
			
 
				+      "docs": [
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The accounts needed by instruction.",
			
 
				+        "* `index` - The index of amm config, there may be multiple config.",
			
 
				+        "* `tick_spacing` - The tickspacing binding with config, cannot be changed.",
			
 
				+        "* `trade_fee_rate` - Trade fee rate, can be changed.",
			
 
				+        "* `protocol_fee_rate` - The rate of protocol fee within trade fee.",
			
 
				+        "* `fund_fee_rate` - The rate of fund fee within trade fee.",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        137,
			
 
				+        52,
			
 
				+        237,
			
 
				+        212,
			
 
				+        215,
			
 
				+        117,
			
 
				+        108,
			
 
				+        104
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "owner",
			
 
				+          "docs": [
			
 
				+            "Address to be set as normal manager in admin group."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config",
			
 
				+          "docs": [
			
 
				+            "Initialize config state account to store protocol owner address and fee rates."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  109,
			
 
				+                  109,
			
 
				+                  95,
			
 
				+                  99,
			
 
				+                  111,
			
 
				+                  110,
			
 
				+                  102,
			
 
				+                  105,
			
 
				+                  103
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "index",
			
 
				+          "type": "u16"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_spacing",
			
 
				+          "type": "u16"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "trade_fee_rate",
			
 
				+          "type": "u32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_fee_rate",
			
 
				+          "type": "u32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "fund_fee_rate",
			
 
				+          "type": "u32"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "create_operation_account",
			
 
				+      "docs": [
			
 
				+        "Creates an operation account for the program",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        63,
			
 
				+        87,
			
 
				+        148,
			
 
				+        33,
			
 
				+        109,
			
 
				+        35,
			
 
				+        8,
			
 
				+        104
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "owner",
			
 
				+          "docs": [
			
 
				+            "Address to be set as operation account owner."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "operation_state",
			
 
				+          "docs": [
			
 
				+            "Initialize operation state account to store operation owner address and white list mint."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  112,
			
 
				+                  101,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": []
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "create_pool",
			
 
				+      "docs": [
			
 
				+        "Creates a pool for the given token pair and the initial price",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `sqrt_price_x64` - the initial sqrt price (amount_token_1 / amount_token_0) of the pool as a Q64.64",
			
 
				+        "Note: The open_time must be smaller than the current block_timestamp on chain."
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        233,
			
 
				+        146,
			
 
				+        209,
			
 
				+        142,
			
 
				+        207,
			
 
				+        104,
			
 
				+        64,
			
 
				+        188
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "pool_creator",
			
 
				+          "docs": [
			
 
				+            "Address paying to create the pool. Can be anyone"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_manager",
			
 
				+          "docs": [
			
 
				+            "with pool_manager permission, the pool creator can create a pool."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config",
			
 
				+          "docs": [
			
 
				+            "Which config the pool belongs to."
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Initialize an account to store the pool state"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "amm_config"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint_0"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint_1"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "offchain_reward_config",
			
 
				+          "docs": [
			
 
				+            "Initialize an account to store the off-chain reward config"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  102,
			
 
				+                  102,
			
 
				+                  99,
			
 
				+                  104,
			
 
				+                  97,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  114,
			
 
				+                  101,
			
 
				+                  119,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  100
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_mint_0",
			
 
				+          "docs": [
			
 
				+            "Token_0 mint, the key must be smaller then token_1 mint."
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_mint_1",
			
 
				+          "docs": [
			
 
				+            "Token_1 mint"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "Token_0 vault for the pool"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108,
			
 
				+                  95,
			
 
				+                  118,
			
 
				+                  97,
			
 
				+                  117,
			
 
				+                  108,
			
 
				+                  116
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint_0"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "Token_1 vault for the pool"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108,
			
 
				+                  95,
			
 
				+                  118,
			
 
				+                  97,
			
 
				+                  117,
			
 
				+                  108,
			
 
				+                  116
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint_1"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "observation_state",
			
 
				+          "docs": [
			
 
				+            "Initialize an account to store oracle observations"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  98,
			
 
				+                  115,
			
 
				+                  101,
			
 
				+                  114,
			
 
				+                  118,
			
 
				+                  97,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_bitmap",
			
 
				+          "docs": [
			
 
				+            "Initialize an account to store if a tick array is initialized."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108,
			
 
				+                  95,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121,
			
 
				+                  95,
			
 
				+                  98,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  109,
			
 
				+                  97,
			
 
				+                  112,
			
 
				+                  95,
			
 
				+                  101,
			
 
				+                  120,
			
 
				+                  116,
			
 
				+                  101,
			
 
				+                  110,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_0",
			
 
				+          "docs": [
			
 
				+            "Spl token program or token program 2022"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_1",
			
 
				+          "docs": [
			
 
				+            "Spl token program or token program 2022"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "docs": [
			
 
				+            "To create a new program account"
			
 
				+          ],
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "rent",
			
 
				+          "docs": [
			
 
				+            "Sysvar for program account"
			
 
				+          ],
			
 
				+          "address": "SysvarRent111111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "sqrt_price_x64",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "open_time",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "create_support_mint_associated",
			
 
				+      "docs": [
			
 
				+        "Create support token22 mint account which can create pool and send rewards with ignoring the not support extensions."
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        17,
			
 
				+        251,
			
 
				+        65,
			
 
				+        92,
			
 
				+        136,
			
 
				+        242,
			
 
				+        14,
			
 
				+        169
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "owner",
			
 
				+          "docs": [
			
 
				+            "Address to be set as protocol owner."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_mint",
			
 
				+          "docs": [
			
 
				+            "Support token mint"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "support_mint_associated",
			
 
				+          "docs": [
			
 
				+            "Initialize support mint state account to store support mint address and bump."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  115,
			
 
				+                  117,
			
 
				+                  112,
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  114,
			
 
				+                  116,
			
 
				+                  95,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  116
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": []
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "decrease_liquidity",
			
 
				+      "docs": [
			
 
				+        "#[deprecated(note = \"Use `decrease_liquidity_v2` instead.\")]",
			
 
				+        "Decreases liquidity for an existing position",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` -  The context of accounts",
			
 
				+        "* `liquidity` - The amount by which liquidity will be decreased",
			
 
				+        "* `amount_0_min` - The minimum amount of token_0 that should be accounted for the burned liquidity",
			
 
				+        "* `amount_1_min` - The minimum amount of token_1 that should be accounted for the burned liquidity",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        160,
			
 
				+        38,
			
 
				+        208,
			
 
				+        111,
			
 
				+        104,
			
 
				+        91,
			
 
				+        44,
			
 
				+        1
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "nft_owner",
			
 
				+          "docs": [
			
 
				+            "The position owner or delegated authority"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "nft_account",
			
 
				+          "docs": [
			
 
				+            "The token account for the tokenized position"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "Decrease liquidity for this position"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_lower_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_upper_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "Token_0 vault"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "Token_1 vault"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the lower tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the upper tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_0",
			
 
				+          "docs": [
			
 
				+            "The destination token account for receive amount_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_1",
			
 
				+          "docs": [
			
 
				+            "The destination token account for receive amount_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "SPL program to transfer out tokens"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_min",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_min",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "decrease_liquidity_v2",
			
 
				+      "docs": [
			
 
				+        "Decreases liquidity for an existing position, support Token2022",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` -  The context of accounts",
			
 
				+        "* `liquidity` - The amount by which liquidity will be decreased",
			
 
				+        "* `amount_0_min` - The minimum amount of token_0 that should be accounted for the burned liquidity",
			
 
				+        "* `amount_1_min` - The minimum amount of token_1 that should be accounted for the burned liquidity",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        58,
			
 
				+        127,
			
 
				+        188,
			
 
				+        62,
			
 
				+        79,
			
 
				+        82,
			
 
				+        196,
			
 
				+        96
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "nft_owner",
			
 
				+          "docs": [
			
 
				+            "The position owner or delegated authority"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "nft_account",
			
 
				+          "docs": [
			
 
				+            "The token account for the tokenized position"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "Decrease liquidity for this position"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_lower_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_upper_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "Token_0 vault"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "Token_1 vault"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the lower tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the upper tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_0",
			
 
				+          "docs": [
			
 
				+            "The destination token account for receive amount_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "recipient_token_account_1",
			
 
				+          "docs": [
			
 
				+            "The destination token account for receive amount_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "SPL program to transfer out tokens"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "Token program 2022"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "memo_program",
			
 
				+          "docs": [
			
 
				+            "memo program"
			
 
				+          ],
			
 
				+          "address": "MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_0_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_1_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_min",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_min",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "deposit_offchain_reward",
			
 
				+      "docs": [
			
 
				+        "deposit offchain reward into the pool"
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        97,
			
 
				+        125,
			
 
				+        48,
			
 
				+        169,
			
 
				+        92,
			
 
				+        241,
			
 
				+        44,
			
 
				+        142
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "the address paying to deposit the offchain reward."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "authority",
			
 
				+          "docs": [
			
 
				+            "The authority make decision that who can deposit the offchain reward."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "Initialize amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_id",
			
 
				+          "docs": [
			
 
				+            "the pool id, which is the pool state account."
			
 
				+          ],
			
 
				+          "relations": [
			
 
				+            "reward_config"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_mint"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "payer_token_account",
			
 
				+          "docs": [
			
 
				+            ""
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_vault_token_account",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "reward_config"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_program"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_config",
			
 
				+          "docs": [
			
 
				+            "The offchain reward config account, it also is the reward vault account."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  102,
			
 
				+                  102,
			
 
				+                  99,
			
 
				+                  104,
			
 
				+                  97,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  114,
			
 
				+                  101,
			
 
				+                  119,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  100
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_id"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Spl token program or token program 2022"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "increase_liquidity",
			
 
				+      "docs": [
			
 
				+        "#[deprecated(note = \"Use `increase_liquidity_v2` instead.\")]",
			
 
				+        "Increases liquidity for an existing position, with amount paid by `payer`",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `liquidity` - The desired liquidity to be added, can't be zero",
			
 
				+        "* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check",
			
 
				+        "* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        46,
			
 
				+        156,
			
 
				+        243,
			
 
				+        118,
			
 
				+        13,
			
 
				+        205,
			
 
				+        251,
			
 
				+        178
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "nft_owner",
			
 
				+          "docs": [
			
 
				+            "Pays to mint the position"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "nft_account",
			
 
				+          "docs": [
			
 
				+            "The token account for nft"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_lower_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_upper_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "Increase liquidity for this position"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the lower tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the upper tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_0",
			
 
				+          "docs": [
			
 
				+            "The payer's token account for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_1",
			
 
				+          "docs": [
			
 
				+            "The token account spending token_1 to mint the position"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create mint account and mint tokens"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_max",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "increase_liquidity_v2",
			
 
				+      "docs": [
			
 
				+        "Increases liquidity for an existing position, with amount paid by `payer`, support Token2022",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `liquidity` - The desired liquidity to be added, if zero, calculate liquidity base amount_0 or amount_1 according base_flag",
			
 
				+        "* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check",
			
 
				+        "* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check",
			
 
				+        "* `base_flag` - must be specified if liquidity is zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        133,
			
 
				+        29,
			
 
				+        89,
			
 
				+        223,
			
 
				+        69,
			
 
				+        238,
			
 
				+        176,
			
 
				+        10
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "nft_owner",
			
 
				+          "docs": [
			
 
				+            "Pays to mint the position"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "nft_account",
			
 
				+          "docs": [
			
 
				+            "The token account for nft"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_lower_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "personal_position.tick_upper_index",
			
 
				+                "account": "PersonalPositionState"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "Increase liquidity for this position"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the lower tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "docs": [
			
 
				+            "Stores init state for the upper tick"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_0",
			
 
				+          "docs": [
			
 
				+            "The payer's token account for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_1",
			
 
				+          "docs": [
			
 
				+            "The token account spending token_1 to mint the position"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create mint account and mint tokens"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "Token program 2022"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_0_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_1_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "base_flag",
			
 
				+          "type": {
			
 
				+            "option": "bool"
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "init_amm_admin_group",
			
 
				+      "docs": [
			
 
				+        "Initialize the AMM admin group account, which is used to manage the AMM protocol."
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        209,
			
 
				+        108,
			
 
				+        32,
			
 
				+        246,
			
 
				+        157,
			
 
				+        214,
			
 
				+        237,
			
 
				+        86
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "only super admin can create admin group"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true,
			
 
				+          "address": "AY196f8U5EvM999PVnvLmyvaUnzL4GLiFaGKUgnJXN6o"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "Initialize amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "params",
			
 
				+          "type": {
			
 
				+            "defined": {
			
 
				+              "name": "InitAdminGroupParams"
			
 
				+            }
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "initialize_reward",
			
 
				+      "docs": [
			
 
				+        "Initialize a reward info for a given pool and reward index",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `reward_index` - the index to reward info",
			
 
				+        "* `open_time` - reward open timestamp",
			
 
				+        "* `end_time` - reward end timestamp",
			
 
				+        "* `emissions_per_second_x64` - Token reward per second are earned per unit of liquidity.",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        95,
			
 
				+        135,
			
 
				+        192,
			
 
				+        196,
			
 
				+        242,
			
 
				+        129,
			
 
				+        230,
			
 
				+        68
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "reward_funder",
			
 
				+          "docs": [
			
 
				+            "The founder deposit reward token to vault"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "funder_token_account",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config",
			
 
				+          "docs": [
			
 
				+            "For check the reward_funder authority"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Set reward for this pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "operation_state",
			
 
				+          "docs": [
			
 
				+            "load info from the account to judge reward permission"
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  112,
			
 
				+                  101,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_token_mint",
			
 
				+          "docs": [
			
 
				+            "Reward mint"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_token_vault",
			
 
				+          "docs": [
			
 
				+            "A pda, reward vault"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108,
			
 
				+                  95,
			
 
				+                  114,
			
 
				+                  101,
			
 
				+                  119,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  100,
			
 
				+                  95,
			
 
				+                  118,
			
 
				+                  97,
			
 
				+                  117,
			
 
				+                  108,
			
 
				+                  116
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "reward_token_mint"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_token_program"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "rent",
			
 
				+          "address": "SysvarRent111111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "param",
			
 
				+          "type": {
			
 
				+            "defined": {
			
 
				+              "name": "InitializeRewardParam"
			
 
				+            }
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "open_position",
			
 
				+      "docs": [
			
 
				+        "#[deprecated(note = \"Use `open_position_with_token22_nft` instead.\")]",
			
 
				+        "Creates a new position wrapped in a NFT",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `tick_lower_index` - The low boundary of market",
			
 
				+        "* `tick_upper_index` - The upper boundary of market",
			
 
				+        "* `tick_array_lower_start_index` - The start index of tick array which include tick low",
			
 
				+        "* `tick_array_upper_start_index` - The start index of tick array which include tick upper",
			
 
				+        "* `liquidity` - The liquidity to be added",
			
 
				+        "* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check",
			
 
				+        "* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        135,
			
 
				+        128,
			
 
				+        47,
			
 
				+        77,
			
 
				+        15,
			
 
				+        152,
			
 
				+        240,
			
 
				+        49
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "Pays to mint the position"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_owner"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_mint",
			
 
				+          "docs": [
			
 
				+            "Unique token mint address"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_account",
			
 
				+          "docs": [
			
 
				+            "Token account where position NFT will be minted",
			
 
				+            "This account created in the contract by cpi to avoid large stack variables"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_owner"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "metadata_account",
			
 
				+          "docs": [
			
 
				+            "To store metaplex metadata"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Add liquidity for this pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "docs": [
			
 
				+            "Store the information of market marking in range"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_lower_index"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_upper_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_array_lower_start_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_array_upper_start_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "personal position state"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_mint"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_0",
			
 
				+          "docs": [
			
 
				+            "The token_0 account deposit token to the pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_1",
			
 
				+          "docs": [
			
 
				+            "The token_1 account deposit token to the pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "rent",
			
 
				+          "docs": [
			
 
				+            "Sysvar for token mint and ATA creation"
			
 
				+          ],
			
 
				+          "address": "SysvarRent111111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "docs": [
			
 
				+            "Program to create the position manager state account"
			
 
				+          ],
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create mint account and mint tokens"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create an ATA for receiving position NFT"
			
 
				+          ],
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "metadata_program",
			
 
				+          "docs": [
			
 
				+            "Program to create NFT metadata"
			
 
				+          ],
			
 
				+          "address": "metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "tick_lower_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_upper_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower_start_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper_start_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_max",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "open_position_v2",
			
 
				+      "docs": [
			
 
				+        "#[deprecated(note = \"Use `open_position_with_token22_nft` instead.\")]",
			
 
				+        "Creates a new position wrapped in a NFT, support Token2022",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `tick_lower_index` - The low boundary of market",
			
 
				+        "* `tick_upper_index` - The upper boundary of market",
			
 
				+        "* `tick_array_lower_start_index` - The start index of tick array which include tick low",
			
 
				+        "* `tick_array_upper_start_index` - The start index of tick array which include tick upper",
			
 
				+        "* `liquidity` - The liquidity to be added, if zero, and the base_flag is specified, calculate liquidity base amount_0_max or amount_1_max according base_flag, otherwise open position with zero liquidity",
			
 
				+        "* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check",
			
 
				+        "* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check",
			
 
				+        "* `with_metadata` - The flag indicating whether to create NFT mint metadata",
			
 
				+        "* `base_flag` - if the liquidity specified as zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        77,
			
 
				+        184,
			
 
				+        74,
			
 
				+        214,
			
 
				+        112,
			
 
				+        86,
			
 
				+        241,
			
 
				+        199
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "Pays to mint the position"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_owner"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_mint",
			
 
				+          "docs": [
			
 
				+            "Unique token mint address"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_account",
			
 
				+          "docs": [
			
 
				+            "Token account where position NFT will be minted"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_owner"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "metadata_account",
			
 
				+          "docs": [
			
 
				+            "To store metaplex metadata"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Add liquidity for this pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "docs": [
			
 
				+            "Store the information of market marking in range"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_lower_index"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_upper_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_array_lower_start_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_array_upper_start_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "personal position state"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_mint"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_0",
			
 
				+          "docs": [
			
 
				+            "The token_0 account deposit token to the pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_1",
			
 
				+          "docs": [
			
 
				+            "The token_1 account deposit token to the pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "rent",
			
 
				+          "docs": [
			
 
				+            "Sysvar for token mint and ATA creation"
			
 
				+          ],
			
 
				+          "address": "SysvarRent111111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "docs": [
			
 
				+            "Program to create the position manager state account"
			
 
				+          ],
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create mint account and mint tokens"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create an ATA for receiving position NFT"
			
 
				+          ],
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "metadata_program",
			
 
				+          "docs": [
			
 
				+            "Program to create NFT metadata"
			
 
				+          ],
			
 
				+          "address": "metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "Program to create mint account and mint tokens"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_0_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_1_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "tick_lower_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_upper_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower_start_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper_start_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "with_metadata",
			
 
				+          "type": "bool"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "base_flag",
			
 
				+          "type": {
			
 
				+            "option": "bool"
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "open_position_with_token22_nft",
			
 
				+      "docs": [
			
 
				+        "Creates a new position wrapped in a Token2022 NFT without relying on metadata_program and metadata_account, reduce the cost for user to create a personal position.",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `tick_lower_index` - The low boundary of market",
			
 
				+        "* `tick_upper_index` - The upper boundary of market",
			
 
				+        "* `tick_array_lower_start_index` - The start index of tick array which include tick low",
			
 
				+        "* `tick_array_upper_start_index` - The start index of tick array which include tick upper",
			
 
				+        "* `liquidity` - The liquidity to be added, if zero, and the base_flag is specified, calculate liquidity base amount_0_max or amount_1_max according base_flag, otherwise open position with zero liquidity",
			
 
				+        "* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check",
			
 
				+        "* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check",
			
 
				+        "* `with_metadata` - The flag indicating whether to create NFT mint metadata",
			
 
				+        "* `base_flag` - if the liquidity specified as zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        77,
			
 
				+        255,
			
 
				+        174,
			
 
				+        82,
			
 
				+        125,
			
 
				+        29,
			
 
				+        201,
			
 
				+        46
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "Pays to mint the position"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_owner"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_mint",
			
 
				+          "docs": [
			
 
				+            "Unique token mint address, initialize in contract"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "position_nft_account",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "Add liquidity for this pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "protocol_position",
			
 
				+          "docs": [
			
 
				+            "Store the information of market marking in range"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_lower_index"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_upper_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_array_lower_start_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_state"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "arg",
			
 
				+                "path": "tick_array_upper_start_index"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "personal_position",
			
 
				+          "docs": [
			
 
				+            "personal position state"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "position_nft_mint"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_0",
			
 
				+          "docs": [
			
 
				+            "The token_0 account deposit token to the pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_account_1",
			
 
				+          "docs": [
			
 
				+            "The token_1 account deposit token to the pool"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_0",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_0"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_vault_1",
			
 
				+          "docs": [
			
 
				+            "The address that holds pool tokens for token_1"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "rent",
			
 
				+          "docs": [
			
 
				+            "Sysvar for token mint and ATA creation"
			
 
				+          ],
			
 
				+          "address": "SysvarRent111111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "docs": [
			
 
				+            "Program to create the position manager state account"
			
 
				+          ],
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Program to transfer for token account"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "docs": [
			
 
				+            "Program to create an ATA for receiving position NFT"
			
 
				+          ],
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "Program to create NFT mint/token account and transfer for token22 account"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_0_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "vault_1_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "tick_lower_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_upper_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_lower_start_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array_upper_start_index",
			
 
				+          "type": "i32"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "liquidity",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_0_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amount_1_max",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "with_metadata",
			
 
				+          "type": "bool"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "base_flag",
			
 
				+          "type": {
			
 
				+            "option": "bool"
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "set_reward_params",
			
 
				+      "docs": [
			
 
				+        "Reset reward param, start a new reward cycle or extend the current cycle.",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `reward_index` - The index of reward token in the pool.",
			
 
				+        "* `emissions_per_second_x64` - The per second emission reward, when extend the current cycle,",
			
 
				+        "new value can't be less than old value",
			
 
				+        "* `open_time` - reward open timestamp, must be set when starting a new cycle",
			
 
				+        "* `end_time` - reward end timestamp",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        112,
			
 
				+        52,
			
 
				+        167,
			
 
				+        75,
			
 
				+        32,
			
 
				+        201,
			
 
				+        211,
			
 
				+        137
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "authority",
			
 
				+          "docs": [
			
 
				+            "Address to be set as protocol owner. It pays to create factory state account."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "operation_state",
			
 
				+          "docs": [
			
 
				+            "load info from the account to judge reward permission"
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  112,
			
 
				+                  101,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Token program"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "Token program 2022"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "reward_index",
			
 
				+          "type": "u8"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "emissions_per_second_x64",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "open_time",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "end_time",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "swap",
			
 
				+      "docs": [
			
 
				+        "#[deprecated(note = \"Use `swap_v2` instead.\")]",
			
 
				+        "Swaps one token for as much as possible of another token across a single pool",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `amount` - Arranged in pairs with other_amount_threshold. (amount_in, amount_out_minimum) or (amount_out, amount_in_maximum)",
			
 
				+        "* `other_amount_threshold` - For slippage check",
			
 
				+        "* `sqrt_price_limit` - The Q64.64 sqrt price √P limit. If zero for one, the price cannot",
			
 
				+        "* `is_base_input` - swap base input or swap base output",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        248,
			
 
				+        198,
			
 
				+        158,
			
 
				+        145,
			
 
				+        225,
			
 
				+        117,
			
 
				+        135,
			
 
				+        200
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "The user performing the swap"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config",
			
 
				+          "docs": [
			
 
				+            "The factory state to read protocol fees"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "The program account of the pool in which the swap will be performed"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "input_token_account",
			
 
				+          "docs": [
			
 
				+            "The user token account for input token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "output_token_account",
			
 
				+          "docs": [
			
 
				+            "The user token account for output token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "input_vault",
			
 
				+          "docs": [
			
 
				+            "The vault token account for input token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "output_vault",
			
 
				+          "docs": [
			
 
				+            "The vault token account for output token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "observation_state",
			
 
				+          "docs": [
			
 
				+            "The program account for the most recent oracle observation"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "SPL program for token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "tick_array",
			
 
				+          "writable": true
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "other_amount_threshold",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "sqrt_price_limit_x64",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "is_base_input",
			
 
				+          "type": "bool"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "swap_v2",
			
 
				+      "docs": [
			
 
				+        "Swaps one token for as much as possible of another token across a single pool, support token program 2022",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx` - The context of accounts",
			
 
				+        "* `amount` - Arranged in pairs with other_amount_threshold. (amount_in, amount_out_minimum) or (amount_out, amount_in_maximum)",
			
 
				+        "* `other_amount_threshold` - For slippage check",
			
 
				+        "* `sqrt_price_limit` - The Q64.64 sqrt price √P limit. If zero for one, the price cannot",
			
 
				+        "* `is_base_input` - swap base input or swap base output",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        43,
			
 
				+        4,
			
 
				+        237,
			
 
				+        11,
			
 
				+        26,
			
 
				+        201,
			
 
				+        30,
			
 
				+        98
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "The user performing the swap"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config",
			
 
				+          "docs": [
			
 
				+            "The factory state to read protocol fees"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "The program account of the pool in which the swap will be performed"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "input_token_account",
			
 
				+          "docs": [
			
 
				+            "The user token account for input token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "output_token_account",
			
 
				+          "docs": [
			
 
				+            "The user token account for output token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "input_vault",
			
 
				+          "docs": [
			
 
				+            "The vault token account for input token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "output_vault",
			
 
				+          "docs": [
			
 
				+            "The vault token account for output token"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "observation_state",
			
 
				+          "docs": [
			
 
				+            "The program account for the most recent oracle observation"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "SPL program for token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program_2022",
			
 
				+          "docs": [
			
 
				+            "SPL program 2022 for token transfers"
			
 
				+          ],
			
 
				+          "address": "TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "memo_program",
			
 
				+          "docs": [
			
 
				+            "Memo program"
			
 
				+          ],
			
 
				+          "address": "MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "input_vault_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 0"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "output_vault_mint",
			
 
				+          "docs": [
			
 
				+            "The mint of token vault 1"
			
 
				+          ]
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "other_amount_threshold",
			
 
				+          "type": "u64"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "sqrt_price_limit_x64",
			
 
				+          "type": "u128"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "is_base_input",
			
 
				+          "type": "bool"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "transfer_reward_owner",
			
 
				+      "docs": [
			
 
				+        "Transfer reward owner",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `new_owner`- new owner pubkey",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        7,
			
 
				+        22,
			
 
				+        12,
			
 
				+        83,
			
 
				+        242,
			
 
				+        43,
			
 
				+        48,
			
 
				+        121
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "authority",
			
 
				+          "docs": [
			
 
				+            "Address to be set as operation account owner."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "new_owner",
			
 
				+          "type": "pubkey"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "update_amm_admin_group",
			
 
				+      "docs": [
			
 
				+        "Update the AMM admin group account, which is used to manage the AMM protocol."
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        61,
			
 
				+        183,
			
 
				+        185,
			
 
				+        188,
			
 
				+        82,
			
 
				+        81,
			
 
				+        141,
			
 
				+        197
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "payer",
			
 
				+          "docs": [
			
 
				+            "only super admin can create admin group"
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "signer": true,
			
 
				+          "address": "AY196f8U5EvM999PVnvLmyvaUnzL4GLiFaGKUgnJXN6o"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "update amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "params",
			
 
				+          "type": {
			
 
				+            "defined": {
			
 
				+              "name": "UpdateAdminGroupParams"
			
 
				+            }
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "update_amm_config",
			
 
				+      "docs": [
			
 
				+        "Updates the owner of the amm config",
			
 
				+        "Must be called by the current owner or admin",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `trade_fee_rate`- The new trade fee rate of amm config, be set when `param` is 0",
			
 
				+        "* `protocol_fee_rate`- The new protocol fee rate of amm config, be set when `param` is 1",
			
 
				+        "* `fund_fee_rate`- The new fund fee rate of amm config, be set when `param` is 2",
			
 
				+        "* `new_owner`- The config's new owner, be set when `param` is 3",
			
 
				+        "* `new_fund_owner`- The config's new fund owner, be set when `param` is 4",
			
 
				+        "* `param`- The value can be 0 | 1 | 2 | 3 | 4, otherwise will report a error",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        49,
			
 
				+        60,
			
 
				+        174,
			
 
				+        136,
			
 
				+        154,
			
 
				+        28,
			
 
				+        116,
			
 
				+        200
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "owner",
			
 
				+          "docs": [
			
 
				+            "The amm config owner or admin"
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "amm_config",
			
 
				+          "docs": [
			
 
				+            "Amm config account to be changed"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "param",
			
 
				+          "type": "u8"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "value",
			
 
				+          "type": "u32"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "update_operation_account",
			
 
				+      "docs": [
			
 
				+        "Update the operation account",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `param`- The value can be 0 | 1 | 2 | 3, otherwise will report a error",
			
 
				+        "* `keys`- update operation owner when the `param` is 0",
			
 
				+        "remove operation owner when the `param` is 1",
			
 
				+        "update whitelist mint when the `param` is 2",
			
 
				+        "remove whitelist mint when the `param` is 3",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        127,
			
 
				+        70,
			
 
				+        119,
			
 
				+        40,
			
 
				+        188,
			
 
				+        227,
			
 
				+        61,
			
 
				+        7
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "owner",
			
 
				+          "docs": [
			
 
				+            "Address to be set as operation account owner."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "operation_state",
			
 
				+          "docs": [
			
 
				+            "Initialize operation state account to store operation owner address and white list mint."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  112,
			
 
				+                  101,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "system_program",
			
 
				+          "address": "11111111111111111111111111111111"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "param",
			
 
				+          "type": "u8"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "keys",
			
 
				+          "type": {
			
 
				+            "vec": "pubkey"
			
 
				+          }
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "update_pool_status",
			
 
				+      "docs": [
			
 
				+        "Update pool status for given value",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        "* `status` - The value of status",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        130,
			
 
				+        87,
			
 
				+        108,
			
 
				+        6,
			
 
				+        46,
			
 
				+        224,
			
 
				+        117,
			
 
				+        123
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "authority",
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "writable": true
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "status",
			
 
				+          "type": "u8"
			
 
				+        }
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "update_reward_infos",
			
 
				+      "docs": [
			
 
				+        "Update rewards info of the given pool, can be called for everyone",
			
 
				+        "",
			
 
				+        "# Arguments",
			
 
				+        "",
			
 
				+        "* `ctx`- The context of accounts",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        163,
			
 
				+        172,
			
 
				+        224,
			
 
				+        52,
			
 
				+        11,
			
 
				+        154,
			
 
				+        106,
			
 
				+        223
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "pool_state",
			
 
				+          "docs": [
			
 
				+            "The liquidity pool for which reward info to update"
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": []
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "withdraw_offchain_reward",
			
 
				+      "docs": [
			
 
				+        "withdraw offchain reward from the pool"
			
 
				+      ],
			
 
				+      "discriminator": [
			
 
				+        86,
			
 
				+        53,
			
 
				+        59,
			
 
				+        76,
			
 
				+        217,
			
 
				+        38,
			
 
				+        71,
			
 
				+        213
			
 
				+      ],
			
 
				+      "accounts": [
			
 
				+        {
			
 
				+          "name": "authority",
			
 
				+          "docs": [
			
 
				+            "The authority make decision that who can withdraw the offchain reward."
			
 
				+          ],
			
 
				+          "signer": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "admin_group",
			
 
				+          "docs": [
			
 
				+            "Initialize amm admin group account to store admin permissions."
			
 
				+          ],
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  97,
			
 
				+                  100,
			
 
				+                  109,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  103,
			
 
				+                  114,
			
 
				+                  111,
			
 
				+                  117,
			
 
				+                  112
			
 
				+                ]
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "pool_id",
			
 
				+          "docs": [
			
 
				+            "the pool id, which is the pool state account."
			
 
				+          ],
			
 
				+          "relations": [
			
 
				+            "reward_config"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_mint"
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "receiver_token_account",
			
 
				+          "docs": [
			
 
				+            "the address who receive the withdrawn offchain reward."
			
 
				+          ],
			
 
				+          "writable": true
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_vault_token_account",
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "reward_config"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_program"
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "token_mint"
			
 
				+              }
			
 
				+            ],
			
 
				+            "program": {
			
 
				+              "kind": "const",
			
 
				+              "value": [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "reward_config",
			
 
				+          "docs": [
			
 
				+            "The offchain reward config account, it also is the reward vault account."
			
 
				+          ],
			
 
				+          "writable": true,
			
 
				+          "pda": {
			
 
				+            "seeds": [
			
 
				+              {
			
 
				+                "kind": "const",
			
 
				+                "value": [
			
 
				+                  111,
			
 
				+                  102,
			
 
				+                  102,
			
 
				+                  99,
			
 
				+                  104,
			
 
				+                  97,
			
 
				+                  105,
			
 
				+                  110,
			
 
				+                  95,
			
 
				+                  114,
			
 
				+                  101,
			
 
				+                  119,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  100
			
 
				+                ]
			
 
				+              },
			
 
				+              {
			
 
				+                "kind": "account",
			
 
				+                "path": "pool_id"
			
 
				+              }
			
 
				+            ]
			
 
				+          }
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "token_program",
			
 
				+          "docs": [
			
 
				+            "Spl token program or token program 2022"
			
 
				+          ]
			
 
				+        },
			
 
				+        {
			
 
				+          "name": "associated_token_program",
			
 
				+          "address": "ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL"
			
 
				+        }
			
 
				+      ],
			
 
				+      "args": [
			
 
				+        {
			
 
				+          "name": "amount",
			
 
				+          "type": "u64"
			
 
				+        }
			
 
				+      ]
			
 
				+    }
			
 
				+  ],
			
 
				+  "accounts": [
			
 
				+    {
			
 
				+      "name": "AmmAdminGroup",
			
 
				+      "discriminator": [
			
 
				+        128,
			
 
				+        128,
			
 
				+        234,
			
 
				+        30,
			
 
				+        61,
			
 
				+        172,
			
 
				+        188,
			
 
				+        123
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "AmmConfig",
			
 
				+      "discriminator": [
			
 
				+        218,
			
 
				+        244,
			
 
				+        33,
			
 
				+        104,
			
 
				+        203,
			
 
				+        203,
			
 
				+        43,
			
 
				+        111
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ObservationState",
			
 
				+      "discriminator": [
			
 
				+        122,
			
 
				+        174,
			
 
				+        197,
			
 
				+        53,
			
 
				+        129,
			
 
				+        9,
			
 
				+        165,
			
 
				+        132
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "OffchainRewardConfig",
			
 
				+      "discriminator": [
			
 
				+        118,
			
 
				+        52,
			
 
				+        115,
			
 
				+        150,
			
 
				+        99,
			
 
				+        69,
			
 
				+        164,
			
 
				+        76
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "OperationState",
			
 
				+      "discriminator": [
			
 
				+        19,
			
 
				+        236,
			
 
				+        58,
			
 
				+        237,
			
 
				+        81,
			
 
				+        222,
			
 
				+        183,
			
 
				+        252
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PersonalPositionState",
			
 
				+      "discriminator": [
			
 
				+        70,
			
 
				+        111,
			
 
				+        150,
			
 
				+        126,
			
 
				+        230,
			
 
				+        15,
			
 
				+        25,
			
 
				+        117
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PoolState",
			
 
				+      "discriminator": [
			
 
				+        247,
			
 
				+        237,
			
 
				+        227,
			
 
				+        245,
			
 
				+        215,
			
 
				+        195,
			
 
				+        222,
			
 
				+        70
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ProtocolPositionState",
			
 
				+      "discriminator": [
			
 
				+        100,
			
 
				+        226,
			
 
				+        145,
			
 
				+        99,
			
 
				+        146,
			
 
				+        218,
			
 
				+        160,
			
 
				+        106
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "SupportMintAssociated",
			
 
				+      "discriminator": [
			
 
				+        134,
			
 
				+        40,
			
 
				+        183,
			
 
				+        79,
			
 
				+        12,
			
 
				+        112,
			
 
				+        162,
			
 
				+        53
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "TickArrayBitmapExtension",
			
 
				+      "discriminator": [
			
 
				+        60,
			
 
				+        150,
			
 
				+        36,
			
 
				+        219,
			
 
				+        97,
			
 
				+        128,
			
 
				+        139,
			
 
				+        153
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "TickArrayState",
			
 
				+      "discriminator": [
			
 
				+        192,
			
 
				+        155,
			
 
				+        85,
			
 
				+        205,
			
 
				+        49,
			
 
				+        249,
			
 
				+        129,
			
 
				+        42
			
 
				+      ]
			
 
				+    }
			
 
				+  ],
			
 
				+  "events": [
			
 
				+    {
			
 
				+      "name": "CollectPersonalFeeEvent",
			
 
				+      "discriminator": [
			
 
				+        166,
			
 
				+        174,
			
 
				+        105,
			
 
				+        192,
			
 
				+        81,
			
 
				+        161,
			
 
				+        83,
			
 
				+        105
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "CollectProtocolFeeEvent",
			
 
				+      "discriminator": [
			
 
				+        206,
			
 
				+        87,
			
 
				+        17,
			
 
				+        79,
			
 
				+        45,
			
 
				+        41,
			
 
				+        213,
			
 
				+        61
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ConfigChangeEvent",
			
 
				+      "discriminator": [
			
 
				+        247,
			
 
				+        189,
			
 
				+        7,
			
 
				+        119,
			
 
				+        106,
			
 
				+        112,
			
 
				+        95,
			
 
				+        151
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "CreatePersonalPositionEvent",
			
 
				+      "discriminator": [
			
 
				+        100,
			
 
				+        30,
			
 
				+        87,
			
 
				+        249,
			
 
				+        196,
			
 
				+        223,
			
 
				+        154,
			
 
				+        206
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "DecreaseLiquidityEvent",
			
 
				+      "discriminator": [
			
 
				+        58,
			
 
				+        222,
			
 
				+        86,
			
 
				+        58,
			
 
				+        68,
			
 
				+        50,
			
 
				+        85,
			
 
				+        56
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "IncreaseLiquidityEvent",
			
 
				+      "discriminator": [
			
 
				+        49,
			
 
				+        79,
			
 
				+        105,
			
 
				+        212,
			
 
				+        32,
			
 
				+        34,
			
 
				+        30,
			
 
				+        84
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "LiquidityCalculateEvent",
			
 
				+      "discriminator": [
			
 
				+        237,
			
 
				+        112,
			
 
				+        148,
			
 
				+        230,
			
 
				+        57,
			
 
				+        84,
			
 
				+        180,
			
 
				+        162
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "LiquidityChangeEvent",
			
 
				+      "discriminator": [
			
 
				+        126,
			
 
				+        240,
			
 
				+        175,
			
 
				+        206,
			
 
				+        158,
			
 
				+        88,
			
 
				+        153,
			
 
				+        107
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ModifyAmmAdminGroupEvent",
			
 
				+      "discriminator": [
			
 
				+        218,
			
 
				+        118,
			
 
				+        87,
			
 
				+        81,
			
 
				+        53,
			
 
				+        80,
			
 
				+        18,
			
 
				+        235
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PoolCreatedEvent",
			
 
				+      "discriminator": [
			
 
				+        25,
			
 
				+        94,
			
 
				+        75,
			
 
				+        47,
			
 
				+        112,
			
 
				+        99,
			
 
				+        53,
			
 
				+        63
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "SwapEvent",
			
 
				+      "discriminator": [
			
 
				+        64,
			
 
				+        198,
			
 
				+        205,
			
 
				+        232,
			
 
				+        38,
			
 
				+        8,
			
 
				+        113,
			
 
				+        226
			
 
				+      ]
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "UpdateRewardInfosEvent",
			
 
				+      "discriminator": [
			
 
				+        109,
			
 
				+        127,
			
 
				+        186,
			
 
				+        78,
			
 
				+        114,
			
 
				+        65,
			
 
				+        37,
			
 
				+        236
			
 
				+      ]
			
 
				+    }
			
 
				+  ],
			
 
				+  "errors": [
			
 
				+    {
			
 
				+      "code": 6000,
			
 
				+      "name": "LOK",
			
 
				+      "msg": "LOK"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6001,
			
 
				+      "name": "NotApproved",
			
 
				+      "msg": "Not approved"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6002,
			
 
				+      "name": "InvalidUpdateConfigFlag",
			
 
				+      "msg": "invalid update amm config flag"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6003,
			
 
				+      "name": "AccountLack",
			
 
				+      "msg": "Account lack"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6004,
			
 
				+      "name": "ClosePositionErr",
			
 
				+      "msg": "Remove liquitity, collect fees owed and reward then you can close position account"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6005,
			
 
				+      "name": "ZeroMintAmount",
			
 
				+      "msg": "Minting amount should be greater than 0"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6006,
			
 
				+      "name": "InvalidTickIndex",
			
 
				+      "msg": "Tick out of range"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6007,
			
 
				+      "name": "TickInvalidOrder",
			
 
				+      "msg": "The lower tick must be below the upper tick"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6008,
			
 
				+      "name": "TickLowerOverflow",
			
 
				+      "msg": "The tick must be greater, or equal to the minimum tick(-443636)"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6009,
			
 
				+      "name": "TickUpperOverflow",
			
 
				+      "msg": "The tick must be lesser than, or equal to the maximum tick(443636)"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6010,
			
 
				+      "name": "TickAndSpacingNotMatch",
			
 
				+      "msg": "tick % tick_spacing must be zero"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6011,
			
 
				+      "name": "InvalidTickArray",
			
 
				+      "msg": "Invalid tick array account"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6012,
			
 
				+      "name": "InvalidTickArrayBoundary",
			
 
				+      "msg": "Invalid tick array boundary"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6013,
			
 
				+      "name": "SqrtPriceLimitOverflow",
			
 
				+      "msg": "Square root price limit overflow"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6014,
			
 
				+      "name": "SqrtPriceX64",
			
 
				+      "msg": "sqrt_price_x64 out of range"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6015,
			
 
				+      "name": "LiquiditySubValueErr",
			
 
				+      "msg": "Liquidity sub delta L must be smaller than before"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6016,
			
 
				+      "name": "LiquidityAddValueErr",
			
 
				+      "msg": "Liquidity add delta L must be greater, or equal to before"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6017,
			
 
				+      "name": "InvalidLiquidity",
			
 
				+      "msg": "Invalid liquidity when update position"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6018,
			
 
				+      "name": "ForbidBothZeroForSupplyLiquidity",
			
 
				+      "msg": "Both token amount must not be zero while supply liquidity"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6019,
			
 
				+      "name": "LiquidityInsufficient",
			
 
				+      "msg": "Liquidity insufficient"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6020,
			
 
				+      "name": "TransactionTooOld",
			
 
				+      "msg": "Transaction too old"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6021,
			
 
				+      "name": "PriceSlippageCheck",
			
 
				+      "msg": "Price slippage check"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6022,
			
 
				+      "name": "TooLittleOutputReceived",
			
 
				+      "msg": "Too little output received"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6023,
			
 
				+      "name": "TooMuchInputPaid",
			
 
				+      "msg": "Too much input paid"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6024,
			
 
				+      "name": "ZeroAmountSpecified",
			
 
				+      "msg": "Swap special amount can not be zero"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6025,
			
 
				+      "name": "InvalidInputPoolVault",
			
 
				+      "msg": "Input pool vault is invalid"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6026,
			
 
				+      "name": "TooSmallInputOrOutputAmount",
			
 
				+      "msg": "Swap input or output amount is too small"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6027,
			
 
				+      "name": "NotEnoughTickArrayAccount",
			
 
				+      "msg": "Not enought tick array account"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6028,
			
 
				+      "name": "InvalidFirstTickArrayAccount",
			
 
				+      "msg": "Invalid first tick array account"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6029,
			
 
				+      "name": "InvalidRewardIndex",
			
 
				+      "msg": "Invalid reward index"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6030,
			
 
				+      "name": "FullRewardInfo",
			
 
				+      "msg": "The init reward token reach to the max"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6031,
			
 
				+      "name": "RewardTokenAlreadyInUse",
			
 
				+      "msg": "The init reward token already in use"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6032,
			
 
				+      "name": "ExceptRewardMint",
			
 
				+      "msg": "The reward tokens must contain one of pool vault mint except the last reward"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6033,
			
 
				+      "name": "InvalidRewardInitParam",
			
 
				+      "msg": "Invalid reward init param"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6034,
			
 
				+      "name": "InvalidRewardDesiredAmount",
			
 
				+      "msg": "Invalid collect reward desired amount"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6035,
			
 
				+      "name": "InvalidRewardInputAccountNumber",
			
 
				+      "msg": "Invalid collect reward input account number"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6036,
			
 
				+      "name": "InvalidRewardPeriod",
			
 
				+      "msg": "Invalid reward period"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6037,
			
 
				+      "name": "NotApproveUpdateRewardEmissiones",
			
 
				+      "msg": "Modification of emissiones is allowed within 72 hours from the end of the previous cycle"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6038,
			
 
				+      "name": "UnInitializedRewardInfo",
			
 
				+      "msg": "uninitialized reward info"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6039,
			
 
				+      "name": "NotSupportMint",
			
 
				+      "msg": "Not support token_2022 mint extension"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6040,
			
 
				+      "name": "MissingTickArrayBitmapExtensionAccount",
			
 
				+      "msg": "Missing tickarray bitmap extension account"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6041,
			
 
				+      "name": "InsufficientLiquidityForDirection",
			
 
				+      "msg": "Insufficient liquidity for this direction"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6042,
			
 
				+      "name": "MaxTokenOverflow",
			
 
				+      "msg": "Max token overflow"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6043,
			
 
				+      "name": "CalculateOverflow",
			
 
				+      "msg": "Calculate overflow"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6044,
			
 
				+      "name": "TransferFeeCalculateNotMatch",
			
 
				+      "msg": "TransferFee calculate not match"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6045,
			
 
				+      "name": "IllegalAccountOwner",
			
 
				+      "msg": "invalid account owner"
			
 
				+    },
			
 
				+    {
			
 
				+      "code": 6046,
			
 
				+      "name": "InvalidAccount",
			
 
				+      "msg": "Invalid account"
			
 
				+    }
			
 
				+  ],
			
 
				+  "types": [
			
 
				+    {
			
 
				+      "name": "AmmAdminGroup",
			
 
				+      "docs": [
			
 
				+        "Holds the admin group information."
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "fee_keeper",
			
 
				+            "docs": [
			
 
				+              "the address who can hold the fee,",
			
 
				+              "anyone can trigger the fee collection action,"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_config_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can config the reward(config, deposit, withdraw),",
			
 
				+              "deposit reward, set the account who can deposit the reward, withdraw the remaining reward(withdraw)"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_claim_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the offchain reward claim"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the pool create action,",
			
 
				+              "without this account's permission, no one can create a pool"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "emergency_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the emergency action,",
			
 
				+              "emergency action includes stop/resume the pool, stop/resume withdraw lp"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "normal_manager",
			
 
				+            "docs": [
			
 
				+              "normal action manager,",
			
 
				+              "such as create amm config, update amm config"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pad",
			
 
				+            "docs": [
			
 
				+              "The space required for the account. may be used for future extensions."
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "pubkey",
			
 
				+                6
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "AmmConfig",
			
 
				+      "docs": [
			
 
				+        "Holds the current owner of the factory"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify PDA"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "index",
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "owner",
			
 
				+            "docs": [
			
 
				+              "Address of the protocol owner"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "protocol_fee_rate",
			
 
				+            "docs": [
			
 
				+              "The protocol fee"
			
 
				+            ],
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "trade_fee_rate",
			
 
				+            "docs": [
			
 
				+              "The trade fee, denominated in hundredths of a bip (10^-6)"
			
 
				+            ],
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_spacing",
			
 
				+            "docs": [
			
 
				+              "The tick spacing"
			
 
				+            ],
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fund_fee_rate",
			
 
				+            "docs": [
			
 
				+              "The fund fee, denominated in hundredths of a bip (10^-6)"
			
 
				+            ],
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding_u32",
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fund_owner",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "CollectPersonalFeeEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when tokens are collected for a position"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "position_nft_mint",
			
 
				+            "docs": [
			
 
				+              "The ID of the token for which underlying tokens were collected"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recipient_token_account_0",
			
 
				+            "docs": [
			
 
				+              "The token account that received the collected token_0 tokens"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recipient_token_account_1",
			
 
				+            "docs": [
			
 
				+              "The token account that received the collected token_1 tokens"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 owed to the position that was collected"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 owed to the position that was collected"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "CollectProtocolFeeEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when the collected protocol fees are withdrawn by the factory owner"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_state",
			
 
				+            "docs": [
			
 
				+              "The pool whose protocol fee is collected"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recipient_token_account_0",
			
 
				+            "docs": [
			
 
				+              "The address that receives the collected token_0 protocol fees"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recipient_token_account_1",
			
 
				+            "docs": [
			
 
				+              "The address that receives the collected token_1 protocol fees"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 protocol fees that is withdrawn"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 protocol fees that is withdrawn"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ConfigChangeEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when create or update a config"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "index",
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "owner",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "protocol_fee_rate",
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "trade_fee_rate",
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_spacing",
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fund_fee_rate",
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fund_owner",
			
 
				+            "type": "pubkey"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "CreatePersonalPositionEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when create a new position"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_state",
			
 
				+            "docs": [
			
 
				+              "The pool for which liquidity was added"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "minter",
			
 
				+            "docs": [
			
 
				+              "The address that create the position"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "nft_owner",
			
 
				+            "docs": [
			
 
				+              "The owner of the position and recipient of any minted liquidity"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_lower_index",
			
 
				+            "docs": [
			
 
				+              "The lower tick of the position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_upper_index",
			
 
				+            "docs": [
			
 
				+              "The upper tick of the position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The amount of liquidity minted to the position range"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "deposit_amount_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 was deposit for the liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "deposit_amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 was deposit for the liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "deposit_amount_0_transfer_fee",
			
 
				+            "docs": [
			
 
				+              "The token transfer fee for deposit_amount_0"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "deposit_amount_1_transfer_fee",
			
 
				+            "docs": [
			
 
				+              "The token transfer fee for deposit_amount_1"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "DecreaseLiquidityEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when liquidity is decreased."
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "position_nft_mint",
			
 
				+            "docs": [
			
 
				+              "The ID of the token for which liquidity was decreased"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The amount by which liquidity for the position was decreased"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "decrease_amount_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 that was paid for the decrease in liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "decrease_amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 that was paid for the decrease in liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_amount_0",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 fee"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_amounts",
			
 
				+            "docs": [
			
 
				+              "The amount of rewards"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "transfer_fee_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 transfer fee"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "transfer_fee_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 transfer fee"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "IncreaseLiquidityEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when liquidity is increased."
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "position_nft_mint",
			
 
				+            "docs": [
			
 
				+              "The ID of the token for which liquidity was increased"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The amount by which liquidity for the NFT position was increased"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 that was paid for the increase in liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 that was paid for the increase in liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_0_transfer_fee",
			
 
				+            "docs": [
			
 
				+              "The token transfer fee for amount_0"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_1_transfer_fee",
			
 
				+            "docs": [
			
 
				+              "The token transfer fee for amount_1"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "InitAdminGroupParams",
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "fee_keeper",
			
 
				+            "docs": [
			
 
				+              "the address who can hold the fee,",
			
 
				+              "anyone can trigger the fee collection action,"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_config_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can config the reward(config, deposit, withdraw),",
			
 
				+              "deposit reward, set the account who can deposit the reward, withdraw the remaining reward(withdraw)"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_claim_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the offchain reward claim"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the pool create action,",
			
 
				+              "without this account's permission, no one can create a pool"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "emergency_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the emergency action,",
			
 
				+              "emergency action includes stop/resume the pool, stop/resume withdraw lp"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "normal_manager",
			
 
				+            "docs": [
			
 
				+              "normal action manager,",
			
 
				+              "such as create amm config, update amm config"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "InitializeRewardParam",
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "open_time",
			
 
				+            "docs": [
			
 
				+              "Reward open time"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "end_time",
			
 
				+            "docs": [
			
 
				+              "Reward end time"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "emissions_per_second_x64",
			
 
				+            "docs": [
			
 
				+              "Token reward per second are earned per unit of liquidity"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "LiquidityCalculateEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when liquidity decreased or increase."
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_liquidity",
			
 
				+            "docs": [
			
 
				+              "The pool liquidity before decrease or increase"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_sqrt_price_x64",
			
 
				+            "docs": [
			
 
				+              "The pool price when decrease or increase in liquidity"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_tick",
			
 
				+            "docs": [
			
 
				+              "The pool tick when decrease or increase in liquidity"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "calc_amount_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 that was calculated for the decrease or increase in liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "calc_amount_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 that was calculated for the decrease or increase in liquidity"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "trade_fee_owed_0",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "trade_fee_owed_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 fee"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "transfer_fee_0",
			
 
				+            "docs": [
			
 
				+              "The amount of token_0 transfer fee without trade_fee_amount_0"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "transfer_fee_1",
			
 
				+            "docs": [
			
 
				+              "The amount of token_1 transfer fee without trade_fee_amount_0"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "LiquidityChangeEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted pool liquidity change when increase and decrease liquidity"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_state",
			
 
				+            "docs": [
			
 
				+              "The pool for swap"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick",
			
 
				+            "docs": [
			
 
				+              "The tick of the pool"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_lower",
			
 
				+            "docs": [
			
 
				+              "The tick lower of position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_upper",
			
 
				+            "docs": [
			
 
				+              "The tick lower of position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity_before",
			
 
				+            "docs": [
			
 
				+              "The liquidity of the pool before liquidity change"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity_after",
			
 
				+            "docs": [
			
 
				+              "The liquidity of the pool after liquidity change"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ModifyAmmAdminGroupEvent",
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "fee_keeper",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_config_manager",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_claim_manager",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_manager",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "emergency_manager",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "normal_manager",
			
 
				+            "type": "pubkey"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "Observation",
			
 
				+      "docs": [
			
 
				+        "The element of observations in ObservationState"
			
 
				+      ],
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "block_timestamp",
			
 
				+            "docs": [
			
 
				+              "The block timestamp of the observation"
			
 
				+            ],
			
 
				+            "type": "u32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_cumulative",
			
 
				+            "docs": [
			
 
				+              "the cumulative of tick during the duration time"
			
 
				+            ],
			
 
				+            "type": "i64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "docs": [
			
 
				+              "padding for feature update"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                4
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ObservationState",
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "initialized",
			
 
				+            "docs": [
			
 
				+              "Whether the ObservationState is initialized"
			
 
				+            ],
			
 
				+            "type": "bool"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recent_epoch",
			
 
				+            "docs": [
			
 
				+              "recent update epoch"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "observation_index",
			
 
				+            "docs": [
			
 
				+              "the most-recently updated index of the observations array"
			
 
				+            ],
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_id",
			
 
				+            "docs": [
			
 
				+              "belongs to which pool"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "observations",
			
 
				+            "docs": [
			
 
				+              "observation array"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                {
			
 
				+                  "defined": {
			
 
				+                    "name": "Observation"
			
 
				+                  }
			
 
				+                },
			
 
				+                100
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "docs": [
			
 
				+              "padding for feature update"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                4
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "OffchainRewardConfig",
			
 
				+      "docs": [
			
 
				+        "Holds the current owner of the factory"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_id",
			
 
				+            "docs": [
			
 
				+              "the pool state address"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_vault",
			
 
				+            "docs": [
			
 
				+              "the vault to hold the reward",
			
 
				+              "vault address is this config address"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "vault_bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify vault PDA"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u8",
			
 
				+                1
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_mint_vec",
			
 
				+            "docs": [
			
 
				+              "reward token mint address list",
			
 
				+              "reward token account is ATA(reward_vault, reward_mint)"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "vec": "pubkey"
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "OperationState",
			
 
				+      "docs": [
			
 
				+        "Holds the current owner of the factory"
			
 
				+      ],
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify PDA"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "operation_owners",
			
 
				+            "docs": [
			
 
				+              "Address of the operation owner"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "pubkey",
			
 
				+                10
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "whitelist_mints",
			
 
				+            "docs": [
			
 
				+              "The mint address of whitelist to emit reward"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "pubkey",
			
 
				+                100
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PersonalPositionState",
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify PDA"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u8",
			
 
				+                1
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "nft_mint",
			
 
				+            "docs": [
			
 
				+              "Mint address of the tokenized position"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_id",
			
 
				+            "docs": [
			
 
				+              "The ID of the pool with which this token is connected"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_lower_index",
			
 
				+            "docs": [
			
 
				+              "The lower bound tick of the position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_upper_index",
			
 
				+            "docs": [
			
 
				+              "The upper bound tick of the position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The amount of liquidity owned by this position"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_inside_0_last_x64",
			
 
				+            "docs": [
			
 
				+              "The token_0 fee growth of the aggregate position as of the last action on the individual position"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_inside_1_last_x64",
			
 
				+            "docs": [
			
 
				+              "The token_1 fee growth of the aggregate position as of the last action on the individual position"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_fees_owed_0",
			
 
				+            "docs": [
			
 
				+              "The fees owed to the position owner in token_0, as of the last computation"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_fees_owed_1",
			
 
				+            "docs": [
			
 
				+              "The fees owed to the position owner in token_1, as of the last computation"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_infos",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                {
			
 
				+                  "defined": {
			
 
				+                    "name": "PositionRewardInfo"
			
 
				+                  }
			
 
				+                },
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recent_epoch",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                7
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PoolCreatedEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when a pool is created and initialized with a starting price",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "token_mint_0",
			
 
				+            "docs": [
			
 
				+              "The first token of the pool by address sort order"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_mint_1",
			
 
				+            "docs": [
			
 
				+              "The second token of the pool by address sort order"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_spacing",
			
 
				+            "docs": [
			
 
				+              "The minimum number of ticks between initialized ticks"
			
 
				+            ],
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_state",
			
 
				+            "docs": [
			
 
				+              "The address of the created pool"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "sqrt_price_x64",
			
 
				+            "docs": [
			
 
				+              "The initial sqrt price of the pool, as a Q64.64"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick",
			
 
				+            "docs": [
			
 
				+              "The initial tick of the pool, i.e. log base 1.0001 of the starting price of the pool"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_vault_0",
			
 
				+            "docs": [
			
 
				+              "Vault of token_0"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_vault_1",
			
 
				+            "docs": [
			
 
				+              "Vault of token_1"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PoolState",
			
 
				+      "docs": [
			
 
				+        "The pool state",
			
 
				+        "",
			
 
				+        "PDA of `[POOL_SEED, config, token_mint_0, token_mint_1]`",
			
 
				+        ""
			
 
				+      ],
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify PDA"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u8",
			
 
				+                1
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amm_config",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "owner",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_mint_0",
			
 
				+            "docs": [
			
 
				+              "Token pair of the pool, where token_mint_0 address < token_mint_1 address"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_mint_1",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_vault_0",
			
 
				+            "docs": [
			
 
				+              "Token pair vault"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_vault_1",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "observation_key",
			
 
				+            "docs": [
			
 
				+              "observation account key"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "mint_decimals_0",
			
 
				+            "docs": [
			
 
				+              "mint0 and mint1 decimals"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "mint_decimals_1",
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_spacing",
			
 
				+            "docs": [
			
 
				+              "The minimum number of ticks between initialized ticks"
			
 
				+            ],
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The currently in range liquidity available to the pool."
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "sqrt_price_x64",
			
 
				+            "docs": [
			
 
				+              "The current price of the pool as a sqrt(token_1/token_0) Q64.64 value"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_current",
			
 
				+            "docs": [
			
 
				+              "The current tick of the pool, i.e. according to the last tick transition that was run."
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding3",
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding4",
			
 
				+            "type": "u16"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_global_0_x64",
			
 
				+            "docs": [
			
 
				+              "The fee growth as a Q64.64 number, i.e. fees of token_0 and token_1 collected per",
			
 
				+              "unit of liquidity for the entire life of the pool."
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_global_1_x64",
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "protocol_fees_token_0",
			
 
				+            "docs": [
			
 
				+              "The amounts of token_0 and token_1 that are owed to the protocol."
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "protocol_fees_token_1",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "swap_in_amount_token_0",
			
 
				+            "docs": [
			
 
				+              "The amounts in and out of swap token_0 and token_1"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "swap_out_amount_token_1",
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "swap_in_amount_token_1",
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "swap_out_amount_token_0",
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "status",
			
 
				+            "docs": [
			
 
				+              "Bitwise representation of the state of the pool",
			
 
				+              "bit0, 1: disable open position and increase liquidity, 0: normal",
			
 
				+              "bit1, 1: disable decrease liquidity, 0: normal",
			
 
				+              "bit2, 1: disable collect fee, 0: normal",
			
 
				+              "bit3, 1: disable collect reward, 0: normal",
			
 
				+              "bit4, 1: disable swap, 0: normal"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "docs": [
			
 
				+              "Leave blank for future use"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u8",
			
 
				+                7
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_infos",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                {
			
 
				+                  "defined": {
			
 
				+                    "name": "RewardInfo"
			
 
				+                  }
			
 
				+                },
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_array_bitmap",
			
 
				+            "docs": [
			
 
				+              "Packed initialized tick array state"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                16
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "total_fees_token_0",
			
 
				+            "docs": [
			
 
				+              "except protocol_fee and fund_fee"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "total_fees_claimed_token_0",
			
 
				+            "docs": [
			
 
				+              "except protocol_fee and fund_fee"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "total_fees_token_1",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "total_fees_claimed_token_1",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fund_fees_token_0",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fund_fees_token_1",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "open_time",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recent_epoch",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding1",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                24
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding2",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                32
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "PositionRewardInfo",
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "growth_inside_last_x64",
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_amount_owed",
			
 
				+            "type": "u64"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "ProtocolPositionState",
			
 
				+      "docs": [
			
 
				+        "Info stored for each user's position"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify PDA"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_id",
			
 
				+            "docs": [
			
 
				+              "The ID of the pool with which this token is connected"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_lower_index",
			
 
				+            "docs": [
			
 
				+              "The lower bound tick of the position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick_upper_index",
			
 
				+            "docs": [
			
 
				+              "The upper bound tick of the position"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The amount of liquidity owned by this position"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_inside_0_last_x64",
			
 
				+            "docs": [
			
 
				+              "The token_0 fee growth per unit of liquidity as of the last update to liquidity or fees owed"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_inside_1_last_x64",
			
 
				+            "docs": [
			
 
				+              "The token_1 fee growth per unit of liquidity as of the last update to liquidity or fees owed"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_fees_owed_0",
			
 
				+            "docs": [
			
 
				+              "The fees owed to the position owner in token_0"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_fees_owed_1",
			
 
				+            "docs": [
			
 
				+              "The fees owed to the position owner in token_1"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_growth_inside",
			
 
				+            "docs": [
			
 
				+              "The reward growth per unit of liquidity as of the last update to liquidity"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u128",
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recent_epoch",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                7
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "RewardInfo",
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "reward_state",
			
 
				+            "docs": [
			
 
				+              "Reward state"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "open_time",
			
 
				+            "docs": [
			
 
				+              "Reward open time"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "end_time",
			
 
				+            "docs": [
			
 
				+              "Reward end time"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "last_update_time",
			
 
				+            "docs": [
			
 
				+              "Reward last update time"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "emissions_per_second_x64",
			
 
				+            "docs": [
			
 
				+              "Q64.64 number indicates how many tokens per second are earned per unit of liquidity."
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_total_emissioned",
			
 
				+            "docs": [
			
 
				+              "The total amount of reward emissioned"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_claimed",
			
 
				+            "docs": [
			
 
				+              "The total amount of claimed reward"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_mint",
			
 
				+            "docs": [
			
 
				+              "Reward token mint."
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_vault",
			
 
				+            "docs": [
			
 
				+              "Reward vault token account."
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "authority",
			
 
				+            "docs": [
			
 
				+              "The owner that has permission to set reward param"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_growth_global_x64",
			
 
				+            "docs": [
			
 
				+              "Q64.64 number that tracks the total tokens earned per unit of liquidity since the reward",
			
 
				+              "emissions were turned on."
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "SupportMintAssociated",
			
 
				+      "docs": [
			
 
				+        "Holds the current owner of the factory"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "bump",
			
 
				+            "docs": [
			
 
				+              "Bump to identify PDA"
			
 
				+            ],
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "mint",
			
 
				+            "docs": [
			
 
				+              "Address of the supported token22 mint"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u64",
			
 
				+                8
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "SwapEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted by when a swap is performed for a pool"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_state",
			
 
				+            "docs": [
			
 
				+              "The pool for which token_0 and token_1 were swapped"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "sender",
			
 
				+            "docs": [
			
 
				+              "The address that initiated the swap call, and that received the callback"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_account_0",
			
 
				+            "docs": [
			
 
				+              "The payer token account in zero for one swaps, or the recipient token account",
			
 
				+              "in one for zero swaps"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "token_account_1",
			
 
				+            "docs": [
			
 
				+              "The payer token account in one for zero swaps, or the recipient token account",
			
 
				+              "in zero for one swaps"
			
 
				+            ],
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_0",
			
 
				+            "docs": [
			
 
				+              "The real delta amount of the token_0 of the pool or user"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "transfer_fee_0",
			
 
				+            "docs": [
			
 
				+              "The transfer fee charged by the withheld_amount of the token_0"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "amount_1",
			
 
				+            "docs": [
			
 
				+              "The real delta of the token_1 of the pool or user"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "transfer_fee_1",
			
 
				+            "docs": [
			
 
				+              "The transfer fee charged by the withheld_amount of the token_1"
			
 
				+            ],
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "zero_for_one",
			
 
				+            "docs": [
			
 
				+              "if true, amount_0 is negtive and amount_1 is positive"
			
 
				+            ],
			
 
				+            "type": "bool"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "sqrt_price_x64",
			
 
				+            "docs": [
			
 
				+              "The sqrt(price) of the pool after the swap, as a Q64.64"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity",
			
 
				+            "docs": [
			
 
				+              "The liquidity of the pool after the swap"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "tick",
			
 
				+            "docs": [
			
 
				+              "The log base 1.0001 of price of the pool after the swap"
			
 
				+            ],
			
 
				+            "type": "i32"
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "TickArrayBitmapExtension",
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_id",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "positive_tick_array_bitmap",
			
 
				+            "docs": [
			
 
				+              "Packed initialized tick array state for start_tick_index is positive"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                {
			
 
				+                  "array": [
			
 
				+                    "u64",
			
 
				+                    8
			
 
				+                  ]
			
 
				+                },
			
 
				+                14
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "negative_tick_array_bitmap",
			
 
				+            "docs": [
			
 
				+              "Packed initialized tick array state for start_tick_index is negitive"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                {
			
 
				+                  "array": [
			
 
				+                    "u64",
			
 
				+                    8
			
 
				+                  ]
			
 
				+                },
			
 
				+                14
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "TickArrayState",
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "pool_id",
			
 
				+            "type": "pubkey"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "start_tick_index",
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "ticks",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                {
			
 
				+                  "defined": {
			
 
				+                    "name": "TickState"
			
 
				+                  }
			
 
				+                },
			
 
				+                60
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "initialized_tick_count",
			
 
				+            "type": "u8"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "recent_epoch",
			
 
				+            "type": "u64"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u8",
			
 
				+                107
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "TickState",
			
 
				+      "serialization": "bytemuckunsafe",
			
 
				+      "repr": {
			
 
				+        "kind": "c",
			
 
				+        "packed": true
			
 
				+      },
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "tick",
			
 
				+            "type": "i32"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity_net",
			
 
				+            "docs": [
			
 
				+              "Amount of net liquidity added (subtracted) when tick is crossed from left to right (right to left)"
			
 
				+            ],
			
 
				+            "type": "i128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "liquidity_gross",
			
 
				+            "docs": [
			
 
				+              "The total position liquidity that references this tick"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_outside_0_x64",
			
 
				+            "docs": [
			
 
				+              "Fee growth per unit of liquidity on the _other_ side of this tick (relative to the current tick)",
			
 
				+              "only has relative meaning, not absolute — the value depends on when the tick is initialized"
			
 
				+            ],
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "fee_growth_outside_1_x64",
			
 
				+            "type": "u128"
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_growths_outside_x64",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u128",
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "padding",
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u32",
			
 
				+                13
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "UpdateAdminGroupParams",
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "fee_keeper",
			
 
				+            "docs": [
			
 
				+              "the address who can hold the fee,",
			
 
				+              "anyone can trigger the fee collection action,"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "option": "pubkey"
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_config_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can config the reward(config, deposit, withdraw),",
			
 
				+              "deposit reward, set the account who can deposit the reward, withdraw the remaining reward(withdraw)"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "option": "pubkey"
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "reward_claim_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the offchain reward claim"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "option": "pubkey"
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "pool_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the pool create action,",
			
 
				+              "without this account's permission, no one can create a pool"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "option": "pubkey"
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "emergency_manager",
			
 
				+            "docs": [
			
 
				+              "the address who can manage the emergency action,",
			
 
				+              "emergency action includes stop/resume the pool, stop/resume withdraw lp"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "option": "pubkey"
			
 
				+            }
			
 
				+          },
			
 
				+          {
			
 
				+            "name": "normal_manager",
			
 
				+            "docs": [
			
 
				+              "normal action manager,",
			
 
				+              "such as create amm config, update amm config"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "option": "pubkey"
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    },
			
 
				+    {
			
 
				+      "name": "UpdateRewardInfosEvent",
			
 
				+      "docs": [
			
 
				+        "Emitted when Reward are updated for a pool"
			
 
				+      ],
			
 
				+      "type": {
			
 
				+        "kind": "struct",
			
 
				+        "fields": [
			
 
				+          {
			
 
				+            "name": "reward_growth_global_x64",
			
 
				+            "docs": [
			
 
				+              "Reward info"
			
 
				+            ],
			
 
				+            "type": {
			
 
				+              "array": [
			
 
				+                "u128",
			
 
				+                3
			
 
				+              ]
			
 
				+            }
			
 
				+          }
			
 
				+        ]
			
 
				+      }
			
 
				+    }
			
 
				+  ]
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/target/types/byreal_amm_v3.ts
+++ b/src/lib/clmm-sdk/src/instructions/target/types/byreal_amm_v3.ts
@@ -0,0 +1,5328 @@
 
				+/**
			
 
				+ * Program IDL in camelCase format in order to be used in JS/TS.
			
 
				+ *
			
 
				+ * Note that this is only a type helper and is not the actual IDL. The original
			
 
				+ * IDL can be found at `target/idl/byreal_clmm.json`.
			
 
				+ */
			
 
				+export type ByrealClmm = {
			
 
				+  address: 'REALQqNEomY6cQGZJUGwywTBD2UmDT32rZcNnfxQ5N2';
			
 
				+  metadata: {
			
 
				+    name: 'byrealClmm';
			
 
				+    version: '0.1.0';
			
 
				+    spec: '0.1.0';
			
 
				+    description: 'Anchor client and source for Byreal concentrated liquidity AMM';
			
 
				+  };
			
 
				+  instructions: [
			
 
				+    {
			
 
				+      name: 'claimOffchainReward';
			
 
				+      docs: ['claim offchain reward from the pool'];
			
 
				+      discriminator: [195, 87, 221, 149, 141, 195, 146, 19];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'claimer';
			
 
				+          docs: ['the address who claim the offchain reward.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['The authority make decision that who can claim the offchain reward.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['Initialize amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolId';
			
 
				+          docs: ['the pool id, which is the pool state account.'];
			
 
				+          relations: ['rewardConfig'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'claimerTokenAccount';
			
 
				+          docs: [''];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardVaultTokenAccount';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'rewardConfig';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenProgram';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardConfig';
			
 
				+          docs: ['The offchain reward config account, it also is the reward vault account.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 102, 102, 99, 104, 97, 105, 110, 95, 114, 101, 119, 97, 114, 100];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolId';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'closePosition';
			
 
				+      docs: [
			
 
				+        "Close the user's position and NFT account. If the NFT mint belongs to token2022, it will also be closed and the funds returned to the NFT owner.",
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [123, 134, 81, 0, 49, 68, 98, 98];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['The position nft owner'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Mint address bound to the personal position.'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          docs: ['User token account where position NFT be minted to'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['System program to close the position state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Token/Token2022 program to close token/mint account'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectFundFee';
			
 
				+      docs: [
			
 
				+        'Collect the fund fee accrued to the pool',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount_0_requested` - The maximum amount of token_0 to send, can be 0 to collect fees in only token_1',
			
 
				+        '* `amount_1_requested` - The maximum amount of token_1 to send, can be 0 to collect fees in only token_0',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [167, 138, 78, 149, 223, 194, 6, 126];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: [
			
 
				+            'amm admin group account to store admin permissions.',
			
 
				+            'anyone can collect fee, but only fee-manager in admin group can receive fee'
			
 
				+          ];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Pool state stores accumulated protocol fee amount'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The address that receives the collected token_0 protocol fees'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'admin_group.fee_keeper';
			
 
				+                account: 'ammAdminGroup';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'vault0Mint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The address that receives the collected token_1 protocol fees'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'admin_group.fee_keeper';
			
 
				+                account: 'ammAdminGroup';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'vault1Mint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['The SPL program to perform token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['The SPL program 2022 to perform token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount0Requested';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Requested';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectProtocolFee';
			
 
				+      docs: [
			
 
				+        'Collect the protocol fee accrued to the pool',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount_0_requested` - The maximum amount of token_0 to send, can be 0 to collect fees in only token_1',
			
 
				+        '* `amount_1_requested` - The maximum amount of token_1 to send, can be 0 to collect fees in only token_0',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [136, 136, 252, 221, 194, 66, 126, 89];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: [
			
 
				+            'amm admin group account to store admin permissions.',
			
 
				+            'anyone can collect fee, but only fee-manager in admin group can receive fee'
			
 
				+          ];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Pool state stores accumulated protocol fee amount'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The address that receives the collected token_0 protocol fees'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'admin_group.fee_keeper';
			
 
				+                account: 'ammAdminGroup';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'vault0Mint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The address that receives the collected token_1 protocol fees'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'admin_group.fee_keeper';
			
 
				+                account: 'ammAdminGroup';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'vault1Mint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['The SPL program to perform token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['The SPL program 2022 to perform token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount0Requested';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Requested';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectRemainingRewards';
			
 
				+      docs: [
			
 
				+        'Collect remaining reward token for reward founder',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `reward_index` - the index to reward info',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [18, 237, 166, 197, 34, 16, 213, 144];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'rewardFunder';
			
 
				+          docs: ['The founder who init reward info previously'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'funderTokenAccount';
			
 
				+          docs: ["The funder's reward token account"];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Set reward for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenVault';
			
 
				+          docs: ['Reward vault transfer remaining token to founder token account'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardVaultMint';
			
 
				+          docs: ['The mint of reward token vault'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'rewardIndex';
			
 
				+          type: 'u8';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createAmmConfig';
			
 
				+      docs: [
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The accounts needed by instruction.',
			
 
				+        '* `index` - The index of amm config, there may be multiple config.',
			
 
				+        '* `tick_spacing` - The tickspacing binding with config, cannot be changed.',
			
 
				+        '* `trade_fee_rate` - Trade fee rate, can be changed.',
			
 
				+        '* `protocol_fee_rate` - The rate of protocol fee within trade fee.',
			
 
				+        '* `fund_fee_rate` - The rate of fund fee within trade fee.',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [137, 52, 237, 212, 215, 117, 108, 104];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as normal manager in admin group.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Initialize config state account to store protocol owner address and fee rates.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 109, 109, 95, 99, 111, 110, 102, 105, 103];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'index';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'index';
			
 
				+          type: 'u16';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickSpacing';
			
 
				+          type: 'u16';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tradeFeeRate';
			
 
				+          type: 'u32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolFeeRate';
			
 
				+          type: 'u32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'fundFeeRate';
			
 
				+          type: 'u32';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createOperationAccount';
			
 
				+      docs: [
			
 
				+        'Creates an operation account for the program',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [63, 87, 148, 33, 109, 35, 8, 104];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as operation account owner.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['Initialize operation state account to store operation owner address and white list mint.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createPool';
			
 
				+      docs: [
			
 
				+        'Creates a pool for the given token pair and the initial price',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `sqrt_price_x64` - the initial sqrt price (amount_token_1 / amount_token_0) of the pool as a Q64.64',
			
 
				+        'Note: The open_time must be smaller than the current block_timestamp on chain.'
			
 
				+      ];
			
 
				+      discriminator: [233, 146, 209, 142, 207, 104, 64, 188];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'poolCreator';
			
 
				+          docs: ['Address paying to create the pool. Can be anyone'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolManager';
			
 
				+          docs: ['with pool_manager permission, the pool creator can create a pool.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Which config the pool belongs to.'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Initialize an account to store the pool state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'ammConfig';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint0';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint1';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'offchainRewardConfig';
			
 
				+          docs: ['Initialize an account to store the off-chain reward config'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 102, 102, 99, 104, 97, 105, 110, 95, 114, 101, 119, 97, 114, 100];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint0';
			
 
				+          docs: ['Token_0 mint, the key must be smaller then token_1 mint.'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint1';
			
 
				+          docs: ['Token_1 mint'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['Token_0 vault for the pool'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108, 95, 118, 97, 117, 108, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint0';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['Token_1 vault for the pool'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108, 95, 118, 97, 117, 108, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint1';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'observationState';
			
 
				+          docs: ['Initialize an account to store oracle observations'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 98, 115, 101, 114, 118, 97, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayBitmap';
			
 
				+          docs: ['Initialize an account to store if a tick array is initialized.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108,
			
 
				+                  95,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121,
			
 
				+                  95,
			
 
				+                  98,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  109,
			
 
				+                  97,
			
 
				+                  112,
			
 
				+                  95,
			
 
				+                  101,
			
 
				+                  120,
			
 
				+                  116,
			
 
				+                  101,
			
 
				+                  110,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram0';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram1';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['To create a new program account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for program account'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'sqrtPriceX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'openTime';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createSupportMintAssociated';
			
 
				+      docs: [
			
 
				+        'Create support token22 mint account which can create pool and send rewards with ignoring the not support extensions.'
			
 
				+      ];
			
 
				+      discriminator: [17, 251, 65, 92, 136, 242, 14, 169];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as protocol owner.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint';
			
 
				+          docs: ['Support token mint'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'supportMintAssociated';
			
 
				+          docs: ['Initialize support mint state account to store support mint address and bump.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [115, 117, 112, 112, 111, 114, 116, 95, 109, 105, 110, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidity';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `decrease_liquidity_v2` instead.")]',
			
 
				+        'Decreases liquidity for an existing position',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` -  The context of accounts',
			
 
				+        '* `liquidity` - The amount by which liquidity will be decreased',
			
 
				+        '* `amount_0_min` - The minimum amount of token_0 that should be accounted for the burned liquidity',
			
 
				+        '* `amount_1_min` - The minimum amount of token_1 that should be accounted for the burned liquidity',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [160, 38, 208, 111, 104, 91, 44, 1];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['The position owner or delegated authority'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for the tokenized position'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Decrease liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['Token_0 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['Token_1 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The destination token account for receive amount_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The destination token account for receive amount_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program to transfer out tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Min';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Min';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidityV2';
			
 
				+      docs: [
			
 
				+        'Decreases liquidity for an existing position, support Token2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` -  The context of accounts',
			
 
				+        '* `liquidity` - The amount by which liquidity will be decreased',
			
 
				+        '* `amount_0_min` - The minimum amount of token_0 that should be accounted for the burned liquidity',
			
 
				+        '* `amount_1_min` - The minimum amount of token_1 that should be accounted for the burned liquidity',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [58, 127, 188, 62, 79, 82, 196, 96];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['The position owner or delegated authority'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for the tokenized position'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Decrease liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['Token_0 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['Token_1 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The destination token account for receive amount_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The destination token account for receive amount_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program to transfer out tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Min';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Min';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'depositOffchainReward';
			
 
				+      docs: ['deposit offchain reward into the pool'];
			
 
				+      discriminator: [97, 125, 48, 169, 92, 241, 44, 142];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['the address paying to deposit the offchain reward.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['The authority make decision that who can deposit the offchain reward.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['Initialize amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolId';
			
 
				+          docs: ['the pool id, which is the pool state account.'];
			
 
				+          relations: ['rewardConfig'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'payerTokenAccount';
			
 
				+          docs: [''];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardVaultTokenAccount';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'rewardConfig';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenProgram';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardConfig';
			
 
				+          docs: ['The offchain reward config account, it also is the reward vault account.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 102, 102, 99, 104, 97, 105, 110, 95, 114, 101, 119, 97, 114, 100];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolId';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidity';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `increase_liquidity_v2` instead.")]',
			
 
				+        'Increases liquidity for an existing position, with amount paid by `payer`',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        "* `liquidity` - The desired liquidity to be added, can't be zero",
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [46, 156, 243, 118, 13, 205, 251, 178];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for nft'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Increase liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ["The payer's token account for token_0"];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token account spending token_1 to mint the position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidityV2';
			
 
				+      docs: [
			
 
				+        'Increases liquidity for an existing position, with amount paid by `payer`, support Token2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `liquidity` - The desired liquidity to be added, if zero, calculate liquidity base amount_0 or amount_1 according base_flag',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        '* `base_flag` - must be specified if liquidity is zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [133, 29, 89, 223, 69, 238, 176, 10];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for nft'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Increase liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ["The payer's token account for token_0"];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token account spending token_1 to mint the position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'baseFlag';
			
 
				+          type: {
			
 
				+            option: 'bool';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'initAmmAdminGroup';
			
 
				+      docs: ['Initialize the AMM admin group account, which is used to manage the AMM protocol.'];
			
 
				+      discriminator: [209, 108, 32, 246, 157, 214, 237, 86];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['only super admin can create admin group'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+          address: 'AY196f8U5EvM999PVnvLmyvaUnzL4GLiFaGKUgnJXN6o';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['Initialize amm admin group account to store admin permissions.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'params';
			
 
				+          type: {
			
 
				+            defined: {
			
 
				+              name: 'initAdminGroupParams';
			
 
				+            };
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'initializeReward';
			
 
				+      docs: [
			
 
				+        'Initialize a reward info for a given pool and reward index',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `reward_index` - the index to reward info',
			
 
				+        '* `open_time` - reward open timestamp',
			
 
				+        '* `end_time` - reward end timestamp',
			
 
				+        '* `emissions_per_second_x64` - Token reward per second are earned per unit of liquidity.',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [95, 135, 192, 196, 242, 129, 230, 68];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'rewardFunder';
			
 
				+          docs: ['The founder deposit reward token to vault'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'funderTokenAccount';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['For check the reward_funder authority'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Set reward for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['load info from the account to judge reward permission'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenMint';
			
 
				+          docs: ['Reward mint'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenVault';
			
 
				+          docs: ['A pda, reward vault'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108, 95, 114, 101, 119, 97, 114, 100, 95, 118, 97, 117, 108, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'rewardTokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenProgram';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'param';
			
 
				+          type: {
			
 
				+            defined: {
			
 
				+              name: 'initializeRewardParam';
			
 
				+            };
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'openPosition';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `open_position_with_token22_nft` instead.")]',
			
 
				+        'Creates a new position wrapped in a NFT',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `tick_lower_index` - The low boundary of market',
			
 
				+        '* `tick_upper_index` - The upper boundary of market',
			
 
				+        '* `tick_array_lower_start_index` - The start index of tick array which include tick low',
			
 
				+        '* `tick_array_upper_start_index` - The start index of tick array which include tick upper',
			
 
				+        '* `liquidity` - The liquidity to be added',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [135, 128, 47, 77, 15, 152, 240, 49];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftOwner';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Unique token mint address'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          docs: [
			
 
				+            'Token account where position NFT will be minted',
			
 
				+            'This account created in the contract by cpi to avoid large stack variables'
			
 
				+          ];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftOwner';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataAccount';
			
 
				+          docs: ['To store metaplex metadata'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Add liquidity for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          docs: ['Store the information of market marking in range'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickLowerIndex';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickUpperIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayLowerStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayUpperStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['personal position state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ['The token_0 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token_1 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for token mint and ATA creation'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['Program to create the position manager state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          docs: ['Program to create an ATA for receiving position NFT'];
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataProgram';
			
 
				+          docs: ['Program to create NFT metadata'];
			
 
				+          address: 'metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'tickLowerIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickUpperIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLowerStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpperStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'openPositionV2';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `open_position_with_token22_nft` instead.")]',
			
 
				+        'Creates a new position wrapped in a NFT, support Token2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `tick_lower_index` - The low boundary of market',
			
 
				+        '* `tick_upper_index` - The upper boundary of market',
			
 
				+        '* `tick_array_lower_start_index` - The start index of tick array which include tick low',
			
 
				+        '* `tick_array_upper_start_index` - The start index of tick array which include tick upper',
			
 
				+        '* `liquidity` - The liquidity to be added, if zero, and the base_flag is specified, calculate liquidity base amount_0_max or amount_1_max according base_flag, otherwise open position with zero liquidity',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        '* `with_metadata` - The flag indicating whether to create NFT mint metadata',
			
 
				+        '* `base_flag` - if the liquidity specified as zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [77, 184, 74, 214, 112, 86, 241, 199];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftOwner';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Unique token mint address'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          docs: ['Token account where position NFT will be minted'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftOwner';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataAccount';
			
 
				+          docs: ['To store metaplex metadata'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Add liquidity for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          docs: ['Store the information of market marking in range'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickLowerIndex';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickUpperIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayLowerStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayUpperStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['personal position state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ['The token_0 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token_1 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for token mint and ATA creation'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['Program to create the position manager state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          docs: ['Program to create an ATA for receiving position NFT'];
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataProgram';
			
 
				+          docs: ['Program to create NFT metadata'];
			
 
				+          address: 'metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'tickLowerIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickUpperIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLowerStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpperStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'withMetadata';
			
 
				+          type: 'bool';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'baseFlag';
			
 
				+          type: {
			
 
				+            option: 'bool';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'openPositionWithToken22Nft';
			
 
				+      docs: [
			
 
				+        'Creates a new position wrapped in a Token2022 NFT without relying on metadata_program and metadata_account, reduce the cost for user to create a personal position.',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `tick_lower_index` - The low boundary of market',
			
 
				+        '* `tick_upper_index` - The upper boundary of market',
			
 
				+        '* `tick_array_lower_start_index` - The start index of tick array which include tick low',
			
 
				+        '* `tick_array_upper_start_index` - The start index of tick array which include tick upper',
			
 
				+        '* `liquidity` - The liquidity to be added, if zero, and the base_flag is specified, calculate liquidity base amount_0_max or amount_1_max according base_flag, otherwise open position with zero liquidity',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        '* `with_metadata` - The flag indicating whether to create NFT mint metadata',
			
 
				+        '* `base_flag` - if the liquidity specified as zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [77, 255, 174, 82, 125, 29, 201, 46];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftOwner';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Unique token mint address, initialize in contract'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Add liquidity for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          docs: ['Store the information of market marking in range'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickLowerIndex';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickUpperIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayLowerStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayUpperStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['personal position state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ['The token_0 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token_1 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for token mint and ATA creation'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['Program to create the position manager state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to transfer for token account'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          docs: ['Program to create an ATA for receiving position NFT'];
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Program to create NFT mint/token account and transfer for token22 account'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'tickLowerIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickUpperIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLowerStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpperStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'withMetadata';
			
 
				+          type: 'bool';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'baseFlag';
			
 
				+          type: {
			
 
				+            option: 'bool';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'setRewardParams';
			
 
				+      docs: [
			
 
				+        'Reset reward param, start a new reward cycle or extend the current cycle.',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `reward_index` - The index of reward token in the pool.',
			
 
				+        '* `emissions_per_second_x64` - The per second emission reward, when extend the current cycle,',
			
 
				+        "new value can't be less than old value",
			
 
				+        '* `open_time` - reward open timestamp, must be set when starting a new cycle',
			
 
				+        '* `end_time` - reward end timestamp',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [112, 52, 167, 75, 32, 201, 211, 137];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['Address to be set as protocol owner. It pays to create factory state account.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['load info from the account to judge reward permission'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Token program'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'rewardIndex';
			
 
				+          type: 'u8';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'emissionsPerSecondX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'openTime';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'endTime';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swap';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `swap_v2` instead.")]',
			
 
				+        'Swaps one token for as much as possible of another token across a single pool',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount` - Arranged in pairs with other_amount_threshold. (amount_in, amount_out_minimum) or (amount_out, amount_in_maximum)',
			
 
				+        '* `other_amount_threshold` - For slippage check',
			
 
				+        '* `sqrt_price_limit` - The Q64.64 sqrt price √P limit. If zero for one, the price cannot',
			
 
				+        '* `is_base_input` - swap base input or swap base output',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [248, 198, 158, 145, 225, 117, 135, 200];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['The user performing the swap'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['The factory state to read protocol fees'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['The program account of the pool in which the swap will be performed'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputTokenAccount';
			
 
				+          docs: ['The user token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputTokenAccount';
			
 
				+          docs: ['The user token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputVault';
			
 
				+          docs: ['The vault token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputVault';
			
 
				+          docs: ['The vault token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'observationState';
			
 
				+          docs: ['The program account for the most recent oracle observation'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program for token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArray';
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'otherAmountThreshold';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'sqrtPriceLimitX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'isBaseInput';
			
 
				+          type: 'bool';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapV2';
			
 
				+      docs: [
			
 
				+        'Swaps one token for as much as possible of another token across a single pool, support token program 2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount` - Arranged in pairs with other_amount_threshold. (amount_in, amount_out_minimum) or (amount_out, amount_in_maximum)',
			
 
				+        '* `other_amount_threshold` - For slippage check',
			
 
				+        '* `sqrt_price_limit` - The Q64.64 sqrt price √P limit. If zero for one, the price cannot',
			
 
				+        '* `is_base_input` - swap base input or swap base output',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [43, 4, 237, 11, 26, 201, 30, 98];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['The user performing the swap'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['The factory state to read protocol fees'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['The program account of the pool in which the swap will be performed'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputTokenAccount';
			
 
				+          docs: ['The user token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputTokenAccount';
			
 
				+          docs: ['The user token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputVault';
			
 
				+          docs: ['The vault token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputVault';
			
 
				+          docs: ['The vault token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'observationState';
			
 
				+          docs: ['The program account for the most recent oracle observation'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program for token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['SPL program 2022 for token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['Memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputVaultMint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputVaultMint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'otherAmountThreshold';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'sqrtPriceLimitX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'isBaseInput';
			
 
				+          type: 'bool';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'transferRewardOwner';
			
 
				+      docs: [
			
 
				+        'Transfer reward owner',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `new_owner`- new owner pubkey',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [7, 22, 12, 83, 242, 43, 48, 121];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['Address to be set as operation account owner.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'newOwner';
			
 
				+          type: 'pubkey';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateAmmAdminGroup';
			
 
				+      docs: ['Update the AMM admin group account, which is used to manage the AMM protocol.'];
			
 
				+      discriminator: [61, 183, 185, 188, 82, 81, 141, 197];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['only super admin can create admin group'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+          address: 'AY196f8U5EvM999PVnvLmyvaUnzL4GLiFaGKUgnJXN6o';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['update amm admin group account to store admin permissions.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'params';
			
 
				+          type: {
			
 
				+            defined: {
			
 
				+              name: 'updateAdminGroupParams';
			
 
				+            };
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateAmmConfig';
			
 
				+      docs: [
			
 
				+        'Updates the owner of the amm config',
			
 
				+        'Must be called by the current owner or admin',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `trade_fee_rate`- The new trade fee rate of amm config, be set when `param` is 0',
			
 
				+        '* `protocol_fee_rate`- The new protocol fee rate of amm config, be set when `param` is 1',
			
 
				+        '* `fund_fee_rate`- The new fund fee rate of amm config, be set when `param` is 2',
			
 
				+        "* `new_owner`- The config's new owner, be set when `param` is 3",
			
 
				+        "* `new_fund_owner`- The config's new fund owner, be set when `param` is 4",
			
 
				+        '* `param`- The value can be 0 | 1 | 2 | 3 | 4, otherwise will report a error',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [49, 60, 174, 136, 154, 28, 116, 200];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['The amm config owner or admin'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Amm config account to be changed'];
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'param';
			
 
				+          type: 'u8';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'value';
			
 
				+          type: 'u32';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateOperationAccount';
			
 
				+      docs: [
			
 
				+        'Update the operation account',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `param`- The value can be 0 | 1 | 2 | 3, otherwise will report a error',
			
 
				+        '* `keys`- update operation owner when the `param` is 0',
			
 
				+        'remove operation owner when the `param` is 1',
			
 
				+        'update whitelist mint when the `param` is 2',
			
 
				+        'remove whitelist mint when the `param` is 3',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [127, 70, 119, 40, 188, 227, 61, 7];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as operation account owner.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['Initialize operation state account to store operation owner address and white list mint.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'param';
			
 
				+          type: 'u8';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'keys';
			
 
				+          type: {
			
 
				+            vec: 'pubkey';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updatePoolStatus';
			
 
				+      docs: [
			
 
				+        'Update pool status for given value',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `status` - The value of status',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [130, 87, 108, 6, 46, 224, 117, 123];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'status';
			
 
				+          type: 'u8';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateRewardInfos';
			
 
				+      docs: [
			
 
				+        'Update rewards info of the given pool, can be called for everyone',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [163, 172, 224, 52, 11, 154, 106, 223];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['The liquidity pool for which reward info to update'];
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'withdrawOffchainReward';
			
 
				+      docs: ['withdraw offchain reward from the pool'];
			
 
				+      discriminator: [86, 53, 59, 76, 217, 38, 71, 213];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['The authority make decision that who can withdraw the offchain reward.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'adminGroup';
			
 
				+          docs: ['Initialize amm admin group account to store admin permissions.'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 100, 109, 105, 110, 95, 103, 114, 111, 117, 112];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolId';
			
 
				+          docs: ['the pool id, which is the pool state account.'];
			
 
				+          relations: ['rewardConfig'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'receiverTokenAccount';
			
 
				+          docs: ['the address who receive the withdrawn offchain reward.'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardVaultTokenAccount';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'rewardConfig';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenProgram';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardConfig';
			
 
				+          docs: ['The offchain reward config account, it also is the reward vault account.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 102, 102, 99, 104, 97, 105, 110, 95, 114, 101, 119, 97, 114, 100];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolId';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    }
			
 
				+  ];
			
 
				+  accounts: [
			
 
				+    {
			
 
				+      name: 'ammAdminGroup';
			
 
				+      discriminator: [128, 128, 234, 30, 61, 172, 188, 123];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'ammConfig';
			
 
				+      discriminator: [218, 244, 33, 104, 203, 203, 43, 111];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'observationState';
			
 
				+      discriminator: [122, 174, 197, 53, 129, 9, 165, 132];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'offchainRewardConfig';
			
 
				+      discriminator: [118, 52, 115, 150, 99, 69, 164, 76];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'operationState';
			
 
				+      discriminator: [19, 236, 58, 237, 81, 222, 183, 252];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'personalPositionState';
			
 
				+      discriminator: [70, 111, 150, 126, 230, 15, 25, 117];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolState';
			
 
				+      discriminator: [247, 237, 227, 245, 215, 195, 222, 70];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'protocolPositionState';
			
 
				+      discriminator: [100, 226, 145, 99, 146, 218, 160, 106];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'supportMintAssociated';
			
 
				+      discriminator: [134, 40, 183, 79, 12, 112, 162, 53];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayBitmapExtension';
			
 
				+      discriminator: [60, 150, 36, 219, 97, 128, 139, 153];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayState';
			
 
				+      discriminator: [192, 155, 85, 205, 49, 249, 129, 42];
			
 
				+    }
			
 
				+  ];
			
 
				+  events: [
			
 
				+    {
			
 
				+      name: 'collectPersonalFeeEvent';
			
 
				+      discriminator: [166, 174, 105, 192, 81, 161, 83, 105];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectProtocolFeeEvent';
			
 
				+      discriminator: [206, 87, 17, 79, 45, 41, 213, 61];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'configChangeEvent';
			
 
				+      discriminator: [247, 189, 7, 119, 106, 112, 95, 151];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createPersonalPositionEvent';
			
 
				+      discriminator: [100, 30, 87, 249, 196, 223, 154, 206];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidityEvent';
			
 
				+      discriminator: [58, 222, 86, 58, 68, 50, 85, 56];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidityEvent';
			
 
				+      discriminator: [49, 79, 105, 212, 32, 34, 30, 84];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityCalculateEvent';
			
 
				+      discriminator: [237, 112, 148, 230, 57, 84, 180, 162];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityChangeEvent';
			
 
				+      discriminator: [126, 240, 175, 206, 158, 88, 153, 107];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'modifyAmmAdminGroupEvent';
			
 
				+      discriminator: [218, 118, 87, 81, 53, 80, 18, 235];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolCreatedEvent';
			
 
				+      discriminator: [25, 94, 75, 47, 112, 99, 53, 63];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapEvent';
			
 
				+      discriminator: [64, 198, 205, 232, 38, 8, 113, 226];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateRewardInfosEvent';
			
 
				+      discriminator: [109, 127, 186, 78, 114, 65, 37, 236];
			
 
				+    }
			
 
				+  ];
			
 
				+  errors: [
			
 
				+    {
			
 
				+      code: 6000;
			
 
				+      name: 'lok';
			
 
				+      msg: 'lok';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6001;
			
 
				+      name: 'notApproved';
			
 
				+      msg: 'Not approved';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6002;
			
 
				+      name: 'invalidUpdateConfigFlag';
			
 
				+      msg: 'invalid update amm config flag';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6003;
			
 
				+      name: 'accountLack';
			
 
				+      msg: 'Account lack';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6004;
			
 
				+      name: 'closePositionErr';
			
 
				+      msg: 'Remove liquitity, collect fees owed and reward then you can close position account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6005;
			
 
				+      name: 'zeroMintAmount';
			
 
				+      msg: 'Minting amount should be greater than 0';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6006;
			
 
				+      name: 'invalidTickIndex';
			
 
				+      msg: 'Tick out of range';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6007;
			
 
				+      name: 'tickInvalidOrder';
			
 
				+      msg: 'The lower tick must be below the upper tick';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6008;
			
 
				+      name: 'tickLowerOverflow';
			
 
				+      msg: 'The tick must be greater, or equal to the minimum tick(-443636)';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6009;
			
 
				+      name: 'tickUpperOverflow';
			
 
				+      msg: 'The tick must be lesser than, or equal to the maximum tick(443636)';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6010;
			
 
				+      name: 'tickAndSpacingNotMatch';
			
 
				+      msg: 'tick % tick_spacing must be zero';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6011;
			
 
				+      name: 'invalidTickArray';
			
 
				+      msg: 'Invalid tick array account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6012;
			
 
				+      name: 'invalidTickArrayBoundary';
			
 
				+      msg: 'Invalid tick array boundary';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6013;
			
 
				+      name: 'sqrtPriceLimitOverflow';
			
 
				+      msg: 'Square root price limit overflow';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6014;
			
 
				+      name: 'sqrtPriceX64';
			
 
				+      msg: 'sqrt_price_x64 out of range';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6015;
			
 
				+      name: 'liquiditySubValueErr';
			
 
				+      msg: 'Liquidity sub delta L must be smaller than before';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6016;
			
 
				+      name: 'liquidityAddValueErr';
			
 
				+      msg: 'Liquidity add delta L must be greater, or equal to before';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6017;
			
 
				+      name: 'invalidLiquidity';
			
 
				+      msg: 'Invalid liquidity when update position';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6018;
			
 
				+      name: 'forbidBothZeroForSupplyLiquidity';
			
 
				+      msg: 'Both token amount must not be zero while supply liquidity';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6019;
			
 
				+      name: 'liquidityInsufficient';
			
 
				+      msg: 'Liquidity insufficient';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6020;
			
 
				+      name: 'transactionTooOld';
			
 
				+      msg: 'Transaction too old';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6021;
			
 
				+      name: 'priceSlippageCheck';
			
 
				+      msg: 'Price slippage check';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6022;
			
 
				+      name: 'tooLittleOutputReceived';
			
 
				+      msg: 'Too little output received';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6023;
			
 
				+      name: 'tooMuchInputPaid';
			
 
				+      msg: 'Too much input paid';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6024;
			
 
				+      name: 'zeroAmountSpecified';
			
 
				+      msg: 'Swap special amount can not be zero';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6025;
			
 
				+      name: 'invalidInputPoolVault';
			
 
				+      msg: 'Input pool vault is invalid';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6026;
			
 
				+      name: 'tooSmallInputOrOutputAmount';
			
 
				+      msg: 'Swap input or output amount is too small';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6027;
			
 
				+      name: 'notEnoughTickArrayAccount';
			
 
				+      msg: 'Not enought tick array account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6028;
			
 
				+      name: 'invalidFirstTickArrayAccount';
			
 
				+      msg: 'Invalid first tick array account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6029;
			
 
				+      name: 'invalidRewardIndex';
			
 
				+      msg: 'Invalid reward index';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6030;
			
 
				+      name: 'fullRewardInfo';
			
 
				+      msg: 'The init reward token reach to the max';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6031;
			
 
				+      name: 'rewardTokenAlreadyInUse';
			
 
				+      msg: 'The init reward token already in use';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6032;
			
 
				+      name: 'exceptRewardMint';
			
 
				+      msg: 'The reward tokens must contain one of pool vault mint except the last reward';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6033;
			
 
				+      name: 'invalidRewardInitParam';
			
 
				+      msg: 'Invalid reward init param';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6034;
			
 
				+      name: 'invalidRewardDesiredAmount';
			
 
				+      msg: 'Invalid collect reward desired amount';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6035;
			
 
				+      name: 'invalidRewardInputAccountNumber';
			
 
				+      msg: 'Invalid collect reward input account number';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6036;
			
 
				+      name: 'invalidRewardPeriod';
			
 
				+      msg: 'Invalid reward period';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6037;
			
 
				+      name: 'notApproveUpdateRewardEmissiones';
			
 
				+      msg: 'Modification of emissiones is allowed within 72 hours from the end of the previous cycle';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6038;
			
 
				+      name: 'unInitializedRewardInfo';
			
 
				+      msg: 'uninitialized reward info';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6039;
			
 
				+      name: 'notSupportMint';
			
 
				+      msg: 'Not support token_2022 mint extension';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6040;
			
 
				+      name: 'missingTickArrayBitmapExtensionAccount';
			
 
				+      msg: 'Missing tickarray bitmap extension account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6041;
			
 
				+      name: 'insufficientLiquidityForDirection';
			
 
				+      msg: 'Insufficient liquidity for this direction';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6042;
			
 
				+      name: 'maxTokenOverflow';
			
 
				+      msg: 'Max token overflow';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6043;
			
 
				+      name: 'calculateOverflow';
			
 
				+      msg: 'Calculate overflow';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6044;
			
 
				+      name: 'transferFeeCalculateNotMatch';
			
 
				+      msg: 'TransferFee calculate not match';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6045;
			
 
				+      name: 'illegalAccountOwner';
			
 
				+      msg: 'invalid account owner';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6046;
			
 
				+      name: 'invalidAccount';
			
 
				+      msg: 'Invalid account';
			
 
				+    }
			
 
				+  ];
			
 
				+  types: [
			
 
				+    {
			
 
				+      name: 'ammAdminGroup';
			
 
				+      docs: ['Holds the admin group information.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'feeKeeper';
			
 
				+            docs: ['the address who can hold the fee,', 'anyone can trigger the fee collection action,'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardConfigManager';
			
 
				+            docs: [
			
 
				+              'the address who can config the reward(config, deposit, withdraw),',
			
 
				+              'deposit reward, set the account who can deposit the reward, withdraw the remaining reward(withdraw)'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardClaimManager';
			
 
				+            docs: ['the address who can manage the offchain reward claim'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolManager';
			
 
				+            docs: [
			
 
				+              'the address who can manage the pool create action,',
			
 
				+              "without this account's permission, no one can create a pool"
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emergencyManager';
			
 
				+            docs: [
			
 
				+              'the address who can manage the emergency action,',
			
 
				+              'emergency action includes stop/resume the pool, stop/resume withdraw lp'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'normalManager';
			
 
				+            docs: ['normal action manager,', 'such as create amm config, update amm config'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'pad';
			
 
				+            docs: ['The space required for the account. may be used for future extensions.'];
			
 
				+            type: {
			
 
				+              array: ['pubkey', 6];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'ammConfig';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'index';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'owner';
			
 
				+            docs: ['Address of the protocol owner'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeeRate';
			
 
				+            docs: ['The protocol fee'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeRate';
			
 
				+            docs: ['The trade fee, denominated in hundredths of a bip (10^-6)'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            docs: ['The tick spacing'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeeRate';
			
 
				+            docs: ['The fund fee, denominated in hundredths of a bip (10^-6)'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'paddingU32';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundOwner';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 3];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectPersonalFeeEvent';
			
 
				+      docs: ['Emitted when tokens are collected for a position'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'positionNftMint';
			
 
				+            docs: ['The ID of the token for which underlying tokens were collected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount0';
			
 
				+            docs: ['The token account that received the collected token_0 tokens'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount1';
			
 
				+            docs: ['The token account that received the collected token_1 tokens'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The amount of token_0 owed to the position that was collected'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The amount of token_1 owed to the position that was collected'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectProtocolFeeEvent';
			
 
				+      docs: ['Emitted when the collected protocol fees are withdrawn by the factory owner'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool whose protocol fee is collected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount0';
			
 
				+            docs: ['The address that receives the collected token_0 protocol fees'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount1';
			
 
				+            docs: ['The address that receives the collected token_1 protocol fees'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The amount of token_0 protocol fees that is withdrawn'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The amount of token_0 protocol fees that is withdrawn'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'configChangeEvent';
			
 
				+      docs: ['Emitted when create or update a config'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'index';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'owner';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeeRate';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeRate';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeeRate';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundOwner';
			
 
				+            type: 'pubkey';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createPersonalPositionEvent';
			
 
				+      docs: ['Emitted when create a new position'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool for which liquidity was added'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'minter';
			
 
				+            docs: ['The address that create the position'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'nftOwner';
			
 
				+            docs: ['The owner of the position and recipient of any minted liquidity'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLowerIndex';
			
 
				+            docs: ['The lower tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpperIndex';
			
 
				+            docs: ['The upper tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount of liquidity minted to the position range'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount0';
			
 
				+            docs: ['The amount of token_0 was deposit for the liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount1';
			
 
				+            docs: ['The amount of token_1 was deposit for the liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount0TransferFee';
			
 
				+            docs: ['The token transfer fee for deposit_amount_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount1TransferFee';
			
 
				+            docs: ['The token transfer fee for deposit_amount_1'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidityEvent';
			
 
				+      docs: ['Emitted when liquidity is decreased.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'positionNftMint';
			
 
				+            docs: ['The ID of the token for which liquidity was decreased'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount by which liquidity for the position was decreased'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'decreaseAmount0';
			
 
				+            docs: ['The amount of token_0 that was paid for the decrease in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'decreaseAmount1';
			
 
				+            docs: ['The amount of token_1 that was paid for the decrease in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeAmount0';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeAmount1';
			
 
				+            docs: ['The amount of token_1 fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardAmounts';
			
 
				+            docs: ['The amount of rewards'];
			
 
				+            type: {
			
 
				+              array: ['u64', 3];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee0';
			
 
				+            docs: ['The amount of token_0 transfer fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee1';
			
 
				+            docs: ['The amount of token_1 transfer fee'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidityEvent';
			
 
				+      docs: ['Emitted when liquidity is increased.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'positionNftMint';
			
 
				+            docs: ['The ID of the token for which liquidity was increased'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount by which liquidity for the NFT position was increased'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The amount of token_0 that was paid for the increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The amount of token_1 that was paid for the increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0TransferFee';
			
 
				+            docs: ['The token transfer fee for amount_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1TransferFee';
			
 
				+            docs: ['The token transfer fee for amount_1'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'initAdminGroupParams';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'feeKeeper';
			
 
				+            docs: ['the address who can hold the fee,', 'anyone can trigger the fee collection action,'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardConfigManager';
			
 
				+            docs: [
			
 
				+              'the address who can config the reward(config, deposit, withdraw),',
			
 
				+              'deposit reward, set the account who can deposit the reward, withdraw the remaining reward(withdraw)'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardClaimManager';
			
 
				+            docs: ['the address who can manage the offchain reward claim'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolManager';
			
 
				+            docs: [
			
 
				+              'the address who can manage the pool create action,',
			
 
				+              "without this account's permission, no one can create a pool"
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emergencyManager';
			
 
				+            docs: [
			
 
				+              'the address who can manage the emergency action,',
			
 
				+              'emergency action includes stop/resume the pool, stop/resume withdraw lp'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'normalManager';
			
 
				+            docs: ['normal action manager,', 'such as create amm config, update amm config'];
			
 
				+            type: 'pubkey';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'initializeRewardParam';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'openTime';
			
 
				+            docs: ['Reward open time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'endTime';
			
 
				+            docs: ['Reward end time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emissionsPerSecondX64';
			
 
				+            docs: ['Token reward per second are earned per unit of liquidity'];
			
 
				+            type: 'u128';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityCalculateEvent';
			
 
				+      docs: ['Emitted when liquidity decreased or increase.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolLiquidity';
			
 
				+            docs: ['The pool liquidity before decrease or increase'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolSqrtPriceX64';
			
 
				+            docs: ['The pool price when decrease or increase in liquidity'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolTick';
			
 
				+            docs: ['The pool tick when decrease or increase in liquidity'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'calcAmount0';
			
 
				+            docs: ['The amount of token_0 that was calculated for the decrease or increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'calcAmount1';
			
 
				+            docs: ['The amount of token_1 that was calculated for the decrease or increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeOwed0';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeOwed1';
			
 
				+            docs: ['The amount of token_1 fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee0';
			
 
				+            docs: ['The amount of token_0 transfer fee without trade_fee_amount_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee1';
			
 
				+            docs: ['The amount of token_1 transfer fee without trade_fee_amount_0'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityChangeEvent';
			
 
				+      docs: ['Emitted pool liquidity change when increase and decrease liquidity'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool for swap'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            docs: ['The tick of the pool'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLower';
			
 
				+            docs: ['The tick lower of position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpper';
			
 
				+            docs: ['The tick lower of position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityBefore';
			
 
				+            docs: ['The liquidity of the pool before liquidity change'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityAfter';
			
 
				+            docs: ['The liquidity of the pool after liquidity change'];
			
 
				+            type: 'u128';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'modifyAmmAdminGroupEvent';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'feeKeeper';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardConfigManager';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardClaimManager';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolManager';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emergencyManager';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'normalManager';
			
 
				+            type: 'pubkey';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'observation';
			
 
				+      docs: ['The element of observations in ObservationState'];
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'blockTimestamp';
			
 
				+            docs: ['The block timestamp of the observation'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickCumulative';
			
 
				+            docs: ['the cumulative of tick during the duration time'];
			
 
				+            type: 'i64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            docs: ['padding for feature update'];
			
 
				+            type: {
			
 
				+              array: ['u64', 4];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'observationState';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'initialized';
			
 
				+            docs: ['Whether the ObservationState is initialized'];
			
 
				+            type: 'bool';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            docs: ['recent update epoch'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'observationIndex';
			
 
				+            docs: ['the most-recently updated index of the observations array'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['belongs to which pool'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'observations';
			
 
				+            docs: ['observation array'];
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'observation';
			
 
				+                  };
			
 
				+                },
			
 
				+                100
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            docs: ['padding for feature update'];
			
 
				+            type: {
			
 
				+              array: ['u64', 4];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'offchainRewardConfig';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['the pool state address'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardVault';
			
 
				+            docs: ['the vault to hold the reward', 'vault address is this config address'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'vaultBump';
			
 
				+            docs: ['Bump to identify vault PDA'];
			
 
				+            type: {
			
 
				+              array: ['u8', 1];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardMintVec';
			
 
				+            docs: ['reward token mint address list', 'reward token account is ATA(reward_vault, reward_mint)'];
			
 
				+            type: {
			
 
				+              vec: 'pubkey';
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'operationState';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'operationOwners';
			
 
				+            docs: ['Address of the operation owner'];
			
 
				+            type: {
			
 
				+              array: ['pubkey', 10];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'whitelistMints';
			
 
				+            docs: ['The mint address of whitelist to emit reward'];
			
 
				+            type: {
			
 
				+              array: ['pubkey', 100];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'personalPositionState';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: {
			
 
				+              array: ['u8', 1];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'nftMint';
			
 
				+            docs: ['Mint address of the tokenized position'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['The ID of the pool with which this token is connected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLowerIndex';
			
 
				+            docs: ['The lower bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpperIndex';
			
 
				+            docs: ['The upper bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount of liquidity owned by this position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside0LastX64';
			
 
				+            docs: ['The token_0 fee growth of the aggregate position as of the last action on the individual position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside1LastX64';
			
 
				+            docs: ['The token_1 fee growth of the aggregate position as of the last action on the individual position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed0';
			
 
				+            docs: ['The fees owed to the position owner in token_0, as of the last computation'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed1';
			
 
				+            docs: ['The fees owed to the position owner in token_1, as of the last computation'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardInfos';
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'positionRewardInfo';
			
 
				+                  };
			
 
				+                },
			
 
				+                3
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 7];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolCreatedEvent';
			
 
				+      docs: ['Emitted when a pool is created and initialized with a starting price', ''];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'tokenMint0';
			
 
				+            docs: ['The first token of the pool by address sort order'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint1';
			
 
				+            docs: ['The second token of the pool by address sort order'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            docs: ['The minimum number of ticks between initialized ticks'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The address of the created pool'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sqrtPriceX64';
			
 
				+            docs: ['The initial sqrt price of the pool, as a Q64.64'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            docs: ['The initial tick of the pool, i.e. log base 1.0001 of the starting price of the pool'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault0';
			
 
				+            docs: ['Vault of token_0'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault1';
			
 
				+            docs: ['Vault of token_1'];
			
 
				+            type: 'pubkey';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolState';
			
 
				+      docs: ['The pool state', '', 'PDA of `[POOL_SEED, config, token_mint_0, token_mint_1]`', ''];
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: {
			
 
				+              array: ['u8', 1];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'ammConfig';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'owner';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint0';
			
 
				+            docs: ['Token pair of the pool, where token_mint_0 address < token_mint_1 address'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint1';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault0';
			
 
				+            docs: ['Token pair vault'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault1';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'observationKey';
			
 
				+            docs: ['observation account key'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'mintDecimals0';
			
 
				+            docs: ['mint0 and mint1 decimals'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'mintDecimals1';
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            docs: ['The minimum number of ticks between initialized ticks'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The currently in range liquidity available to the pool.'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sqrtPriceX64';
			
 
				+            docs: ['The current price of the pool as a sqrt(token_1/token_0) Q64.64 value'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickCurrent';
			
 
				+            docs: ['The current tick of the pool, i.e. according to the last tick transition that was run.'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding3';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding4';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthGlobal0X64';
			
 
				+            docs: [
			
 
				+              'The fee growth as a Q64.64 number, i.e. fees of token_0 and token_1 collected per',
			
 
				+              'unit of liquidity for the entire life of the pool.'
			
 
				+            ];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthGlobal1X64';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeesToken0';
			
 
				+            docs: ['The amounts of token_0 and token_1 that are owed to the protocol.'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeesToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapInAmountToken0';
			
 
				+            docs: ['The amounts in and out of swap token_0 and token_1'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapOutAmountToken1';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapInAmountToken1';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapOutAmountToken0';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'status';
			
 
				+            docs: [
			
 
				+              'Bitwise representation of the state of the pool',
			
 
				+              'bit0, 1: disable open position and increase liquidity, 0: normal',
			
 
				+              'bit1, 1: disable decrease liquidity, 0: normal',
			
 
				+              'bit2, 1: disable collect fee, 0: normal',
			
 
				+              'bit3, 1: disable collect reward, 0: normal',
			
 
				+              'bit4, 1: disable swap, 0: normal'
			
 
				+            ];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            docs: ['Leave blank for future use'];
			
 
				+            type: {
			
 
				+              array: ['u8', 7];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardInfos';
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'rewardInfo';
			
 
				+                  };
			
 
				+                },
			
 
				+                3
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickArrayBitmap';
			
 
				+            docs: ['Packed initialized tick array state'];
			
 
				+            type: {
			
 
				+              array: ['u64', 16];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesToken0';
			
 
				+            docs: ['except protocol_fee and fund_fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesClaimedToken0';
			
 
				+            docs: ['except protocol_fee and fund_fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesClaimedToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeesToken0';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeesToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'openTime';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding1';
			
 
				+            type: {
			
 
				+              array: ['u64', 24];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding2';
			
 
				+            type: {
			
 
				+              array: ['u64', 32];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'positionRewardInfo';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'growthInsideLastX64';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardAmountOwed';
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'protocolPositionState';
			
 
				+      docs: ["Info stored for each user's position"];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['The ID of the pool with which this token is connected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLowerIndex';
			
 
				+            docs: ['The lower bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpperIndex';
			
 
				+            docs: ['The upper bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount of liquidity owned by this position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside0LastX64';
			
 
				+            docs: ['The token_0 fee growth per unit of liquidity as of the last update to liquidity or fees owed'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside1LastX64';
			
 
				+            docs: ['The token_1 fee growth per unit of liquidity as of the last update to liquidity or fees owed'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed0';
			
 
				+            docs: ['The fees owed to the position owner in token_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed1';
			
 
				+            docs: ['The fees owed to the position owner in token_1'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardGrowthInside';
			
 
				+            docs: ['The reward growth per unit of liquidity as of the last update to liquidity'];
			
 
				+            type: {
			
 
				+              array: ['u128', 3];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 7];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'rewardInfo';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'rewardState';
			
 
				+            docs: ['Reward state'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'openTime';
			
 
				+            docs: ['Reward open time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'endTime';
			
 
				+            docs: ['Reward end time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'lastUpdateTime';
			
 
				+            docs: ['Reward last update time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emissionsPerSecondX64';
			
 
				+            docs: ['Q64.64 number indicates how many tokens per second are earned per unit of liquidity.'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardTotalEmissioned';
			
 
				+            docs: ['The total amount of reward emissioned'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardClaimed';
			
 
				+            docs: ['The total amount of claimed reward'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint';
			
 
				+            docs: ['Reward token mint.'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault';
			
 
				+            docs: ['Reward vault token account.'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'authority';
			
 
				+            docs: ['The owner that has permission to set reward param'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardGrowthGlobalX64';
			
 
				+            docs: [
			
 
				+              'Q64.64 number that tracks the total tokens earned per unit of liquidity since the reward',
			
 
				+              'emissions were turned on.'
			
 
				+            ];
			
 
				+            type: 'u128';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'supportMintAssociated';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'mint';
			
 
				+            docs: ['Address of the supported token22 mint'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 8];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapEvent';
			
 
				+      docs: ['Emitted by when a swap is performed for a pool'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool for which token_0 and token_1 were swapped'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sender';
			
 
				+            docs: ['The address that initiated the swap call, and that received the callback'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenAccount0';
			
 
				+            docs: [
			
 
				+              'The payer token account in zero for one swaps, or the recipient token account',
			
 
				+              'in one for zero swaps'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenAccount1';
			
 
				+            docs: [
			
 
				+              'The payer token account in one for zero swaps, or the recipient token account',
			
 
				+              'in zero for one swaps'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The real delta amount of the token_0 of the pool or user'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee0';
			
 
				+            docs: ['The transfer fee charged by the withheld_amount of the token_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The real delta of the token_1 of the pool or user'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee1';
			
 
				+            docs: ['The transfer fee charged by the withheld_amount of the token_1'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'zeroForOne';
			
 
				+            docs: ['if true, amount_0 is negtive and amount_1 is positive'];
			
 
				+            type: 'bool';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sqrtPriceX64';
			
 
				+            docs: ['The sqrt(price) of the pool after the swap, as a Q64.64'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The liquidity of the pool after the swap'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            docs: ['The log base 1.0001 of price of the pool after the swap'];
			
 
				+            type: 'i32';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayBitmapExtension';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'positiveTickArrayBitmap';
			
 
				+            docs: ['Packed initialized tick array state for start_tick_index is positive'];
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  array: ['u64', 8];
			
 
				+                },
			
 
				+                14
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'negativeTickArrayBitmap';
			
 
				+            docs: ['Packed initialized tick array state for start_tick_index is negitive'];
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  array: ['u64', 8];
			
 
				+                },
			
 
				+                14
			
 
				+              ];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayState';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'startTickIndex';
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'ticks';
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'tickState';
			
 
				+                  };
			
 
				+                },
			
 
				+                60
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'initializedTickCount';
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u8', 107];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickState';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityNet';
			
 
				+            docs: [
			
 
				+              'Amount of net liquidity added (subtracted) when tick is crossed from left to right (right to left)'
			
 
				+            ];
			
 
				+            type: 'i128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityGross';
			
 
				+            docs: ['The total position liquidity that references this tick'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthOutside0X64';
			
 
				+            docs: [
			
 
				+              'Fee growth per unit of liquidity on the _other_ side of this tick (relative to the current tick)',
			
 
				+              'only has relative meaning, not absolute — the value depends on when the tick is initialized'
			
 
				+            ];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthOutside1X64';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardGrowthsOutsideX64';
			
 
				+            type: {
			
 
				+              array: ['u128', 3];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u32', 13];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateAdminGroupParams';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'feeKeeper';
			
 
				+            docs: ['the address who can hold the fee,', 'anyone can trigger the fee collection action,'];
			
 
				+            type: {
			
 
				+              option: 'pubkey';
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardConfigManager';
			
 
				+            docs: [
			
 
				+              'the address who can config the reward(config, deposit, withdraw),',
			
 
				+              'deposit reward, set the account who can deposit the reward, withdraw the remaining reward(withdraw)'
			
 
				+            ];
			
 
				+            type: {
			
 
				+              option: 'pubkey';
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardClaimManager';
			
 
				+            docs: ['the address who can manage the offchain reward claim'];
			
 
				+            type: {
			
 
				+              option: 'pubkey';
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolManager';
			
 
				+            docs: [
			
 
				+              'the address who can manage the pool create action,',
			
 
				+              "without this account's permission, no one can create a pool"
			
 
				+            ];
			
 
				+            type: {
			
 
				+              option: 'pubkey';
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emergencyManager';
			
 
				+            docs: [
			
 
				+              'the address who can manage the emergency action,',
			
 
				+              'emergency action includes stop/resume the pool, stop/resume withdraw lp'
			
 
				+            ];
			
 
				+            type: {
			
 
				+              option: 'pubkey';
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'normalManager';
			
 
				+            docs: ['normal action manager,', 'such as create amm config, update amm config'];
			
 
				+            type: {
			
 
				+              option: 'pubkey';
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateRewardInfosEvent';
			
 
				+      docs: ['Emitted when Reward are updated for a pool'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'rewardGrowthGlobalX64';
			
 
				+            docs: ['Reward info'];
			
 
				+            type: {
			
 
				+              array: ['u128', 3];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    }
			
 
				+  ];
			
 
				+};
			
--- a/src/lib/clmm-sdk/src/instructions/target/types/raydium_amm_v3.ts
+++ b/src/lib/clmm-sdk/src/instructions/target/types/raydium_amm_v3.ts
@@ -0,0 +1,4148 @@
 
				+/**
			
 
				+ * Program IDL in camelCase format in order to be used in JS/TS.
			
 
				+ *
			
 
				+ * Note that this is only a type helper and is not the actual IDL. The original
			
 
				+ * IDL can be found at `target/idl/amm_v3.json`.
			
 
				+ */
			
 
				+export type AmmV3 = {
			
 
				+  address: 'CAMMCzo5YL8w4VFF8KVHrK22GGUsp5VTaW7grrKgrWqK';
			
 
				+  metadata: {
			
 
				+    name: 'ammV3';
			
 
				+    version: '0.1.0';
			
 
				+    spec: '0.1.0';
			
 
				+    description: 'Anchor client and source for Raydium concentrated liquidity AMM';
			
 
				+  };
			
 
				+  instructions: [
			
 
				+    {
			
 
				+      name: 'closePosition';
			
 
				+      docs: [
			
 
				+        "Close the user's position and NFT account. If the NFT mint belongs to token2022, it will also be closed and the funds returned to the NFT owner.",
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [123, 134, 81, 0, 49, 68, 98, 98];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['The position nft owner'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Mint address bound to the personal position.'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          docs: ['User token account where position NFT be minted to'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['System program to close the position state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Token/Token2022 program to close token/mint account'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectFundFee';
			
 
				+      docs: [
			
 
				+        'Collect the fund fee accrued to the pool',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount_0_requested` - The maximum amount of token_0 to send, can be 0 to collect fees in only token_1',
			
 
				+        '* `amount_1_requested` - The maximum amount of token_1 to send, can be 0 to collect fees in only token_0',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [167, 138, 78, 149, 223, 194, 6, 126];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Only admin or fund_owner can collect fee now'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Pool state stores accumulated protocol fee amount'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Amm config account stores fund_owner'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The address that receives the collected token_0 protocol fees'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The address that receives the collected token_1 protocol fees'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['The SPL program to perform token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['The SPL program 2022 to perform token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount0Requested';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Requested';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectProtocolFee';
			
 
				+      docs: [
			
 
				+        'Collect the protocol fee accrued to the pool',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount_0_requested` - The maximum amount of token_0 to send, can be 0 to collect fees in only token_1',
			
 
				+        '* `amount_1_requested` - The maximum amount of token_1 to send, can be 0 to collect fees in only token_0',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [136, 136, 252, 221, 194, 66, 126, 89];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Only admin or config owner can collect fee now'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Pool state stores accumulated protocol fee amount'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Amm config account stores owner'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The address that receives the collected token_0 protocol fees'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The address that receives the collected token_1 protocol fees'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['The SPL program to perform token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['The SPL program 2022 to perform token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount0Requested';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Requested';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectRemainingRewards';
			
 
				+      docs: [
			
 
				+        'Collect remaining reward token for reward founder',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `reward_index` - the index to reward info',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [18, 237, 166, 197, 34, 16, 213, 144];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'rewardFunder';
			
 
				+          docs: ['The founder who init reward info previously'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'funderTokenAccount';
			
 
				+          docs: ["The funder's reward token account"];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Set reward for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenVault';
			
 
				+          docs: ['Reward vault transfer remaining token to founder token account'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardVaultMint';
			
 
				+          docs: ['The mint of reward token vault'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'rewardIndex';
			
 
				+          type: 'u8';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createAmmConfig';
			
 
				+      docs: [
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The accounts needed by instruction.',
			
 
				+        '* `index` - The index of amm config, there may be multiple config.',
			
 
				+        '* `tick_spacing` - The tickspacing binding with config, cannot be changed.',
			
 
				+        '* `trade_fee_rate` - Trade fee rate, can be changed.',
			
 
				+        '* `protocol_fee_rate` - The rate of protocol fee within trade fee.',
			
 
				+        '* `fund_fee_rate` - The rate of fund fee within trade fee.',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [137, 52, 237, 212, 215, 117, 108, 104];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as protocol owner.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Initialize config state account to store protocol owner address and fee rates.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [97, 109, 109, 95, 99, 111, 110, 102, 105, 103];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'index';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'index';
			
 
				+          type: 'u16';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickSpacing';
			
 
				+          type: 'u16';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tradeFeeRate';
			
 
				+          type: 'u32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolFeeRate';
			
 
				+          type: 'u32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'fundFeeRate';
			
 
				+          type: 'u32';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createOperationAccount';
			
 
				+      docs: [
			
 
				+        'Creates an operation account for the program',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [63, 87, 148, 33, 109, 35, 8, 104];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as operation account owner.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['Initialize operation state account to store operation owner address and white list mint.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createPool';
			
 
				+      docs: [
			
 
				+        'Creates a pool for the given token pair and the initial price',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `sqrt_price_x64` - the initial sqrt price (amount_token_1 / amount_token_0) of the pool as a Q64.64',
			
 
				+        'Note: The open_time must be smaller than the current block_timestamp on chain.'
			
 
				+      ];
			
 
				+      discriminator: [233, 146, 209, 142, 207, 104, 64, 188];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'poolCreator';
			
 
				+          docs: ['Address paying to create the pool. Can be anyone'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Which config the pool belongs to.'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Initialize an account to store the pool state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'ammConfig';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint0';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint1';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint0';
			
 
				+          docs: ['Token_0 mint, the key must be smaller then token_1 mint.'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint1';
			
 
				+          docs: ['Token_1 mint'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['Token_0 vault for the pool'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108, 95, 118, 97, 117, 108, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint0';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['Token_1 vault for the pool'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108, 95, 118, 97, 117, 108, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint1';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'observationState';
			
 
				+          docs: ['Initialize an account to store oracle observations'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 98, 115, 101, 114, 118, 97, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayBitmap';
			
 
				+          docs: ['Initialize an account to store if a tick array is initialized.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  112,
			
 
				+                  111,
			
 
				+                  111,
			
 
				+                  108,
			
 
				+                  95,
			
 
				+                  116,
			
 
				+                  105,
			
 
				+                  99,
			
 
				+                  107,
			
 
				+                  95,
			
 
				+                  97,
			
 
				+                  114,
			
 
				+                  114,
			
 
				+                  97,
			
 
				+                  121,
			
 
				+                  95,
			
 
				+                  98,
			
 
				+                  105,
			
 
				+                  116,
			
 
				+                  109,
			
 
				+                  97,
			
 
				+                  112,
			
 
				+                  95,
			
 
				+                  101,
			
 
				+                  120,
			
 
				+                  116,
			
 
				+                  101,
			
 
				+                  110,
			
 
				+                  115,
			
 
				+                  105,
			
 
				+                  111,
			
 
				+                  110
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram0';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram1';
			
 
				+          docs: ['Spl token program or token program 2022'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['To create a new program account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for program account'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'sqrtPriceX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'openTime';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createSupportMintAssociated';
			
 
				+      docs: [
			
 
				+        'Create support token22 mint account which can create pool and send rewards with ignoring the not support extensions.'
			
 
				+      ];
			
 
				+      discriminator: [17, 251, 65, 92, 136, 242, 14, 169];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as protocol owner.'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenMint';
			
 
				+          docs: ['Support token mint'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'supportMintAssociated';
			
 
				+          docs: ['Initialize support mint state account to store support mint address and bump.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [115, 117, 112, 112, 111, 114, 116, 95, 109, 105, 110, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'tokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidity';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `decrease_liquidity_v2` instead.")]',
			
 
				+        'Decreases liquidity for an existing position',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` -  The context of accounts',
			
 
				+        '* `liquidity` - The amount by which liquidity will be decreased',
			
 
				+        '* `amount_0_min` - The minimum amount of token_0 that should be accounted for the burned liquidity',
			
 
				+        '* `amount_1_min` - The minimum amount of token_1 that should be accounted for the burned liquidity',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [160, 38, 208, 111, 104, 91, 44, 1];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['The position owner or delegated authority'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for the tokenized position'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Decrease liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['Token_0 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['Token_1 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The destination token account for receive amount_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The destination token account for receive amount_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program to transfer out tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Min';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Min';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidityV2';
			
 
				+      docs: [
			
 
				+        'Decreases liquidity for an existing position, support Token2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` -  The context of accounts',
			
 
				+        '* `liquidity` - The amount by which liquidity will be decreased',
			
 
				+        '* `amount_0_min` - The minimum amount of token_0 that should be accounted for the burned liquidity',
			
 
				+        '* `amount_1_min` - The minimum amount of token_1 that should be accounted for the burned liquidity',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [58, 127, 188, 62, 79, 82, 196, 96];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['The position owner or delegated authority'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for the tokenized position'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Decrease liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['Token_0 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['Token_1 vault'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount0';
			
 
				+          docs: ['The destination token account for receive amount_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'recipientTokenAccount1';
			
 
				+          docs: ['The destination token account for receive amount_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program to transfer out tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Min';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Min';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidity';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `increase_liquidity_v2` instead.")]',
			
 
				+        'Increases liquidity for an existing position, with amount paid by `payer`',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        "* `liquidity` - The desired liquidity to be added, can't be zero",
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [46, 156, 243, 118, 13, 205, 251, 178];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for nft'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Increase liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ["The payer's token account for token_0"];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token account spending token_1 to mint the position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidityV2';
			
 
				+      docs: [
			
 
				+        'Increases liquidity for an existing position, with amount paid by `payer`, support Token2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `liquidity` - The desired liquidity to be added, if zero, calculate liquidity base amount_0 or amount_1 according base_flag',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        '* `base_flag` - must be specified if liquidity is zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [133, 29, 89, 223, 69, 238, 176, 10];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'nftOwner';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'nftAccount';
			
 
				+          docs: ['The token account for nft'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_lower_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'personal_position.tick_upper_index';
			
 
				+                account: 'personalPositionState';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['Increase liquidity for this position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          docs: ['Stores init state for the lower tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          docs: ['Stores init state for the upper tick'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ["The payer's token account for token_0"];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token account spending token_1 to mint the position'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'baseFlag';
			
 
				+          type: {
			
 
				+            option: 'bool';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'initializeReward';
			
 
				+      docs: [
			
 
				+        'Initialize a reward info for a given pool and reward index',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `reward_index` - the index to reward info',
			
 
				+        '* `open_time` - reward open timestamp',
			
 
				+        '* `end_time` - reward end timestamp',
			
 
				+        '* `emissions_per_second_x64` - Token reward per second are earned per unit of liquidity.',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [95, 135, 192, 196, 242, 129, 230, 68];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'rewardFunder';
			
 
				+          docs: ['The founder deposit reward token to vault'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'funderTokenAccount';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['For check the reward_funder authority'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Set reward for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['load info from the account to judge reward permission'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenMint';
			
 
				+          docs: ['Reward mint'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenVault';
			
 
				+          docs: ['A pda, reward vault'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 111, 108, 95, 114, 101, 119, 97, 114, 100, 95, 118, 97, 117, 108, 116];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'rewardTokenMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rewardTokenProgram';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'param';
			
 
				+          type: {
			
 
				+            defined: {
			
 
				+              name: 'initializeRewardParam';
			
 
				+            };
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'openPosition';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `open_position_with_token22_nft` instead.")]',
			
 
				+        'Creates a new position wrapped in a NFT',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `tick_lower_index` - The low boundary of market',
			
 
				+        '* `tick_upper_index` - The upper boundary of market',
			
 
				+        '* `tick_array_lower_start_index` - The start index of tick array which include tick low',
			
 
				+        '* `tick_array_upper_start_index` - The start index of tick array which include tick upper',
			
 
				+        '* `liquidity` - The liquidity to be added',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [135, 128, 47, 77, 15, 152, 240, 49];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftOwner';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Unique token mint address'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          docs: [
			
 
				+            'Token account where position NFT will be minted',
			
 
				+            'This account created in the contract by cpi to avoid large stack variables'
			
 
				+          ];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftOwner';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataAccount';
			
 
				+          docs: ['To store metaplex metadata'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Add liquidity for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          docs: ['Store the information of market marking in range'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickLowerIndex';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickUpperIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayLowerStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayUpperStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['personal position state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ['The token_0 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token_1 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for token mint and ATA creation'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['Program to create the position manager state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          docs: ['Program to create an ATA for receiving position NFT'];
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataProgram';
			
 
				+          docs: ['Program to create NFT metadata'];
			
 
				+          address: 'metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'tickLowerIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickUpperIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLowerStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpperStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'openPositionV2';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `open_position_with_token22_nft` instead.")]',
			
 
				+        'Creates a new position wrapped in a NFT, support Token2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `tick_lower_index` - The low boundary of market',
			
 
				+        '* `tick_upper_index` - The upper boundary of market',
			
 
				+        '* `tick_array_lower_start_index` - The start index of tick array which include tick low',
			
 
				+        '* `tick_array_upper_start_index` - The start index of tick array which include tick upper',
			
 
				+        '* `liquidity` - The liquidity to be added, if zero, and the base_flag is specified, calculate liquidity base amount_0_max or amount_1_max according base_flag, otherwise open position with zero liquidity',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        '* `with_metadata` - The flag indicating whether to create NFT mint metadata',
			
 
				+        '* `base_flag` - if the liquidity specified as zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [77, 184, 74, 214, 112, 86, 241, 199];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftOwner';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Unique token mint address'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          docs: ['Token account where position NFT will be minted'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftOwner';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [
			
 
				+                  6,
			
 
				+                  221,
			
 
				+                  246,
			
 
				+                  225,
			
 
				+                  215,
			
 
				+                  101,
			
 
				+                  161,
			
 
				+                  147,
			
 
				+                  217,
			
 
				+                  203,
			
 
				+                  225,
			
 
				+                  70,
			
 
				+                  206,
			
 
				+                  235,
			
 
				+                  121,
			
 
				+                  172,
			
 
				+                  28,
			
 
				+                  180,
			
 
				+                  133,
			
 
				+                  237,
			
 
				+                  95,
			
 
				+                  91,
			
 
				+                  55,
			
 
				+                  145,
			
 
				+                  58,
			
 
				+                  140,
			
 
				+                  245,
			
 
				+                  133,
			
 
				+                  126,
			
 
				+                  255,
			
 
				+                  0,
			
 
				+                  169
			
 
				+                ];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+            program: {
			
 
				+              kind: 'const';
			
 
				+              value: [
			
 
				+                140,
			
 
				+                151,
			
 
				+                37,
			
 
				+                143,
			
 
				+                78,
			
 
				+                36,
			
 
				+                137,
			
 
				+                241,
			
 
				+                187,
			
 
				+                61,
			
 
				+                16,
			
 
				+                41,
			
 
				+                20,
			
 
				+                142,
			
 
				+                13,
			
 
				+                131,
			
 
				+                11,
			
 
				+                90,
			
 
				+                19,
			
 
				+                153,
			
 
				+                218,
			
 
				+                255,
			
 
				+                16,
			
 
				+                132,
			
 
				+                4,
			
 
				+                142,
			
 
				+                123,
			
 
				+                216,
			
 
				+                219,
			
 
				+                233,
			
 
				+                248,
			
 
				+                89
			
 
				+              ];
			
 
				+            };
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataAccount';
			
 
				+          docs: ['To store metaplex metadata'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Add liquidity for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          docs: ['Store the information of market marking in range'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickLowerIndex';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickUpperIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayLowerStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayUpperStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['personal position state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ['The token_0 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token_1 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for token mint and ATA creation'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['Program to create the position manager state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          docs: ['Program to create an ATA for receiving position NFT'];
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'metadataProgram';
			
 
				+          docs: ['Program to create NFT metadata'];
			
 
				+          address: 'metaqbxxUerdq28cj1RbAWkYQm3ybzjb6a8bt518x1s';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Program to create mint account and mint tokens'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'tickLowerIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickUpperIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLowerStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpperStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'withMetadata';
			
 
				+          type: 'bool';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'baseFlag';
			
 
				+          type: {
			
 
				+            option: 'bool';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'openPositionWithToken22Nft';
			
 
				+      docs: [
			
 
				+        'Creates a new position wrapped in a Token2022 NFT without relying on metadata_program and metadata_account, reduce the cost for user to create a personal position.',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `tick_lower_index` - The low boundary of market',
			
 
				+        '* `tick_upper_index` - The upper boundary of market',
			
 
				+        '* `tick_array_lower_start_index` - The start index of tick array which include tick low',
			
 
				+        '* `tick_array_upper_start_index` - The start index of tick array which include tick upper',
			
 
				+        '* `liquidity` - The liquidity to be added, if zero, and the base_flag is specified, calculate liquidity base amount_0_max or amount_1_max according base_flag, otherwise open position with zero liquidity',
			
 
				+        '* `amount_0_max` - The max amount of token_0 to spend, which serves as a slippage check',
			
 
				+        '* `amount_1_max` - The max amount of token_1 to spend, which serves as a slippage check',
			
 
				+        '* `with_metadata` - The flag indicating whether to create NFT mint metadata',
			
 
				+        '* `base_flag` - if the liquidity specified as zero, true: calculate liquidity base amount_0_max otherwise base amount_1_max',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [77, 255, 174, 82, 125, 29, 201, 46];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['Pays to mint the position'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftOwner';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftMint';
			
 
				+          docs: ['Unique token mint address, initialize in contract'];
			
 
				+          writable: true;
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'positionNftAccount';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['Add liquidity for this pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'protocolPosition';
			
 
				+          docs: ['Store the information of market marking in range'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickLowerIndex';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickUpperIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLower';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayLowerStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpper';
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [116, 105, 99, 107, 95, 97, 114, 114, 97, 121];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'poolState';
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'arg';
			
 
				+                path: 'tickArrayUpperStartIndex';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'personalPosition';
			
 
				+          docs: ['personal position state'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [112, 111, 115, 105, 116, 105, 111, 110];
			
 
				+              },
			
 
				+              {
			
 
				+                kind: 'account';
			
 
				+                path: 'positionNftMint';
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount0';
			
 
				+          docs: ['The token_0 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenAccount1';
			
 
				+          docs: ['The token_1 account deposit token to the pool'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault0';
			
 
				+          docs: ['The address that holds pool tokens for token_0'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenVault1';
			
 
				+          docs: ['The address that holds pool tokens for token_1'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'rent';
			
 
				+          docs: ['Sysvar for token mint and ATA creation'];
			
 
				+          address: 'SysvarRent111111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          docs: ['Program to create the position manager state account'];
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Program to transfer for token account'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'associatedTokenProgram';
			
 
				+          docs: ['Program to create an ATA for receiving position NFT'];
			
 
				+          address: 'ATokenGPvbdGVxr1b2hvZbsiqW5xWH25efTNsLJA8knL';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Program to create NFT mint/token account and transfer for token22 account'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault0Mint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'vault1Mint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'tickLowerIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickUpperIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayLowerStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArrayUpperStartIndex';
			
 
				+          type: 'i32';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'liquidity';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount0Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amount1Max';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'withMetadata';
			
 
				+          type: 'bool';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'baseFlag';
			
 
				+          type: {
			
 
				+            option: 'bool';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'setRewardParams';
			
 
				+      docs: [
			
 
				+        'Reset reward param, start a new reward cycle or extend the current cycle.',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `reward_index` - The index of reward token in the pool.',
			
 
				+        '* `emissions_per_second_x64` - The per second emission reward, when extend the current cycle,',
			
 
				+        "new value can't be less than old value",
			
 
				+        '* `open_time` - reward open timestamp, must be set when starting a new cycle',
			
 
				+        '* `end_time` - reward end timestamp',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [112, 52, 167, 75, 32, 201, 211, 137];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['Address to be set as protocol owner. It pays to create factory state account.'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['load info from the account to judge reward permission'];
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['Token program'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['Token program 2022'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'rewardIndex';
			
 
				+          type: 'u8';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'emissionsPerSecondX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'openTime';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'endTime';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swap';
			
 
				+      docs: [
			
 
				+        '#[deprecated(note = "Use `swap_v2` instead.")]',
			
 
				+        'Swaps one token for as much as possible of another token across a single pool',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount` - Arranged in pairs with other_amount_threshold. (amount_in, amount_out_minimum) or (amount_out, amount_in_maximum)',
			
 
				+        '* `other_amount_threshold` - For slippage check',
			
 
				+        '* `sqrt_price_limit` - The Q64.64 sqrt price √P limit. If zero for one, the price cannot',
			
 
				+        '* `is_base_input` - swap base input or swap base output',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [248, 198, 158, 145, 225, 117, 135, 200];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['The user performing the swap'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['The factory state to read protocol fees'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['The program account of the pool in which the swap will be performed'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputTokenAccount';
			
 
				+          docs: ['The user token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputTokenAccount';
			
 
				+          docs: ['The user token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputVault';
			
 
				+          docs: ['The vault token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputVault';
			
 
				+          docs: ['The vault token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'observationState';
			
 
				+          docs: ['The program account for the most recent oracle observation'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program for token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tickArray';
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'otherAmountThreshold';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'sqrtPriceLimitX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'isBaseInput';
			
 
				+          type: 'bool';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapRouterBaseIn';
			
 
				+      docs: [
			
 
				+        'Swap token for as much as possible of another token across the path provided, base input',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount_in` - Token amount to be swapped in',
			
 
				+        '* `amount_out_minimum` - Panic if output amount is below minimum amount. For slippage.',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [69, 125, 115, 218, 245, 186, 242, 196];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['The user performing the swap'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputTokenAccount';
			
 
				+          docs: ['The token account that pays input tokens for the swap'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputTokenMint';
			
 
				+          docs: ['The mint of input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program for token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['SPL program 2022 for token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['Memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amountIn';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'amountOutMinimum';
			
 
				+          type: 'u64';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapV2';
			
 
				+      docs: [
			
 
				+        'Swaps one token for as much as possible of another token across a single pool, support token program 2022',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx` - The context of accounts',
			
 
				+        '* `amount` - Arranged in pairs with other_amount_threshold. (amount_in, amount_out_minimum) or (amount_out, amount_in_maximum)',
			
 
				+        '* `other_amount_threshold` - For slippage check',
			
 
				+        '* `sqrt_price_limit` - The Q64.64 sqrt price √P limit. If zero for one, the price cannot',
			
 
				+        '* `is_base_input` - swap base input or swap base output',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [43, 4, 237, 11, 26, 201, 30, 98];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'payer';
			
 
				+          docs: ['The user performing the swap'];
			
 
				+          signer: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['The factory state to read protocol fees'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['The program account of the pool in which the swap will be performed'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputTokenAccount';
			
 
				+          docs: ['The user token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputTokenAccount';
			
 
				+          docs: ['The user token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputVault';
			
 
				+          docs: ['The vault token account for input token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputVault';
			
 
				+          docs: ['The vault token account for output token'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'observationState';
			
 
				+          docs: ['The program account for the most recent oracle observation'];
			
 
				+          writable: true;
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram';
			
 
				+          docs: ['SPL program for token transfers'];
			
 
				+          address: 'TokenkegQfeZyiNwAJbNbGKPFXCWuBvf9Ss623VQ5DA';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'tokenProgram2022';
			
 
				+          docs: ['SPL program 2022 for token transfers'];
			
 
				+          address: 'TokenzQdBNbLqP5VEhdkAS6EPFLC1PHnBqCXEpPxuEb';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'memoProgram';
			
 
				+          docs: ['Memo program'];
			
 
				+          address: 'MemoSq4gqABAXKb96qnH8TysNcWxMyWCqXgDLGmfcHr';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'inputVaultMint';
			
 
				+          docs: ['The mint of token vault 0'];
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'outputVaultMint';
			
 
				+          docs: ['The mint of token vault 1'];
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'amount';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'otherAmountThreshold';
			
 
				+          type: 'u64';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'sqrtPriceLimitX64';
			
 
				+          type: 'u128';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'isBaseInput';
			
 
				+          type: 'bool';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'transferRewardOwner';
			
 
				+      docs: [
			
 
				+        'Transfer reward owner',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `new_owner`- new owner pubkey',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [7, 22, 12, 83, 242, 43, 48, 121];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          docs: ['Address to be set as operation account owner.'];
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'newOwner';
			
 
				+          type: 'pubkey';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateAmmConfig';
			
 
				+      docs: [
			
 
				+        'Updates the owner of the amm config',
			
 
				+        'Must be called by the current owner or admin',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `trade_fee_rate`- The new trade fee rate of amm config, be set when `param` is 0',
			
 
				+        '* `protocol_fee_rate`- The new protocol fee rate of amm config, be set when `param` is 1',
			
 
				+        '* `fund_fee_rate`- The new fund fee rate of amm config, be set when `param` is 2',
			
 
				+        "* `new_owner`- The config's new owner, be set when `param` is 3",
			
 
				+        "* `new_fund_owner`- The config's new fund owner, be set when `param` is 4",
			
 
				+        '* `param`- The value can be 0 | 1 | 2 | 3 | 4, otherwise will report a error',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [49, 60, 174, 136, 154, 28, 116, 200];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['The amm config owner or admin'];
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'ammConfig';
			
 
				+          docs: ['Amm config account to be changed'];
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'param';
			
 
				+          type: 'u8';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'value';
			
 
				+          type: 'u32';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateOperationAccount';
			
 
				+      docs: [
			
 
				+        'Update the operation account',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `param`- The value can be 0 | 1 | 2 | 3, otherwise will report a error',
			
 
				+        '* `keys`- update operation owner when the `param` is 0',
			
 
				+        'remove operation owner when the `param` is 1',
			
 
				+        'update whitelist mint when the `param` is 2',
			
 
				+        'remove whitelist mint when the `param` is 3',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [127, 70, 119, 40, 188, 227, 61, 7];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'owner';
			
 
				+          docs: ['Address to be set as operation account owner.'];
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'operationState';
			
 
				+          docs: ['Initialize operation state account to store operation owner address and white list mint.'];
			
 
				+          writable: true;
			
 
				+          pda: {
			
 
				+            seeds: [
			
 
				+              {
			
 
				+                kind: 'const';
			
 
				+                value: [111, 112, 101, 114, 97, 116, 105, 111, 110];
			
 
				+              }
			
 
				+            ];
			
 
				+          };
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'systemProgram';
			
 
				+          address: '11111111111111111111111111111111';
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'param';
			
 
				+          type: 'u8';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'keys';
			
 
				+          type: {
			
 
				+            vec: 'pubkey';
			
 
				+          };
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updatePoolStatus';
			
 
				+      docs: [
			
 
				+        'Update pool status for given value',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        '* `status` - The value of status',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [130, 87, 108, 6, 46, 224, 117, 123];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'authority';
			
 
				+          signer: true;
			
 
				+          address: 'GThUX1Atko4tqhN2NaiTazWSeFWMuiUvfFnyJyUghFMJ';
			
 
				+        },
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [
			
 
				+        {
			
 
				+          name: 'status';
			
 
				+          type: 'u8';
			
 
				+        }
			
 
				+      ];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateRewardInfos';
			
 
				+      docs: [
			
 
				+        'Update rewards info of the given pool, can be called for everyone',
			
 
				+        '',
			
 
				+        '# Arguments',
			
 
				+        '',
			
 
				+        '* `ctx`- The context of accounts',
			
 
				+        ''
			
 
				+      ];
			
 
				+      discriminator: [163, 172, 224, 52, 11, 154, 106, 223];
			
 
				+      accounts: [
			
 
				+        {
			
 
				+          name: 'poolState';
			
 
				+          docs: ['The liquidity pool for which reward info to update'];
			
 
				+          writable: true;
			
 
				+        }
			
 
				+      ];
			
 
				+      args: [];
			
 
				+    }
			
 
				+  ];
			
 
				+  accounts: [
			
 
				+    {
			
 
				+      name: 'ammConfig';
			
 
				+      discriminator: [218, 244, 33, 104, 203, 203, 43, 111];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'observationState';
			
 
				+      discriminator: [122, 174, 197, 53, 129, 9, 165, 132];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'operationState';
			
 
				+      discriminator: [19, 236, 58, 237, 81, 222, 183, 252];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'personalPositionState';
			
 
				+      discriminator: [70, 111, 150, 126, 230, 15, 25, 117];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolState';
			
 
				+      discriminator: [247, 237, 227, 245, 215, 195, 222, 70];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'protocolPositionState';
			
 
				+      discriminator: [100, 226, 145, 99, 146, 218, 160, 106];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'supportMintAssociated';
			
 
				+      discriminator: [134, 40, 183, 79, 12, 112, 162, 53];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayBitmapExtension';
			
 
				+      discriminator: [60, 150, 36, 219, 97, 128, 139, 153];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayState';
			
 
				+      discriminator: [192, 155, 85, 205, 49, 249, 129, 42];
			
 
				+    }
			
 
				+  ];
			
 
				+  events: [
			
 
				+    {
			
 
				+      name: 'collectPersonalFeeEvent';
			
 
				+      discriminator: [166, 174, 105, 192, 81, 161, 83, 105];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectProtocolFeeEvent';
			
 
				+      discriminator: [206, 87, 17, 79, 45, 41, 213, 61];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'configChangeEvent';
			
 
				+      discriminator: [247, 189, 7, 119, 106, 112, 95, 151];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createPersonalPositionEvent';
			
 
				+      discriminator: [100, 30, 87, 249, 196, 223, 154, 206];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidityEvent';
			
 
				+      discriminator: [58, 222, 86, 58, 68, 50, 85, 56];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidityEvent';
			
 
				+      discriminator: [49, 79, 105, 212, 32, 34, 30, 84];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityCalculateEvent';
			
 
				+      discriminator: [237, 112, 148, 230, 57, 84, 180, 162];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityChangeEvent';
			
 
				+      discriminator: [126, 240, 175, 206, 158, 88, 153, 107];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolCreatedEvent';
			
 
				+      discriminator: [25, 94, 75, 47, 112, 99, 53, 63];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapEvent';
			
 
				+      discriminator: [64, 198, 205, 232, 38, 8, 113, 226];
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateRewardInfosEvent';
			
 
				+      discriminator: [109, 127, 186, 78, 114, 65, 37, 236];
			
 
				+    }
			
 
				+  ];
			
 
				+  errors: [
			
 
				+    {
			
 
				+      code: 6000;
			
 
				+      name: 'lok';
			
 
				+      msg: 'lok';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6001;
			
 
				+      name: 'notApproved';
			
 
				+      msg: 'Not approved';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6002;
			
 
				+      name: 'invalidUpdateConfigFlag';
			
 
				+      msg: 'invalid update amm config flag';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6003;
			
 
				+      name: 'accountLack';
			
 
				+      msg: 'Account lack';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6004;
			
 
				+      name: 'closePositionErr';
			
 
				+      msg: 'Remove liquitity, collect fees owed and reward then you can close position account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6005;
			
 
				+      name: 'zeroMintAmount';
			
 
				+      msg: 'Minting amount should be greater than 0';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6006;
			
 
				+      name: 'invaildTickIndex';
			
 
				+      msg: 'Tick out of range';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6007;
			
 
				+      name: 'tickInvaildOrder';
			
 
				+      msg: 'The lower tick must be below the upper tick';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6008;
			
 
				+      name: 'tickLowerOverflow';
			
 
				+      msg: 'The tick must be greater, or equal to the minimum tick(-443636)';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6009;
			
 
				+      name: 'tickUpperOverflow';
			
 
				+      msg: 'The tick must be lesser than, or equal to the maximum tick(443636)';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6010;
			
 
				+      name: 'tickAndSpacingNotMatch';
			
 
				+      msg: 'tick % tick_spacing must be zero';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6011;
			
 
				+      name: 'invalidTickArray';
			
 
				+      msg: 'Invaild tick array account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6012;
			
 
				+      name: 'invalidTickArrayBoundary';
			
 
				+      msg: 'Invaild tick array boundary';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6013;
			
 
				+      name: 'sqrtPriceLimitOverflow';
			
 
				+      msg: 'Square root price limit overflow';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6014;
			
 
				+      name: 'sqrtPriceX64';
			
 
				+      msg: 'sqrt_price_x64 out of range';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6015;
			
 
				+      name: 'liquiditySubValueErr';
			
 
				+      msg: 'Liquidity sub delta L must be smaller than before';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6016;
			
 
				+      name: 'liquidityAddValueErr';
			
 
				+      msg: 'Liquidity add delta L must be greater, or equal to before';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6017;
			
 
				+      name: 'invaildLiquidity';
			
 
				+      msg: 'Invaild liquidity when update position';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6018;
			
 
				+      name: 'forbidBothZeroForSupplyLiquidity';
			
 
				+      msg: 'Both token amount must not be zero while supply liquidity';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6019;
			
 
				+      name: 'liquidityInsufficient';
			
 
				+      msg: 'Liquidity insufficient';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6020;
			
 
				+      name: 'transactionTooOld';
			
 
				+      msg: 'Transaction too old';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6021;
			
 
				+      name: 'priceSlippageCheck';
			
 
				+      msg: 'Price slippage check';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6022;
			
 
				+      name: 'tooLittleOutputReceived';
			
 
				+      msg: 'Too little output received';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6023;
			
 
				+      name: 'tooMuchInputPaid';
			
 
				+      msg: 'Too much input paid';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6024;
			
 
				+      name: 'zeroAmountSpecified';
			
 
				+      msg: 'Swap special amount can not be zero';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6025;
			
 
				+      name: 'invalidInputPoolVault';
			
 
				+      msg: 'Input pool vault is invalid';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6026;
			
 
				+      name: 'tooSmallInputOrOutputAmount';
			
 
				+      msg: 'Swap input or output amount is too small';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6027;
			
 
				+      name: 'notEnoughTickArrayAccount';
			
 
				+      msg: 'Not enought tick array account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6028;
			
 
				+      name: 'invalidFirstTickArrayAccount';
			
 
				+      msg: 'Invaild first tick array account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6029;
			
 
				+      name: 'invalidRewardIndex';
			
 
				+      msg: 'Invalid reward index';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6030;
			
 
				+      name: 'fullRewardInfo';
			
 
				+      msg: 'The init reward token reach to the max';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6031;
			
 
				+      name: 'rewardTokenAlreadyInUse';
			
 
				+      msg: 'The init reward token already in use';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6032;
			
 
				+      name: 'exceptRewardMint';
			
 
				+      msg: 'The reward tokens must contain one of pool vault mint except the last reward';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6033;
			
 
				+      name: 'invalidRewardInitParam';
			
 
				+      msg: 'Invalid reward init param';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6034;
			
 
				+      name: 'invalidRewardDesiredAmount';
			
 
				+      msg: 'Invalid collect reward desired amount';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6035;
			
 
				+      name: 'invalidRewardInputAccountNumber';
			
 
				+      msg: 'Invalid collect reward input account number';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6036;
			
 
				+      name: 'invalidRewardPeriod';
			
 
				+      msg: 'Invalid reward period';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6037;
			
 
				+      name: 'notApproveUpdateRewardEmissiones';
			
 
				+      msg: 'Modification of emissiones is allowed within 72 hours from the end of the previous cycle';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6038;
			
 
				+      name: 'unInitializedRewardInfo';
			
 
				+      msg: 'uninitialized reward info';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6039;
			
 
				+      name: 'notSupportMint';
			
 
				+      msg: 'Not support token_2022 mint extension';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6040;
			
 
				+      name: 'missingTickArrayBitmapExtensionAccount';
			
 
				+      msg: 'Missing tickarray bitmap extension account';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6041;
			
 
				+      name: 'insufficientLiquidityForDirection';
			
 
				+      msg: 'Insufficient liquidity for this direction';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6042;
			
 
				+      name: 'maxTokenOverflow';
			
 
				+      msg: 'Max token overflow';
			
 
				+    },
			
 
				+    {
			
 
				+      code: 6043;
			
 
				+      name: 'calculateOverflow';
			
 
				+      msg: 'calculate overflow';
			
 
				+    }
			
 
				+  ];
			
 
				+  types: [
			
 
				+    {
			
 
				+      name: 'ammConfig';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'index';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'owner';
			
 
				+            docs: ['Address of the protocol owner'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeeRate';
			
 
				+            docs: ['The protocol fee'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeRate';
			
 
				+            docs: ['The trade fee, denominated in hundredths of a bip (10^-6)'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            docs: ['The tick spacing'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeeRate';
			
 
				+            docs: ['The fund fee, denominated in hundredths of a bip (10^-6)'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'paddingU32';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundOwner';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 3];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectPersonalFeeEvent';
			
 
				+      docs: ['Emitted when tokens are collected for a position'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'positionNftMint';
			
 
				+            docs: ['The ID of the token for which underlying tokens were collected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount0';
			
 
				+            docs: ['The token account that received the collected token_0 tokens'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount1';
			
 
				+            docs: ['The token account that received the collected token_1 tokens'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The amount of token_0 owed to the position that was collected'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The amount of token_1 owed to the position that was collected'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'collectProtocolFeeEvent';
			
 
				+      docs: ['Emitted when the collected protocol fees are withdrawn by the factory owner'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool whose protocol fee is collected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount0';
			
 
				+            docs: ['The address that receives the collected token_0 protocol fees'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recipientTokenAccount1';
			
 
				+            docs: ['The address that receives the collected token_1 protocol fees'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The amount of token_0 protocol fees that is withdrawn'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The amount of token_0 protocol fees that is withdrawn'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'configChangeEvent';
			
 
				+      docs: ['Emitted when create or update a config'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'index';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'owner';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeeRate';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeRate';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeeRate';
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundOwner';
			
 
				+            type: 'pubkey';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'createPersonalPositionEvent';
			
 
				+      docs: ['Emitted when create a new position'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool for which liquidity was added'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'minter';
			
 
				+            docs: ['The address that create the position'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'nftOwner';
			
 
				+            docs: ['The owner of the position and recipient of any minted liquidity'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLowerIndex';
			
 
				+            docs: ['The lower tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpperIndex';
			
 
				+            docs: ['The upper tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount of liquidity minted to the position range'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount0';
			
 
				+            docs: ['The amount of token_0 was deposit for the liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount1';
			
 
				+            docs: ['The amount of token_1 was deposit for the liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount0TransferFee';
			
 
				+            docs: ['The token transfer fee for deposit_amount_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'depositAmount1TransferFee';
			
 
				+            docs: ['The token transfer fee for deposit_amount_1'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'decreaseLiquidityEvent';
			
 
				+      docs: ['Emitted when liquidity is decreased.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'positionNftMint';
			
 
				+            docs: ['The ID of the token for which liquidity was decreased'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount by which liquidity for the position was decreased'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'decreaseAmount0';
			
 
				+            docs: ['The amount of token_0 that was paid for the decrease in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'decreaseAmount1';
			
 
				+            docs: ['The amount of token_1 that was paid for the decrease in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeAmount0';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeAmount1';
			
 
				+            docs: ['The amount of token_1 fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardAmounts';
			
 
				+            docs: ['The amount of rewards'];
			
 
				+            type: {
			
 
				+              array: ['u64', 3];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee0';
			
 
				+            docs: ['The amount of token_0 transfer fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee1';
			
 
				+            docs: ['The amount of token_1 transfer fee'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'increaseLiquidityEvent';
			
 
				+      docs: ['Emitted when liquidity is increased.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'positionNftMint';
			
 
				+            docs: ['The ID of the token for which liquidity was increased'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount by which liquidity for the NFT position was increased'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The amount of token_0 that was paid for the increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The amount of token_1 that was paid for the increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0TransferFee';
			
 
				+            docs: ['The token transfer fee for amount_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1TransferFee';
			
 
				+            docs: ['The token transfer fee for amount_1'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'initializeRewardParam';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'openTime';
			
 
				+            docs: ['Reward open time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'endTime';
			
 
				+            docs: ['Reward end time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emissionsPerSecondX64';
			
 
				+            docs: ['Token reward per second are earned per unit of liquidity'];
			
 
				+            type: 'u128';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityCalculateEvent';
			
 
				+      docs: ['Emitted when liquidity decreased or increase.'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolLiquidity';
			
 
				+            docs: ['The pool liquidity before decrease or increase'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolSqrtPriceX64';
			
 
				+            docs: ['The pool price when decrease or increase in liquidity'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolTick';
			
 
				+            docs: ['The pool tick when decrease or increase in liquidity'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'calcAmount0';
			
 
				+            docs: ['The amount of token_0 that was calculated for the decrease or increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'calcAmount1';
			
 
				+            docs: ['The amount of token_1 that was calculated for the decrease or increase in liquidity'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeOwed0';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tradeFeeOwed1';
			
 
				+            docs: ['The amount of token_1 fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee0';
			
 
				+            docs: ['The amount of token_0 transfer fee without trade_fee_amount_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee1';
			
 
				+            docs: ['The amount of token_1 transfer fee without trade_fee_amount_0'];
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'liquidityChangeEvent';
			
 
				+      docs: ['Emitted pool liquidity change when increase and decrease liquidity'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool for swap'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            docs: ['The tick of the pool'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLower';
			
 
				+            docs: ['The tick lower of position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpper';
			
 
				+            docs: ['The tick lower of position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityBefore';
			
 
				+            docs: ['The liquidity of the pool before liquidity change'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityAfter';
			
 
				+            docs: ['The liquidity of the pool after liquidity change'];
			
 
				+            type: 'u128';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'observation';
			
 
				+      docs: ['The element of observations in ObservationState'];
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'blockTimestamp';
			
 
				+            docs: ['The block timestamp of the observation'];
			
 
				+            type: 'u32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickCumulative';
			
 
				+            docs: ['the cumulative of tick during the duration time'];
			
 
				+            type: 'i64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            docs: ['padding for feature update'];
			
 
				+            type: {
			
 
				+              array: ['u64', 4];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'observationState';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'initialized';
			
 
				+            docs: ['Whether the ObservationState is initialized'];
			
 
				+            type: 'bool';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            docs: ['recent update epoch'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'observationIndex';
			
 
				+            docs: ['the most-recently updated index of the observations array'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['belongs to which pool'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'observations';
			
 
				+            docs: ['observation array'];
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'observation';
			
 
				+                  };
			
 
				+                },
			
 
				+                100
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            docs: ['padding for feature update'];
			
 
				+            type: {
			
 
				+              array: ['u64', 4];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'operationState';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'operationOwners';
			
 
				+            docs: ['Address of the operation owner'];
			
 
				+            type: {
			
 
				+              array: ['pubkey', 10];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'whitelistMints';
			
 
				+            docs: ['The mint address of whitelist to emit reward'];
			
 
				+            type: {
			
 
				+              array: ['pubkey', 100];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'personalPositionState';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: {
			
 
				+              array: ['u8', 1];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'nftMint';
			
 
				+            docs: ['Mint address of the tokenized position'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['The ID of the pool with which this token is connected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLowerIndex';
			
 
				+            docs: ['The lower bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpperIndex';
			
 
				+            docs: ['The upper bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount of liquidity owned by this position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside0LastX64';
			
 
				+            docs: ['The token_0 fee growth of the aggregate position as of the last action on the individual position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside1LastX64';
			
 
				+            docs: ['The token_1 fee growth of the aggregate position as of the last action on the individual position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed0';
			
 
				+            docs: ['The fees owed to the position owner in token_0, as of the last computation'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed1';
			
 
				+            docs: ['The fees owed to the position owner in token_1, as of the last computation'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardInfos';
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'positionRewardInfo';
			
 
				+                  };
			
 
				+                },
			
 
				+                3
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 7];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolCreatedEvent';
			
 
				+      docs: ['Emitted when a pool is created and initialized with a starting price', ''];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'tokenMint0';
			
 
				+            docs: ['The first token of the pool by address sort order'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint1';
			
 
				+            docs: ['The second token of the pool by address sort order'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            docs: ['The minimum number of ticks between initialized ticks'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The address of the created pool'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sqrtPriceX64';
			
 
				+            docs: ['The initial sqrt price of the pool, as a Q64.64'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            docs: ['The initial tick of the pool, i.e. log base 1.0001 of the starting price of the pool'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault0';
			
 
				+            docs: ['Vault of token_0'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault1';
			
 
				+            docs: ['Vault of token_1'];
			
 
				+            type: 'pubkey';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'poolState';
			
 
				+      docs: ['The pool state', '', 'PDA of `[POOL_SEED, config, token_mint_0, token_mint_1]`', ''];
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: {
			
 
				+              array: ['u8', 1];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'ammConfig';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'owner';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint0';
			
 
				+            docs: ['Token pair of the pool, where token_mint_0 address < token_mint_1 address'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint1';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault0';
			
 
				+            docs: ['Token pair vault'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault1';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'observationKey';
			
 
				+            docs: ['observation account key'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'mintDecimals0';
			
 
				+            docs: ['mint0 and mint1 decimals'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'mintDecimals1';
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickSpacing';
			
 
				+            docs: ['The minimum number of ticks between initialized ticks'];
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The currently in range liquidity available to the pool.'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sqrtPriceX64';
			
 
				+            docs: ['The current price of the pool as a sqrt(token_1/token_0) Q64.64 value'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickCurrent';
			
 
				+            docs: ['The current tick of the pool, i.e. according to the last tick transition that was run.'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding3';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding4';
			
 
				+            type: 'u16';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthGlobal0X64';
			
 
				+            docs: [
			
 
				+              'The fee growth as a Q64.64 number, i.e. fees of token_0 and token_1 collected per',
			
 
				+              'unit of liquidity for the entire life of the pool.'
			
 
				+            ];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthGlobal1X64';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeesToken0';
			
 
				+            docs: ['The amounts of token_0 and token_1 that are owed to the protocol.'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'protocolFeesToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapInAmountToken0';
			
 
				+            docs: ['The amounts in and out of swap token_0 and token_1'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapOutAmountToken1';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapInAmountToken1';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'swapOutAmountToken0';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'status';
			
 
				+            docs: [
			
 
				+              'Bitwise representation of the state of the pool',
			
 
				+              'bit0, 1: disable open position and increase liquidity, 0: normal',
			
 
				+              'bit1, 1: disable decrease liquidity, 0: normal',
			
 
				+              'bit2, 1: disable collect fee, 0: normal',
			
 
				+              'bit3, 1: disable collect reward, 0: normal',
			
 
				+              'bit4, 1: disable swap, 0: normal'
			
 
				+            ];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            docs: ['Leave blank for future use'];
			
 
				+            type: {
			
 
				+              array: ['u8', 7];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardInfos';
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'rewardInfo';
			
 
				+                  };
			
 
				+                },
			
 
				+                3
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickArrayBitmap';
			
 
				+            docs: ['Packed initialized tick array state'];
			
 
				+            type: {
			
 
				+              array: ['u64', 16];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesToken0';
			
 
				+            docs: ['except protocol_fee and fund_fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesClaimedToken0';
			
 
				+            docs: ['except protocol_fee and fund_fee'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'totalFeesClaimedToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeesToken0';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'fundFeesToken1';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'openTime';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding1';
			
 
				+            type: {
			
 
				+              array: ['u64', 24];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding2';
			
 
				+            type: {
			
 
				+              array: ['u64', 32];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'positionRewardInfo';
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'growthInsideLastX64';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardAmountOwed';
			
 
				+            type: 'u64';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'protocolPositionState';
			
 
				+      docs: ["Info stored for each user's position"];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            docs: ['The ID of the pool with which this token is connected'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickLowerIndex';
			
 
				+            docs: ['The lower bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tickUpperIndex';
			
 
				+            docs: ['The upper bound tick of the position'];
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The amount of liquidity owned by this position'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside0LastX64';
			
 
				+            docs: ['The token_0 fee growth per unit of liquidity as of the last update to liquidity or fees owed'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthInside1LastX64';
			
 
				+            docs: ['The token_1 fee growth per unit of liquidity as of the last update to liquidity or fees owed'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed0';
			
 
				+            docs: ['The fees owed to the position owner in token_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenFeesOwed1';
			
 
				+            docs: ['The fees owed to the position owner in token_1'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardGrowthInside';
			
 
				+            docs: ['The reward growth per unit of liquidity as of the last update to liquidity'];
			
 
				+            type: {
			
 
				+              array: ['u128', 3];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 7];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'rewardInfo';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'rewardState';
			
 
				+            docs: ['Reward state'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'openTime';
			
 
				+            docs: ['Reward open time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'endTime';
			
 
				+            docs: ['Reward end time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'lastUpdateTime';
			
 
				+            docs: ['Reward last update time'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'emissionsPerSecondX64';
			
 
				+            docs: ['Q64.64 number indicates how many tokens per second are earned per unit of liquidity.'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardTotalEmissioned';
			
 
				+            docs: ['The total amount of reward emissioned'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardClaimed';
			
 
				+            docs: ['The total amount of claimed reward'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenMint';
			
 
				+            docs: ['Reward token mint.'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenVault';
			
 
				+            docs: ['Reward vault token account.'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'authority';
			
 
				+            docs: ['The owner that has permission to set reward param'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardGrowthGlobalX64';
			
 
				+            docs: [
			
 
				+              'Q64.64 number that tracks the total tokens earned per unit of liquidity since the reward',
			
 
				+              'emissions were turned on.'
			
 
				+            ];
			
 
				+            type: 'u128';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'supportMintAssociated';
			
 
				+      docs: ['Holds the current owner of the factory'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'bump';
			
 
				+            docs: ['Bump to identify PDA'];
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'mint';
			
 
				+            docs: ['Address of the supported token22 mint'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u64', 8];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'swapEvent';
			
 
				+      docs: ['Emitted by when a swap is performed for a pool'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolState';
			
 
				+            docs: ['The pool for which token_0 and token_1 were swapped'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sender';
			
 
				+            docs: ['The address that initiated the swap call, and that received the callback'];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenAccount0';
			
 
				+            docs: [
			
 
				+              'The payer token account in zero for one swaps, or the recipient token account',
			
 
				+              'in one for zero swaps'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tokenAccount1';
			
 
				+            docs: [
			
 
				+              'The payer token account in one for zero swaps, or the recipient token account',
			
 
				+              'in zero for one swaps'
			
 
				+            ];
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount0';
			
 
				+            docs: ['The real delta amount of the token_0 of the pool or user'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee0';
			
 
				+            docs: ['The transfer fee charged by the withheld_amount of the token_0'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'amount1';
			
 
				+            docs: ['The real delta of the token_1 of the pool or user'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'transferFee1';
			
 
				+            docs: ['The transfer fee charged by the withheld_amount of the token_1'];
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'zeroForOne';
			
 
				+            docs: ['if true, amount_0 is negtive and amount_1 is positive'];
			
 
				+            type: 'bool';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'sqrtPriceX64';
			
 
				+            docs: ['The sqrt(price) of the pool after the swap, as a Q64.64'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidity';
			
 
				+            docs: ['The liquidity of the pool after the swap'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            docs: ['The log base 1.0001 of price of the pool after the swap'];
			
 
				+            type: 'i32';
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayBitmapExtension';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'positiveTickArrayBitmap';
			
 
				+            docs: ['Packed initialized tick array state for start_tick_index is positive'];
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  array: ['u64', 8];
			
 
				+                },
			
 
				+                14
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'negativeTickArrayBitmap';
			
 
				+            docs: ['Packed initialized tick array state for start_tick_index is negitive'];
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  array: ['u64', 8];
			
 
				+                },
			
 
				+                14
			
 
				+              ];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickArrayState';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'poolId';
			
 
				+            type: 'pubkey';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'startTickIndex';
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'ticks';
			
 
				+            type: {
			
 
				+              array: [
			
 
				+                {
			
 
				+                  defined: {
			
 
				+                    name: 'tickState';
			
 
				+                  };
			
 
				+                },
			
 
				+                60
			
 
				+              ];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'initializedTickCount';
			
 
				+            type: 'u8';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'recentEpoch';
			
 
				+            type: 'u64';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u8', 107];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'tickState';
			
 
				+      serialization: 'bytemuckunsafe';
			
 
				+      repr: {
			
 
				+        kind: 'c';
			
 
				+        packed: true;
			
 
				+      };
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'tick';
			
 
				+            type: 'i32';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityNet';
			
 
				+            docs: [
			
 
				+              'Amount of net liquidity added (subtracted) when tick is crossed from left to right (right to left)'
			
 
				+            ];
			
 
				+            type: 'i128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'liquidityGross';
			
 
				+            docs: ['The total position liquidity that references this tick'];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthOutside0X64';
			
 
				+            docs: [
			
 
				+              'Fee growth per unit of liquidity on the _other_ side of this tick (relative to the current tick)',
			
 
				+              'only has relative meaning, not absolute — the value depends on when the tick is initialized'
			
 
				+            ];
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'feeGrowthOutside1X64';
			
 
				+            type: 'u128';
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'rewardGrowthsOutsideX64';
			
 
				+            type: {
			
 
				+              array: ['u128', 3];
			
 
				+            };
			
 
				+          },
			
 
				+          {
			
 
				+            name: 'padding';
			
 
				+            type: {
			
 
				+              array: ['u32', 13];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    },
			
 
				+    {
			
 
				+      name: 'updateRewardInfosEvent';
			
 
				+      docs: ['Emitted when Reward are updated for a pool'];
			
 
				+      type: {
			
 
				+        kind: 'struct';
			
 
				+        fields: [
			
 
				+          {
			
 
				+            name: 'rewardGrowthGlobalX64';
			
 
				+            docs: ['Reward info'];
			
 
				+            type: {
			
 
				+              array: ['u128', 3];
			
 
				+            };
			
 
				+          }
			
 
				+        ];
			
 
				+      };
			
 
				+    }
			
 
				+  ];
			
 
				+};
			
--- a/src/lib/clmm-sdk/src/instructions/utils/binaryUtils.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/binaryUtils.ts
@@ -0,0 +1,79 @@
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+// Convert 16-bit unsigned integer to byte array
			
 
				+export function u16ToBytes(num: number): Uint8Array {
			
 
				+  const arr = new ArrayBuffer(2);
			
 
				+  const view = new DataView(arr);
			
 
				+  view.setUint16(0, num, false);
			
 
				+  return new Uint8Array(arr);
			
 
				+}
			
 
				+
			
 
				+// Convert 16-bit integer to byte array
			
 
				+export function i16ToBytes(num: number): Uint8Array {
			
 
				+  const arr = new ArrayBuffer(2);
			
 
				+  const view = new DataView(arr);
			
 
				+  view.setInt16(0, num, false);
			
 
				+  return new Uint8Array(arr);
			
 
				+}
			
 
				+
			
 
				+// Convert 32-bit unsigned integer to byte array
			
 
				+export function u32ToBytes(num: number): Uint8Array {
			
 
				+  const arr = new ArrayBuffer(4);
			
 
				+  const view = new DataView(arr);
			
 
				+  view.setUint32(0, num, false);
			
 
				+  return new Uint8Array(arr);
			
 
				+}
			
 
				+
			
 
				+// Convert 32-bit integer to byte array
			
 
				+export function i32ToBytes(num: number): Uint8Array {
			
 
				+  const arr = new ArrayBuffer(4);
			
 
				+  const view = new DataView(arr);
			
 
				+  view.setInt32(0, num, false);
			
 
				+  return new Uint8Array(arr);
			
 
				+}
			
 
				+
			
 
				+// Find the position of the highest bit '1' in the bitmap
			
 
				+export function leadingZeros(bitNum: number, data: BN): number {
			
 
				+  let i = 0;
			
 
				+  for (let j = bitNum - 1; j >= 0; j--) {
			
 
				+    if (!data.testn(j)) {
			
 
				+      i++;
			
 
				+    } else {
			
 
				+      break;
			
 
				+    }
			
 
				+  }
			
 
				+  return i;
			
 
				+}
			
 
				+
			
 
				+// Find the position of the lowest '0' in the bitmap
			
 
				+export function trailingZeros(bitNum: number, data: BN): number {
			
 
				+  let i = 0;
			
 
				+  for (let j = 0; j < bitNum; j++) {
			
 
				+    if (!data.testn(j)) {
			
 
				+      i++;
			
 
				+    } else {
			
 
				+      break;
			
 
				+    }
			
 
				+  }
			
 
				+  return i;
			
 
				+}
			
 
				+
			
 
				+// Check if the bitmap is empty
			
 
				+export function isZero(bitNum: number, data: BN): boolean {
			
 
				+  for (let i = 0; i < bitNum; i++) {
			
 
				+    if (data.testn(i)) return false;
			
 
				+  }
			
 
				+  return true;
			
 
				+}
			
 
				+
			
 
				+// Find the position of the highest bit '1' in the bitmap
			
 
				+export function mostSignificantBit(bitNum: number, data: BN): number | null {
			
 
				+  if (isZero(bitNum, data)) return null;
			
 
				+  else return leadingZeros(bitNum, data);
			
 
				+}
			
 
				+
			
 
				+// Find the position of the lowest bit '1' in the bitmap
			
 
				+export function leastSignificantBit(bitNum: number, data: BN): number | null {
			
 
				+  if (isZero(bitNum, data)) return null;
			
 
				+  else return trailingZeros(bitNum, data);
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/fetchWalletTokenAccounts.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/fetchWalletTokenAccounts.ts
@@ -0,0 +1,111 @@
 
				+import { TOKEN_2022_PROGRAM_ID, TOKEN_PROGRAM_ID } from '@solana/spl-token';
			
 
				+import {
			
 
				+  AccountInfo,
			
 
				+  Commitment,
			
 
				+  Connection,
			
 
				+  GetProgramAccountsResponse,
			
 
				+  PublicKey,
			
 
				+  RpcResponseAndContext,
			
 
				+} from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { SPLTokenAccountLayout } from '../layout.js';
			
 
				+import { GetStructureSchema } from '../libs/marshmallow/index.js';
			
 
				+import { getATAAddress } from '../pda.js';
			
 
				+
			
 
				+export interface ParseTokenAccount {
			
 
				+  owner: PublicKey;
			
 
				+  solAccountResp?: AccountInfo<Buffer> | null;
			
 
				+  tokenAccountResp: RpcResponseAndContext<GetProgramAccountsResponse>;
			
 
				+}
			
 
				+
			
 
				+export type ISPLTokenAccount = GetStructureSchema<typeof SPLTokenAccountLayout>;
			
 
				+
			
 
				+export interface TokenAccountRaw {
			
 
				+  programId: PublicKey;
			
 
				+  pubkey: PublicKey;
			
 
				+  accountInfo: ISPLTokenAccount;
			
 
				+}
			
 
				+
			
 
				+export interface TokenAccount {
			
 
				+  publicKey?: PublicKey;
			
 
				+  mint: PublicKey;
			
 
				+  isAssociated?: boolean;
			
 
				+  amount: BN;
			
 
				+  isNative: boolean;
			
 
				+  programId: PublicKey;
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Get all token account information in the wallet (pure function version)
			
 
				+ *
			
 
				+ * This function will simultaneously query user's SOL account, standard SPL token accounts, and Token-2022 accounts.
			
 
				+ *
			
 
				+ * @param connection - Solana connection instance
			
 
				+ * @param ownerPubKey - Public key of the wallet owner
			
 
				+ * @param commitment - Optional commitment level
			
 
				+ * @returns Promise containing token accounts and raw account information
			
 
				+ */
			
 
				+export async function fetchWalletTokenAccounts(
			
 
				+  connection: Connection,
			
 
				+  ownerPubKey: PublicKey,
			
 
				+  commitment?: Commitment
			
 
				+): Promise<{
			
 
				+  tokenAccounts: TokenAccount[];
			
 
				+  rawTokenAccountInfos: TokenAccountRaw[];
			
 
				+}> {
			
 
				+  // Request all account information in parallel
			
 
				+  const [solAccountResp, ownerTokenAccountResp, ownerToken2022AccountResp] = await Promise.all([
			
 
				+    connection.getAccountInfo(ownerPubKey, commitment),
			
 
				+    connection.getTokenAccountsByOwner(ownerPubKey, { programId: TOKEN_PROGRAM_ID }, commitment),
			
 
				+    connection.getTokenAccountsByOwner(ownerPubKey, { programId: TOKEN_2022_PROGRAM_ID }, commitment),
			
 
				+  ]);
			
 
				+
			
 
				+  // Parse and merge all token account information
			
 
				+  const { tokenAccounts, rawTokenAccountInfos } = parseTokenAccountResp({
			
 
				+    owner: ownerPubKey,
			
 
				+    solAccountResp,
			
 
				+    tokenAccountResp: {
			
 
				+      context: ownerTokenAccountResp.context,
			
 
				+      value: [...ownerTokenAccountResp.value, ...ownerToken2022AccountResp.value],
			
 
				+    },
			
 
				+  });
			
 
				+
			
 
				+  return { tokenAccounts, rawTokenAccountInfos };
			
 
				+}
			
 
				+
			
 
				+export function parseTokenAccountResp({ owner, solAccountResp, tokenAccountResp }: ParseTokenAccount): {
			
 
				+  tokenAccounts: TokenAccount[];
			
 
				+  rawTokenAccountInfos: TokenAccountRaw[];
			
 
				+} {
			
 
				+  const tokenAccounts: TokenAccount[] = [];
			
 
				+  const rawTokenAccountInfos: TokenAccountRaw[] = [];
			
 
				+
			
 
				+  for (const { pubkey, account } of tokenAccountResp.value) {
			
 
				+    const accountInfo = SPLTokenAccountLayout.decode(account.data);
			
 
				+    const { mint, amount } = accountInfo;
			
 
				+    tokenAccounts.push({
			
 
				+      publicKey: pubkey,
			
 
				+      mint,
			
 
				+      amount,
			
 
				+      isAssociated: getATAAddress(owner, mint, account.owner).publicKey.equals(pubkey),
			
 
				+      isNative: false,
			
 
				+      programId: account.owner,
			
 
				+    });
			
 
				+    rawTokenAccountInfos.push({ pubkey, accountInfo, programId: account.owner });
			
 
				+  }
			
 
				+
			
 
				+  if (solAccountResp) {
			
 
				+    tokenAccounts.push({
			
 
				+      mint: PublicKey.default,
			
 
				+      amount: new BN(String(solAccountResp.lamports)),
			
 
				+      isNative: true,
			
 
				+      programId: solAccountResp.owner,
			
 
				+    });
			
 
				+  }
			
 
				+
			
 
				+  return {
			
 
				+    tokenAccounts,
			
 
				+    rawTokenAccountInfos,
			
 
				+  };
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/getTickArrayBitmapExtension.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/getTickArrayBitmapExtension.ts
@@ -0,0 +1,29 @@
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { TickArrayBitmapExtensionLayout } from '../layout.js';
			
 
				+import { getPdaExBitmapAccount } from '../pda.js';
			
 
				+
			
 
				+import { TickArrayBitmapExtensionType } from './models';
			
 
				+
			
 
				+/**
			
 
				+ * @description Get the tick array bitmap extension
			
 
				+ *
			
 
				+ */
			
 
				+export async function getTickArrayBitmapExtension(
			
 
				+  programId: PublicKey,
			
 
				+  poolId: PublicKey,
			
 
				+  connection: Connection
			
 
				+): Promise<TickArrayBitmapExtensionType> {
			
 
				+  const exBitmapAddress = getPdaExBitmapAccount(programId, new PublicKey(poolId)).publicKey;
			
 
				+  const exBitmapInfo = await connection.getAccountInfo(exBitmapAddress);
			
 
				+  if (!exBitmapInfo) {
			
 
				+    throw new Error('exBitmapInfo not found');
			
 
				+  }
			
 
				+  const exBitmapInfoData = TickArrayBitmapExtensionLayout.decode(exBitmapInfo.data);
			
 
				+  return {
			
 
				+    poolId: new PublicKey(poolId),
			
 
				+    exBitmapAddress,
			
 
				+    positiveTickArrayBitmap: exBitmapInfoData.positiveTickArrayBitmap,
			
 
				+    negativeTickArrayBitmap: exBitmapInfoData.negativeTickArrayBitmap,
			
 
				+  };
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/getTickArrayInfo.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/getTickArrayInfo.ts
@@ -0,0 +1,106 @@
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { TickArrayLayout } from '../layout.js';
			
 
				+import { IPoolLayoutWithId } from '../models.js';
			
 
				+import { TickArrayBitmapExtensionType } from './models.js';
			
 
				+import { getPdaTickArrayAddress } from '../pda.js';
			
 
				+
			
 
				+import { TickArrayContainer } from './models';
			
 
				+import { TickUtils } from './tick.js';
			
 
				+import { TickArrayUtils } from './tickArrayUtils.js';
			
 
				+
			
 
				+/**
			
 
				+ * Get tick array cache
			
 
				+ * Now returns TickArrayContainer which supports both fixed and dynamic tick arrays
			
 
				+ */
			
 
				+export async function getTickArrayInfo({
			
 
				+  connection,
			
 
				+  poolInfo,
			
 
				+  exBitmapInfo,
			
 
				+  expectedCount = 7, // Default get 7 tick arrays
			
 
				+}: {
			
 
				+  connection: Connection;
			
 
				+  poolInfo: IPoolLayoutWithId;
			
 
				+  exBitmapInfo: TickArrayBitmapExtensionType;
			
 
				+  expectedCount?: number;
			
 
				+}): Promise<{ [key: string]: TickArrayContainer }> {
			
 
				+  poolInfo;
			
 
				+  // 1. Calculate the starting index of the tick array where the current tick is located
			
 
				+  const currentTickArrayStartIndex = TickUtils.getTickArrayStartIndexByTick(poolInfo.tickCurrent, poolInfo.tickSpacing);
			
 
				+
			
 
				+  // 2. Get the list of tick array start indices that need to be loaded
			
 
				+  const startIndexArray = TickUtils.getInitializedTickArrayInRange(
			
 
				+    poolInfo.tickArrayBitmap,
			
 
				+    exBitmapInfo,
			
 
				+    poolInfo.tickSpacing,
			
 
				+    currentTickArrayStartIndex,
			
 
				+    expectedCount
			
 
				+  );
			
 
				+
			
 
				+  // 3. Calculate PDA addresses for all tick arrays
			
 
				+  const tickArrayAddresses: PublicKey[] = [];
			
 
				+  const startIndexToAddress: { [key: number]: PublicKey } = {};
			
 
				+
			
 
				+  for (const startIndex of startIndexArray) {
			
 
				+    const { publicKey: tickArrayAddress } = getPdaTickArrayAddress(poolInfo.programId, poolInfo.poolId, startIndex);
			
 
				+    tickArrayAddresses.push(tickArrayAddress);
			
 
				+    startIndexToAddress[startIndex] = tickArrayAddress;
			
 
				+  }
			
 
				+
			
 
				+  // 4. Batch fetch on-chain account data
			
 
				+  const accountInfos = await connection.getMultipleAccountsInfo(tickArrayAddresses);
			
 
				+
			
 
				+  // 5. Decode and build cache (now supports both fixed and dynamic tick arrays)
			
 
				+  const tickArrayCache: { [key: string]: TickArrayContainer } = {};
			
 
				+
			
 
				+  for (let i = 0; i < accountInfos.length; i++) {
			
 
				+    const accountInfo = accountInfos[i];
			
 
				+    const startIndex = startIndexArray[i];
			
 
				+
			
 
				+    if (!accountInfo || !accountInfo.data) {
			
 
				+      console.warn(`Tick array at index ${startIndex} not found`);
			
 
				+      continue;
			
 
				+    }
			
 
				+
			
 
				+    try {
			
 
				+      // Identify tick array type
			
 
				+      const tickArrayType = TickArrayUtils.identifyTickArrayType(accountInfo.data);
			
 
				+
			
 
				+      if (tickArrayType === 'Fixed') {
			
 
				+        // Fixed tick array: use TickArrayLayout
			
 
				+        const decoded = TickArrayLayout.decode(accountInfo.data);
			
 
				+
			
 
				+        tickArrayCache[startIndex.toString()] = {
			
 
				+          type: 'Fixed',
			
 
				+          data: {
			
 
				+            address: tickArrayAddresses[i],
			
 
				+            poolId: decoded.poolId,
			
 
				+            startTickIndex: decoded.startTickIndex,
			
 
				+            ticks: decoded.ticks.map((tick: any) => ({
			
 
				+              tick: tick.tick,
			
 
				+              liquidityNet: new BN(tick.liquidityNet.toString()),
			
 
				+              liquidityGross: new BN(tick.liquidityGross.toString()),
			
 
				+              feeGrowthOutsideX64A: new BN(tick.feeGrowthOutsideX64A.toString()),
			
 
				+              feeGrowthOutsideX64B: new BN(tick.feeGrowthOutsideX64B.toString()),
			
 
				+              rewardGrowthsOutsideX64: tick.rewardGrowthsOutsideX64.map((r: any) => new BN(r.toString())),
			
 
				+            })),
			
 
				+            initializedTickCount: decoded.initializedTickCount,
			
 
				+          },
			
 
				+        };
			
 
				+      } else {
			
 
				+        // Dynamic tick array: use decodeDynTickArray
			
 
				+        const decoded = TickArrayUtils.decodeDynTickArray(accountInfo.data, tickArrayAddresses[i]);
			
 
				+
			
 
				+        tickArrayCache[startIndex.toString()] = {
			
 
				+          type: 'Dynamic',
			
 
				+          data: decoded,
			
 
				+        };
			
 
				+      }
			
 
				+    } catch (error) {
			
 
				+      console.error(`Failed to decode tick array at index ${startIndex}:`, error);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  return tickArrayCache;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/index.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/index.ts
@@ -0,0 +1,28 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+export function findProgramAddress(
			
 
				+  seeds: Array<Buffer | Uint8Array>,
			
 
				+  programId: PublicKey
			
 
				+): {
			
 
				+  publicKey: PublicKey;
			
 
				+  nonce: number;
			
 
				+} {
			
 
				+  const [publicKey, nonce] = PublicKey.findProgramAddressSync(seeds, programId);
			
 
				+  return { publicKey, nonce };
			
 
				+}
			
 
				+
			
 
				+export * from './binaryUtils.js';
			
 
				+export * from './liquidityMath.js';
			
 
				+export * from './mathUtils.js';
			
 
				+export * from './poolUtils.js';
			
 
				+export * from './sqrtPriceMath.js';
			
 
				+export * from './tickMath.js';
			
 
				+export * from './tick.js';
			
 
				+export * from './tickarrayBitmap.js';
			
 
				+export * from './transfer.js';
			
 
				+export * from './position.js';
			
 
				+export * from './getTickArrayInfo.js';
			
 
				+export * from './swapMath.js';
			
 
				+export * from './getTickArrayBitmapExtension.js';
			
 
				+export * from './tickArrayUtils.js';
			
 
				+export * from './models.js';
			
--- a/src/lib/clmm-sdk/src/instructions/utils/liquidityMath.test.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/liquidityMath.test.ts
@@ -0,0 +1,617 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+import { describe, test, expect } from 'vitest';
			
 
				+
			
 
				+import { LiquidityMath } from './liquidityMath.js';
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+
			
 
				+describe('LiquidityMath.getLiquidityFromTokenAmounts', () => {
			
 
				+  test('current price is below the lower limit - only consider tokenA', () => {
			
 
				+    // price: current < A < B
			
 
				+    const sqrtPriceCurrentX64 = new BN('100000');
			
 
				+    const sqrtPriceX64A = new BN('150000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+    const amountA = new BN('1000000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    // manually calculate the expected result
			
 
				+    const expectedLiquidity = LiquidityMath.getLiquidityFromTokenAmountA(sqrtPriceX64A, sqrtPriceX64B, amountA, false);
			
 
				+
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      amountA,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(liquidity.toString()).toBe(expectedLiquidity.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('current price is in the range - take the minimum of the two liquiditys', () => {
			
 
				+    // price: A < current < B
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('200000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+    const amountA = new BN('1000000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    // calculate the two liquiditys
			
 
				+    const liquidityA = LiquidityMath.getLiquidityFromTokenAmountA(sqrtPriceCurrentX64, sqrtPriceX64B, amountA, false);
			
 
				+
			
 
				+    const liquidityB = LiquidityMath.getLiquidityFromTokenAmountB(sqrtPriceX64A, sqrtPriceCurrentX64, amountB);
			
 
				+
			
 
				+    // the expected result is the minimum of the two liquiditys
			
 
				+    const expectedLiquidity = BN.min(liquidityA, liquidityB);
			
 
				+
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      amountA,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(liquidity.toString()).toBe(expectedLiquidity.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('current price is above the upper limit - only consider tokenB', () => {
			
 
				+    // price: A < B < current
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceX64B = new BN('200000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('300000');
			
 
				+    const amountA = new BN('1000000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    // manually calculate the expected result
			
 
				+    const expectedLiquidity = LiquidityMath.getLiquidityFromTokenAmountB(sqrtPriceX64A, sqrtPriceX64B, amountB);
			
 
				+
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      amountA,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(liquidity.toString()).toBe(expectedLiquidity.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('price range order adjustment - ensure A is always less than B', () => {
			
 
				+    // test the case of reversed price order: B < A
			
 
				+    const sqrtPriceCurrentX64 = new BN('200000');
			
 
				+    const sqrtPriceX64B = new BN('100000'); // deliberately reversed
			
 
				+    const sqrtPriceX64A = new BN('300000'); // deliberately reversed
			
 
				+    const amountA = new BN('1000000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    // call in the correct order
			
 
				+    const expectedLiquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      amountA,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // call in the reversed order
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64B,
			
 
				+      sqrtPriceX64A,
			
 
				+      amountA,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is the same
			
 
				+    expect(liquidity.toString()).toBe(expectedLiquidity.toString());
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('LiquidityMath.getAmountsFromLiquidity', () => {
			
 
				+  test('current price is below the lower limit - only return tokenA', () => {
			
 
				+    // price: current < A < B
			
 
				+    const sqrtPriceCurrentX64 = new BN('100000');
			
 
				+    const sqrtPriceX64A = new BN('150000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+    const liquidity = new BN('10000000');
			
 
				+    const roundUp = true;
			
 
				+
			
 
				+    // manually calculate the expected tokenA quantity
			
 
				+    const expectedAmountA = LiquidityMath.getTokenAmountAFromLiquidity(
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(amountA.toString()).toBe(expectedAmountA.toString());
			
 
				+    expect(amountB.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('current price is in the range - return two tokens', () => {
			
 
				+    // price: A < current < B
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('200000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+    const liquidity = new BN('10000000');
			
 
				+    const roundUp = true;
			
 
				+
			
 
				+    // manually calculate the expected quantity
			
 
				+    const expectedAmountA = LiquidityMath.getTokenAmountAFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    const expectedAmountB = LiquidityMath.getTokenAmountBFromLiquidity(
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(amountA.toString()).toBe(expectedAmountA.toString());
			
 
				+    expect(amountB.toString()).toBe(expectedAmountB.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('current price is above the upper limit - only return tokenB', () => {
			
 
				+    // price: A < B < current
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceX64B = new BN('200000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('300000');
			
 
				+    const liquidity = new BN('10000000');
			
 
				+    const roundUp = true;
			
 
				+
			
 
				+    // manually calculate the expected tokenB quantity
			
 
				+    const expectedAmountB = LiquidityMath.getTokenAmountBFromLiquidity(
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(amountA.toString()).toBe('0');
			
 
				+    expect(amountB.toString()).toBe(expectedAmountB.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('rounding behavior test - roundUp = true vs false', () => {
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('200000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+    const liquidity = new BN('10000000');
			
 
				+
			
 
				+    // use roundUp = true
			
 
				+    const resultRoundUp = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    // use roundUp = false
			
 
				+    const resultRoundDown = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      false
			
 
				+    );
			
 
				+
			
 
				+    expect(new BN(resultRoundUp.amountA).gte(new BN(resultRoundDown.amountA))).toBeTruthy();
			
 
				+    expect(new BN(resultRoundUp.amountB).gte(new BN(resultRoundDown.amountB))).toBeTruthy();
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('LiquidityMath.getAmountBFromAmountA', () => {
			
 
				+  test('calculate tokenB from tokenA - normal case', () => {
			
 
				+    // price: start < current < end
			
 
				+    const startSqrtPriceX64 = new BN('100000');
			
 
				+    const currentSqrtPriceX64 = new BN('200000');
			
 
				+    const endSqrtPriceX64 = new BN('300000');
			
 
				+    const amountA = new BN('1000000');
			
 
				+
			
 
				+    const amountB = LiquidityMath.getAmountBFromAmountA(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountA
			
 
				+    );
			
 
				+
			
 
				+    // verify the correctness of the calculation process
			
 
				+    // 1. calculate the liquidity
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmountA(currentSqrtPriceX64, endSqrtPriceX64, amountA, false);
			
 
				+
			
 
				+    // 2. calculate the tokenB quantity from the liquidity
			
 
				+    const expectedAmountB = LiquidityMath.getTokenAmountBFromLiquidity(
			
 
				+      startSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      liquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(amountB.toString()).toBe(expectedAmountB.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('current price is below the lower limit - return 0', () => {
			
 
				+    // price: current < start < end
			
 
				+    const startSqrtPriceX64 = new BN('200000');
			
 
				+    const currentSqrtPriceX64 = new BN('100000'); // below the lower limit
			
 
				+    const endSqrtPriceX64 = new BN('300000');
			
 
				+    const amountA = new BN('1000000');
			
 
				+
			
 
				+    const amountB = LiquidityMath.getAmountBFromAmountA(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountA
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is 0
			
 
				+    expect(amountB.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('current price is above the upper limit - return 0', () => {
			
 
				+    // price: start < end < current
			
 
				+    const startSqrtPriceX64 = new BN('100000');
			
 
				+    const endSqrtPriceX64 = new BN('200000');
			
 
				+    const currentSqrtPriceX64 = new BN('300000'); // above the upper limit
			
 
				+    const amountA = new BN('1000000');
			
 
				+
			
 
				+    const amountB = LiquidityMath.getAmountBFromAmountA(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountA
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is 0
			
 
				+    expect(amountB.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('price range order adjustment - ensure start is always less than end', () => {
			
 
				+    // test the case of reversed price order: end < start
			
 
				+    const endSqrtPriceX64 = new BN('100000'); // deliberately reversed
			
 
				+    const currentSqrtPriceX64 = new BN('150000');
			
 
				+    const startSqrtPriceX64 = new BN('200000'); // deliberately reversed
			
 
				+    const amountA = new BN('1000000');
			
 
				+
			
 
				+    // call in the correct order
			
 
				+    const expectedAmountB = LiquidityMath.getAmountBFromAmountA(
			
 
				+      endSqrtPriceX64,
			
 
				+      startSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountA
			
 
				+    );
			
 
				+
			
 
				+    // call in the reversed order
			
 
				+    const amountB = LiquidityMath.getAmountBFromAmountA(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountA
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is the same
			
 
				+    expect(amountB.toString()).toBe(expectedAmountB.toString());
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('LiquidityMath.getAmountAFromAmountB', () => {
			
 
				+  test('calculate tokenA from tokenB - normal case', () => {
			
 
				+    // price: start < current < end
			
 
				+    const startSqrtPriceX64 = new BN('100000');
			
 
				+    const currentSqrtPriceX64 = new BN('200000');
			
 
				+    const endSqrtPriceX64 = new BN('300000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    const amountA = LiquidityMath.getAmountAFromAmountB(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the correctness of the calculation process
			
 
				+    // 1. calculate the liquidity
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmountB(startSqrtPriceX64, currentSqrtPriceX64, amountB);
			
 
				+
			
 
				+    // 2. calculate the tokenA quantity from the liquidity
			
 
				+    const expectedAmountA = LiquidityMath.getTokenAmountAFromLiquidity(
			
 
				+      currentSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      liquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(amountA.toString()).toBe(expectedAmountA.toString());
			
 
				+  });
			
 
				+
			
 
				+  test('current price is below the lower limit - return 0', () => {
			
 
				+    // price: current < start < end
			
 
				+    const startSqrtPriceX64 = new BN('200000');
			
 
				+    const currentSqrtPriceX64 = new BN('100000'); // below the lower limit
			
 
				+    const endSqrtPriceX64 = new BN('300000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    const amountA = LiquidityMath.getAmountAFromAmountB(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is 0
			
 
				+    expect(amountA.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('current price is above the upper limit - return 0', () => {
			
 
				+    // price: start < end < current
			
 
				+    const startSqrtPriceX64 = new BN('100000');
			
 
				+    const endSqrtPriceX64 = new BN('200000');
			
 
				+    const currentSqrtPriceX64 = new BN('300000'); // above the upper limit
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    const amountA = LiquidityMath.getAmountAFromAmountB(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is 0
			
 
				+    expect(amountA.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('price range order adjustment - ensure start is always less than end', () => {
			
 
				+    // test the case of reversed price order: end < start
			
 
				+    const endSqrtPriceX64 = new BN('100000'); // deliberately reversed
			
 
				+    const currentSqrtPriceX64 = new BN('150000');
			
 
				+    const startSqrtPriceX64 = new BN('200000'); // deliberately reversed
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    // call in the correct order
			
 
				+    const expectedAmountA = LiquidityMath.getAmountAFromAmountB(
			
 
				+      endSqrtPriceX64,
			
 
				+      startSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // call in the reversed order
			
 
				+    const amountA = LiquidityMath.getAmountAFromAmountB(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // verify the result is the same
			
 
				+    expect(amountA.toString()).toBe(expectedAmountA.toString());
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('LiquidityMath consistency test', () => {
			
 
				+  test('liquidity calculation and token quantity calculation consistency', () => {
			
 
				+    const startPirce = '1';
			
 
				+    const currentPrice = '2';
			
 
				+    const endPrice = '3';
			
 
				+
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    // set test parameters
			
 
				+    const sqrtPriceX64A = SqrtPriceMath.priceToSqrtPriceX64(new Decimal(startPirce), decimalsA, decimalsB);
			
 
				+    const sqrtPriceCurrentX64 = SqrtPriceMath.priceToSqrtPriceX64(new Decimal(currentPrice), decimalsA, decimalsB);
			
 
				+    const sqrtPriceX64B = SqrtPriceMath.priceToSqrtPriceX64(new Decimal(endPrice), decimalsA, decimalsB);
			
 
				+    const amountA = new BN('1000000');
			
 
				+    const amountB = new BN('500000');
			
 
				+
			
 
				+    // 1. use token quantity to calculate liquidity
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmounts(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      amountA,
			
 
				+      amountB
			
 
				+    );
			
 
				+
			
 
				+    // 2. use the calculated liquidity to calculate the token quantity
			
 
				+    const { amountA: calculatedAmountA, amountB: calculatedAmountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      false // do not round up for comparison
			
 
				+    );
			
 
				+
			
 
				+    // verify: the calculated token quantity should be less than or equal to the original token quantity
			
 
				+    // (since the liquidity depends on the smaller of the two tokens provided)
			
 
				+    expect(new BN(calculatedAmountA).lte(amountA)).toBeTruthy();
			
 
				+    expect(new BN(calculatedAmountB).lte(amountB)).toBeTruthy();
			
 
				+
			
 
				+    // verify: at least one of the calculated token quantities should be close to the original token quantity
			
 
				+    const precisionThreshold = 0.0001; // allow 0.01% error
			
 
				+
			
 
				+    const amountADiff = Math.abs(1 - Number(calculatedAmountA.toString()) / Number(amountA.toString()));
			
 
				+
			
 
				+    const amountBDiff = Math.abs(1 - Number(calculatedAmountB.toString()) / Number(amountB.toString()));
			
 
				+
			
 
				+    expect(amountADiff < precisionThreshold || amountBDiff < precisionThreshold).toBeTruthy();
			
 
				+  });
			
 
				+
			
 
				+  test('consistency test between getAmountBFromAmountA and getAmountAFromAmountB', () => {
			
 
				+    const startPirce = '1';
			
 
				+    const currentPrice = '2';
			
 
				+    const endPrice = '3';
			
 
				+
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    // set test parameters
			
 
				+    const startSqrtPriceX64 = SqrtPriceMath.priceToSqrtPriceX64(new Decimal(startPirce), decimalsA, decimalsB);
			
 
				+    const currentSqrtPriceX64 = SqrtPriceMath.priceToSqrtPriceX64(new Decimal(currentPrice), decimalsA, decimalsB);
			
 
				+    const endSqrtPriceX64 = SqrtPriceMath.priceToSqrtPriceX64(new Decimal(endPrice), decimalsA, decimalsB);
			
 
				+    const initialAmountA = new BN('1000000');
			
 
				+
			
 
				+    // 1. A -> B
			
 
				+    const calculatedAmountB = LiquidityMath.getAmountBFromAmountA(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      initialAmountA
			
 
				+    );
			
 
				+
			
 
				+    // 2. B -> A
			
 
				+    const calculatedAmountA = LiquidityMath.getAmountAFromAmountB(
			
 
				+      startSqrtPriceX64,
			
 
				+      endSqrtPriceX64,
			
 
				+      currentSqrtPriceX64,
			
 
				+      calculatedAmountB
			
 
				+    );
			
 
				+
			
 
				+    // verify: the calculated A quantity should be close to the original value
			
 
				+    // due to rounding errors, it may not be exactly equal, so use relative error
			
 
				+    const relativeError =
			
 
				+      Math.abs(Number(initialAmountA.toString()) - Number(calculatedAmountA.toString())) /
			
 
				+      Number(initialAmountA.toString());
			
 
				+
			
 
				+    expect(relativeError).toBeLessThan(0.0001); // 允许 0.01% 误差
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('LiquidityMath boundary and special case test', () => {
			
 
				+  test('zero input test', () => {
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('200000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+
			
 
				+    // zero liquidity
			
 
				+    const zeroLiquidity = new BN(0);
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      zeroLiquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    expect(amountA.toString()).toBe('0');
			
 
				+    expect(amountB.toString()).toBe('0');
			
 
				+
			
 
				+    // zero token quantity
			
 
				+    const zeroAmount = new BN(0);
			
 
				+    const amountAResult = LiquidityMath.getAmountAFromAmountB(
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      zeroAmount
			
 
				+    );
			
 
				+
			
 
				+    const amountBResult = LiquidityMath.getAmountBFromAmountA(
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      zeroAmount
			
 
				+    );
			
 
				+
			
 
				+    expect(amountAResult.toString()).toBe('0');
			
 
				+    expect(amountBResult.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('extreme liquidity value test', () => {
			
 
				+    const sqrtPriceX64A = new BN('100000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('200000');
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+
			
 
				+    // extremely large liquidity value
			
 
				+    const largeLiquidity = new BN('340282366920938463463374607431768211455'); // MaxUint128 - 1
			
 
				+
			
 
				+    // this test is mainly to ensure that no exceptions or overflows are thrown
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      largeLiquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    expect(amountA.toString()).not.toBe('NaN');
			
 
				+    expect(amountB.toString()).not.toBe('NaN');
			
 
				+  });
			
 
				+
			
 
				+  test('equal price point test', () => {
			
 
				+    // test the case of sqrtPriceX64A = sqrtPriceX64B
			
 
				+    const sqrtPriceX64 = new BN('200000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('150000');
			
 
				+    const liquidity = new BN('10000000');
			
 
				+
			
 
				+    // when the price is equal
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64,
			
 
				+      sqrtPriceX64,
			
 
				+      liquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    // expected to be zero or very small
			
 
				+    expect(amountA.toString()).toBe('0');
			
 
				+    expect(amountB.toString()).toBe('0');
			
 
				+  });
			
 
				+
			
 
				+  test('price point near current price test', () => {
			
 
				+    // test the case of current ≈ A or current ≈ B
			
 
				+    const sqrtPriceX64A = new BN('200000');
			
 
				+    const sqrtPriceCurrentX64 = new BN('200001'); // very close to A
			
 
				+    const sqrtPriceX64B = new BN('300000');
			
 
				+    const liquidity = new BN('10000000');
			
 
				+
			
 
				+    // call the function
			
 
				+    const result = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      true
			
 
				+    );
			
 
				+
			
 
				+    // verify the result
			
 
				+    expect(result.amountA.toString()).not.toBe('NaN');
			
 
				+    expect(result.amountB.toString()).not.toBe('NaN');
			
 
				+  });
			
 
				+});
			
--- a/src/lib/clmm-sdk/src/instructions/utils/liquidityMath.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/liquidityMath.ts
@@ -0,0 +1,212 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { MaxU64, ONE, Q64, U64Resolution, ZERO } from '../constants.js';
			
 
				+
			
 
				+import { MathUtils } from './mathUtils.js';
			
 
				+
			
 
				+export class LiquidityMath {
			
 
				+  public static addDelta(x: BN, y: BN): BN {
			
 
				+    return x.add(y);
			
 
				+  }
			
 
				+
			
 
				+  public static getTokenAmountAFromLiquidity(
			
 
				+    sqrtPriceX64A: BN,
			
 
				+    sqrtPriceX64B: BN,
			
 
				+    liquidity: BN,
			
 
				+    roundUp: boolean
			
 
				+  ): BN {
			
 
				+    if (sqrtPriceX64A.gt(sqrtPriceX64B)) {
			
 
				+      [sqrtPriceX64A, sqrtPriceX64B] = [sqrtPriceX64B, sqrtPriceX64A];
			
 
				+    }
			
 
				+
			
 
				+    if (!sqrtPriceX64A.gt(ZERO)) {
			
 
				+      throw new Error('sqrtPriceX64A must greater than 0');
			
 
				+    }
			
 
				+
			
 
				+    const numerator1 = liquidity.ushln(U64Resolution);
			
 
				+    const numerator2 = sqrtPriceX64B.sub(sqrtPriceX64A);
			
 
				+
			
 
				+    return roundUp
			
 
				+      ? MathUtils.mulDivRoundingUp(MathUtils.mulDivCeil(numerator1, numerator2, sqrtPriceX64B), ONE, sqrtPriceX64A)
			
 
				+      : MathUtils.mulDivFloor(numerator1, numerator2, sqrtPriceX64B).div(sqrtPriceX64A);
			
 
				+  }
			
 
				+
			
 
				+  public static getTokenAmountBFromLiquidity(
			
 
				+    sqrtPriceX64A: BN,
			
 
				+    sqrtPriceX64B: BN,
			
 
				+    liquidity: BN,
			
 
				+    roundUp: boolean
			
 
				+  ): BN {
			
 
				+    if (sqrtPriceX64A.gt(sqrtPriceX64B)) {
			
 
				+      [sqrtPriceX64A, sqrtPriceX64B] = [sqrtPriceX64B, sqrtPriceX64A];
			
 
				+    }
			
 
				+    if (!sqrtPriceX64A.gt(ZERO)) {
			
 
				+      throw new Error('sqrtPriceX64A must greater than 0');
			
 
				+    }
			
 
				+
			
 
				+    return roundUp
			
 
				+      ? MathUtils.mulDivCeil(liquidity, sqrtPriceX64B.sub(sqrtPriceX64A), Q64)
			
 
				+      : MathUtils.mulDivFloor(liquidity, sqrtPriceX64B.sub(sqrtPriceX64A), Q64);
			
 
				+  }
			
 
				+
			
 
				+  public static getLiquidityFromTokenAmountA(sqrtPriceX64A: BN, sqrtPriceX64B: BN, amountA: BN, roundUp: boolean): BN {
			
 
				+    if (sqrtPriceX64A.gt(sqrtPriceX64B)) {
			
 
				+      [sqrtPriceX64A, sqrtPriceX64B] = [sqrtPriceX64B, sqrtPriceX64A];
			
 
				+    }
			
 
				+
			
 
				+    const numerator = amountA.mul(sqrtPriceX64A).mul(sqrtPriceX64B);
			
 
				+    const denominator = sqrtPriceX64B.sub(sqrtPriceX64A);
			
 
				+    const result = numerator.div(denominator);
			
 
				+
			
 
				+    if (roundUp) {
			
 
				+      return MathUtils.mulDivRoundingUp(result, ONE, MaxU64);
			
 
				+    } else {
			
 
				+      return result.shrn(U64Resolution);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  public static getLiquidityFromTokenAmountB(sqrtPriceX64A: BN, sqrtPriceX64B: BN, amountB: BN): BN {
			
 
				+    if (sqrtPriceX64A.gt(sqrtPriceX64B)) {
			
 
				+      [sqrtPriceX64A, sqrtPriceX64B] = [sqrtPriceX64B, sqrtPriceX64A];
			
 
				+    }
			
 
				+    return MathUtils.mulDivFloor(amountB, MaxU64, sqrtPriceX64B.sub(sqrtPriceX64A));
			
 
				+  }
			
 
				+
			
 
				+  public static getLiquidityFromTokenAmounts(
			
 
				+    sqrtPriceCurrentX64: BN,
			
 
				+    sqrtPriceX64A: BN,
			
 
				+    sqrtPriceX64B: BN,
			
 
				+    amountA: BN,
			
 
				+    amountB: BN
			
 
				+  ): BN {
			
 
				+    if (sqrtPriceX64A.gt(sqrtPriceX64B)) {
			
 
				+      [sqrtPriceX64A, sqrtPriceX64B] = [sqrtPriceX64B, sqrtPriceX64A];
			
 
				+    }
			
 
				+
			
 
				+    if (sqrtPriceCurrentX64.lte(sqrtPriceX64A)) {
			
 
				+      return LiquidityMath.getLiquidityFromTokenAmountA(sqrtPriceX64A, sqrtPriceX64B, amountA, false);
			
 
				+    } else if (sqrtPriceCurrentX64.lt(sqrtPriceX64B)) {
			
 
				+      const liquidity0 = LiquidityMath.getLiquidityFromTokenAmountA(sqrtPriceCurrentX64, sqrtPriceX64B, amountA, false);
			
 
				+      const liquidity1 = LiquidityMath.getLiquidityFromTokenAmountB(sqrtPriceX64A, sqrtPriceCurrentX64, amountB);
			
 
				+      return liquidity0.lt(liquidity1) ? liquidity0 : liquidity1;
			
 
				+    } else {
			
 
				+      return LiquidityMath.getLiquidityFromTokenAmountB(sqrtPriceX64A, sqrtPriceX64B, amountB);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  public static getAmountsFromLiquidity(
			
 
				+    sqrtPriceCurrentX64: BN,
			
 
				+    sqrtPriceX64A: BN,
			
 
				+    sqrtPriceX64B: BN,
			
 
				+    liquidity: BN,
			
 
				+    roundUp: boolean
			
 
				+  ): { amountA: BN; amountB: BN } {
			
 
				+    if (sqrtPriceX64A.gt(sqrtPriceX64B)) {
			
 
				+      [sqrtPriceX64A, sqrtPriceX64B] = [sqrtPriceX64B, sqrtPriceX64A];
			
 
				+    }
			
 
				+
			
 
				+    if (sqrtPriceCurrentX64.lte(sqrtPriceX64A)) {
			
 
				+      return {
			
 
				+        amountA: LiquidityMath.getTokenAmountAFromLiquidity(sqrtPriceX64A, sqrtPriceX64B, liquidity, roundUp),
			
 
				+        amountB: new BN(0),
			
 
				+      };
			
 
				+    } else if (sqrtPriceCurrentX64.lt(sqrtPriceX64B)) {
			
 
				+      const amountA = LiquidityMath.getTokenAmountAFromLiquidity(
			
 
				+        sqrtPriceCurrentX64,
			
 
				+        sqrtPriceX64B,
			
 
				+        liquidity,
			
 
				+        roundUp
			
 
				+      );
			
 
				+      const amountB = LiquidityMath.getTokenAmountBFromLiquidity(
			
 
				+        sqrtPriceX64A,
			
 
				+        sqrtPriceCurrentX64,
			
 
				+        liquidity,
			
 
				+        roundUp
			
 
				+      );
			
 
				+      return { amountA, amountB };
			
 
				+    } else {
			
 
				+      return {
			
 
				+        amountA: new BN(0),
			
 
				+        amountB: LiquidityMath.getTokenAmountBFromLiquidity(sqrtPriceX64A, sqrtPriceX64B, liquidity, roundUp),
			
 
				+      };
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  public static getAmountsFromLiquidityWithSlippage(
			
 
				+    sqrtPriceCurrentX64: BN,
			
 
				+    sqrtPriceX64A: BN,
			
 
				+    sqrtPriceX64B: BN,
			
 
				+    liquidity: BN,
			
 
				+    amountMax: boolean,
			
 
				+    roundUp: boolean,
			
 
				+    amountSlippage: number
			
 
				+  ): { amountSlippageA: BN; amountSlippageB: BN } {
			
 
				+    const { amountA, amountB } = LiquidityMath.getAmountsFromLiquidity(
			
 
				+      sqrtPriceCurrentX64,
			
 
				+      sqrtPriceX64A,
			
 
				+      sqrtPriceX64B,
			
 
				+      liquidity,
			
 
				+      roundUp
			
 
				+    );
			
 
				+    const coefficient = amountMax ? 1 + amountSlippage : 1 - amountSlippage;
			
 
				+
			
 
				+    const amount0Slippage = new BN(new Decimal(amountA.toString()).mul(coefficient).toFixed(0));
			
 
				+    const amount1Slippage = new BN(new Decimal(amountB.toString()).mul(coefficient).toFixed(0));
			
 
				+    return {
			
 
				+      amountSlippageA: amount0Slippage,
			
 
				+      amountSlippageB: amount1Slippage,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Given a price range, calculate the required tokenB amount after investing a specified tokenA amount
			
 
				+   *
			
 
				+   * Similar implementation in raydium: getLiquidityAmountOutFromAmountIn
			
 
				+   */
			
 
				+  public static getAmountBFromAmountA(
			
 
				+    startSqrtPriceX64: BN,
			
 
				+    endSqrtPriceX64: BN,
			
 
				+    currentSqrtPriceX64: BN,
			
 
				+    amountA: BN
			
 
				+  ): BN {
			
 
				+    if (startSqrtPriceX64.gt(endSqrtPriceX64)) {
			
 
				+      [startSqrtPriceX64, endSqrtPriceX64] = [endSqrtPriceX64, startSqrtPriceX64];
			
 
				+    }
			
 
				+
			
 
				+    if (currentSqrtPriceX64.lte(startSqrtPriceX64)) {
			
 
				+      return new BN(0);
			
 
				+    }
			
 
				+
			
 
				+    if (currentSqrtPriceX64.gt(endSqrtPriceX64)) {
			
 
				+      return new BN(0);
			
 
				+    }
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmountA(currentSqrtPriceX64, endSqrtPriceX64, amountA, false);
			
 
				+    return LiquidityMath.getTokenAmountBFromLiquidity(startSqrtPriceX64, currentSqrtPriceX64, liquidity, true);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Given a price range, calculate the required tokenA amount after investing a specified tokenB amount
			
 
				+   *
			
 
				+   * Similar implementation in raydium: getLiquidityAmountOutFromAmountIn
			
 
				+   */
			
 
				+  public static getAmountAFromAmountB(
			
 
				+    startSqrtPriceX64: BN,
			
 
				+    endSqrtPriceX64: BN,
			
 
				+    currentSqrtPriceX64: BN,
			
 
				+    amountB: BN
			
 
				+  ): BN {
			
 
				+    if (startSqrtPriceX64.gt(endSqrtPriceX64)) {
			
 
				+      [startSqrtPriceX64, endSqrtPriceX64] = [endSqrtPriceX64, startSqrtPriceX64];
			
 
				+    }
			
 
				+
			
 
				+    if (currentSqrtPriceX64.lte(startSqrtPriceX64)) {
			
 
				+      return new BN(0);
			
 
				+    }
			
 
				+    if (currentSqrtPriceX64.gt(endSqrtPriceX64)) {
			
 
				+      return new BN(0);
			
 
				+    }
			
 
				+    const liquidity = LiquidityMath.getLiquidityFromTokenAmountB(startSqrtPriceX64, currentSqrtPriceX64, amountB);
			
 
				+    return LiquidityMath.getTokenAmountAFromLiquidity(currentSqrtPriceX64, endSqrtPriceX64, liquidity, true);
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/mathUtils.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/mathUtils.ts
@@ -0,0 +1,42 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { ONE, Q128, ZERO } from '../constants.js';
			
 
				+
			
 
				+export class MathUtils {
			
 
				+  public static mulDivRoundingUp(a: BN, b: BN, denominator: BN): BN {
			
 
				+    const numerator = a.mul(b);
			
 
				+    let result = numerator.div(denominator);
			
 
				+    if (!numerator.mod(denominator).eq(ZERO)) {
			
 
				+      result = result.add(ONE);
			
 
				+    }
			
 
				+    return result;
			
 
				+  }
			
 
				+
			
 
				+  public static mulDivFloor(a: BN, b: BN, denominator: BN): BN {
			
 
				+    if (denominator.eq(ZERO)) {
			
 
				+      throw new Error('division by 0');
			
 
				+    }
			
 
				+    return a.mul(b).div(denominator);
			
 
				+  }
			
 
				+
			
 
				+  public static mulDivCeil(a: BN, b: BN, denominator: BN): BN {
			
 
				+    if (denominator.eq(ZERO)) {
			
 
				+      throw new Error('division by 0');
			
 
				+    }
			
 
				+    const numerator = a.mul(b).add(denominator.sub(ONE));
			
 
				+    return numerator.div(denominator);
			
 
				+  }
			
 
				+
			
 
				+  public static x64ToDecimal(num: BN, decimalPlaces?: number): Decimal {
			
 
				+    return new Decimal(num.toString()).div(Decimal.pow(2, 64)).toDecimalPlaces(decimalPlaces);
			
 
				+  }
			
 
				+
			
 
				+  public static decimalToX64(num: Decimal): BN {
			
 
				+    return new BN(num.mul(Decimal.pow(2, 64)).floor().toFixed());
			
 
				+  }
			
 
				+
			
 
				+  public static wrappingSubU128(n0: BN, n1: BN): BN {
			
 
				+    return n0.add(Q128).sub(n1).mod(Q128);
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/models.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/models.ts
@@ -0,0 +1,97 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+export interface ReturnTypeGetPriceAndTick {
			
 
				+  tick: number;
			
 
				+  price: Decimal;
			
 
				+}
			
 
				+
			
 
				+export type Tick = {
			
 
				+  tick: number;
			
 
				+  liquidityNet: BN;
			
 
				+  liquidityGross: BN;
			
 
				+  feeGrowthOutsideX64A: BN;
			
 
				+  feeGrowthOutsideX64B: BN;
			
 
				+  rewardGrowthsOutsideX64: BN[];
			
 
				+};
			
 
				+
			
 
				+export type TickArray = {
			
 
				+  address: PublicKey;
			
 
				+  poolId: PublicKey;
			
 
				+  startTickIndex: number;
			
 
				+  ticks: Tick[];
			
 
				+  initializedTickCount: number;
			
 
				+};
			
 
				+
			
 
				+/**
			
 
				+ * Dynamic Tick Array type
			
 
				+ * Uses sparse storage with a mapping table to track allocated tick positions
			
 
				+ */
			
 
				+export type DynTickArray = {
			
 
				+  address: PublicKey;
			
 
				+  poolId: PublicKey;
			
 
				+  startTickIndex: number;
			
 
				+  tickOffsetIndex: number[]; // Mapping table: tickOffsetIndex[offset] = position + 1 (0 = unallocated)
			
 
				+  allocTickCount: number; // Number of allocated ticks
			
 
				+  initializedTickCount: number; // Number of initialized ticks
			
 
				+  ticks: Tick[]; // Dynamic array of tick states (length = allocTickCount)
			
 
				+};
			
 
				+
			
 
				+/**
			
 
				+ * Unified Tick Array Container
			
 
				+ * Discriminated union to handle both fixed and dynamic tick arrays
			
 
				+ */
			
 
				+export type TickArrayContainer = { type: 'Fixed'; data: TickArray } | { type: 'Dynamic'; data: DynTickArray };
			
 
				+
			
 
				+/**
			
 
				+ * Type guard to check if a container is a fixed tick array
			
 
				+ */
			
 
				+export function isFixedTickArray(container: TickArrayContainer): container is { type: 'Fixed'; data: TickArray } {
			
 
				+  return container.type === 'Fixed';
			
 
				+}
			
 
				+
			
 
				+/**
			
 
				+ * Type guard to check if a container is a dynamic tick array
			
 
				+ */
			
 
				+export function isDynamicTickArray(
			
 
				+  container: TickArrayContainer
			
 
				+): container is { type: 'Dynamic'; data: DynTickArray } {
			
 
				+  return container.type === 'Dynamic';
			
 
				+}
			
 
				+
			
 
				+export type TickState = {
			
 
				+  tick: number;
			
 
				+  liquidityNet: BN;
			
 
				+  liquidityGross: BN;
			
 
				+  feeGrowthOutsideX64A: BN;
			
 
				+  feeGrowthOutsideX64B: BN;
			
 
				+  tickCumulativeOutside: BN;
			
 
				+  secondsPerLiquidityOutsideX64: BN;
			
 
				+  secondsOutside: number;
			
 
				+  rewardGrowthsOutside: BN[];
			
 
				+};
			
 
				+
			
 
				+export type TickArrayState = {
			
 
				+  ammPool: PublicKey;
			
 
				+  startTickIndex: number;
			
 
				+  ticks: TickState[];
			
 
				+  initializedTickCount: number;
			
 
				+};
			
 
				+
			
 
				+export interface TickArrayBitmapExtensionType {
			
 
				+  poolId: PublicKey;
			
 
				+  exBitmapAddress: PublicKey;
			
 
				+  positiveTickArrayBitmap: BN[][];
			
 
				+  negativeTickArrayBitmap: BN[][];
			
 
				+}
			
 
				+
			
 
				+export interface StepComputations {
			
 
				+  sqrtPriceStartX64: BN;
			
 
				+  tickNext: number;
			
 
				+  initialized: boolean;
			
 
				+  sqrtPriceNextX64: BN;
			
 
				+  amountIn: BN;
			
 
				+  amountOut: BN;
			
 
				+  feeAmount: BN;
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/poolStateUtils.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/poolStateUtils.ts
@@ -0,0 +1,164 @@
 
				+import { Connection, PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { RawDataUtils } from '../getRawData.js';
			
 
				+import { IPoolLayout } from '../layout.js';
			
 
				+
			
 
				+/**
			
 
				+ * Pool State Utilities for querying pool information with decay fee support
			
 
				+ */
			
 
				+export class PoolStateUtils {
			
 
				+  /**
			
 
				+   * Check if the pool has decay fee enabled
			
 
				+   * @param poolInfo Pool layout information
			
 
				+   * @returns boolean indicating if decay fee is enabled
			
 
				+   */
			
 
				+  static isDecayFeeEnabled(poolInfo: IPoolLayout): boolean {
			
 
				+    return (poolInfo.decayFeeFlag & (1 << 0)) !== 0;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Check if decay fee is enabled for selling mint0
			
 
				+   * @param poolInfo Pool layout information
			
 
				+   * @returns boolean indicating if decay fee is enabled for mint0 sell
			
 
				+   */
			
 
				+  static isDecayFeeOnSellMint0(poolInfo: IPoolLayout): boolean {
			
 
				+    return (poolInfo.decayFeeFlag & (1 << 1)) !== 0;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Check if decay fee is enabled for selling mint1
			
 
				+   * @param poolInfo Pool layout information
			
 
				+   * @returns boolean indicating if decay fee is enabled for mint1 sell
			
 
				+   */
			
 
				+  static isDecayFeeOnSellMint1(poolInfo: IPoolLayout): boolean {
			
 
				+    return (poolInfo.decayFeeFlag & (1 << 2)) !== 0;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Calculate the current decay fee rate based on the current time
			
 
				+   * @param poolInfo Pool layout information
			
 
				+   * @param currentTimestamp Current timestamp in seconds
			
 
				+   * @returns Decay fee rate in hundredths of a bip (10^-6)
			
 
				+   */
			
 
				+  static getDecayFeeRate(poolInfo: IPoolLayout, currentTimestamp: number): number {
			
 
				+    if (!this.isDecayFeeEnabled(poolInfo)) {
			
 
				+      return 0;
			
 
				+    }
			
 
				+
			
 
				+    // Pool is not open yet
			
 
				+    if (currentTimestamp < poolInfo.openTime.toNumber()) {
			
 
				+      return 0;
			
 
				+    }
			
 
				+
			
 
				+    const intervalCount = Math.floor(
			
 
				+      (currentTimestamp - poolInfo.openTime.toNumber()) / poolInfo.decayFeeDecreaseInterval
			
 
				+    );
			
 
				+
			
 
				+    const decayFeeDecreaseRate = poolInfo.decayFeeDecreaseRate * 10000; // Convert to basis points
			
 
				+    const FEE_RATE_DENOMINATOR_VALUE = 1000000; // 10^6
			
 
				+    const hundredthsOfABip = FEE_RATE_DENOMINATOR_VALUE;
			
 
				+    let rate = hundredthsOfABip;
			
 
				+
			
 
				+    // Fast power calculation: (1 - x)^c
			
 
				+    // where x = decayFeeDecreaseRate / 10^6, c = intervalCount
			
 
				+    if (intervalCount > 0) {
			
 
				+      let exp = intervalCount;
			
 
				+      let base = hundredthsOfABip - decayFeeDecreaseRate;
			
 
				+
			
 
				+      while (exp > 0) {
			
 
				+        if (exp % 2 === 1) {
			
 
				+          rate = Math.ceil((rate * base) / hundredthsOfABip);
			
 
				+        }
			
 
				+        base = Math.ceil((base * base) / hundredthsOfABip);
			
 
				+        exp = Math.floor(exp / 2);
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    // Apply initial fee rate (convert from percentage)
			
 
				+    rate = Math.ceil((rate * poolInfo.decayFeeInitFeeRate) / 100);
			
 
				+
			
 
				+    return rate;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get comprehensive decay fee information for a pool
			
 
				+   * @param poolInfo Pool layout information
			
 
				+   * @param currentTimestamp Current timestamp in seconds
			
 
				+   * @returns Object containing all decay fee related information
			
 
				+   */
			
 
				+  static getDecayFeeInfo(poolInfo: IPoolLayout, currentTimestamp?: number) {
			
 
				+    const timestamp = currentTimestamp || Math.floor(Date.now() / 1000);
			
 
				+
			
 
				+    return {
			
 
				+      isEnabled: this.isDecayFeeEnabled(poolInfo),
			
 
				+      onSellMint0: this.isDecayFeeOnSellMint0(poolInfo),
			
 
				+      onSellMint1: this.isDecayFeeOnSellMint1(poolInfo),
			
 
				+      initFeeRate: poolInfo.decayFeeInitFeeRate, // Percentage (1 = 1%)
			
 
				+      decreaseRate: poolInfo.decayFeeDecreaseRate, // Percentage (1 = 1%)
			
 
				+      decreaseInterval: poolInfo.decayFeeDecreaseInterval, // Seconds
			
 
				+      currentFeeRate: this.getDecayFeeRate(poolInfo, timestamp), // In hundredths of a bip (10^-6)
			
 
				+      openTime: poolInfo.openTime.toNumber(),
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get pool state with decay fee information from chain
			
 
				+   * @param connection Solana connection
			
 
				+   * @param poolId Pool address
			
 
				+   * @param currentTimestamp Optional current timestamp
			
 
				+   * @returns Pool information with decay fee details
			
 
				+   */
			
 
				+  static async getPoolStateWithDecayFee(connection: Connection, poolId: string | PublicKey, currentTimestamp?: number) {
			
 
				+    const poolInfo = await RawDataUtils.getRawPoolInfoByPoolId({
			
 
				+      connection,
			
 
				+      poolId,
			
 
				+    });
			
 
				+
			
 
				+    if (!poolInfo) {
			
 
				+      throw new Error(`Pool not found: ${poolId}`);
			
 
				+    }
			
 
				+
			
 
				+    const decayFeeInfo = this.getDecayFeeInfo(poolInfo, currentTimestamp);
			
 
				+
			
 
				+    return {
			
 
				+      ...poolInfo,
			
 
				+      decayFeeInfo,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Check if decay fee is currently active for a specific direction
			
 
				+   * @param poolInfo Pool layout information
			
 
				+   * @param zeroForOne True if swapping token0 for token1 (selling token0)
			
 
				+   * @param currentTimestamp Current timestamp in seconds
			
 
				+   * @returns Object with active status and current fee rate
			
 
				+   */
			
 
				+  static getDecayFeeForDirection(poolInfo: IPoolLayout, zeroForOne: boolean, currentTimestamp?: number) {
			
 
				+    const timestamp = currentTimestamp || Math.floor(Date.now() / 1000);
			
 
				+
			
 
				+    if (!this.isDecayFeeEnabled(poolInfo)) {
			
 
				+      return {
			
 
				+        isActive: false,
			
 
				+        feeRate: 0,
			
 
				+      };
			
 
				+    }
			
 
				+
			
 
				+    const isActiveForDirection = zeroForOne
			
 
				+      ? this.isDecayFeeOnSellMint0(poolInfo)
			
 
				+      : this.isDecayFeeOnSellMint1(poolInfo);
			
 
				+
			
 
				+    if (!isActiveForDirection) {
			
 
				+      return {
			
 
				+        isActive: false,
			
 
				+        feeRate: 0,
			
 
				+      };
			
 
				+    }
			
 
				+
			
 
				+    const currentFeeRate = this.getDecayFeeRate(poolInfo, timestamp);
			
 
				+
			
 
				+    return {
			
 
				+      isActive: true,
			
 
				+      feeRate: currentFeeRate,
			
 
				+    };
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/poolUtils.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/poolUtils.ts
@@ -0,0 +1,412 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { MAX_TICK, MIN_TICK, NEGATIVE_ONE } from '../constants.js';
			
 
				+import { IAmmConfigLayout } from '../layout.js';
			
 
				+import { IPoolLayoutWithId } from '../models.js';
			
 
				+import { getPdaTickArrayAddress } from '../pda.js';
			
 
				+
			
 
				+import { TickArrayContainer, TickArrayBitmapExtensionType } from './models.js';
			
 
				+import { SwapMath } from './swapMath.js';
			
 
				+import { TickQuery, TickUtils } from './tick.js';
			
 
				+import { TickArrayBitmap, TickArrayBitmapExtensionUtils } from './tickarrayBitmap.js';
			
 
				+
			
 
				+export class PoolUtils {
			
 
				+  // Used to check if a set of tickarray start indices exceed the boundary range of the default bitmap
			
 
				+  public static isOverflowDefaultTickarrayBitmap(tickSpacing: number, tickarrayStartIndexs: number[]): boolean {
			
 
				+    const { maxTickBoundary, minTickBoundary } = this._tickRange(tickSpacing);
			
 
				+
			
 
				+    for (const tickIndex of tickarrayStartIndexs) {
			
 
				+      const tickarrayStartIndex = TickUtils.getTickArrayStartIndexByTick(tickIndex, tickSpacing);
			
 
				+
			
 
				+      if (tickarrayStartIndex >= maxTickBoundary || tickarrayStartIndex < minTickBoundary) {
			
 
				+        return true;
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    return false;
			
 
				+  }
			
 
				+
			
 
				+  public static _tickRange(tickSpacing: number): {
			
 
				+    maxTickBoundary: number;
			
 
				+    minTickBoundary: number;
			
 
				+  } {
			
 
				+    let maxTickBoundary = TickArrayBitmap.maxTickInTickarrayBitmap(tickSpacing);
			
 
				+    let minTickBoundary = -maxTickBoundary;
			
 
				+
			
 
				+    if (maxTickBoundary > MAX_TICK) {
			
 
				+      maxTickBoundary = TickQuery.getArrayStartIndex(MAX_TICK, tickSpacing) + TickQuery.tickCount(tickSpacing);
			
 
				+    }
			
 
				+    if (minTickBoundary < MIN_TICK) {
			
 
				+      minTickBoundary = TickQuery.getArrayStartIndex(MIN_TICK, tickSpacing);
			
 
				+    }
			
 
				+    return { maxTickBoundary, minTickBoundary };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Calculate the maximum and minimum ticks selectable by users in the UI
			
 
				+   * Unlike _tickRange, this method directly returns the available tick value range, not the tickarray boundaries
			
 
				+   *
			
 
				+   * @param tickSpacing tick spacing
			
 
				+   * @returns Maximum and minimum tick values selectable by users
			
 
				+   */
			
 
				+  public static tickRange(tickSpacing: number): {
			
 
				+    maxTickBoundary: number;
			
 
				+    minTickBoundary: number;
			
 
				+  } {
			
 
				+    // Use protocol-defined hard boundaries
			
 
				+    let maxTickBoundary = MAX_TICK;
			
 
				+    let minTickBoundary = MIN_TICK;
			
 
				+
			
 
				+    // Ensure returned tick values are divisible by tickSpacing to meet UI selection requirements
			
 
				+    maxTickBoundary = Math.floor(maxTickBoundary / tickSpacing) * tickSpacing;
			
 
				+    minTickBoundary = Math.ceil(minTickBoundary / tickSpacing) * tickSpacing;
			
 
				+
			
 
				+    return { maxTickBoundary, minTickBoundary };
			
 
				+  }
			
 
				+
			
 
				+  public static nextInitializedTickArrayStartIndex(
			
 
				+    poolInfo: {
			
 
				+      tickCurrent: number;
			
 
				+      tickSpacing: number;
			
 
				+      tickArrayBitmap: BN[];
			
 
				+      exBitmapInfo: TickArrayBitmapExtensionType;
			
 
				+    },
			
 
				+    lastTickArrayStartIndex: number,
			
 
				+    zeroForOne: boolean
			
 
				+  ): { isExist: boolean; nextStartIndex: number } {
			
 
				+    // Start scanning from the provided lastTickArrayStartIndex instead of recomputing from tickCurrent
			
 
				+    // This avoids skipping the immediate adjacent array when tickCurrent happens to equal a start index.
			
 
				+
			
 
				+    while (true) {
			
 
				+      const { isInit: startIsInit, tickIndex: startIndex } = TickArrayBitmap.nextInitializedTickArrayStartIndex(
			
 
				+        TickUtils.mergeTickArrayBitmap(poolInfo.tickArrayBitmap),
			
 
				+        lastTickArrayStartIndex,
			
 
				+        poolInfo.tickSpacing,
			
 
				+        zeroForOne
			
 
				+      );
			
 
				+      if (startIsInit) {
			
 
				+        return { isExist: true, nextStartIndex: startIndex };
			
 
				+      }
			
 
				+      lastTickArrayStartIndex = startIndex;
			
 
				+
			
 
				+      const { isInit, tickIndex } = TickArrayBitmapExtensionUtils.nextInitializedTickArrayFromOneBitmap(
			
 
				+        lastTickArrayStartIndex,
			
 
				+        poolInfo.tickSpacing,
			
 
				+        zeroForOne,
			
 
				+        poolInfo.exBitmapInfo
			
 
				+      );
			
 
				+      if (isInit) return { isExist: true, nextStartIndex: tickIndex };
			
 
				+
			
 
				+      lastTickArrayStartIndex = tickIndex;
			
 
				+
			
 
				+      if (lastTickArrayStartIndex < MIN_TICK || lastTickArrayStartIndex > MAX_TICK)
			
 
				+        return { isExist: false, nextStartIndex: 0 };
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  public static getFirstInitializedTickArray(
			
 
				+    poolInfo: {
			
 
				+      programId: PublicKey;
			
 
				+      poolId: PublicKey;
			
 
				+      tickCurrent: number;
			
 
				+      tickSpacing: number;
			
 
				+      tickArrayBitmap: BN[];
			
 
				+      exBitmapInfo: TickArrayBitmapExtensionType;
			
 
				+    },
			
 
				+    zeroForOne: boolean
			
 
				+  ):
			
 
				+    | { isExist: true; startIndex: number; nextAccountMeta: PublicKey }
			
 
				+    | { isExist: false; startIndex: undefined; nextAccountMeta: undefined } {
			
 
				+    const { isInitialized, startIndex } = PoolUtils.isOverflowDefaultTickarrayBitmap(poolInfo.tickSpacing, [
			
 
				+      poolInfo.tickCurrent,
			
 
				+    ])
			
 
				+      ? TickArrayBitmapExtensionUtils.checkTickArrayIsInit(
			
 
				+          TickQuery.getArrayStartIndex(poolInfo.tickCurrent, poolInfo.tickSpacing),
			
 
				+          poolInfo.tickSpacing,
			
 
				+          poolInfo.exBitmapInfo
			
 
				+        )
			
 
				+      : TickUtils.checkTickArrayIsInitialized(
			
 
				+          TickUtils.mergeTickArrayBitmap(poolInfo.tickArrayBitmap),
			
 
				+          poolInfo.tickCurrent,
			
 
				+          poolInfo.tickSpacing
			
 
				+        );
			
 
				+
			
 
				+    if (isInitialized) {
			
 
				+      const { publicKey: address } = getPdaTickArrayAddress(poolInfo.programId, poolInfo.poolId, startIndex);
			
 
				+      return {
			
 
				+        isExist: true,
			
 
				+        startIndex,
			
 
				+        nextAccountMeta: address,
			
 
				+      };
			
 
				+    }
			
 
				+    const { isExist, nextStartIndex } = this.nextInitializedTickArrayStartIndex(
			
 
				+      poolInfo,
			
 
				+      TickQuery.getArrayStartIndex(poolInfo.tickCurrent, poolInfo.tickSpacing),
			
 
				+      zeroForOne
			
 
				+    );
			
 
				+    if (isExist) {
			
 
				+      const { publicKey: address } = getPdaTickArrayAddress(poolInfo.programId, poolInfo.poolId, nextStartIndex);
			
 
				+      return {
			
 
				+        isExist: true,
			
 
				+        startIndex: nextStartIndex,
			
 
				+        nextAccountMeta: address,
			
 
				+      };
			
 
				+    }
			
 
				+    return { isExist: false, nextAccountMeta: undefined, startIndex: undefined };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Calculate the output amount and required account list for token swap
			
 
				+   *
			
 
				+   * This function is the core of CLMM (Concentrated Liquidity Market Maker) swap logic, used to calculate the expected output amount for a given input amount,
			
 
				+   * and determine all tick array accounts that need to be accessed during trade execution.
			
 
				+   *
			
 
				+   * @param params Swap calculation parameter object
			
 
				+   * @param params.poolInfo - Complete information of the liquidity pool, including current price, liquidity, tick and other states
			
 
				+   * @param params.exBitmapInfo - Tick array bitmap extension information, used to handle ticks beyond the default range
			
 
				+   * @param params.ammConfig - AMM configuration information, including transaction fee rates and other parameters
			
 
				+   * @param params.tickArrayInfo - Loaded tick array information cache, with keys as tick array start indices
			
 
				+   * @param params.inputTokenMint - Input token mint address, used to determine trade direction
			
 
				+   * @param params.inputAmount - Input token amount (using minimum units)
			
 
				+   * @param params.sqrtPriceLimitX64 - Optional price limit, representing the worst price for the trade (Q64.64 format)
			
 
				+   * @param params.catchLiquidityInsufficient - Whether to catch liquidity insufficient situations, default false
			
 
				+   *
			
 
				+   * @returns Swap calculation result object
			
 
				+   * @returns allTrade - Boolean value indicating whether the specified input amount can be fully traded
			
 
				+   *                    true: All amount can be traded
			
 
				+   *                    false: Only partial trading due to insufficient liquidity or price limit
			
 
				+   * @returns expectedAmountOut - Expected output token amount to be obtained (using minimum units)
			
 
				+   * @returns remainingAccounts - List of all tick array account addresses that need to be accessed during trading
			
 
				+   *                             These accounts need to be passed as remaining accounts in the trade instruction
			
 
				+   * @returns executionPrice - Final price after trade execution (square root price in Q64.64 format)
			
 
				+   * @returns feeAmount - Total fees generated by the trade (using input token minimum units)
			
 
				+   *
			
 
				+   * @throws Error Throws 'Invalid tick array' error when no valid tick array is found
			
 
				+   */
			
 
				+  public static getOutputAmountAndRemainAccounts(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    exBitmapInfo: TickArrayBitmapExtensionType;
			
 
				+    ammConfig: IAmmConfigLayout;
			
 
				+    tickArrayInfo: { [key: string]: TickArrayContainer };
			
 
				+    inputTokenMint: PublicKey;
			
 
				+    inputAmount: BN;
			
 
				+    sqrtPriceLimitX64?: BN;
			
 
				+    catchLiquidityInsufficient?: boolean;
			
 
				+  }): {
			
 
				+    allTrade: boolean;
			
 
				+    expectedAmountOut: BN;
			
 
				+    remainingAccounts: PublicKey[];
			
 
				+    executionPrice: BN;
			
 
				+    feeAmount: BN;
			
 
				+  } {
			
 
				+    const {
			
 
				+      poolInfo,
			
 
				+      exBitmapInfo,
			
 
				+      ammConfig,
			
 
				+      tickArrayInfo,
			
 
				+      inputTokenMint,
			
 
				+      inputAmount,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      catchLiquidityInsufficient = false,
			
 
				+    } = params;
			
 
				+
			
 
				+    // Step 1: Determine trade direction
			
 
				+    // zeroForOne = true: means trading tokenA (token0) for tokenB (token1), price decreases
			
 
				+    // zeroForOne = false: means trading tokenB (token1) for tokenA (token0), price increases
			
 
				+    const zeroForOne = inputTokenMint.toBase58() === poolInfo.mintA.toBase58();
			
 
				+
			
 
				+    // Step 2: Initialize account list to store all tick array accounts needed during trading
			
 
				+    const allNeededAccounts: PublicKey[] = [];
			
 
				+
			
 
				+    // Step 3: Find the first tick array that needs to be accessed
			
 
				+    // Based on current tick position and trade direction, find the array containing current tick or next initialized tick
			
 
				+    const {
			
 
				+      isExist,
			
 
				+      startIndex: firstTickArrayStartIndex,
			
 
				+      nextAccountMeta,
			
 
				+    } = this.getFirstInitializedTickArray(
			
 
				+      {
			
 
				+        programId: poolInfo.programId,
			
 
				+        poolId: poolInfo.poolId,
			
 
				+        tickCurrent: poolInfo.tickCurrent,
			
 
				+        tickSpacing: poolInfo.tickSpacing,
			
 
				+        tickArrayBitmap: poolInfo.tickArrayBitmap,
			
 
				+        exBitmapInfo,
			
 
				+      },
			
 
				+      zeroForOne
			
 
				+    );
			
 
				+
			
 
				+    // If no valid tick array is found, it indicates abnormal pool state or no liquidity
			
 
				+    if (!isExist || firstTickArrayStartIndex === undefined || !nextAccountMeta) throw new Error('Invalid tick array');
			
 
				+
			
 
				+    // Step 4: Add the first tick array account to the list
			
 
				+    allNeededAccounts.push(nextAccountMeta);
			
 
				+
			
 
				+    // Step 5: Execute the core logic of swap calculation
			
 
				+    // SwapMath.swapCompute simulates the entire swap process, calculating:
			
 
				+    // - Actual tradable amount
			
 
				+    // - Output token amount
			
 
				+    // - Other tick array accounts needed on the trade path
			
 
				+    // - Final execution price and fees
			
 
				+    const {
			
 
				+      allTrade,
			
 
				+      amountCalculated: outputAmount,
			
 
				+      accounts: reaminAccounts,
			
 
				+      sqrtPriceX64: executionPrice,
			
 
				+      feeAmount,
			
 
				+    } = SwapMath.swapCompute(
			
 
				+      poolInfo.programId,
			
 
				+      poolInfo.poolId,
			
 
				+      tickArrayInfo,
			
 
				+      poolInfo.tickArrayBitmap,
			
 
				+      exBitmapInfo,
			
 
				+      zeroForOne,
			
 
				+      ammConfig.tradeFeeRate,
			
 
				+      poolInfo.liquidity,
			
 
				+      poolInfo.tickCurrent,
			
 
				+      poolInfo.tickSpacing,
			
 
				+      poolInfo.sqrtPriceX64,
			
 
				+      inputAmount,
			
 
				+      firstTickArrayStartIndex,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      catchLiquidityInsufficient
			
 
				+    );
			
 
				+
			
 
				+    // Step 6: Add other necessary accounts discovered during swap to the list
			
 
				+    allNeededAccounts.push(...reaminAccounts);
			
 
				+
			
 
				+    // Step 7: Return calculation results
			
 
				+    // Note: outputAmount is negative (indicating outflow), needs to be multiplied by -1 to convert to positive
			
 
				+    return {
			
 
				+      allTrade,
			
 
				+      expectedAmountOut: outputAmount.mul(NEGATIVE_ONE),
			
 
				+      remainingAccounts: allNeededAccounts,
			
 
				+      executionPrice,
			
 
				+      feeAmount,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Calculate the required input token amount and account list for exact output
			
 
				+   *
			
 
				+   * This function is used for "exact output" scenarios, where the user specifies the desired output token amount,
			
 
				+   * and the function calculates how many tokens need to be input to obtain the specified output amount.
			
 
				+   *
			
 
				+   * @param params Swap calculation parameter object
			
 
				+   * @param params.poolInfo - Complete information of the liquidity pool
			
 
				+   * @param params.exBitmapInfo - Tick array bitmap extension information
			
 
				+   * @param params.ammConfig - AMM configuration information
			
 
				+   * @param params.tickArrayInfo - Loaded tick array information cache
			
 
				+   * @param params.outputTokenMint - Output token mint address
			
 
				+   * @param params.outputAmount - Expected output token amount (using minimum units)
			
 
				+   * @param params.sqrtPriceLimitX64 - Optional price limit (Q64.64 format)
			
 
				+   * @param params.catchLiquidityInsufficient - Whether to catch liquidity insufficient situations
			
 
				+   *
			
 
				+   * @returns Swap calculation result object
			
 
				+   * @returns allTrade - Whether the specified output amount can be fully obtained
			
 
				+   * @returns expectedAmountIn - Required input token amount (including fees)
			
 
				+   * @returns remainingAccounts - List of tick array accounts that need to be accessed during trading
			
 
				+   * @returns executionPrice - Final price after trade execution
			
 
				+   * @returns feeAmount - Total fees generated by the trade
			
 
				+   */
			
 
				+  public static getInputAmountAndRemainAccounts(params: {
			
 
				+    poolInfo: IPoolLayoutWithId;
			
 
				+    exBitmapInfo: TickArrayBitmapExtensionType;
			
 
				+    ammConfig: IAmmConfigLayout;
			
 
				+    tickArrayInfo: { [key: string]: TickArrayContainer };
			
 
				+    outputTokenMint: PublicKey;
			
 
				+    outputAmount: BN;
			
 
				+    sqrtPriceLimitX64?: BN;
			
 
				+    catchLiquidityInsufficient?: boolean;
			
 
				+  }): {
			
 
				+    allTrade: boolean;
			
 
				+    expectedAmountIn: BN;
			
 
				+    remainingAccounts: PublicKey[];
			
 
				+    executionPrice: BN;
			
 
				+    feeAmount: BN;
			
 
				+  } {
			
 
				+    const {
			
 
				+      poolInfo,
			
 
				+      exBitmapInfo,
			
 
				+      ammConfig,
			
 
				+      tickArrayInfo,
			
 
				+      outputTokenMint,
			
 
				+      outputAmount,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      catchLiquidityInsufficient = false,
			
 
				+    } = params;
			
 
				+
			
 
				+    // 步骤1: 确定交易方向
			
 
				+    // 注意：对于精确输出，交易方向的判断基于输出代币
			
 
				+    // 如果输出 tokenB，则需要输入 tokenA（zeroForOne = true）
			
 
				+    // 如果输出 tokenA，则需要输入 tokenB（zeroForOne = false）
			
 
				+    const zeroForOne = outputTokenMint.toBase58() === poolInfo.mintB.toBase58();
			
 
				+
			
 
				+    // 步骤2: 初始化账户列表
			
 
				+    const allNeededAccounts: PublicKey[] = [];
			
 
				+
			
 
				+    // 步骤3: 查找第一个需要访问的 tick 数组
			
 
				+    const {
			
 
				+      isExist,
			
 
				+      startIndex: firstTickArrayStartIndex,
			
 
				+      nextAccountMeta,
			
 
				+    } = this.getFirstInitializedTickArray(
			
 
				+      {
			
 
				+        programId: poolInfo.programId,
			
 
				+        poolId: poolInfo.poolId,
			
 
				+        tickCurrent: poolInfo.tickCurrent,
			
 
				+        tickSpacing: poolInfo.tickSpacing,
			
 
				+        tickArrayBitmap: poolInfo.tickArrayBitmap,
			
 
				+        exBitmapInfo,
			
 
				+      },
			
 
				+      zeroForOne
			
 
				+    );
			
 
				+
			
 
				+    if (!isExist || firstTickArrayStartIndex === undefined || !nextAccountMeta) throw new Error('Invalid tick array');
			
 
				+
			
 
				+    // Step 4: Add the first tick array account to the list
			
 
				+    allNeededAccounts.push(nextAccountMeta);
			
 
				+
			
 
				+    // 步骤5: 执行交换计算
			
 
				+    // 对于精确输出，amountSpecified 需要是负数
			
 
				+    const amountSpecified = outputAmount.mul(NEGATIVE_ONE);
			
 
				+
			
 
				+    const {
			
 
				+      allTrade,
			
 
				+      amountCalculated: inputAmount,
			
 
				+      accounts: reaminAccounts,
			
 
				+      sqrtPriceX64: executionPrice,
			
 
				+      feeAmount,
			
 
				+    } = SwapMath.swapCompute(
			
 
				+      poolInfo.programId,
			
 
				+      poolInfo.poolId,
			
 
				+      tickArrayInfo,
			
 
				+      poolInfo.tickArrayBitmap,
			
 
				+      exBitmapInfo,
			
 
				+      zeroForOne,
			
 
				+      ammConfig.tradeFeeRate,
			
 
				+      poolInfo.liquidity,
			
 
				+      poolInfo.tickCurrent,
			
 
				+      poolInfo.tickSpacing,
			
 
				+      poolInfo.sqrtPriceX64,
			
 
				+      amountSpecified,
			
 
				+      firstTickArrayStartIndex,
			
 
				+      sqrtPriceLimitX64,
			
 
				+      catchLiquidityInsufficient
			
 
				+    );
			
 
				+
			
 
				+    // 步骤6: 将其他必需账户添加到列表中
			
 
				+    allNeededAccounts.push(...reaminAccounts);
			
 
				+
			
 
				+    // 步骤7: 返回计算结果
			
 
				+    // 注意：对于精确输出，inputAmount 包含了手续费
			
 
				+    return {
			
 
				+      allTrade,
			
 
				+      expectedAmountIn: inputAmount,
			
 
				+      remainingAccounts: allNeededAccounts,
			
 
				+      executionPrice,
			
 
				+      feeAmount,
			
 
				+    };
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/position.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/position.ts
@@ -0,0 +1,160 @@
 
				+import { EpochInfo } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { Q64 } from '../constants.js';
			
 
				+import { IPersonalPositionLayout, IPoolLayout } from '../layout.js';
			
 
				+
			
 
				+import { LiquidityMath } from './liquidityMath.js';
			
 
				+import { MathUtils } from './mathUtils.js';
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+import { getTransferAmountFee, minExpirationTime } from './transfer.js';
			
 
				+import { Tick } from './models.js';
			
 
				+
			
 
				+export interface GetTransferAmountFee {
			
 
				+  amount: BN;
			
 
				+  fee: BN | undefined;
			
 
				+  expirationTime: number | undefined;
			
 
				+}
			
 
				+
			
 
				+export interface ReturnTypeGetLiquidityAmountOut {
			
 
				+  liquidity: BN;
			
 
				+  amountSlippageA: GetTransferAmountFee;
			
 
				+  amountSlippageB: GetTransferAmountFee;
			
 
				+  amountA: GetTransferAmountFee;
			
 
				+  amountB: GetTransferAmountFee;
			
 
				+  expirationTime: number | undefined;
			
 
				+}
			
 
				+
			
 
				+export class PositionUtils {
			
 
				+  static getfeeGrowthInside(
			
 
				+    poolInfo: Pick<IPoolLayout, 'tickCurrent' | 'feeGrowthGlobalX64A' | 'feeGrowthGlobalX64B'>,
			
 
				+    tickLowerState: Tick,
			
 
				+    tickUpperState: Tick
			
 
				+  ): { feeGrowthInsideX64A: BN; feeGrowthInsideBX64: BN } {
			
 
				+    let feeGrowthBelowX64A = new BN(0);
			
 
				+    let feeGrowthBelowX64B = new BN(0);
			
 
				+    if (poolInfo.tickCurrent >= tickLowerState.tick) {
			
 
				+      feeGrowthBelowX64A = tickLowerState.feeGrowthOutsideX64A;
			
 
				+      feeGrowthBelowX64B = tickLowerState.feeGrowthOutsideX64B;
			
 
				+    } else {
			
 
				+      feeGrowthBelowX64A = poolInfo.feeGrowthGlobalX64A.sub(tickLowerState.feeGrowthOutsideX64A);
			
 
				+      feeGrowthBelowX64B = poolInfo.feeGrowthGlobalX64B.sub(tickLowerState.feeGrowthOutsideX64B);
			
 
				+    }
			
 
				+
			
 
				+    let feeGrowthAboveX64A = new BN(0);
			
 
				+    let feeGrowthAboveX64B = new BN(0);
			
 
				+    if (poolInfo.tickCurrent < tickUpperState.tick) {
			
 
				+      feeGrowthAboveX64A = tickUpperState.feeGrowthOutsideX64A;
			
 
				+      feeGrowthAboveX64B = tickUpperState.feeGrowthOutsideX64B;
			
 
				+    } else {
			
 
				+      feeGrowthAboveX64A = poolInfo.feeGrowthGlobalX64A.sub(tickUpperState.feeGrowthOutsideX64A);
			
 
				+      feeGrowthAboveX64B = poolInfo.feeGrowthGlobalX64B.sub(tickUpperState.feeGrowthOutsideX64B);
			
 
				+    }
			
 
				+
			
 
				+    const feeGrowthInsideX64A = MathUtils.wrappingSubU128(
			
 
				+      MathUtils.wrappingSubU128(poolInfo.feeGrowthGlobalX64A, feeGrowthBelowX64A),
			
 
				+      feeGrowthAboveX64A
			
 
				+    );
			
 
				+    const feeGrowthInsideBX64 = MathUtils.wrappingSubU128(
			
 
				+      MathUtils.wrappingSubU128(poolInfo.feeGrowthGlobalX64B, feeGrowthBelowX64B),
			
 
				+      feeGrowthAboveX64B
			
 
				+    );
			
 
				+    return { feeGrowthInsideX64A, feeGrowthInsideBX64 };
			
 
				+  }
			
 
				+
			
 
				+  static getPositionFees(
			
 
				+    poolInfo: Pick<IPoolLayout, 'tickCurrent' | 'feeGrowthGlobalX64A' | 'feeGrowthGlobalX64B'>,
			
 
				+    positionState: IPersonalPositionLayout,
			
 
				+    tickLowerState: Tick,
			
 
				+    tickUpperState: Tick
			
 
				+  ): { tokenFeeAmountA: BN; tokenFeeAmountB: BN } {
			
 
				+    const { feeGrowthInsideX64A, feeGrowthInsideBX64 } = this.getfeeGrowthInside(
			
 
				+      poolInfo,
			
 
				+      tickLowerState,
			
 
				+      tickUpperState
			
 
				+    );
			
 
				+
			
 
				+    const feeGrowthdeltaA = MathUtils.mulDivFloor(
			
 
				+      MathUtils.wrappingSubU128(feeGrowthInsideX64A, positionState.feeGrowthInsideLastX64A),
			
 
				+      positionState.liquidity,
			
 
				+      Q64
			
 
				+    );
			
 
				+    const tokenFeeAmountA = positionState.tokenFeesOwedA.add(feeGrowthdeltaA);
			
 
				+
			
 
				+    const feeGrowthdelta1 = MathUtils.mulDivFloor(
			
 
				+      MathUtils.wrappingSubU128(feeGrowthInsideBX64, positionState.feeGrowthInsideLastX64B),
			
 
				+      positionState.liquidity,
			
 
				+      Q64
			
 
				+    );
			
 
				+    const tokenFeeAmountB = positionState.tokenFeesOwedB.add(feeGrowthdelta1);
			
 
				+
			
 
				+    return { tokenFeeAmountA, tokenFeeAmountB };
			
 
				+  }
			
 
				+
			
 
				+  static getAmountsFromLiquidity(params: {
			
 
				+    poolInfo: IPoolLayout;
			
 
				+    ownerPosition: IPersonalPositionLayout;
			
 
				+    liquidity: BN;
			
 
				+    slippage: number;
			
 
				+    add: boolean;
			
 
				+    epochInfo: EpochInfo;
			
 
				+  }): ReturnTypeGetLiquidityAmountOut {
			
 
				+    const { poolInfo, ownerPosition, liquidity, slippage, add, epochInfo } = params;
			
 
				+    const sqrtPriceX64 = poolInfo.sqrtPriceX64;
			
 
				+    const sqrtPriceX64A = SqrtPriceMath.getSqrtPriceX64FromTick(ownerPosition.tickLower);
			
 
				+    const sqrtPriceX64B = SqrtPriceMath.getSqrtPriceX64FromTick(ownerPosition.tickUpper);
			
 
				+
			
 
				+    const coefficientRe = add ? 1 + slippage : 1 - slippage;
			
 
				+
			
 
				+    const amounts = LiquidityMath.getAmountsFromLiquidity(sqrtPriceX64, sqrtPriceX64A, sqrtPriceX64B, liquidity, add);
			
 
				+
			
 
				+    // TODO: Temporarily not considering Token 2022 transfer fee scenarios. If needed in the future, this should be added here;
			
 
				+    const [amountA, amountB] = [
			
 
				+      getTransferAmountFee(amounts.amountA, undefined, epochInfo, true),
			
 
				+      getTransferAmountFee(amounts.amountB, undefined, epochInfo, true),
			
 
				+    ];
			
 
				+    const [amountSlippageA, amountSlippageB] = [
			
 
				+      getTransferAmountFee(
			
 
				+        new BN(new Decimal(amounts.amountA.toString()).mul(coefficientRe).toFixed(0)),
			
 
				+        undefined,
			
 
				+        epochInfo,
			
 
				+        true
			
 
				+      ),
			
 
				+      getTransferAmountFee(
			
 
				+        new BN(new Decimal(amounts.amountB.toString()).mul(coefficientRe).toFixed(0)),
			
 
				+        undefined,
			
 
				+        epochInfo,
			
 
				+        true
			
 
				+      ),
			
 
				+    ];
			
 
				+
			
 
				+    // const [amountA, amountB] = [
			
 
				+    //   getTransferAmountFee(amounts.amountA, poolInfo.mintA.extensions?.feeConfig, epochInfo, true),
			
 
				+    //   getTransferAmountFee(amounts.amountB, poolInfo.mintB.extensions?.feeConfig, epochInfo, true),
			
 
				+    // ];
			
 
				+    // const [amountSlippageA, amountSlippageB] = [
			
 
				+    //   getTransferAmountFee(
			
 
				+    //     new BN(new Decimal(amounts.amountA.toString()).mul(coefficientRe).toFixed(0)),
			
 
				+    //     poolInfo.mintA.extensions?.feeConfig,
			
 
				+    //     epochInfo,
			
 
				+    //     true,
			
 
				+    //   ),
			
 
				+    //   getTransferAmountFee(
			
 
				+    //     new BN(new Decimal(amounts.amountB.toString()).mul(coefficientRe).toFixed(0)),
			
 
				+    //     poolInfo.mintB.extensions?.feeConfig,
			
 
				+    //     epochInfo,
			
 
				+    //     true,
			
 
				+    //   ),
			
 
				+    // ];
			
 
				+
			
 
				+    return {
			
 
				+      liquidity,
			
 
				+      amountA,
			
 
				+      amountB,
			
 
				+      amountSlippageA,
			
 
				+      amountSlippageB,
			
 
				+      expirationTime: minExpirationTime(amountA.expirationTime, amountB.expirationTime),
			
 
				+    };
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/sqrtPriceMath.test.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/sqrtPriceMath.test.ts
@@ -0,0 +1,220 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+import { describe, test, expect } from 'vitest';
			
 
				+
			
 
				+import { MIN_TICK, MAX_TICK, MIN_SQRT_PRICE_X64, MAX_SQRT_PRICE_X64 } from '../constants.js';
			
 
				+
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+
			
 
				+describe('SqrtPriceMath basic functionality test', () => {
			
 
				+  test('price, sqrtPriceX64 and tick conversion', () => {
			
 
				+    const price = new Decimal('1.0001');
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    // price -> tick
			
 
				+    const tick = SqrtPriceMath.getTickFromPrice(price, decimalsA, decimalsB);
			
 
				+
			
 
				+    // tick -> sqrtPriceX64
			
 
				+    const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+
			
 
				+    // sqrtPriceX64 -> price
			
 
				+    const calculatedPrice = SqrtPriceMath.sqrtPriceX64ToPrice(sqrtPriceX64, decimalsA, decimalsB);
			
 
				+
			
 
				+    // Verify that the converted price is close to the original price
			
 
				+    expect(calculatedPrice.toNumber()).toBeCloseTo(price.toNumber(), 1);
			
 
				+
			
 
				+    // sqrtPriceX64 -> tick
			
 
				+    const calculatedTick = SqrtPriceMath.getTickFromSqrtPriceX64(sqrtPriceX64);
			
 
				+
			
 
				+    // Verify that the converted tick is the same as the original tick
			
 
				+    expect(calculatedTick).toBe(tick);
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('SqrtPriceMath boundary condition test', () => {
			
 
				+  test('MIN_TICK and MAX_TICK boundary test', () => {
			
 
				+    // Test minimum tick
			
 
				+    const minTickSqrtPrice = SqrtPriceMath.getSqrtPriceX64FromTick(MIN_TICK);
			
 
				+    const minTickCalculated = SqrtPriceMath.getTickFromSqrtPriceX64(minTickSqrtPrice);
			
 
				+    expect(minTickCalculated).toBe(MIN_TICK);
			
 
				+
			
 
				+    // Test maximum tick
			
 
				+    const maxTickSqrtPrice = SqrtPriceMath.getSqrtPriceX64FromTick(MAX_TICK);
			
 
				+    const maxTickCalculated = SqrtPriceMath.getTickFromSqrtPriceX64(maxTickSqrtPrice);
			
 
				+    expect(maxTickCalculated).toBe(MAX_TICK);
			
 
				+  });
			
 
				+
			
 
				+  test('MIN_SQRT_PRICE_X64 and MAX_SQRT_PRICE_X64 boundary test', () => {
			
 
				+    // Test minimum sqrtPriceX64
			
 
				+    const minTick = SqrtPriceMath.getTickFromSqrtPriceX64(MIN_SQRT_PRICE_X64);
			
 
				+    const recalculatedSqrtPrice = SqrtPriceMath.getSqrtPriceX64FromTick(minTick);
			
 
				+    // Check if it is within the reasonable error range
			
 
				+    expect(recalculatedSqrtPrice.gte(MIN_SQRT_PRICE_X64)).toBeTruthy();
			
 
				+
			
 
				+    // Test maximum sqrtPriceX64
			
 
				+    const maxTick = SqrtPriceMath.getTickFromSqrtPriceX64(MAX_SQRT_PRICE_X64);
			
 
				+    const recalculatedMaxSqrtPrice = SqrtPriceMath.getSqrtPriceX64FromTick(maxTick);
			
 
				+    // Check if it is within the reasonable error range
			
 
				+    expect(recalculatedMaxSqrtPrice.lte(MAX_SQRT_PRICE_X64)).toBeTruthy();
			
 
				+  });
			
 
				+
			
 
				+  test('Exception handling for out-of-bounds', () => {
			
 
				+    // Test for less than MIN_TICK
			
 
				+    expect(() => {
			
 
				+      SqrtPriceMath.getSqrtPriceX64FromTick(MIN_TICK - 1);
			
 
				+    }).toThrow();
			
 
				+
			
 
				+    // Test for greater than MAX_TICK
			
 
				+    expect(() => {
			
 
				+      SqrtPriceMath.getSqrtPriceX64FromTick(MAX_TICK + 1);
			
 
				+    }).toThrow();
			
 
				+
			
 
				+    // Test for less than MIN_SQRT_PRICE_X64
			
 
				+    expect(() => {
			
 
				+      SqrtPriceMath.getTickFromSqrtPriceX64(MIN_SQRT_PRICE_X64.sub(new BN(1)));
			
 
				+    }).toThrow();
			
 
				+
			
 
				+    // Test for greater than MAX_SQRT_PRICE_X64
			
 
				+    expect(() => {
			
 
				+      SqrtPriceMath.getTickFromSqrtPriceX64(MAX_SQRT_PRICE_X64.add(new BN(1)));
			
 
				+    }).toThrow();
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('SqrtPriceMath precision and rounding behavior test', () => {
			
 
				+  test('tick boundary value rounding behavior_1', () => {
			
 
				+    const tick = 1000;
			
 
				+    const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+
			
 
				+    // Create a slightly larger sqrtPriceX64 value than the current tick
			
 
				+    const slightlyLargerSqrtPrice = sqrtPriceX64.add(new BN(1));
			
 
				+    const nextTick = SqrtPriceMath.getTickFromSqrtPriceX64(slightlyLargerSqrtPrice);
			
 
				+
			
 
				+    expect(nextTick).toBe(tick);
			
 
				+  });
			
 
				+
			
 
				+  test('tick boundary value rounding behavior_2', () => {
			
 
				+    const tick = 1000;
			
 
				+    const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+
			
 
				+    // Create a slightly smaller sqrtPriceX64 value than the current tick
			
 
				+    const slightlyLargerSqrtPrice = sqrtPriceX64.sub(new BN(1));
			
 
				+    const nextTick = SqrtPriceMath.getTickFromSqrtPriceX64(slightlyLargerSqrtPrice);
			
 
				+
			
 
				+    expect(nextTick).toBe(tick - 1);
			
 
				+  });
			
 
				+
			
 
				+  test('Different decimal places affect conversion', () => {
			
 
				+    const price = new Decimal('8.7');
			
 
				+
			
 
				+    // Test different decimal place combinations
			
 
				+    const decimalCombinations = [
			
 
				+      { decimalsA: 6, decimalsB: 6 },
			
 
				+      { decimalsA: 8, decimalsB: 6 },
			
 
				+      { decimalsA: 6, decimalsB: 8 },
			
 
				+      { decimalsA: 9, decimalsB: 18 },
			
 
				+    ];
			
 
				+
			
 
				+    for (const { decimalsA, decimalsB } of decimalCombinations) {
			
 
				+      // price -> sqrtPriceX64
			
 
				+      const sqrtPriceX64 = SqrtPriceMath.priceToSqrtPriceX64(price, decimalsA, decimalsB);
			
 
				+
			
 
				+      // sqrtPriceX64 -> price
			
 
				+      const calculatedPrice = SqrtPriceMath.sqrtPriceX64ToPrice(sqrtPriceX64, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Verify that the converted price is close to the original price
			
 
				+      expect(calculatedPrice.toNumber()).toBeCloseTo(price.toNumber(), 0.01);
			
 
				+    }
			
 
				+  });
			
 
				+
			
 
				+  test('Price precision boundary case', () => {
			
 
				+    // Test for very small and very large price values
			
 
				+    const extremePrices = [
			
 
				+      new Decimal('0.0000001'), // Very small price
			
 
				+      new Decimal('1000000'), // Very large price
			
 
				+    ];
			
 
				+
			
 
				+    for (const price of extremePrices) {
			
 
				+      const decimalsA = 6;
			
 
				+      const decimalsB = 6;
			
 
				+
			
 
				+      // price -> tick -> sqrtPriceX64 -> price complete loop test
			
 
				+      const tick = SqrtPriceMath.getTickFromPrice(price, decimalsA, decimalsB);
			
 
				+      const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+      const calculatedPrice = SqrtPriceMath.sqrtPriceX64ToPrice(sqrtPriceX64, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Verify that the relative error is within the acceptable range
			
 
				+      const relativeError = price.minus(calculatedPrice).abs().div(price);
			
 
				+      expect(relativeError.toNumber()).toBeLessThan(0.001); // 0.1% error
			
 
				+    }
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('SqrtPriceMath special case test', () => {
			
 
				+  test('Non-integer tick handling', () => {
			
 
				+    // Test for non-integer tick
			
 
				+    expect(() => {
			
 
				+      SqrtPriceMath.getSqrtPriceX64FromTick(1.5);
			
 
				+    }).toThrow();
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('SqrtPriceMath loop consistency test', () => {
			
 
				+  test('price -> tick -> price conversion consistency', () => {
			
 
				+    const testPrices = [
			
 
				+      new Decimal('0.01'),
			
 
				+      new Decimal('0.5'),
			
 
				+      new Decimal('1'),
			
 
				+      new Decimal('2'),
			
 
				+      new Decimal('10'),
			
 
				+      new Decimal('100'),
			
 
				+    ];
			
 
				+
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 9;
			
 
				+
			
 
				+    for (const initialPrice of testPrices) {
			
 
				+      // price -> tick
			
 
				+      const tick = SqrtPriceMath.getTickFromPrice(initialPrice, decimalsA, decimalsB);
			
 
				+
			
 
				+      // tick -> sqrtPriceX64
			
 
				+      const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+
			
 
				+      // sqrtPriceX64 -> price
			
 
				+      const finalPrice = SqrtPriceMath.sqrtPriceX64ToPrice(sqrtPriceX64, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Verify that the relative error is within the acceptable range
			
 
				+      const relativeError = initialPrice.minus(finalPrice).abs().div(initialPrice);
			
 
				+      expect(relativeError.toNumber()).toBeLessThan(0.001); // 0.1% error
			
 
				+    }
			
 
				+  });
			
 
				+
			
 
				+  test('sqrtPriceX64 -> tick -> sqrtPriceX64 conversion consistency', () => {
			
 
				+    // Generate a series of test sqrtPriceX64 values
			
 
				+    const testValues = [
			
 
				+      // Close to MIN_SQRT_PRICE_X64
			
 
				+      MIN_SQRT_PRICE_X64.add(new BN('1000')),
			
 
				+      // Middle value
			
 
				+      new BN('79226673521066979257578248091').div(new BN(2)),
			
 
				+      // Close to MAX_SQRT_PRICE_X64
			
 
				+      MAX_SQRT_PRICE_X64.sub(new BN('1000')),
			
 
				+    ];
			
 
				+
			
 
				+    for (const initialSqrtPriceX64 of testValues) {
			
 
				+      // sqrtPriceX64 -> tick
			
 
				+      const tick = SqrtPriceMath.getTickFromSqrtPriceX64(initialSqrtPriceX64);
			
 
				+
			
 
				+      // tick -> sqrtPriceX64
			
 
				+      const finalSqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+
			
 
				+      // Calculate relative error
			
 
				+      const diff = initialSqrtPriceX64.sub(finalSqrtPriceX64).abs();
			
 
				+
			
 
				+      const relativeError = diff.mul(new BN(1000000)).div(initialSqrtPriceX64);
			
 
				+
			
 
				+      // Verify that the relative error is within the acceptable range
			
 
				+      expect(relativeError.ltn(1000)).toBeTruthy(); // 0.1% error
			
 
				+    }
			
 
				+  });
			
 
				+});
			
--- a/src/lib/clmm-sdk/src/instructions/utils/sqrtPriceMath.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/sqrtPriceMath.ts
@@ -0,0 +1,194 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import {
			
 
				+  BIT_PRECISION,
			
 
				+  LOG_B_2_X32,
			
 
				+  LOG_B_P_ERR_MARGIN_LOWER_X64,
			
 
				+  LOG_B_P_ERR_MARGIN_UPPER_X64,
			
 
				+  MAX_SQRT_PRICE_X64,
			
 
				+  MAX_TICK,
			
 
				+  MaxUint128,
			
 
				+  MIN_SQRT_PRICE_X64,
			
 
				+  MIN_TICK,
			
 
				+  ONE,
			
 
				+  U64Resolution,
			
 
				+  ZERO,
			
 
				+} from '../constants.js';
			
 
				+
			
 
				+import { MathUtils } from './mathUtils.js';
			
 
				+
			
 
				+function mulRightShift(val: BN, mulBy: BN): BN {
			
 
				+  return signedRightShift(val.mul(mulBy), 64, 256);
			
 
				+}
			
 
				+
			
 
				+function signedLeftShift(n0: BN, shiftBy: number, bitWidth: number): BN {
			
 
				+  const twosN0 = n0.toTwos(bitWidth).shln(shiftBy);
			
 
				+  twosN0.imaskn(bitWidth + 1);
			
 
				+  return twosN0.fromTwos(bitWidth);
			
 
				+}
			
 
				+
			
 
				+function signedRightShift(n0: BN, shiftBy: number, bitWidth: number): BN {
			
 
				+  const twoN0 = n0.toTwos(bitWidth).shrn(shiftBy);
			
 
				+  twoN0.imaskn(bitWidth - shiftBy + 1);
			
 
				+  return twoN0.fromTwos(bitWidth - shiftBy);
			
 
				+}
			
 
				+
			
 
				+export class SqrtPriceMath {
			
 
				+  public static sqrtPriceX64ToPrice(sqrtPriceX64: BN, decimalsA: number, decimalsB: number): Decimal {
			
 
				+    return MathUtils.x64ToDecimal(sqrtPriceX64)
			
 
				+      .pow(2)
			
 
				+      .mul(Decimal.pow(10, decimalsA - decimalsB));
			
 
				+  }
			
 
				+
			
 
				+  public static priceToSqrtPriceX64(price: Decimal, decimalsA: number, decimalsB: number): BN {
			
 
				+    return MathUtils.decimalToX64(price.mul(Decimal.pow(10, decimalsB - decimalsA)).sqrt());
			
 
				+  }
			
 
				+
			
 
				+  public static getNextSqrtPriceX64FromInput(sqrtPriceX64: BN, liquidity: BN, amountIn: BN, zeroForOne: boolean): BN {
			
 
				+    if (!sqrtPriceX64.gt(ZERO)) {
			
 
				+      throw new Error('sqrtPriceX64 must greater than 0');
			
 
				+    }
			
 
				+    if (!liquidity.gt(ZERO)) {
			
 
				+      throw new Error('liquidity must greater than 0');
			
 
				+    }
			
 
				+
			
 
				+    return zeroForOne
			
 
				+      ? this.getNextSqrtPriceFromTokenAmountARoundingUp(sqrtPriceX64, liquidity, amountIn, true)
			
 
				+      : this.getNextSqrtPriceFromTokenAmountBRoundingDown(sqrtPriceX64, liquidity, amountIn, true);
			
 
				+  }
			
 
				+
			
 
				+  public static getNextSqrtPriceX64FromOutput(sqrtPriceX64: BN, liquidity: BN, amountOut: BN, zeroForOne: boolean): BN {
			
 
				+    if (!sqrtPriceX64.gt(ZERO)) {
			
 
				+      throw new Error('sqrtPriceX64 must greater than 0');
			
 
				+    }
			
 
				+    if (!liquidity.gt(ZERO)) {
			
 
				+      throw new Error('liquidity must greater than 0');
			
 
				+    }
			
 
				+
			
 
				+    return zeroForOne
			
 
				+      ? this.getNextSqrtPriceFromTokenAmountBRoundingDown(sqrtPriceX64, liquidity, amountOut, false)
			
 
				+      : this.getNextSqrtPriceFromTokenAmountARoundingUp(sqrtPriceX64, liquidity, amountOut, false);
			
 
				+  }
			
 
				+
			
 
				+  private static getNextSqrtPriceFromTokenAmountARoundingUp(
			
 
				+    sqrtPriceX64: BN,
			
 
				+    liquidity: BN,
			
 
				+    amount: BN,
			
 
				+    add: boolean
			
 
				+  ): BN {
			
 
				+    if (amount.eq(ZERO)) return sqrtPriceX64;
			
 
				+    const liquidityLeftShift = liquidity.shln(U64Resolution);
			
 
				+
			
 
				+    if (add) {
			
 
				+      const numerator1 = liquidityLeftShift;
			
 
				+      const denominator = liquidityLeftShift.add(amount.mul(sqrtPriceX64));
			
 
				+      if (denominator.gte(numerator1)) {
			
 
				+        return MathUtils.mulDivCeil(numerator1, sqrtPriceX64, denominator);
			
 
				+      }
			
 
				+      return MathUtils.mulDivRoundingUp(numerator1, ONE, numerator1.div(sqrtPriceX64).add(amount));
			
 
				+    } else {
			
 
				+      const amountMulSqrtPrice = amount.mul(sqrtPriceX64);
			
 
				+      if (!liquidityLeftShift.gt(amountMulSqrtPrice)) {
			
 
				+        throw new Error('getNextSqrtPriceFromTokenAmountARoundingUp,liquidityLeftShift must gt amountMulSqrtPrice');
			
 
				+      }
			
 
				+      const denominator = liquidityLeftShift.sub(amountMulSqrtPrice);
			
 
				+      return MathUtils.mulDivCeil(liquidityLeftShift, sqrtPriceX64, denominator);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  private static getNextSqrtPriceFromTokenAmountBRoundingDown(
			
 
				+    sqrtPriceX64: BN,
			
 
				+    liquidity: BN,
			
 
				+    amount: BN,
			
 
				+    add: boolean
			
 
				+  ): BN {
			
 
				+    const deltaY = amount.shln(U64Resolution);
			
 
				+    if (add) {
			
 
				+      return sqrtPriceX64.add(deltaY.div(liquidity));
			
 
				+    } else {
			
 
				+      const amountDivLiquidity = MathUtils.mulDivRoundingUp(deltaY, ONE, liquidity);
			
 
				+      if (!sqrtPriceX64.gt(amountDivLiquidity)) {
			
 
				+        throw new Error('getNextSqrtPriceFromTokenAmountBRoundingDown sqrtPriceX64 must gt amountDivLiquidity');
			
 
				+      }
			
 
				+      return sqrtPriceX64.sub(amountDivLiquidity);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  public static getSqrtPriceX64FromTick(tick: number): BN {
			
 
				+    if (!Number.isInteger(tick)) {
			
 
				+      throw new Error('tick must be integer');
			
 
				+    }
			
 
				+    if (tick < MIN_TICK || tick > MAX_TICK) {
			
 
				+      throw new Error('tick must be in MIN_TICK and MAX_TICK');
			
 
				+    }
			
 
				+    const tickAbs: number = tick < 0 ? tick * -1 : tick;
			
 
				+
			
 
				+    let ratio: BN = (tickAbs & 0x1) != 0 ? new BN('18445821805675395072') : new BN('18446744073709551616');
			
 
				+    if ((tickAbs & 0x2) != 0) ratio = mulRightShift(ratio, new BN('18444899583751176192'));
			
 
				+    if ((tickAbs & 0x4) != 0) ratio = mulRightShift(ratio, new BN('18443055278223355904'));
			
 
				+    if ((tickAbs & 0x8) != 0) ratio = mulRightShift(ratio, new BN('18439367220385607680'));
			
 
				+    if ((tickAbs & 0x10) != 0) ratio = mulRightShift(ratio, new BN('18431993317065453568'));
			
 
				+    if ((tickAbs & 0x20) != 0) ratio = mulRightShift(ratio, new BN('18417254355718170624'));
			
 
				+    if ((tickAbs & 0x40) != 0) ratio = mulRightShift(ratio, new BN('18387811781193609216'));
			
 
				+    if ((tickAbs & 0x80) != 0) ratio = mulRightShift(ratio, new BN('18329067761203558400'));
			
 
				+    if ((tickAbs & 0x100) != 0) ratio = mulRightShift(ratio, new BN('18212142134806163456'));
			
 
				+    if ((tickAbs & 0x200) != 0) ratio = mulRightShift(ratio, new BN('17980523815641700352'));
			
 
				+    if ((tickAbs & 0x400) != 0) ratio = mulRightShift(ratio, new BN('17526086738831433728'));
			
 
				+    if ((tickAbs & 0x800) != 0) ratio = mulRightShift(ratio, new BN('16651378430235570176'));
			
 
				+    if ((tickAbs & 0x1000) != 0) ratio = mulRightShift(ratio, new BN('15030750278694412288'));
			
 
				+    if ((tickAbs & 0x2000) != 0) ratio = mulRightShift(ratio, new BN('12247334978884435968'));
			
 
				+    if ((tickAbs & 0x4000) != 0) ratio = mulRightShift(ratio, new BN('8131365268886854656'));
			
 
				+    if ((tickAbs & 0x8000) != 0) ratio = mulRightShift(ratio, new BN('3584323654725218816'));
			
 
				+    if ((tickAbs & 0x10000) != 0) ratio = mulRightShift(ratio, new BN('696457651848324352'));
			
 
				+    if ((tickAbs & 0x20000) != 0) ratio = mulRightShift(ratio, new BN('26294789957507116'));
			
 
				+    if ((tickAbs & 0x40000) != 0) ratio = mulRightShift(ratio, new BN('37481735321082'));
			
 
				+
			
 
				+    if (tick > 0) ratio = MaxUint128.div(ratio);
			
 
				+    return ratio;
			
 
				+  }
			
 
				+
			
 
				+  public static getTickFromPrice(price: Decimal, decimalsA: number, decimalsB: number): number {
			
 
				+    return SqrtPriceMath.getTickFromSqrtPriceX64(SqrtPriceMath.priceToSqrtPriceX64(price, decimalsA, decimalsB));
			
 
				+  }
			
 
				+
			
 
				+  public static getTickFromSqrtPriceX64(sqrtPriceX64: BN): number {
			
 
				+    if (sqrtPriceX64.gt(MAX_SQRT_PRICE_X64) || sqrtPriceX64.lt(MIN_SQRT_PRICE_X64)) {
			
 
				+      throw new Error('Provided sqrtPrice is not within the supported sqrtPrice range.');
			
 
				+    }
			
 
				+
			
 
				+    const msb = sqrtPriceX64.bitLength() - 1;
			
 
				+    const adjustedMsb = new BN(msb - 64);
			
 
				+    const log2pIntegerX32 = signedLeftShift(adjustedMsb, 32, 128);
			
 
				+
			
 
				+    let bit = new BN('8000000000000000', 'hex');
			
 
				+    let precision = 0;
			
 
				+    let log2pFractionX64 = new BN(0);
			
 
				+
			
 
				+    let r = msb >= 64 ? sqrtPriceX64.shrn(msb - 63) : sqrtPriceX64.shln(63 - msb);
			
 
				+
			
 
				+    while (bit.gt(new BN(0)) && precision < BIT_PRECISION) {
			
 
				+      r = r.mul(r);
			
 
				+      const rMoreThanTwo = r.shrn(127);
			
 
				+      r = r.shrn(63 + rMoreThanTwo.toNumber());
			
 
				+      log2pFractionX64 = log2pFractionX64.add(bit.mul(rMoreThanTwo));
			
 
				+      bit = bit.shrn(1);
			
 
				+      precision += 1;
			
 
				+    }
			
 
				+
			
 
				+    const log2pFractionX32 = log2pFractionX64.shrn(32);
			
 
				+
			
 
				+    const log2pX32 = log2pIntegerX32.add(log2pFractionX32);
			
 
				+    const logbpX64 = log2pX32.mul(new BN(LOG_B_2_X32));
			
 
				+
			
 
				+    const tickLow = signedRightShift(logbpX64.sub(new BN(LOG_B_P_ERR_MARGIN_LOWER_X64)), 64, 128).toNumber();
			
 
				+    const tickHigh = signedRightShift(logbpX64.add(new BN(LOG_B_P_ERR_MARGIN_UPPER_X64)), 64, 128).toNumber();
			
 
				+
			
 
				+    if (tickLow == tickHigh) {
			
 
				+      return tickLow;
			
 
				+    } else {
			
 
				+      const derivedTickHighSqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickHigh);
			
 
				+      return derivedTickHighSqrtPriceX64.lte(sqrtPriceX64) ? tickHigh : tickLow;
			
 
				+    }
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/swapMath.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/swapMath.ts
@@ -0,0 +1,393 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import {
			
 
				+  FEE_RATE_DENOMINATOR,
			
 
				+  MAX_SQRT_PRICE_X64,
			
 
				+  MAX_TICK,
			
 
				+  MIN_SQRT_PRICE_X64,
			
 
				+  MIN_TICK,
			
 
				+  NEGATIVE_ONE,
			
 
				+  ONE,
			
 
				+  ZERO,
			
 
				+} from '../constants.js';
			
 
				+import { getPdaTickArrayAddress } from '../pda.js';
			
 
				+
			
 
				+import { LiquidityMath } from './liquidityMath.js';
			
 
				+import { MathUtils } from './mathUtils.js';
			
 
				+import { StepComputations, Tick, TickArrayContainer, TickArrayBitmapExtensionType } from './models.js';
			
 
				+import { PoolUtils } from './poolUtils.js';
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+import { TickQuery, TickUtils } from './tick.js';
			
 
				+
			
 
				+type SwapStep = {
			
 
				+  sqrtPriceX64Next: BN;
			
 
				+  amountIn: BN;
			
 
				+  amountOut: BN;
			
 
				+  feeAmount: BN;
			
 
				+};
			
 
				+
			
 
				+export abstract class SwapMath {
			
 
				+  /**
			
 
				+   * Calculate swap path and output amount
			
 
				+   *
			
 
				+   * @param programId - Public key address of the CLMM program
			
 
				+   * @param poolId - Public key address of the liquidity pool
			
 
				+   * @param tickArrayCache - Tick array cache with keys as tick array start indices
			
 
				+   * @param tickArrayBitmap - Tick array bitmap for quickly finding initialized ticks
			
 
				+   * @param tickarrayBitmapExtension - Tick array bitmap extension information
			
 
				+   * @param zeroForOne - Swap direction: true means token0 to token1, false means token1 to token0
			
 
				+   * @param fee - Transaction fee rate (base 1000000)
			
 
				+   * @param liquidity - Current liquidity amount
			
 
				+   * @param currentTick - Current tick position
			
 
				+   * @param tickSpacing - Tick spacing
			
 
				+   * @param currentSqrtPriceX64 - Square root of current price (Q64.64 format)
			
 
				+   * @param amountSpecified - Specified swap amount (positive for input amount, negative for output amount)
			
 
				+   * @param lastSavedTickArrayStartIndex - Last saved tick array start index
			
 
				+   * @param sqrtPriceLimitX64 - Square root of price limit (Q64.64 format), optional parameter
			
 
				+   * @param catchLiquidityInsufficient - Whether to catch liquidity insufficient errors, default false
			
 
				+   *
			
 
				+   * @returns Swap calculation result object
			
 
				+   * @returns allTrade - Whether all trades were completed
			
 
				+   * @returns amountSpecifiedRemaining - Remaining untraded amount
			
 
				+   * @returns amountCalculated - Calculated amount of the other token
			
 
				+   * @returns feeAmount - Total fees
			
 
				+   * @returns sqrtPriceX64 - Square root of price after swap (Q64.64 format)
			
 
				+   * @returns liquidity - Liquidity after swap
			
 
				+   * @returns tickCurrent - Tick position after swap
			
 
				+   * @returns accounts - List of tick array accounts that need to be accessed
			
 
				+   */
			
 
				+  public static swapCompute(
			
 
				+    programId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    tickArrayInfo: { [key: string]: TickArrayContainer },
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    tickarrayBitmapExtension: TickArrayBitmapExtensionType,
			
 
				+    zeroForOne: boolean,
			
 
				+    fee: number,
			
 
				+    liquidity: BN,
			
 
				+    currentTick: number,
			
 
				+    tickSpacing: number,
			
 
				+    currentSqrtPriceX64: BN,
			
 
				+    amountSpecified: BN,
			
 
				+    lastSavedTickArrayStartIndex: number,
			
 
				+    sqrtPriceLimitX64?: BN,
			
 
				+    catchLiquidityInsufficient = false
			
 
				+  ): {
			
 
				+    allTrade: boolean;
			
 
				+    amountSpecifiedRemaining: BN;
			
 
				+    amountCalculated: BN;
			
 
				+    feeAmount: BN;
			
 
				+    sqrtPriceX64: BN;
			
 
				+    liquidity: BN;
			
 
				+    tickCurrent: number;
			
 
				+    accounts: PublicKey[];
			
 
				+  } {
			
 
				+    if (amountSpecified.eq(ZERO)) {
			
 
				+      throw new Error('amountSpecified must not be 0');
			
 
				+    }
			
 
				+    if (!sqrtPriceLimitX64) sqrtPriceLimitX64 = zeroForOne ? MIN_SQRT_PRICE_X64.add(ONE) : MAX_SQRT_PRICE_X64.sub(ONE);
			
 
				+
			
 
				+    if (zeroForOne) {
			
 
				+      if (sqrtPriceLimitX64.lt(MIN_SQRT_PRICE_X64)) {
			
 
				+        throw new Error('sqrtPriceX64 must greater than MIN_SQRT_PRICE_X64');
			
 
				+      }
			
 
				+
			
 
				+      if (sqrtPriceLimitX64.gte(currentSqrtPriceX64)) {
			
 
				+        throw new Error('sqrtPriceX64 must smaller than current');
			
 
				+      }
			
 
				+    } else {
			
 
				+      if (sqrtPriceLimitX64.gt(MAX_SQRT_PRICE_X64)) {
			
 
				+        throw new Error('sqrtPriceX64 must smaller than MAX_SQRT_PRICE_X64');
			
 
				+      }
			
 
				+
			
 
				+      if (sqrtPriceLimitX64.lte(currentSqrtPriceX64)) {
			
 
				+        throw new Error('sqrtPriceX64 must greater than current');
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    const baseInput = amountSpecified.gt(ZERO);
			
 
				+
			
 
				+    const state = {
			
 
				+      amountSpecifiedRemaining: amountSpecified,
			
 
				+      amountCalculated: ZERO,
			
 
				+      sqrtPriceX64: currentSqrtPriceX64,
			
 
				+      tick:
			
 
				+        currentTick > lastSavedTickArrayStartIndex
			
 
				+          ? Math.min(lastSavedTickArrayStartIndex + TickQuery.tickCount(tickSpacing) - 1, currentTick)
			
 
				+          : lastSavedTickArrayStartIndex,
			
 
				+      accounts: [] as PublicKey[],
			
 
				+      liquidity,
			
 
				+      feeAmount: new BN(0),
			
 
				+    };
			
 
				+    let tickAarrayStartIndex = lastSavedTickArrayStartIndex;
			
 
				+    let tickArrayCurrent = tickArrayInfo[lastSavedTickArrayStartIndex];
			
 
				+
			
 
				+    // Verify if tickArrayInfo contains necessary data
			
 
				+    if (!tickArrayCurrent) {
			
 
				+      throw new Error(
			
 
				+        `TickArray not found in cache for startIndex: ${lastSavedTickArrayStartIndex}. Please ensure tickArrayCache is properly initialized.`
			
 
				+      );
			
 
				+    }
			
 
				+
			
 
				+    let loopCount = 0;
			
 
				+    let t = !zeroForOne && tickArrayCurrent.data.startTickIndex === state.tick;
			
 
				+    while (
			
 
				+      !state.amountSpecifiedRemaining.eq(ZERO) &&
			
 
				+      !state.sqrtPriceX64.eq(sqrtPriceLimitX64)
			
 
				+      // state.tick < MAX_TICK &&
			
 
				+      // state.tick > MIN_TICK
			
 
				+    ) {
			
 
				+      if (loopCount > 10) {
			
 
				+        // throw Error('liquidity limit')
			
 
				+      }
			
 
				+      const step: Partial<StepComputations> = {};
			
 
				+      step.sqrtPriceStartX64 = state.sqrtPriceX64;
			
 
				+
			
 
				+      const tickState: Tick | null = TickUtils.nextInitTick(tickArrayCurrent, state.tick, tickSpacing, zeroForOne, t);
			
 
				+
			
 
				+      let nextInitTick: Tick | null = tickState ? tickState : null; // TickUtils.firstInitializedTick(tickArrayCurrent, zeroForOne)
			
 
				+      let tickArrayAddress: null | PublicKey = null;
			
 
				+
			
 
				+      if (!nextInitTick?.liquidityGross.gtn(0)) {
			
 
				+        const nextInitTickArrayIndex = PoolUtils.nextInitializedTickArrayStartIndex(
			
 
				+          {
			
 
				+            tickCurrent: state.tick,
			
 
				+            tickSpacing,
			
 
				+            tickArrayBitmap,
			
 
				+            exBitmapInfo: tickarrayBitmapExtension,
			
 
				+          },
			
 
				+          tickAarrayStartIndex,
			
 
				+          zeroForOne
			
 
				+        );
			
 
				+        if (!nextInitTickArrayIndex.isExist) {
			
 
				+          if (catchLiquidityInsufficient) {
			
 
				+            return {
			
 
				+              allTrade: false,
			
 
				+              amountSpecifiedRemaining: state.amountSpecifiedRemaining,
			
 
				+              amountCalculated: state.amountCalculated,
			
 
				+              feeAmount: state.feeAmount,
			
 
				+              sqrtPriceX64: state.sqrtPriceX64,
			
 
				+              liquidity: state.liquidity,
			
 
				+              tickCurrent: state.tick,
			
 
				+              accounts: state.accounts,
			
 
				+            };
			
 
				+          }
			
 
				+          throw Error('swapCompute LiquidityInsufficient');
			
 
				+        }
			
 
				+        tickAarrayStartIndex = nextInitTickArrayIndex.nextStartIndex;
			
 
				+
			
 
				+        const { publicKey: expectedNextTickArrayAddress } = getPdaTickArrayAddress(
			
 
				+          programId,
			
 
				+          poolId,
			
 
				+          tickAarrayStartIndex
			
 
				+        );
			
 
				+        tickArrayAddress = expectedNextTickArrayAddress;
			
 
				+        tickArrayCurrent = tickArrayInfo[tickAarrayStartIndex];
			
 
				+
			
 
				+        // Verify if new tick array is in cache
			
 
				+        if (!tickArrayCurrent) {
			
 
				+          throw new Error(
			
 
				+            `TickArray not found in cache for startIndex: ${tickAarrayStartIndex}. Missing tick array data during swap computation.`
			
 
				+          );
			
 
				+        }
			
 
				+
			
 
				+        try {
			
 
				+          nextInitTick = TickUtils.firstInitializedTick(tickArrayCurrent, zeroForOne);
			
 
				+        } catch (error) {
			
 
				+          throw new Error(
			
 
				+            `Failed to find initialized tick in array ${tickAarrayStartIndex}: ${
			
 
				+              error instanceof Error ? error.message : 'Unknown error'
			
 
				+            }`
			
 
				+          );
			
 
				+        }
			
 
				+      }
			
 
				+
			
 
				+      step.tickNext = nextInitTick.tick;
			
 
				+      step.initialized = nextInitTick.liquidityGross.gtn(0);
			
 
				+      if (lastSavedTickArrayStartIndex !== tickAarrayStartIndex && tickArrayAddress) {
			
 
				+        state.accounts.push(tickArrayAddress);
			
 
				+        lastSavedTickArrayStartIndex = tickAarrayStartIndex;
			
 
				+      }
			
 
				+      if (step.tickNext < MIN_TICK) {
			
 
				+        step.tickNext = MIN_TICK;
			
 
				+      } else if (step.tickNext > MAX_TICK) {
			
 
				+        step.tickNext = MAX_TICK;
			
 
				+      }
			
 
				+
			
 
				+      step.sqrtPriceNextX64 = SqrtPriceMath.getSqrtPriceX64FromTick(step.tickNext);
			
 
				+      let targetPrice: BN;
			
 
				+      if (
			
 
				+        (zeroForOne && step.sqrtPriceNextX64.lt(sqrtPriceLimitX64)) ||
			
 
				+        (!zeroForOne && step.sqrtPriceNextX64.gt(sqrtPriceLimitX64))
			
 
				+      ) {
			
 
				+        targetPrice = sqrtPriceLimitX64;
			
 
				+      } else {
			
 
				+        targetPrice = step.sqrtPriceNextX64;
			
 
				+      }
			
 
				+      [state.sqrtPriceX64, step.amountIn, step.amountOut, step.feeAmount] = SwapMath.swapStepCompute(
			
 
				+        state.sqrtPriceX64,
			
 
				+        targetPrice,
			
 
				+        state.liquidity,
			
 
				+        state.amountSpecifiedRemaining,
			
 
				+        fee,
			
 
				+        zeroForOne
			
 
				+      );
			
 
				+
			
 
				+      state.feeAmount = state.feeAmount.add(step.feeAmount);
			
 
				+
			
 
				+      if (baseInput) {
			
 
				+        state.amountSpecifiedRemaining = state.amountSpecifiedRemaining.sub(step.amountIn.add(step.feeAmount));
			
 
				+        state.amountCalculated = state.amountCalculated.sub(step.amountOut);
			
 
				+      } else {
			
 
				+        state.amountSpecifiedRemaining = state.amountSpecifiedRemaining.add(step.amountOut);
			
 
				+        state.amountCalculated = state.amountCalculated.add(step.amountIn.add(step.feeAmount));
			
 
				+      }
			
 
				+      if (state.sqrtPriceX64.eq(step.sqrtPriceNextX64)) {
			
 
				+        if (step.initialized) {
			
 
				+          let liquidityNet = nextInitTick.liquidityNet;
			
 
				+          if (zeroForOne) liquidityNet = liquidityNet.mul(NEGATIVE_ONE);
			
 
				+          state.liquidity = LiquidityMath.addDelta(state.liquidity, liquidityNet);
			
 
				+        }
			
 
				+
			
 
				+        t = step.tickNext != state.tick && !zeroForOne && tickArrayCurrent.data.startTickIndex === step.tickNext;
			
 
				+        state.tick = zeroForOne ? step.tickNext - 1 : step.tickNext; //
			
 
				+      } else if (state.sqrtPriceX64 != step.sqrtPriceStartX64) {
			
 
				+        const _T = SqrtPriceMath.getTickFromSqrtPriceX64(state.sqrtPriceX64);
			
 
				+        t = _T != state.tick && !zeroForOne && tickArrayCurrent.data.startTickIndex === _T;
			
 
				+        state.tick = _T;
			
 
				+      }
			
 
				+      ++loopCount;
			
 
				+    }
			
 
				+
			
 
				+    try {
			
 
				+      const { nextStartIndex: tickAarrayStartIndex, isExist } = TickQuery.nextInitializedTickArray(
			
 
				+        state.tick,
			
 
				+        tickSpacing,
			
 
				+        zeroForOne,
			
 
				+        tickArrayBitmap,
			
 
				+        tickarrayBitmapExtension
			
 
				+      );
			
 
				+      if (isExist && lastSavedTickArrayStartIndex !== tickAarrayStartIndex) {
			
 
				+        state.accounts.push(getPdaTickArrayAddress(programId, poolId, tickAarrayStartIndex).publicKey);
			
 
				+        lastSavedTickArrayStartIndex = tickAarrayStartIndex;
			
 
				+      }
			
 
				+    } catch (e) {
			
 
				+      /* empty */
			
 
				+    }
			
 
				+
			
 
				+    return {
			
 
				+      allTrade: true,
			
 
				+      amountSpecifiedRemaining: ZERO,
			
 
				+      amountCalculated: state.amountCalculated,
			
 
				+      feeAmount: state.feeAmount,
			
 
				+      sqrtPriceX64: state.sqrtPriceX64,
			
 
				+      liquidity: state.liquidity,
			
 
				+      tickCurrent: state.tick,
			
 
				+      accounts: state.accounts,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  private static swapStepCompute(
			
 
				+    sqrtPriceX64Current: BN,
			
 
				+    sqrtPriceX64Target: BN,
			
 
				+    liquidity: BN,
			
 
				+    amountRemaining: BN,
			
 
				+    feeRate: number, // Base 1000000
			
 
				+    zeroForOne: boolean
			
 
				+  ): [BN, BN, BN, BN] {
			
 
				+    const swapStep: SwapStep = {
			
 
				+      sqrtPriceX64Next: new BN(0),
			
 
				+      amountIn: new BN(0),
			
 
				+      amountOut: new BN(0),
			
 
				+      feeAmount: new BN(0),
			
 
				+    };
			
 
				+
			
 
				+    const baseInput = amountRemaining.gte(ZERO);
			
 
				+
			
 
				+    if (baseInput) {
			
 
				+      const amountRemainingSubtractFee = MathUtils.mulDivFloor(
			
 
				+        amountRemaining,
			
 
				+        FEE_RATE_DENOMINATOR.sub(new BN(feeRate.toString())),
			
 
				+        FEE_RATE_DENOMINATOR
			
 
				+      );
			
 
				+      swapStep.amountIn = zeroForOne
			
 
				+        ? LiquidityMath.getTokenAmountAFromLiquidity(sqrtPriceX64Target, sqrtPriceX64Current, liquidity, true)
			
 
				+        : LiquidityMath.getTokenAmountBFromLiquidity(sqrtPriceX64Current, sqrtPriceX64Target, liquidity, true);
			
 
				+      if (amountRemainingSubtractFee.gte(swapStep.amountIn)) {
			
 
				+        swapStep.sqrtPriceX64Next = sqrtPriceX64Target;
			
 
				+      } else {
			
 
				+        swapStep.sqrtPriceX64Next = SqrtPriceMath.getNextSqrtPriceX64FromInput(
			
 
				+          sqrtPriceX64Current,
			
 
				+          liquidity,
			
 
				+          amountRemainingSubtractFee,
			
 
				+          zeroForOne
			
 
				+        );
			
 
				+      }
			
 
				+    } else {
			
 
				+      swapStep.amountOut = zeroForOne
			
 
				+        ? LiquidityMath.getTokenAmountBFromLiquidity(sqrtPriceX64Target, sqrtPriceX64Current, liquidity, false)
			
 
				+        : LiquidityMath.getTokenAmountAFromLiquidity(sqrtPriceX64Current, sqrtPriceX64Target, liquidity, false);
			
 
				+      if (amountRemaining.mul(NEGATIVE_ONE).gte(swapStep.amountOut)) {
			
 
				+        swapStep.sqrtPriceX64Next = sqrtPriceX64Target;
			
 
				+      } else {
			
 
				+        swapStep.sqrtPriceX64Next = SqrtPriceMath.getNextSqrtPriceX64FromOutput(
			
 
				+          sqrtPriceX64Current,
			
 
				+          liquidity,
			
 
				+          amountRemaining.mul(NEGATIVE_ONE),
			
 
				+          zeroForOne
			
 
				+        );
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    const reachTargetPrice = sqrtPriceX64Target.eq(swapStep.sqrtPriceX64Next);
			
 
				+
			
 
				+    if (zeroForOne) {
			
 
				+      if (!(reachTargetPrice && baseInput)) {
			
 
				+        swapStep.amountIn = LiquidityMath.getTokenAmountAFromLiquidity(
			
 
				+          swapStep.sqrtPriceX64Next,
			
 
				+          sqrtPriceX64Current,
			
 
				+          liquidity,
			
 
				+          true
			
 
				+        );
			
 
				+      }
			
 
				+
			
 
				+      if (!(reachTargetPrice && !baseInput)) {
			
 
				+        swapStep.amountOut = LiquidityMath.getTokenAmountBFromLiquidity(
			
 
				+          swapStep.sqrtPriceX64Next,
			
 
				+          sqrtPriceX64Current,
			
 
				+          liquidity,
			
 
				+          false
			
 
				+        );
			
 
				+      }
			
 
				+    } else {
			
 
				+      swapStep.amountIn =
			
 
				+        reachTargetPrice && baseInput
			
 
				+          ? swapStep.amountIn
			
 
				+          : LiquidityMath.getTokenAmountBFromLiquidity(sqrtPriceX64Current, swapStep.sqrtPriceX64Next, liquidity, true);
			
 
				+      swapStep.amountOut =
			
 
				+        reachTargetPrice && !baseInput
			
 
				+          ? swapStep.amountOut
			
 
				+          : LiquidityMath.getTokenAmountAFromLiquidity(
			
 
				+              sqrtPriceX64Current,
			
 
				+              swapStep.sqrtPriceX64Next,
			
 
				+              liquidity,
			
 
				+              false
			
 
				+            );
			
 
				+    }
			
 
				+
			
 
				+    if (!baseInput && swapStep.amountOut.gt(amountRemaining.mul(NEGATIVE_ONE))) {
			
 
				+      swapStep.amountOut = amountRemaining.mul(NEGATIVE_ONE);
			
 
				+    }
			
 
				+    if (baseInput && !swapStep.sqrtPriceX64Next.eq(sqrtPriceX64Target)) {
			
 
				+      swapStep.feeAmount = amountRemaining.sub(swapStep.amountIn);
			
 
				+    } else {
			
 
				+      swapStep.feeAmount = MathUtils.mulDivCeil(
			
 
				+        swapStep.amountIn,
			
 
				+        new BN(feeRate),
			
 
				+        FEE_RATE_DENOMINATOR.sub(new BN(feeRate))
			
 
				+      );
			
 
				+    }
			
 
				+    return [swapStep.sqrtPriceX64Next, swapStep.amountIn, swapStep.amountOut, swapStep.feeAmount];
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/tick.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/tick.ts
@@ -0,0 +1,567 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { TICK_ARRAY_SIZE, TICK_ARRAY_BITMAP_SIZE } from '../../constants.js';
			
 
				+import { MAX_TICK, MIN_TICK } from '../constants.js';
			
 
				+import { IPoolLayout } from '../layout.js';
			
 
				+import { TickArrayBitmapExtensionType } from './models.js';
			
 
				+import { TickArrayBitmapExtensionUtils } from './tickarrayBitmap.js';
			
 
				+import { getPdaTickArrayAddress } from '../pda.js';
			
 
				+
			
 
				+import {
			
 
				+  ReturnTypeGetPriceAndTick,
			
 
				+  Tick,
			
 
				+  TickArray,
			
 
				+  TickArrayState,
			
 
				+  TickState,
			
 
				+  TickArrayContainer,
			
 
				+  DynTickArray,
			
 
				+} from './models.js';
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+import { TickMath } from './tickMath.js';
			
 
				+
			
 
				+export class TickUtils {
			
 
				+  // Calculate the address of the TickArray corresponding to the given tick index
			
 
				+  public static getTickArrayAddressByTick(
			
 
				+    programId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    tickIndex: number,
			
 
				+    tickSpacing: number
			
 
				+  ): PublicKey {
			
 
				+    const startIndex = TickUtils.getTickArrayStartIndexByTick(tickIndex, tickSpacing);
			
 
				+    const { publicKey: tickArrayAddress } = getPdaTickArrayAddress(programId, poolId, startIndex);
			
 
				+    return tickArrayAddress;
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the offset of the given tick index within the corresponding TickArray
			
 
				+  public static getTickOffsetInArray(tickIndex: number, tickSpacing: number): number {
			
 
				+    if (tickIndex % tickSpacing != 0) {
			
 
				+      throw new Error('tickIndex % tickSpacing not equal 0');
			
 
				+    }
			
 
				+    const startTickIndex = TickUtils.getTickArrayStartIndexByTick(tickIndex, tickSpacing);
			
 
				+    const offsetInArray = Math.floor((tickIndex - startTickIndex) / tickSpacing);
			
 
				+    if (offsetInArray < 0 || offsetInArray >= TICK_ARRAY_SIZE) {
			
 
				+      throw new Error('tick offset in array overflow');
			
 
				+    }
			
 
				+    return offsetInArray;
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the index position of the TickArray corresponding to the given tick index in the bitmap.
			
 
				+  public static getTickArrayBitIndex(tickIndex: number, tickSpacing: number): number {
			
 
				+    const ticksInArray = TickQuery.tickCount(tickSpacing);
			
 
				+
			
 
				+    let startIndex: number = tickIndex / ticksInArray;
			
 
				+    if (tickIndex < 0 && tickIndex % ticksInArray != 0) {
			
 
				+      startIndex = Math.ceil(startIndex) - 1;
			
 
				+    } else {
			
 
				+      startIndex = Math.floor(startIndex);
			
 
				+    }
			
 
				+    return startIndex;
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the start index of the TickArray corresponding to the given tick index
			
 
				+  public static getTickArrayStartIndexByTick(tickIndex: number, tickSpacing: number): number {
			
 
				+    return this.getTickArrayBitIndex(tickIndex, tickSpacing) * TickQuery.tickCount(tickSpacing);
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the offset of the TickArray corresponding to the given tick index in the default bitmap
			
 
				+  public static getTickArrayOffsetInBitmapByTick(tick: number, tickSpacing: number): number {
			
 
				+    const multiplier = tickSpacing * TICK_ARRAY_SIZE;
			
 
				+    const compressed = Math.floor(tick / multiplier) + 512;
			
 
				+    return Math.abs(compressed);
			
 
				+  }
			
 
				+
			
 
				+  // Check if the TickArray corresponding to the given tick index has been initialized
			
 
				+  public static checkTickArrayIsInitialized(
			
 
				+    bitmap: BN,
			
 
				+    tick: number,
			
 
				+    tickSpacing: number
			
 
				+  ): {
			
 
				+    isInitialized: boolean;
			
 
				+    startIndex: number;
			
 
				+  } {
			
 
				+    const multiplier = tickSpacing * TICK_ARRAY_SIZE;
			
 
				+    const compressed = Math.floor(tick / multiplier) + 512;
			
 
				+    const bitPos = Math.abs(compressed);
			
 
				+    return {
			
 
				+      isInitialized: bitmap.testn(bitPos),
			
 
				+      startIndex: (bitPos - 512) * multiplier,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the start index of the next TickArray
			
 
				+  // Can be ignored, referenced by nextInitializedTick, but nextInitializedTick is not used
			
 
				+  public static getNextTickArrayStartIndex(
			
 
				+    lastTickArrayStartIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean
			
 
				+  ): number {
			
 
				+    return zeroForOne
			
 
				+      ? lastTickArrayStartIndex - tickSpacing * TICK_ARRAY_SIZE
			
 
				+      : lastTickArrayStartIndex + tickSpacing * TICK_ARRAY_SIZE;
			
 
				+  }
			
 
				+
			
 
				+  // Merge bitmaps of multiple TickArrays
			
 
				+  public static mergeTickArrayBitmap(bns: BN[]): BN {
			
 
				+    let b = new BN(0);
			
 
				+    for (let i = 0; i < bns.length; i++) {
			
 
				+      b = b.add(bns[i].shln(64 * i));
			
 
				+    }
			
 
				+    return b;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Search for initialized TickArrays around the current position to find the starting indices of a specified number of initialized TickArrays
			
 
				+   *
			
 
				+   * @param tickArrayBitmap - Main tick array bitmap used to mark initialized tick arrays
			
 
				+   * @param exTickArrayBitmap - Extended tick array bitmap containing positive and negative direction extension bitmap information
			
 
				+   * @param tickSpacing - Tick spacing
			
 
				+   * @param tickArrayStartIndex - Starting tick array index for the search
			
 
				+   * @param expectedCount - Expected number of initialized TickArrays to find
			
 
				+   *
			
 
				+   * @returns Array of initialized TickArray starting indices
			
 
				+   *
			
 
				+   * @description
			
 
				+   * This function is used to locate active liquidity around the current price. It searches on both sides of the given starting position:
			
 
				+   * - Search right (higher tick positions)
			
 
				+   * - Search left (lower tick positions)
			
 
				+   * By combining the search results from both directions, it provides the liquidity distribution around the current price
			
 
				+   */
			
 
				+  public static getInitializedTickArrayInRange(
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    exTickArrayBitmap: TickArrayBitmapExtensionType,
			
 
				+    tickSpacing: number,
			
 
				+    tickArrayStartIndex: number,
			
 
				+    expectedCount: number
			
 
				+  ): number[] {
			
 
				+    const tickArrayOffset = Math.floor(tickArrayStartIndex / (tickSpacing * TICK_ARRAY_SIZE));
			
 
				+    return [
			
 
				+      // find right of currenct offset
			
 
				+      ...TickUtils.searchLowBitFromStart(
			
 
				+        tickArrayBitmap,
			
 
				+        exTickArrayBitmap,
			
 
				+        tickArrayOffset - 1,
			
 
				+        expectedCount,
			
 
				+        tickSpacing
			
 
				+      ),
			
 
				+
			
 
				+      // find left of current offset
			
 
				+      ...TickUtils.searchHightBitFromStart(
			
 
				+        tickArrayBitmap,
			
 
				+        exTickArrayBitmap,
			
 
				+        tickArrayOffset,
			
 
				+        expectedCount,
			
 
				+        tickSpacing
			
 
				+      ),
			
 
				+    ];
			
 
				+  }
			
 
				+
			
 
				+  // Get start indices of all initialized TickArrays
			
 
				+  // TODO: The TICK_ARRAY_BITMAP_SIZE passed in this function may not be able to retrieve all initialized TickArrays
			
 
				+  public static getAllInitializedTickArrayStartIndex(
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    exTickArrayBitmap: TickArrayBitmapExtensionType,
			
 
				+    tickSpacing: number
			
 
				+  ): number[] {
			
 
				+    // find from offset 0 to 1024
			
 
				+    return TickUtils.searchHightBitFromStart(
			
 
				+      tickArrayBitmap,
			
 
				+      exTickArrayBitmap,
			
 
				+      -7680,
			
 
				+      TICK_ARRAY_BITMAP_SIZE,
			
 
				+      tickSpacing
			
 
				+    );
			
 
				+  }
			
 
				+
			
 
				+  // Get information of all initialized TickArrays
			
 
				+  public static getAllInitializedTickArrayInfo(
			
 
				+    programId: PublicKey,
			
 
				+    poolId: PublicKey,
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    exTickArrayBitmap: TickArrayBitmapExtensionType,
			
 
				+    tickSpacing: number
			
 
				+  ): {
			
 
				+    tickArrayStartIndex: number;
			
 
				+    tickArrayAddress: PublicKey;
			
 
				+  }[] {
			
 
				+    const result: {
			
 
				+      tickArrayStartIndex: number;
			
 
				+      tickArrayAddress: PublicKey;
			
 
				+    }[] = [];
			
 
				+    const allInitializedTickArrayIndex: number[] = TickUtils.getAllInitializedTickArrayStartIndex(
			
 
				+      tickArrayBitmap,
			
 
				+      exTickArrayBitmap,
			
 
				+      tickSpacing
			
 
				+    );
			
 
				+    for (const startIndex of allInitializedTickArrayIndex) {
			
 
				+      const { publicKey: address } = getPdaTickArrayAddress(programId, poolId, startIndex);
			
 
				+      result.push({
			
 
				+        tickArrayStartIndex: startIndex,
			
 
				+        tickArrayAddress: address,
			
 
				+      });
			
 
				+    }
			
 
				+    return result;
			
 
				+  }
			
 
				+
			
 
				+  // Get all initialized Ticks in the given TickArray
			
 
				+  public static getAllInitializedTickInTickArray(tickArray: TickArrayState): TickState[] {
			
 
				+    return tickArray.ticks.filter((i) => i.liquidityGross.gtn(0));
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Search for initialized TickArrays to the left from the starting position
			
 
				+   * Used to locate active liquidity near the current price
			
 
				+   */
			
 
				+  public static searchLowBitFromStart(
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    exTickArrayBitmap: TickArrayBitmapExtensionType,
			
 
				+    currentTickArrayBitStartIndex: number,
			
 
				+    expectedCount: number,
			
 
				+    tickSpacing: number
			
 
				+  ): number[] {
			
 
				+    const tickArrayBitmaps = [
			
 
				+      ...[...exTickArrayBitmap.negativeTickArrayBitmap].reverse(),
			
 
				+      tickArrayBitmap.slice(0, 8),
			
 
				+      tickArrayBitmap.slice(8, 16),
			
 
				+      ...exTickArrayBitmap.positiveTickArrayBitmap,
			
 
				+    ].map((i) => TickUtils.mergeTickArrayBitmap(i));
			
 
				+    const result: number[] = [];
			
 
				+    while (currentTickArrayBitStartIndex >= -7680) {
			
 
				+      const arrayIndex = Math.floor((currentTickArrayBitStartIndex + 7680) / 512);
			
 
				+      const searchIndex = (currentTickArrayBitStartIndex + 7680) % 512;
			
 
				+
			
 
				+      if (tickArrayBitmaps[arrayIndex].testn(searchIndex)) result.push(currentTickArrayBitStartIndex);
			
 
				+
			
 
				+      currentTickArrayBitStartIndex--;
			
 
				+      if (result.length === expectedCount) break;
			
 
				+    }
			
 
				+
			
 
				+    const tickCount = TickQuery.tickCount(tickSpacing);
			
 
				+    return result.map((i) => i * tickCount);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Search for initialized TickArrays to the right from the starting position
			
 
				+   * Used to locate active liquidity near the current price
			
 
				+   */
			
 
				+  public static searchHightBitFromStart(
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    exTickArrayBitmap: TickArrayBitmapExtensionType,
			
 
				+    currentTickArrayBitStartIndex: number,
			
 
				+    expectedCount: number,
			
 
				+    tickSpacing: number
			
 
				+  ): number[] {
			
 
				+    const tickArrayBitmaps = [
			
 
				+      ...[...exTickArrayBitmap.negativeTickArrayBitmap].reverse(),
			
 
				+      tickArrayBitmap.slice(0, 8),
			
 
				+      tickArrayBitmap.slice(8, 16),
			
 
				+      ...exTickArrayBitmap.positiveTickArrayBitmap,
			
 
				+    ].map((i) => TickUtils.mergeTickArrayBitmap(i));
			
 
				+    const result: number[] = [];
			
 
				+    while (currentTickArrayBitStartIndex < 7680) {
			
 
				+      const arrayIndex = Math.floor((currentTickArrayBitStartIndex + 7680) / 512);
			
 
				+      const searchIndex = (currentTickArrayBitStartIndex + 7680) % 512;
			
 
				+
			
 
				+      if (tickArrayBitmaps[arrayIndex].testn(searchIndex)) result.push(currentTickArrayBitStartIndex);
			
 
				+
			
 
				+      currentTickArrayBitStartIndex++;
			
 
				+      if (result.length === expectedCount) break;
			
 
				+    }
			
 
				+
			
 
				+    const tickCount = TickQuery.tickCount(tickSpacing);
			
 
				+    return result.map((i) => i * tickCount);
			
 
				+  }
			
 
				+
			
 
				+  // Check if the given tick index is out of bounds
			
 
				+  public static checkIsOutOfBoundary(tick: number): boolean {
			
 
				+    return tick < MIN_TICK || tick > MAX_TICK;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Get the next initialized Tick
			
 
				+   * Used to locate active liquidity near the current price
			
 
				+   * Now supports both fixed and dynamic tick arrays through the container pattern
			
 
				+   */
			
 
				+  public static nextInitTick(
			
 
				+    tickArrayCurrent: TickArrayContainer,
			
 
				+    currentTickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean,
			
 
				+    t: boolean
			
 
				+  ): Tick | null {
			
 
				+    if (tickArrayCurrent.type === 'Fixed') {
			
 
				+      return this._nextInitTickFixed(tickArrayCurrent.data, currentTickIndex, tickSpacing, zeroForOne, t);
			
 
				+    } else {
			
 
				+      return this._nextInitTickDynamic(tickArrayCurrent.data, currentTickIndex, tickSpacing, zeroForOne, t);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Fixed tick array implementation (original logic)
			
 
				+   */
			
 
				+  private static _nextInitTickFixed(
			
 
				+    tickArray: TickArray,
			
 
				+    currentTickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean,
			
 
				+    t: boolean
			
 
				+  ): Tick | null {
			
 
				+    const currentTickArrayStartIndex = TickQuery.getArrayStartIndex(currentTickIndex, tickSpacing);
			
 
				+    if (currentTickArrayStartIndex != tickArray.startTickIndex) {
			
 
				+      return null;
			
 
				+    }
			
 
				+    let offsetInArray = Math.floor((currentTickIndex - tickArray.startTickIndex) / tickSpacing);
			
 
				+
			
 
				+    if (zeroForOne) {
			
 
				+      while (offsetInArray >= 0) {
			
 
				+        if (tickArray.ticks[offsetInArray].liquidityGross.gtn(0)) {
			
 
				+          return tickArray.ticks[offsetInArray];
			
 
				+        }
			
 
				+        offsetInArray = offsetInArray - 1;
			
 
				+      }
			
 
				+    } else {
			
 
				+      if (!t) offsetInArray = offsetInArray + 1;
			
 
				+      while (offsetInArray < TICK_ARRAY_SIZE) {
			
 
				+        if (tickArray.ticks[offsetInArray].liquidityGross.gtn(0)) {
			
 
				+          return tickArray.ticks[offsetInArray];
			
 
				+        }
			
 
				+        offsetInArray = offsetInArray + 1;
			
 
				+      }
			
 
				+    }
			
 
				+    return null;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Dynamic tick array implementation
			
 
				+   * Uses the mapping table (tickOffsetIndex) to find allocated ticks
			
 
				+   */
			
 
				+  private static _nextInitTickDynamic(
			
 
				+    dynTickArray: DynTickArray,
			
 
				+    currentTickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean,
			
 
				+    t: boolean
			
 
				+  ): Tick | null {
			
 
				+    const currentTickArrayStartIndex = TickQuery.getArrayStartIndex(currentTickIndex, tickSpacing);
			
 
				+    if (currentTickArrayStartIndex !== dynTickArray.startTickIndex) {
			
 
				+      return null;
			
 
				+    }
			
 
				+
			
 
				+    let offsetInArray = Math.floor((currentTickIndex - dynTickArray.startTickIndex) / tickSpacing);
			
 
				+
			
 
				+    if (zeroForOne) {
			
 
				+      while (offsetInArray >= 0) {
			
 
				+        // Check mapping table
			
 
				+        const physicalIndex = dynTickArray.tickOffsetIndex[offsetInArray];
			
 
				+
			
 
				+        if (physicalIndex > 0) {
			
 
				+          const tick = dynTickArray.ticks[physicalIndex - 1];
			
 
				+          if (tick.liquidityGross.gtn(0)) {
			
 
				+            return tick;
			
 
				+          }
			
 
				+        }
			
 
				+
			
 
				+        offsetInArray = offsetInArray - 1;
			
 
				+      }
			
 
				+    } else {
			
 
				+      if (!t) offsetInArray = offsetInArray + 1;
			
 
				+
			
 
				+      while (offsetInArray < TICK_ARRAY_SIZE) {
			
 
				+        const physicalIndex = dynTickArray.tickOffsetIndex[offsetInArray];
			
 
				+
			
 
				+        if (physicalIndex > 0) {
			
 
				+          const tick = dynTickArray.ticks[physicalIndex - 1];
			
 
				+          if (tick.liquidityGross.gtn(0)) {
			
 
				+            return tick;
			
 
				+          }
			
 
				+        }
			
 
				+
			
 
				+        offsetInArray = offsetInArray + 1;
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    return null;
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Find the first initialized Tick in the given TickArray, where "first" is defined based on the trading direction (zeroForOne)
			
 
				+   * Now supports both fixed and dynamic tick arrays through the container pattern
			
 
				+   */
			
 
				+  public static firstInitializedTick(tickArrayCurrent: TickArrayContainer, zeroForOne: boolean): Tick {
			
 
				+    if (tickArrayCurrent.type === 'Fixed') {
			
 
				+      return this._firstInitializedTickFixed(tickArrayCurrent.data, zeroForOne);
			
 
				+    } else {
			
 
				+      return this._firstInitializedTickDynamic(tickArrayCurrent.data, zeroForOne);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Fixed tick array implementation (original logic)
			
 
				+   */
			
 
				+  private static _firstInitializedTickFixed(tickArray: TickArray, zeroForOne: boolean): Tick {
			
 
				+    if (zeroForOne) {
			
 
				+      let i = TICK_ARRAY_SIZE - 1;
			
 
				+      while (i >= 0) {
			
 
				+        if (tickArray.ticks[i].liquidityGross.gtn(0)) {
			
 
				+          return tickArray.ticks[i];
			
 
				+        }
			
 
				+        i = i - 1;
			
 
				+      }
			
 
				+    } else {
			
 
				+      let i = 0;
			
 
				+      while (i < TICK_ARRAY_SIZE) {
			
 
				+        if (tickArray.ticks[i].liquidityGross.gtn(0)) {
			
 
				+          return tickArray.ticks[i];
			
 
				+        }
			
 
				+        i = i + 1;
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    throw Error(`firstInitializedTick check error: ${tickArray} - ${zeroForOne}`);
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Dynamic tick array implementation
			
 
				+   * Uses the mapping table (tickOffsetIndex) to find the first allocated tick
			
 
				+   */
			
 
				+  private static _firstInitializedTickDynamic(dynTickArray: DynTickArray, zeroForOne: boolean): Tick {
			
 
				+    if (zeroForOne) {
			
 
				+      // Search from right to left (highest tick index first)
			
 
				+      let i = TICK_ARRAY_SIZE - 1;
			
 
				+      while (i >= 0) {
			
 
				+        const physicalIndex = dynTickArray.tickOffsetIndex[i];
			
 
				+
			
 
				+        if (physicalIndex > 0) {
			
 
				+          const tick = dynTickArray.ticks[physicalIndex - 1];
			
 
				+          if (tick.liquidityGross.gtn(0)) {
			
 
				+            return tick;
			
 
				+          }
			
 
				+        }
			
 
				+
			
 
				+        i = i - 1;
			
 
				+      }
			
 
				+    } else {
			
 
				+      // Search from left to right (lowest tick index first)
			
 
				+      let i = 0;
			
 
				+      while (i < TICK_ARRAY_SIZE) {
			
 
				+        const physicalIndex = dynTickArray.tickOffsetIndex[i];
			
 
				+
			
 
				+        if (physicalIndex > 0) {
			
 
				+          const tick = dynTickArray.ticks[physicalIndex - 1];
			
 
				+          if (tick.liquidityGross.gtn(0)) {
			
 
				+            return tick;
			
 
				+          }
			
 
				+        }
			
 
				+
			
 
				+        i = i + 1;
			
 
				+      }
			
 
				+    }
			
 
				+
			
 
				+    throw Error(`firstInitializedTick check error: ${dynTickArray} - ${zeroForOne}`);
			
 
				+  }
			
 
				+
			
 
				+  public static getPriceAndTick({
			
 
				+    poolInfo,
			
 
				+    price,
			
 
				+    baseIn,
			
 
				+  }: {
			
 
				+    poolInfo: IPoolLayout;
			
 
				+    price: Decimal;
			
 
				+    baseIn: boolean;
			
 
				+  }): ReturnTypeGetPriceAndTick {
			
 
				+    const _price = baseIn ? price : new Decimal(1).div(price);
			
 
				+
			
 
				+    const tick = TickMath.getTickWithPriceAndTickspacing(
			
 
				+      _price,
			
 
				+      poolInfo.tickSpacing,
			
 
				+      poolInfo.mintDecimalsA,
			
 
				+      poolInfo.mintDecimalsB
			
 
				+    );
			
 
				+    const tickSqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+    const tickPrice = SqrtPriceMath.sqrtPriceX64ToPrice(
			
 
				+      tickSqrtPriceX64,
			
 
				+      poolInfo.mintDecimalsA,
			
 
				+      poolInfo.mintDecimalsB
			
 
				+    );
			
 
				+
			
 
				+    return baseIn ? { tick, price: tickPrice } : { tick, price: new Decimal(1).div(tickPrice) };
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export declare type PoolVars = {
			
 
				+  key: PublicKey;
			
 
				+  tokenA: PublicKey;
			
 
				+  tokenB: PublicKey;
			
 
				+  fee: number;
			
 
				+};
			
 
				+
			
 
				+export class TickQuery {
			
 
				+  /**
			
 
				+   * Find the next initialized TickArray
			
 
				+   */
			
 
				+  public static nextInitializedTickArray(
			
 
				+    tickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean,
			
 
				+    tickArrayBitmap: BN[],
			
 
				+    exBitmapInfo: TickArrayBitmapExtensionType
			
 
				+  ): {
			
 
				+    isExist: boolean;
			
 
				+    nextStartIndex: number;
			
 
				+  } {
			
 
				+    // First, include the array that contains tickIndex itself if initialized (handles boundary inclusively)
			
 
				+    const startIndex = TickQuery.getArrayStartIndex(tickIndex, tickSpacing);
			
 
				+    const merged = TickUtils.mergeTickArrayBitmap(tickArrayBitmap);
			
 
				+    try {
			
 
				+      const { isInitialized } = TickUtils.checkTickArrayIsInitialized(merged, startIndex, tickSpacing);
			
 
				+      if (isInitialized) return { isExist: true, nextStartIndex: startIndex };
			
 
				+    } catch {
			
 
				+      /* ignore */
			
 
				+    }
			
 
				+    try {
			
 
				+      const { isInitialized } = TickArrayBitmapExtensionUtils.checkTickArrayIsInit(
			
 
				+        startIndex,
			
 
				+        tickSpacing,
			
 
				+        exBitmapInfo
			
 
				+      );
			
 
				+      if (isInitialized) return { isExist: true, nextStartIndex: startIndex };
			
 
				+    } catch {
			
 
				+      /* ignore */
			
 
				+    }
			
 
				+
			
 
				+    // Otherwise, search outward in the given direction
			
 
				+    const currentOffset = TickUtils.getTickArrayBitIndex(tickIndex, tickSpacing);
			
 
				+    const result: number[] = zeroForOne
			
 
				+      ? TickUtils.searchLowBitFromStart(tickArrayBitmap, exBitmapInfo, currentOffset - 1, 1, tickSpacing)
			
 
				+      : TickUtils.searchHightBitFromStart(tickArrayBitmap, exBitmapInfo, currentOffset + 1, 1, tickSpacing);
			
 
				+
			
 
				+    return result.length > 0 ? { isExist: true, nextStartIndex: result[0] } : { isExist: false, nextStartIndex: 0 };
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the start index of the TickArray corresponding to the given tick index
			
 
				+  public static getArrayStartIndex(tickIndex: number, tickSpacing: number): number {
			
 
				+    const ticksInArray = this.tickCount(tickSpacing);
			
 
				+    const start = Math.floor(tickIndex / ticksInArray);
			
 
				+
			
 
				+    return start * ticksInArray;
			
 
				+  }
			
 
				+
			
 
				+  // Check if the given tick index is a valid start index
			
 
				+  public static checkIsValidStartIndex(tickIndex: number, tickSpacing: number): boolean {
			
 
				+    if (TickUtils.checkIsOutOfBoundary(tickIndex)) {
			
 
				+      if (tickIndex > MAX_TICK) {
			
 
				+        return false;
			
 
				+      }
			
 
				+      // In extreme scenarios, tickIndex may be less than MIN_TICK
			
 
				+      const minStartIndex = TickUtils.getTickArrayStartIndexByTick(MIN_TICK, tickSpacing);
			
 
				+      return tickIndex == minStartIndex;
			
 
				+    }
			
 
				+    return tickIndex % this.tickCount(tickSpacing) == 0;
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the number of ticks contained in one tickarray
			
 
				+  public static tickCount(tickSpacing: number): number {
			
 
				+    return TICK_ARRAY_SIZE * tickSpacing;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/tickArrayUtils.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/tickArrayUtils.ts
@@ -0,0 +1,189 @@
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { DYN_TICK_ARRAY_HEADER_LEN, TICK_STATE_LEN } from '../../constants.js';
			
 
				+import { DynTickArrayLayout, TickArrayLayout, TickStateLayout } from '../layout.js';
			
 
				+
			
 
				+import { Tick, DynTickArray, TickArrayContainer } from './models.js';
			
 
				+import { TickUtils } from './tick.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+/**
			
 
				+ * Tick Array 工具类
			
 
				+ * 处理固定和动态 Tick Array 的统一操作
			
 
				+ */
			
 
				+export class TickArrayUtils {
			
 
				+  /**
			
 
				+   * Discriminator 常量
			
 
				+   * 这些值通过 Anchor 框架自动生成（SHA256("account:<StructName>") 的前 8 字节）
			
 
				+   */
			
 
				+  private static readonly FIXED_TICK_ARRAY_DISCRIMINATOR = Buffer.from('c09b55cd31f9812a', 'hex');
			
 
				+  private static readonly DYN_TICK_ARRAY_DISCRIMINATOR = Buffer.from('6a8b98247599b838', 'hex');
			
 
				+
			
 
				+  /**
			
 
				+   * 识别 Tick Array 的类型
			
 
				+   * @param accountData 账户数据
			
 
				+   * @returns 'Fixed' 或 'Dynamic'
			
 
				+   */
			
 
				+  public static identifyTickArrayType(accountData: Buffer): 'Fixed' | 'Dynamic' {
			
 
				+    if (accountData.length < 8) {
			
 
				+      throw new Error('Invalid tick array data: too short to contain discriminator');
			
 
				+    }
			
 
				+
			
 
				+    const discriminator = accountData.slice(0, 8);
			
 
				+
			
 
				+    if (discriminator.equals(this.FIXED_TICK_ARRAY_DISCRIMINATOR)) {
			
 
				+      return 'Fixed';
			
 
				+    } else if (discriminator.equals(this.DYN_TICK_ARRAY_DISCRIMINATOR)) {
			
 
				+      return 'Dynamic';
			
 
				+    } else {
			
 
				+      throw new Error(
			
 
				+        `Unknown tick array discriminator: ${discriminator.toString('hex')}. ` +
			
 
				+          `Expected Fixed: ${this.FIXED_TICK_ARRAY_DISCRIMINATOR.toString('hex')} ` +
			
 
				+          `or Dynamic: ${this.DYN_TICK_ARRAY_DISCRIMINATOR.toString('hex')}`,
			
 
				+      );
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * 解码动态 Tick Array
			
 
				+   * @param accountData 账户数据
			
 
				+   * @param address 账户地址（可选）
			
 
				+   * @returns DynTickArray
			
 
				+   */
			
 
				+  public static decodeDynTickArray(accountData: Buffer, address?: PublicKey): DynTickArray {
			
 
				+    // DynTickArrayState Header 长度：8 (discriminator) + 208 (struct) = 216 bytes
			
 
				+
			
 
				+    if (accountData.length < DYN_TICK_ARRAY_HEADER_LEN) {
			
 
				+      throw new Error(
			
 
				+        `Invalid dyn tick array data: expected at least ${DYN_TICK_ARRAY_HEADER_LEN} bytes, got ${accountData.length}`,
			
 
				+      );
			
 
				+    }
			
 
				+
			
 
				+    // 1. 解析 header
			
 
				+    const headerData = accountData.slice(0, DYN_TICK_ARRAY_HEADER_LEN);
			
 
				+    const header = DynTickArrayLayout.decode(headerData);
			
 
				+
			
 
				+    // 2. 验证数据长度
			
 
				+    const expectedSize = DYN_TICK_ARRAY_HEADER_LEN + header.allocTickCount * TICK_STATE_LEN;
			
 
				+    if (accountData.length !== expectedSize) {
			
 
				+      throw new Error(`Invalid dyn tick array data size: expected ${expectedSize} bytes, got ${accountData.length}`);
			
 
				+    }
			
 
				+
			
 
				+    // 3. 解析 TickState 数组
			
 
				+    const ticksData = accountData.slice(DYN_TICK_ARRAY_HEADER_LEN);
			
 
				+    const ticks: Tick[] = [];
			
 
				+
			
 
				+    for (let i = 0; i < header.allocTickCount; i++) {
			
 
				+      const offset = i * TICK_STATE_LEN;
			
 
				+      const tickData = ticksData.slice(offset, offset + TICK_STATE_LEN);
			
 
				+      const tick = TickStateLayout.decode(tickData);
			
 
				+      ticks.push(tick);
			
 
				+    }
			
 
				+
			
 
				+    // 4. 构建结果
			
 
				+    return {
			
 
				+      address: address || PublicKey.default,
			
 
				+      poolId: header.poolId,
			
 
				+      startTickIndex: header.startTickIndex,
			
 
				+      tickOffsetIndex: Array.from(header.tickOffsetIndex),
			
 
				+      allocTickCount: header.allocTickCount,
			
 
				+      initializedTickCount: header.initializedTickCount,
			
 
				+      ticks,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * 从容器中获取 Tick State
			
 
				+   * @param container TickArrayContainer
			
 
				+   * @param tickIndex Tick 索引
			
 
				+   * @param tickSpacing Tick 间距
			
 
				+   * @returns Tick 或 null（如果未分配）
			
 
				+   */
			
 
				+  public static getTickStateFromContainer(
			
 
				+    container: TickArrayContainer,
			
 
				+    tickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+  ): Tick | null {
			
 
				+    if (container.type === 'Fixed') {
			
 
				+      // 固定 Tick Array: 直接数组访问
			
 
				+      const offset = TickUtils.getTickOffsetInArray(tickIndex, tickSpacing);
			
 
				+      return container.data.ticks[offset];
			
 
				+    } else {
			
 
				+      // 动态 Tick Array: 通过映射表访问
			
 
				+      return this.getTickStateFromDynArray(container.data, tickIndex, tickSpacing);
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * 从动态 Tick Array 中获取 Tick State
			
 
				+   * @param dynTickArray DynTickArray
			
 
				+   * @param tickIndex Tick 索引
			
 
				+   * @param tickSpacing Tick 间距
			
 
				+   * @returns Tick 或 null（如果未分配）
			
 
				+   */
			
 
				+  private static getTickStateFromDynArray(
			
 
				+    dynTickArray: DynTickArray,
			
 
				+    tickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+  ): Tick | null {
			
 
				+    // 1. 计算逻辑偏移 (0-59)
			
 
				+    const logicalOffset = TickUtils.getTickOffsetInArray(tickIndex, tickSpacing);
			
 
				+
			
 
				+    // 2. 查映射表
			
 
				+    const physicalIndexPlusOne = dynTickArray.tickOffsetIndex[logicalOffset];
			
 
				+
			
 
				+    // 3. 检查是否已分配
			
 
				+    if (physicalIndexPlusOne === 0) {
			
 
				+      return null; // 未分配
			
 
				+    }
			
 
				+
			
 
				+    // 4. 计算实际索引 (position + 1 - 1 = position)
			
 
				+    const actualIndex = physicalIndexPlusOne - 1;
			
 
				+
			
 
				+    // 5. 边界检查
			
 
				+    if (actualIndex >= dynTickArray.ticks.length) {
			
 
				+      throw new Error(
			
 
				+        `Tick state index out of bounds: ${actualIndex} >= ${dynTickArray.ticks.length}. ` +
			
 
				+          `This indicates corrupted tick array data.`,
			
 
				+      );
			
 
				+    }
			
 
				+
			
 
				+    return dynTickArray.ticks[actualIndex];
			
 
				+  }
			
 
				+
			
 
				+  /**
			
 
				+   * Parse tick array account data into a container
			
 
				+   * Supports both fixed and dynamic tick arrays
			
 
				+   * @private
			
 
				+   */
			
 
				+  public static parseTickArrayContainer(accountData: Buffer, address: PublicKey): TickArrayContainer {
			
 
				+    const tickArrayType = this.identifyTickArrayType(accountData);
			
 
				+
			
 
				+    if (tickArrayType === 'Fixed') {
			
 
				+      const decoded = TickArrayLayout.decode(accountData);
			
 
				+      return {
			
 
				+        type: 'Fixed',
			
 
				+        data: {
			
 
				+          address,
			
 
				+          poolId: decoded.poolId,
			
 
				+          startTickIndex: decoded.startTickIndex,
			
 
				+          ticks: decoded.ticks.map((tick: any) => ({
			
 
				+            tick: tick.tick,
			
 
				+            liquidityNet: new BN(tick.liquidityNet.toString()),
			
 
				+            liquidityGross: new BN(tick.liquidityGross.toString()),
			
 
				+            feeGrowthOutsideX64A: new BN(tick.feeGrowthOutsideX64A.toString()),
			
 
				+            feeGrowthOutsideX64B: new BN(tick.feeGrowthOutsideX64B.toString()),
			
 
				+            rewardGrowthsOutsideX64: tick.rewardGrowthsOutsideX64.map((r: any) => new BN(r.toString())),
			
 
				+          })),
			
 
				+          initializedTickCount: decoded.initializedTickCount,
			
 
				+        },
			
 
				+      };
			
 
				+    } else {
			
 
				+      const decoded = this.decodeDynTickArray(accountData, address);
			
 
				+      return {
			
 
				+        type: 'Dynamic',
			
 
				+        data: decoded,
			
 
				+      };
			
 
				+    }
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/tickMath.test.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/tickMath.test.ts
@@ -0,0 +1,227 @@
 
				+import { Decimal } from 'decimal.js';
			
 
				+import { describe, test, expect } from 'vitest';
			
 
				+
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+import { TickMath } from './tickMath.js';
			
 
				+
			
 
				+describe('TickMath basic functionality test', () => {
			
 
				+  test('getTickWithPriceAndTickspacing basic functionality', () => {
			
 
				+    const priceList = [
			
 
				+      new Decimal('0.001'),
			
 
				+      new Decimal('0.01'),
			
 
				+      new Decimal('0.1'),
			
 
				+      new Decimal('1'),
			
 
				+      new Decimal('10'),
			
 
				+      new Decimal('100'),
			
 
				+      new Decimal('1000'),
			
 
				+      new Decimal('10000'),
			
 
				+    ];
			
 
				+
			
 
				+    const tickSpacing = 10;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    for (const price of priceList) {
			
 
				+      const tick = TickMath.getTickWithPriceAndTickspacing(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+      expect(Math.abs(tick % tickSpacing)).toBe(0);
			
 
				+    }
			
 
				+  });
			
 
				+
			
 
				+  test('getPriceFromTick basic functionality', () => {
			
 
				+    const tick = 100;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    const price = TickMath.getPriceFromTick({ tick, decimalsA, decimalsB });
			
 
				+
			
 
				+    // Verify that the price is positive
			
 
				+    expect(price.isPositive()).toBeTruthy();
			
 
				+  });
			
 
				+
			
 
				+  test('getTickAlignedPriceDetails returns the correct structure', () => {
			
 
				+    const price = new Decimal('1.5');
			
 
				+    const tickSpacing = 10;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    const details = TickMath.getTickAlignedPriceDetails(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+    // Verify that the returned object contains all necessary fields
			
 
				+    expect(details).toHaveProperty('tick');
			
 
				+    expect(details).toHaveProperty('sqrtPriceX64');
			
 
				+    expect(details).toHaveProperty('price');
			
 
				+    expect(details.tick % tickSpacing).toBe(0);
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('TickMath rounding behavior test', () => {
			
 
				+  test('positive tick rounding up', () => {
			
 
				+    // Select a positive tick that is not a multiple of tickSpacing
			
 
				+    const originalTick = 15;
			
 
				+
			
 
				+    const tickSpacing = 10;
			
 
				+    const decimalsA = 9;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    const price = TickMath.getPriceFromTick({ tick: originalTick, decimalsA, decimalsB });
			
 
				+    const alignedTick = TickMath.getTickWithPriceAndTickspacing(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+    expect(alignedTick).toBe(20);
			
 
				+  });
			
 
				+
			
 
				+  test('negative tick rounding down', () => {
			
 
				+    // Similar to above, but using a negative tick
			
 
				+    const originalTick = -15;
			
 
				+
			
 
				+    const tickSpacing = 10;
			
 
				+    const decimalsA = 9;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    const price = TickMath.getPriceFromTick({ tick: originalTick, decimalsA, decimalsB });
			
 
				+    const alignedTick = TickMath.getTickWithPriceAndTickspacing(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+    // 负数应该向下舍入到 -20
			
 
				+    expect(alignedTick).toBe(-20);
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('TickMath boundary condition test', () => {
			
 
				+  test('extreme price values', () => {
			
 
				+    const extremePrices = [
			
 
				+      new Decimal('0.0000001'), // Very small price
			
 
				+      new Decimal('1000000'), // Very large price
			
 
				+    ];
			
 
				+
			
 
				+    const tickSpacing = 60;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    for (const price of extremePrices) {
			
 
				+      const tick = TickMath.getTickWithPriceAndTickspacing(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Verify that the tick is a multiple of tickSpacing
			
 
				+      expect(Math.abs(tick % tickSpacing)).toBe(0);
			
 
				+
			
 
				+      // Verify that there is no exception when converting back from tick to price
			
 
				+      const details = TickMath.getTickAlignedPriceDetails(price, tickSpacing, decimalsA, decimalsB);
			
 
				+      expect(details.price.isPositive()).toBeTruthy();
			
 
				+    }
			
 
				+  });
			
 
				+
			
 
				+  test('different tickSpacing values', () => {
			
 
				+    const price = new Decimal('1.5');
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    const tickSpacings = [1, 10, 60, 200];
			
 
				+
			
 
				+    for (const spacing of tickSpacings) {
			
 
				+      const tick = TickMath.getTickWithPriceAndTickspacing(price, spacing, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Verify that the tick is a multiple of tickSpacing
			
 
				+      expect(tick % spacing).toBe(0);
			
 
				+
			
 
				+      // Verify that the difference between the original tick and the aligned tick should not exceed tickSpacing
			
 
				+      const originalTick = SqrtPriceMath.getTickFromPrice(price, decimalsA, decimalsB);
			
 
				+      expect(Math.abs(tick - originalTick)).toBeLessThan(spacing);
			
 
				+    }
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('TickMath consistency test', () => {
			
 
				+  test('price -> tick -> price conversion consistency', () => {
			
 
				+    const testPrices = [new Decimal('0.01'), new Decimal('0.5'), new Decimal('1'), new Decimal('2'), new Decimal('10')];
			
 
				+
			
 
				+    const tickSpacing = 10;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    for (const initialPrice of testPrices) {
			
 
				+      // Get the aligned price information
			
 
				+      const details = TickMath.getTickAlignedPriceDetails(initialPrice, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Convert back from tick to price
			
 
				+      const recalculatedPrice = TickMath.getPriceFromTick({
			
 
				+        tick: details.tick,
			
 
				+        decimalsA,
			
 
				+        decimalsB,
			
 
				+      });
			
 
				+
			
 
				+      // Verify that the two price values are equal within a reasonable error range
			
 
				+      expect(details.price.toString()).toBe(recalculatedPrice.toString());
			
 
				+    }
			
 
				+  });
			
 
				+
			
 
				+  test('different decimals combinations', () => {
			
 
				+    const price = new Decimal('2.5');
			
 
				+    const tickSpacing = 60;
			
 
				+
			
 
				+    const decimalCombinations = [
			
 
				+      { decimalsA: 6, decimalsB: 6 },
			
 
				+      { decimalsA: 8, decimalsB: 6 },
			
 
				+      { decimalsA: 6, decimalsB: 8 },
			
 
				+      { decimalsA: 9, decimalsB: 18 },
			
 
				+    ];
			
 
				+
			
 
				+    for (const { decimalsA, decimalsB } of decimalCombinations) {
			
 
				+      const details = TickMath.getTickAlignedPriceDetails(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+      // Verify that the tick is a multiple of tickSpacing
			
 
				+      expect(Math.abs(details.tick % tickSpacing)).toBe(0);
			
 
				+
			
 
				+      // Verify that the magnitude of the adjusted price is similar to the original price
			
 
				+      const magnitudeDiff = Math.abs(details.price.div(price).toNumber() - 1);
			
 
				+
			
 
				+      expect(magnitudeDiff).toBeLessThan(0.01);
			
 
				+    }
			
 
				+  });
			
 
				+});
			
 
				+
			
 
				+describe('TickMath and SqrtPriceMath combination test', () => {
			
 
				+  test('getTickWithPriceAndTickspacing and SqrtPriceMath consistency', () => {
			
 
				+    const price = new Decimal('1.2345');
			
 
				+    const tickSpacing = 60;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    // Get the original tick
			
 
				+    const originalTick = SqrtPriceMath.getTickFromPrice(price, decimalsA, decimalsB);
			
 
				+
			
 
				+    // Get the aligned tick
			
 
				+    const alignedTick = TickMath.getTickWithPriceAndTickspacing(price, tickSpacing, decimalsA, decimalsB);
			
 
				+
			
 
				+    // Verify that the aligned tick is the closest multiple of tickSpacing to the original tick
			
 
				+    const expectedAlignedTick =
			
 
				+      originalTick >= 0
			
 
				+        ? Math.ceil(originalTick / tickSpacing) * tickSpacing
			
 
				+        : Math.floor(originalTick / tickSpacing) * tickSpacing;
			
 
				+
			
 
				+    expect(alignedTick).toBe(expectedAlignedTick);
			
 
				+  });
			
 
				+
			
 
				+  test('the effect of baseIn parameter on price calculation', () => {
			
 
				+    const tick = 100;
			
 
				+    const decimalsA = 6;
			
 
				+    const decimalsB = 6;
			
 
				+
			
 
				+    // baseIn = true
			
 
				+    const priceBaseIn = TickMath.getPriceFromTick({
			
 
				+      tick,
			
 
				+      decimalsA,
			
 
				+      decimalsB,
			
 
				+      baseIn: true,
			
 
				+    });
			
 
				+
			
 
				+    // baseIn = false
			
 
				+    const priceBaseOut = TickMath.getPriceFromTick({
			
 
				+      tick,
			
 
				+      decimalsA,
			
 
				+      decimalsB,
			
 
				+      baseIn: false,
			
 
				+    });
			
 
				+
			
 
				+    // Verify that the price when baseIn = false should be the reciprocal of the price when baseIn = true
			
 
				+    expect(priceBaseIn.mul(priceBaseOut).toNumber()).toBeCloseTo(1, 0.00001);
			
 
				+  });
			
 
				+});
			
--- a/src/lib/clmm-sdk/src/instructions/utils/tickMath.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/tickMath.ts
@@ -0,0 +1,60 @@
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { SqrtPriceMath } from './sqrtPriceMath.js';
			
 
				+
			
 
				+export interface TickAlignedPriceDetails {
			
 
				+  tick: number;
			
 
				+  sqrtPriceX64: BN;
			
 
				+  price: Decimal;
			
 
				+}
			
 
				+export class TickMath {
			
 
				+  // Convert price to tick
			
 
				+  public static getTickWithPriceAndTickspacing(
			
 
				+    price: Decimal,
			
 
				+    tickSpacing: number,
			
 
				+    mintDecimalsA: number,
			
 
				+    mintDecimalsB: number
			
 
				+  ): number {
			
 
				+    const tick = SqrtPriceMath.getTickFromSqrtPriceX64(
			
 
				+      SqrtPriceMath.priceToSqrtPriceX64(price, mintDecimalsA, mintDecimalsB)
			
 
				+    );
			
 
				+    let result = tick / tickSpacing;
			
 
				+    if (result < 0) {
			
 
				+      result = Math.floor(result);
			
 
				+    } else {
			
 
				+      result = Math.ceil(result);
			
 
				+    }
			
 
				+    return result * tickSpacing;
			
 
				+  }
			
 
				+
			
 
				+  public static getPriceFromTick(params: {
			
 
				+    tick: number;
			
 
				+    decimalsA: number;
			
 
				+    decimalsB: number;
			
 
				+    baseIn?: boolean;
			
 
				+  }): Decimal {
			
 
				+    const { tick, decimalsA, decimalsB, baseIn = true } = params;
			
 
				+    const tickSqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+    const tickPrice = SqrtPriceMath.sqrtPriceX64ToPrice(tickSqrtPriceX64, decimalsA, decimalsB);
			
 
				+
			
 
				+    return baseIn ? tickPrice : new Decimal(1).div(tickPrice);
			
 
				+  }
			
 
				+
			
 
				+  // Align price to the nearest valid tick and return related data
			
 
				+  public static getTickAlignedPriceDetails(
			
 
				+    price: Decimal,
			
 
				+    tickSpacing: number,
			
 
				+    mintDecimalsA: number,
			
 
				+    mintDecimalsB: number
			
 
				+  ): TickAlignedPriceDetails {
			
 
				+    const tick = TickMath.getTickWithPriceAndTickspacing(price, tickSpacing, mintDecimalsA, mintDecimalsB);
			
 
				+    const sqrtPriceX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tick);
			
 
				+    const roundedPrice = SqrtPriceMath.sqrtPriceX64ToPrice(sqrtPriceX64, mintDecimalsA, mintDecimalsB);
			
 
				+    return {
			
 
				+      tick,
			
 
				+      sqrtPriceX64,
			
 
				+      price: roundedPrice,
			
 
				+    };
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/tickarrayBitmap.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/tickarrayBitmap.ts
@@ -0,0 +1,227 @@
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { TICK_ARRAY_BITMAP_SIZE, TICK_ARRAY_SIZE } from '../../constants.js';
			
 
				+import { MAX_TICK, MIN_TICK } from '../constants.js';
			
 
				+import { TickArrayBitmapExtensionType } from './models.js';
			
 
				+
			
 
				+import { isZero, leadingZeros, leastSignificantBit, mostSignificantBit, trailingZeros } from './binaryUtils.js';
			
 
				+import { TickUtils, TickQuery } from './tick.js';
			
 
				+
			
 
				+export class TickArrayBitmap {
			
 
				+  // Calculate the maximum tick range that a single bitmap can represent
			
 
				+  public static maxTickInTickarrayBitmap(tickSpacing: number): number {
			
 
				+    return tickSpacing * TICK_ARRAY_SIZE * TICK_ARRAY_BITMAP_SIZE;
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the bitmap boundaries corresponding to the given tick range
			
 
				+  public static getBitmapTickBoundary(
			
 
				+    tickarrayStartIndex: number,
			
 
				+    tickSpacing: number
			
 
				+  ): {
			
 
				+    minValue: number;
			
 
				+    maxValue: number;
			
 
				+  } {
			
 
				+    const ticksInOneBitmap = this.maxTickInTickarrayBitmap(tickSpacing);
			
 
				+    let m = Math.floor(Math.abs(tickarrayStartIndex) / ticksInOneBitmap);
			
 
				+    if (tickarrayStartIndex < 0 && Math.abs(tickarrayStartIndex) % ticksInOneBitmap != 0) m += 1;
			
 
				+
			
 
				+    const minValue = ticksInOneBitmap * m;
			
 
				+
			
 
				+    return tickarrayStartIndex < 0
			
 
				+      ? { minValue: -minValue, maxValue: -minValue + ticksInOneBitmap }
			
 
				+      : { minValue, maxValue: minValue + ticksInOneBitmap };
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the start index of the next initialized TickArray
			
 
				+  public static nextInitializedTickArrayStartIndex(
			
 
				+    bitMap: BN,
			
 
				+    lastTickArrayStartIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean
			
 
				+  ): { isInit: boolean; tickIndex: number } {
			
 
				+    if (!TickQuery.checkIsValidStartIndex(lastTickArrayStartIndex, tickSpacing))
			
 
				+      throw Error('nextInitializedTickArrayStartIndex check error');
			
 
				+
			
 
				+    const tickBoundary = this.maxTickInTickarrayBitmap(tickSpacing);
			
 
				+    const nextTickArrayStartIndex = zeroForOne
			
 
				+      ? lastTickArrayStartIndex - TickQuery.tickCount(tickSpacing)
			
 
				+      : lastTickArrayStartIndex + TickQuery.tickCount(tickSpacing);
			
 
				+
			
 
				+    if (nextTickArrayStartIndex < -tickBoundary || nextTickArrayStartIndex >= tickBoundary) {
			
 
				+      return { isInit: false, tickIndex: lastTickArrayStartIndex };
			
 
				+    }
			
 
				+
			
 
				+    const multiplier = tickSpacing * TICK_ARRAY_SIZE;
			
 
				+    let compressed = nextTickArrayStartIndex / multiplier + 512;
			
 
				+
			
 
				+    if (nextTickArrayStartIndex < 0 && nextTickArrayStartIndex % multiplier != 0) {
			
 
				+      compressed--;
			
 
				+    }
			
 
				+
			
 
				+    const bitPos = Math.abs(compressed);
			
 
				+
			
 
				+    if (zeroForOne) {
			
 
				+      const offsetBitMap = bitMap.shln(1024 - bitPos - 1);
			
 
				+      const nextBit = mostSignificantBit(1024, offsetBitMap);
			
 
				+      if (nextBit !== null) {
			
 
				+        const nextArrayStartIndex = (bitPos - nextBit - 512) * multiplier;
			
 
				+        return { isInit: true, tickIndex: nextArrayStartIndex };
			
 
				+      } else {
			
 
				+        return { isInit: false, tickIndex: -tickBoundary };
			
 
				+      }
			
 
				+    } else {
			
 
				+      const offsetBitMap = bitMap.shrn(bitPos);
			
 
				+      const nextBit = leastSignificantBit(1024, offsetBitMap);
			
 
				+      if (nextBit !== null) {
			
 
				+        const nextArrayStartIndex = (bitPos + nextBit - 512) * multiplier;
			
 
				+        return { isInit: true, tickIndex: nextArrayStartIndex };
			
 
				+      } else {
			
 
				+        return { isInit: false, tickIndex: tickBoundary - TickQuery.tickCount(tickSpacing) };
			
 
				+      }
			
 
				+    }
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export class TickArrayBitmapExtensionUtils {
			
 
				+  public static getBitmapOffset(tickIndex: number, tickSpacing: number): number {
			
 
				+    if (!TickQuery.checkIsValidStartIndex(tickIndex, tickSpacing)) {
			
 
				+      throw new Error('No enough initialized tickArray');
			
 
				+    }
			
 
				+
			
 
				+    const { positiveTickBoundary, negativeTickBoundary } = this.extensionTickBoundary(tickSpacing);
			
 
				+
			
 
				+    if (tickIndex >= negativeTickBoundary && tickIndex < positiveTickBoundary) {
			
 
				+      throw Error('checkExtensionBoundary -> InvalidTickArrayBoundary');
			
 
				+    }
			
 
				+
			
 
				+    const ticksInOneBitmap = TickArrayBitmap.maxTickInTickarrayBitmap(tickSpacing);
			
 
				+    let offset = Math.floor(Math.abs(tickIndex) / ticksInOneBitmap) - 1;
			
 
				+
			
 
				+    if (tickIndex < 0 && Math.abs(tickIndex) % ticksInOneBitmap === 0) offset--;
			
 
				+    return offset;
			
 
				+  }
			
 
				+
			
 
				+  public static getBitmap(
			
 
				+    tickIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    tickArrayBitmapExtension: TickArrayBitmapExtensionType
			
 
				+  ): { offset: number; tickarrayBitmap: BN[] } {
			
 
				+    const offset = this.getBitmapOffset(tickIndex, tickSpacing);
			
 
				+    if (tickIndex < 0) {
			
 
				+      return { offset, tickarrayBitmap: tickArrayBitmapExtension.negativeTickArrayBitmap[offset] };
			
 
				+    } else {
			
 
				+      return { offset, tickarrayBitmap: tickArrayBitmapExtension.positiveTickArrayBitmap[offset] };
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the boundary values of the extended bitmap
			
 
				+  public static extensionTickBoundary(tickSpacing: number): {
			
 
				+    positiveTickBoundary: number;
			
 
				+    negativeTickBoundary: number;
			
 
				+  } {
			
 
				+    const positiveTickBoundary = TickArrayBitmap.maxTickInTickarrayBitmap(tickSpacing);
			
 
				+
			
 
				+    const negativeTickBoundary = -positiveTickBoundary;
			
 
				+
			
 
				+    if (MAX_TICK <= positiveTickBoundary)
			
 
				+      throw Error(`extensionTickBoundary check error: ${MAX_TICK}, ${positiveTickBoundary}`);
			
 
				+    if (negativeTickBoundary <= MIN_TICK)
			
 
				+      throw Error(`extensionTickBoundary check error: ${negativeTickBoundary}, ${MIN_TICK}`);
			
 
				+
			
 
				+    return { positiveTickBoundary, negativeTickBoundary };
			
 
				+  }
			
 
				+
			
 
				+  // Check if a specific TickArray has been initialized
			
 
				+  public static checkTickArrayIsInit(
			
 
				+    tickArrayStartIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    tickArrayBitmapExtension: TickArrayBitmapExtensionType
			
 
				+  ): { isInitialized: boolean; startIndex: number } {
			
 
				+    const { tickarrayBitmap } = this.getBitmap(tickArrayStartIndex, tickSpacing, tickArrayBitmapExtension);
			
 
				+
			
 
				+    const tickArrayOffsetInBitmap = this.tickArrayOffsetInBitmap(tickArrayStartIndex, tickSpacing);
			
 
				+
			
 
				+    return {
			
 
				+      isInitialized: TickUtils.mergeTickArrayBitmap(tickarrayBitmap).testn(tickArrayOffsetInBitmap),
			
 
				+      startIndex: tickArrayStartIndex,
			
 
				+    };
			
 
				+  }
			
 
				+
			
 
				+  // Find the start index of the next initialized TickArray from a single bitmap
			
 
				+  public static nextInitializedTickArrayFromOneBitmap(
			
 
				+    lastTickArrayStartIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean,
			
 
				+    tickArrayBitmapExtension: TickArrayBitmapExtensionType
			
 
				+  ): {
			
 
				+    isInit: boolean;
			
 
				+    tickIndex: number;
			
 
				+  } {
			
 
				+    const multiplier = TickQuery.tickCount(tickSpacing);
			
 
				+    const nextTickArrayStartIndex = zeroForOne
			
 
				+      ? lastTickArrayStartIndex - multiplier
			
 
				+      : lastTickArrayStartIndex + multiplier;
			
 
				+    const { tickarrayBitmap } = this.getBitmap(nextTickArrayStartIndex, tickSpacing, tickArrayBitmapExtension);
			
 
				+
			
 
				+    return this.nextInitializedTickArrayInBitmap(tickarrayBitmap, nextTickArrayStartIndex, tickSpacing, zeroForOne);
			
 
				+  }
			
 
				+
			
 
				+  // Find the start index of the next initialized TickArray in the bitmap
			
 
				+  public static nextInitializedTickArrayInBitmap(
			
 
				+    tickarrayBitmap: BN[],
			
 
				+    nextTickArrayStartIndex: number,
			
 
				+    tickSpacing: number,
			
 
				+    zeroForOne: boolean
			
 
				+  ): {
			
 
				+    isInit: boolean;
			
 
				+    tickIndex: number;
			
 
				+  } {
			
 
				+    const { minValue: bitmapMinTickBoundary, maxValue: bitmapMaxTickBoundary } = TickArrayBitmap.getBitmapTickBoundary(
			
 
				+      nextTickArrayStartIndex,
			
 
				+      tickSpacing
			
 
				+    );
			
 
				+
			
 
				+    const tickArrayOffsetInBitmap = this.tickArrayOffsetInBitmap(nextTickArrayStartIndex, tickSpacing);
			
 
				+    if (zeroForOne) {
			
 
				+      // tick from upper to lower
			
 
				+      // find from highter bits to lower bits
			
 
				+      const offsetBitMap = TickUtils.mergeTickArrayBitmap(tickarrayBitmap).shln(
			
 
				+        TICK_ARRAY_BITMAP_SIZE - 1 - tickArrayOffsetInBitmap
			
 
				+      );
			
 
				+
			
 
				+      const nextBit = isZero(512, offsetBitMap) ? null : leadingZeros(512, offsetBitMap);
			
 
				+
			
 
				+      if (nextBit !== null) {
			
 
				+        const nextArrayStartIndex = nextTickArrayStartIndex - nextBit * TickQuery.tickCount(tickSpacing);
			
 
				+        return { isInit: true, tickIndex: nextArrayStartIndex };
			
 
				+      } else {
			
 
				+        // not found til to the end
			
 
				+        return { isInit: false, tickIndex: bitmapMinTickBoundary };
			
 
				+      }
			
 
				+    } else {
			
 
				+      // tick from lower to upper
			
 
				+      // find from lower bits to highter bits
			
 
				+      const offsetBitMap = TickUtils.mergeTickArrayBitmap(tickarrayBitmap).shrn(tickArrayOffsetInBitmap);
			
 
				+
			
 
				+      const nextBit = isZero(512, offsetBitMap) ? null : trailingZeros(512, offsetBitMap);
			
 
				+
			
 
				+      if (nextBit !== null) {
			
 
				+        const nextArrayStartIndex = nextTickArrayStartIndex + nextBit * TickQuery.tickCount(tickSpacing);
			
 
				+        return { isInit: true, tickIndex: nextArrayStartIndex };
			
 
				+      } else {
			
 
				+        // not found til to the end
			
 
				+        return { isInit: false, tickIndex: bitmapMaxTickBoundary - TickQuery.tickCount(tickSpacing) };
			
 
				+      }
			
 
				+    }
			
 
				+  }
			
 
				+
			
 
				+  // Calculate the offset position (index) of a TickArray within its belonging bitmap
			
 
				+  public static tickArrayOffsetInBitmap(tickArrayStartIndex: number, tickSpacing: number): number {
			
 
				+    const m = Math.abs(tickArrayStartIndex) % TickArrayBitmap.maxTickInTickarrayBitmap(tickSpacing);
			
 
				+    let tickArrayOffsetInBitmap = Math.floor(m / TickQuery.tickCount(tickSpacing));
			
 
				+    if (tickArrayStartIndex < 0 && m != 0) {
			
 
				+      tickArrayOffsetInBitmap = TICK_ARRAY_BITMAP_SIZE - tickArrayOffsetInBitmap;
			
 
				+    }
			
 
				+    return tickArrayOffsetInBitmap;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/instructions/utils/transfer.ts
+++ b/src/lib/clmm-sdk/src/instructions/utils/transfer.ts
@@ -0,0 +1,97 @@
 
				+import { TransferFee } from '@solana/spl-token';
			
 
				+import { EpochInfo } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { TransferFeeDataBaseType, IGetTransferAmountFee } from '../models.js';
			
 
				+
			
 
				+const POINT = 10_000;
			
 
				+
			
 
				+// This function is a specialized utility function for calculating transfer fees and final amounts for Token-2022 token transfers. It handles the transfer fee feature introduced in the Solana Token-2022 program, calculating precise transfer amounts and fees based on the current epoch and fee configuration
			
 
				+export function getTransferAmountFee(
			
 
				+  amount: BN,
			
 
				+  _feeConfig: TransferFeeDataBaseType | undefined,
			
 
				+  epochInfo: EpochInfo,
			
 
				+  addFee: boolean
			
 
				+): IGetTransferAmountFee {
			
 
				+  if (_feeConfig === undefined) {
			
 
				+    return {
			
 
				+      amount,
			
 
				+      fee: undefined,
			
 
				+      expirationTime: undefined,
			
 
				+    };
			
 
				+  }
			
 
				+  const feeConfig = {
			
 
				+    ..._feeConfig,
			
 
				+    olderTransferFee: {
			
 
				+      epoch: BigInt(_feeConfig.olderTransferFee.epoch),
			
 
				+      maximumFee: BigInt(_feeConfig.olderTransferFee.maximumFee),
			
 
				+      transferFeeBasisPoints: _feeConfig.olderTransferFee.transferFeeBasisPoints,
			
 
				+    },
			
 
				+    newerTransferFee: {
			
 
				+      epoch: BigInt(_feeConfig.newerTransferFee.epoch),
			
 
				+      maximumFee: BigInt(_feeConfig.newerTransferFee.maximumFee),
			
 
				+      transferFeeBasisPoints: _feeConfig.newerTransferFee.transferFeeBasisPoints,
			
 
				+    },
			
 
				+  };
			
 
				+
			
 
				+  const nowFeeConfig: TransferFee =
			
 
				+    epochInfo.epoch < feeConfig.newerTransferFee.epoch ? feeConfig.olderTransferFee : feeConfig.newerTransferFee;
			
 
				+  const maxFee = new BN(nowFeeConfig.maximumFee.toString());
			
 
				+  const expirationTime: number | undefined =
			
 
				+    epochInfo.epoch < feeConfig.newerTransferFee.epoch
			
 
				+      ? ((Number(feeConfig.newerTransferFee.epoch) * epochInfo.slotsInEpoch - epochInfo.absoluteSlot) * 400) / 1000
			
 
				+      : undefined;
			
 
				+
			
 
				+  if (addFee) {
			
 
				+    if (nowFeeConfig.transferFeeBasisPoints === POINT) {
			
 
				+      const nowMaxFee = new BN(nowFeeConfig.maximumFee.toString());
			
 
				+      return {
			
 
				+        amount: amount.add(nowMaxFee),
			
 
				+        fee: nowMaxFee,
			
 
				+        expirationTime,
			
 
				+      };
			
 
				+    } else {
			
 
				+      const _TAmount = BNDivCeil(amount.mul(new BN(POINT)), new BN(POINT - nowFeeConfig.transferFeeBasisPoints));
			
 
				+
			
 
				+      const nowMaxFee = new BN(nowFeeConfig.maximumFee.toString());
			
 
				+      const TAmount = _TAmount.sub(amount).gt(nowMaxFee) ? amount.add(nowMaxFee) : _TAmount;
			
 
				+
			
 
				+      const _fee = BNDivCeil(TAmount.mul(new BN(nowFeeConfig.transferFeeBasisPoints)), new BN(POINT));
			
 
				+      const fee = _fee.gt(maxFee) ? maxFee : _fee;
			
 
				+      return {
			
 
				+        amount: TAmount,
			
 
				+        fee,
			
 
				+        expirationTime,
			
 
				+      };
			
 
				+    }
			
 
				+  } else {
			
 
				+    const _fee = BNDivCeil(amount.mul(new BN(nowFeeConfig.transferFeeBasisPoints)), new BN(POINT));
			
 
				+    const fee = _fee.gt(maxFee) ? maxFee : _fee;
			
 
				+
			
 
				+    return {
			
 
				+      amount,
			
 
				+      fee,
			
 
				+      expirationTime,
			
 
				+    };
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+export function minExpirationTime(
			
 
				+  expirationTime1: number | undefined,
			
 
				+  expirationTime2: number | undefined
			
 
				+): number | undefined {
			
 
				+  if (expirationTime1 === undefined) return expirationTime2;
			
 
				+  if (expirationTime2 === undefined) return expirationTime1;
			
 
				+
			
 
				+  return Math.min(expirationTime1, expirationTime2);
			
 
				+}
			
 
				+
			
 
				+export function BNDivCeil(bn1: BN, bn2: BN): BN {
			
 
				+  const { div, mod } = bn1.divmod(bn2);
			
 
				+
			
 
				+  if (mod.gt(new BN(0))) {
			
 
				+    return div.add(new BN(1));
			
 
				+  } else {
			
 
				+    return div;
			
 
				+  }
			
 
				+}
			
--- a/src/lib/clmm-sdk/src/playgrounds/01_get_raw_position_info_list.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/01_get_raw_position_info_list.ts
@@ -0,0 +1,14 @@
 
				+/**
			
 
				+ * Get the list of positions for a specified user (on-chain way)
			
 
				+ */
			
 
				+
			
 
				+import { userAddress, chain } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // Get the list of positions for a specified user
			
 
				+  console.log('userAddress =>', userAddress.toBase58());
			
 
				+  const positionList = await chain.getRawPositionInfoListByUserAddress(userAddress);
			
 
				+  console.log(positionList);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/02_get_raw_position_info.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/02_get_raw_position_info.ts
@@ -0,0 +1,17 @@
 
				+/**
			
 
				+ * Get the position information corresponding to the NFT mint address (on-chain way)
			
 
				+ */
			
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+
			
 
				+import { chain } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // Change to your own NFT mint address
			
 
				+  const nftMint = new PublicKey('2GfNC4r784awMFDW2d1RDDebTzStTY6aMr78K5Q6DGyM');
			
 
				+
			
 
				+  // Get the position information corresponding to the NFT mint address
			
 
				+  const positionInfo = await chain.getRawPositionInfoByNftMint(nftMint);
			
 
				+  console.log(positionInfo);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/03_get_raw_pool_info.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/03_get_raw_pool_info.ts
@@ -0,0 +1,13 @@
 
				+/**
			
 
				+ * Get the on-chain information of the specified pool
			
 
				+ */
			
 
				+
			
 
				+import { chain, PoolAddress } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // Get the on-chain information of the specified pool
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.SOL_USDC);
			
 
				+  console.log(poolInfo);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/04_get_position_info_list.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/04_get_position_info_list.ts
@@ -0,0 +1,42 @@
 
				+/**
			
 
				+ * Get the position information corresponding to the NFT mint address
			
 
				+ */
			
 
				+
			
 
				+import { chain, userAddress } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  console.log('userAddress ==>', userAddress.toBase58());
			
 
				+
			
 
				+  // Get the list of positions for a specified user
			
 
				+  const positionList = await chain.getRawPositionInfoListByUserAddress(userAddress);
			
 
				+
			
 
				+  const nftMints = positionList.map((position) => position.nftMint);
			
 
				+
			
 
				+  for (const nftMint of nftMints) {
			
 
				+    const positionInfo = await chain.getPositionInfoByNftMint(nftMint);
			
 
				+
			
 
				+    if (!positionInfo) continue;
			
 
				+
			
 
				+    const { uiPriceLower, uiPriceUpper, tokenA, tokenB } = positionInfo;
			
 
				+
			
 
				+    console.log(`\n=========== Position information ===========`);
			
 
				+    console.log(`NFT mint address: ${nftMint.toBase58()}`);
			
 
				+
			
 
				+    console.log(`Price range: ${uiPriceLower} - ${uiPriceUpper}`);
			
 
				+
			
 
				+    console.log(`Liquidity assets:`);
			
 
				+    console.log(
			
 
				+      `  TokenA(${positionInfo.tokenA.address.toBase58().slice(0, 4)}...${positionInfo.tokenA.address
			
 
				+        .toBase58()
			
 
				+        .slice(-4)}):`
			
 
				+    );
			
 
				+    console.log(`    • Amount: ${tokenA.uiAmount}`);
			
 
				+    console.log(`    • Fee income: ${tokenA.uiFeeAmount}`);
			
 
				+
			
 
				+    console.log(`  TokenB(${tokenB.address.toBase58().slice(0, 4)}...${tokenB.address.toBase58().slice(-4)}):`);
			
 
				+    console.log(`    • Amount: ${tokenB.uiAmount}`);
			
 
				+    console.log(`    • Fee income: ${tokenB.uiFeeAmount}`);
			
 
				+  }
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/05_align_price.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/05_align_price.ts
@@ -0,0 +1,23 @@
 
				+/**
			
 
				+ * Round the price to the price of the corresponding tick (used when creating a position)
			
 
				+ */
			
 
				+
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { chain, PoolAddress } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.SOL_USDC);
			
 
				+
			
 
				+  const userInputPriceLower = 120;
			
 
				+  const userInputPriceUpper = 160;
			
 
				+
			
 
				+  // When creating a position, round the price to the price of the corresponding tick
			
 
				+  const roundPriceLower = chain.alignPriceToTickPrice(new Decimal(userInputPriceLower), poolInfo);
			
 
				+  const roundPriceUpper = chain.alignPriceToTickPrice(new Decimal(userInputPriceUpper), poolInfo);
			
 
				+
			
 
				+  console.log(`User input price: ${userInputPriceLower} - ${userInputPriceUpper}`);
			
 
				+  console.log(`Aligned to tick price: ${roundPriceLower} - ${roundPriceUpper}`);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/06_get_amount_from_another_amount.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/06_get_amount_from_another_amount.ts
@@ -0,0 +1,32 @@
 
				+/**
			
 
				+ * Round the price to the price of the corresponding tick (used when creating a position)
			
 
				+ */
			
 
				+
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { chain, PoolAddress } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.SOL_USDC);
			
 
				+
			
 
				+  const userInputPriceLower = 120;
			
 
				+  const userInputPriceUpper = 160;
			
 
				+  const userInputAmountA = new BN(1000000000); // 1 SOL
			
 
				+
			
 
				+  // Calculate the amount of tokenB needed to be invested in the specified price range after the specified tokenA amount has been invested
			
 
				+  const amountB = chain.getAmountBFromAmountA({
			
 
				+    priceLower: new Decimal(userInputPriceLower),
			
 
				+    priceUpper: new Decimal(userInputPriceUpper),
			
 
				+    amountA: userInputAmountA,
			
 
				+    poolInfo,
			
 
				+  });
			
 
				+
			
 
				+  // Tips: This is the amount of tokens that will be accurately invested in the vault pool;
			
 
				+  console.log(
			
 
				+    'Estimated amount of tokenB to be invested =>',
			
 
				+    Number(amountB.toString()) / 10 ** poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/07_create_position_baseA.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/07_create_position_baseA.ts
@@ -0,0 +1,83 @@
 
				+/**
			
 
				+ * Create a position
			
 
				+ */
			
 
				+
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { SignerCallback } from '../client/chain/models.js';
			
 
				+import { TickMath } from '../index.js';
			
 
				+
			
 
				+import { userKeypair, userAddress, chain, PoolAddress } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // step 1: User selects the pool
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.USDC_USDT);
			
 
				+
			
 
				+  console.log('========= step 1: Select the pool =========');
			
 
				+  console.log('Selected pool address:', poolInfo.poolId.toBase58());
			
 
				+
			
 
				+  // step 2: User inputs the price range
			
 
				+  const userStartPrice = '0.998';
			
 
				+  const userEndPrice = '1.002';
			
 
				+
			
 
				+  // Calculate the accurate tick price, and show it to the user
			
 
				+  const priceInTickLower = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userStartPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  const priceInTickUpper = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userEndPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+
			
 
				+  console.log('========= step 2: User inputs the price range =========');
			
 
				+  console.log(`User input price range: ${userStartPrice} - ${userEndPrice}`);
			
 
				+  console.log(`Accurate price range: ${priceInTickLower.price.toNumber()} - ${priceInTickUpper.price.toNumber()}`);
			
 
				+  console.log(`Accurate price tick range: ${priceInTickLower.tick} - ${priceInTickUpper.tick}`);
			
 
				+
			
 
				+  // step 3: User inputs the amount of TokenB and the token type
			
 
				+  const base = 'MintA';
			
 
				+  const baseAmount = new BN(2 * 10 ** poolInfo.mintDecimalsA);
			
 
				+
			
 
				+  // Calculate the amount of TokenA needed
			
 
				+  const amountB = chain.getAmountBFromAmountA({
			
 
				+    priceLower: priceInTickLower.price,
			
 
				+    priceUpper: priceInTickUpper.price,
			
 
				+    amountA: baseAmount,
			
 
				+    poolInfo,
			
 
				+  });
			
 
				+
			
 
				+  // Add a 2% slippage
			
 
				+  const amountBWithSlippage = new BN(amountB).mul(new BN(10000 * (1 + 0.02))).div(new BN(10000));
			
 
				+
			
 
				+  console.log('========= step 3: User inputs the amount of TokenB and the token type =========');
			
 
				+  console.log('Amount of TokenA to be invested =>', Number(baseAmount.toString()) / 10 ** poolInfo.mintDecimalsA);
			
 
				+  console.log('Estimated amount of TokenB needed =>', Number(amountB.toString()) / 10 ** poolInfo.mintDecimalsB);
			
 
				+
			
 
				+  // Signer callback, later this can be implemented with a wallet plugin
			
 
				+  const signerCallback: SignerCallback = async (tx) => {
			
 
				+    tx.sign([userKeypair]);
			
 
				+    return tx;
			
 
				+  };
			
 
				+
			
 
				+  console.log('======= step 4: After confirming that there is no error, start creating a position =======');
			
 
				+  const txid = await chain.createPosition({
			
 
				+    userAddress: userAddress,
			
 
				+    poolInfo,
			
 
				+    tickLower: priceInTickLower.tick,
			
 
				+    tickUpper: priceInTickUpper.tick,
			
 
				+    base,
			
 
				+    baseAmount,
			
 
				+    otherAmountMax: amountBWithSlippage,
			
 
				+    signerCallback,
			
 
				+  });
			
 
				+
			
 
				+  console.log('Create position successfully, txid:', txid);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/07_create_position_baseB.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/07_create_position_baseB.ts
@@ -0,0 +1,82 @@
 
				+/**
			
 
				+ * Create a position
			
 
				+ */
			
 
				+
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { SignerCallback } from '../client/chain/models.js';
			
 
				+import { TickMath } from '../index.js';
			
 
				+
			
 
				+import { userKeypair, userAddress, PoolAddress, chain } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // step 1: User selects the pool
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.USDC_USDT);
			
 
				+
			
 
				+  console.log('========= step 1: Select the pool =========');
			
 
				+  console.log('Selected pool address:', poolInfo.poolId.toBase58());
			
 
				+
			
 
				+  // step 2: User inputs the price range
			
 
				+  const userStartPrice = '0.998';
			
 
				+  const userEndPrice = '1.002';
			
 
				+
			
 
				+  // Calculate the accurate tick price, and show it to the user
			
 
				+  const priceInTickLower = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userStartPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  const priceInTickUpper = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userEndPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+
			
 
				+  console.log('========= step 2: User inputs the price range =========');
			
 
				+  console.log(`User input price range: ${userStartPrice} - ${userEndPrice}`);
			
 
				+  console.log(`Accurate price range: ${priceInTickLower.price.toNumber()} - ${priceInTickUpper.price.toNumber()}`);
			
 
				+
			
 
				+  // step 3: User inputs the amount of TokenB and the token type
			
 
				+  const base = 'MintB';
			
 
				+  const baseAmount = new BN(2 * 10 ** poolInfo.mintDecimalsB);
			
 
				+
			
 
				+  // Calculate the amount of TokenA needed
			
 
				+  const amountA = chain.getAmountAFromAmountB({
			
 
				+    priceLower: priceInTickLower.price,
			
 
				+    priceUpper: priceInTickUpper.price,
			
 
				+    amountB: baseAmount,
			
 
				+    poolInfo,
			
 
				+  });
			
 
				+
			
 
				+  // Add a 2% slippage
			
 
				+  const amountAWithSlippage = new BN(amountA).mul(new BN(10000 * (1 + 0.02))).div(new BN(10000));
			
 
				+
			
 
				+  console.log('========= step 3: User inputs the amount of TokenB and the token type =========');
			
 
				+  console.log('Amount of TokenB to be invested =>', Number(baseAmount.toString()) / 10 ** poolInfo.mintDecimalsB);
			
 
				+  console.log('Estimated amount of TokenA needed =>', Number(amountA.toString()) / 10 ** poolInfo.mintDecimalsA);
			
 
				+
			
 
				+  // Signer callback, later this can be implemented with a wallet plugin
			
 
				+  const signerCallback: SignerCallback = async (tx) => {
			
 
				+    tx.sign([userKeypair]);
			
 
				+    return tx;
			
 
				+  };
			
 
				+
			
 
				+  console.log('======= step 4: After confirming that there is no error, start creating a position =======');
			
 
				+  const txid = await chain.createPosition({
			
 
				+    userAddress: userAddress,
			
 
				+    poolInfo,
			
 
				+    tickLower: priceInTickLower.tick,
			
 
				+    tickUpper: priceInTickUpper.tick,
			
 
				+    base,
			
 
				+    baseAmount,
			
 
				+    otherAmountMax: amountAWithSlippage,
			
 
				+    signerCallback,
			
 
				+  });
			
 
				+
			
 
				+  console.log('Create position successfully, txid:', txid);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/08_decrease_liquidity.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/08_decrease_liquidity.ts
@@ -0,0 +1,40 @@
 
				+/**
			
 
				+ * Decrease liquidity proportionally
			
 
				+ */
			
 
				+
			
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+
			
 
				+import { chain, signerCallback, userAddress } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // Change to your own NFT mint address
			
 
				+  const nftMint = new PublicKey('3eunC8kdMEwBRQHd91cyQ36FVQFXDuicGk7xuVS6hFfk');
			
 
				+
			
 
				+  const positionInfo = await chain.getRawPositionInfoByNftMint(nftMint);
			
 
				+
			
 
				+  if (!positionInfo) {
			
 
				+    throw new Error('Position not found');
			
 
				+  }
			
 
				+
			
 
				+  const { liquidity } = positionInfo;
			
 
				+
			
 
				+  const decreasePercentage = 50; // Decrease 50% of the liquidity
			
 
				+
			
 
				+  const liquidityToDecrease = liquidity.mul(new BN(decreasePercentage)).div(new BN(100));
			
 
				+
			
 
				+  console.log('Current liquidity amount:', liquidity.toString());
			
 
				+  console.log('Liquidity to decrease:', liquidityToDecrease.toString());
			
 
				+
			
 
				+  const txid = await chain.decreaseLiquidity({
			
 
				+    userAddress,
			
 
				+    nftMint,
			
 
				+    // Decrease half of the liquidity
			
 
				+    liquidity: liquidityToDecrease,
			
 
				+    signerCallback,
			
 
				+  });
			
 
				+
			
 
				+  console.log('Decrease liquidity successfully, txid:', txid);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/09_create_position_side_tokenA.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/09_create_position_side_tokenA.ts
@@ -0,0 +1,82 @@
 
				+/**
			
 
				+ * Create a position
			
 
				+ */
			
 
				+
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { SignerCallback } from '../client/chain/models.js';
			
 
				+import { TickMath } from '../index.js';
			
 
				+
			
 
				+import { userKeypair, userAddress, PoolAddress, chain } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // step 1: User selects the pool
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.USDC_USDT);
			
 
				+
			
 
				+  console.log('========= step 1: Select the pool =========');
			
 
				+  console.log('Selected pool address:', poolInfo.poolId.toBase58());
			
 
				+
			
 
				+  // step 2: User inputs the price range
			
 
				+  const userStartPrice = '1.1';
			
 
				+  const userEndPrice = '1.2';
			
 
				+
			
 
				+  // Calculate the accurate tick price, and show it to the user
			
 
				+  const priceInTickLower = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userStartPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  const priceInTickUpper = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userEndPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+
			
 
				+  console.log('========= step 2: User inputs the price range =========');
			
 
				+  console.log(`User input price range: ${userStartPrice} - ${userEndPrice}`);
			
 
				+  console.log(`Accurate price range: ${priceInTickLower.price.toNumber()} - ${priceInTickUpper.price.toNumber()}`);
			
 
				+
			
 
				+  // step 3: User inputs the amount of TokenA and the token type
			
 
				+  const base = 'MintA';
			
 
				+  const baseAmount = new BN(2 * 10 ** poolInfo.mintDecimalsA);
			
 
				+
			
 
				+  // Calculate the amount of TokenB needed
			
 
				+  const amountB = chain.getAmountBFromAmountA({
			
 
				+    priceLower: priceInTickLower.price,
			
 
				+    priceUpper: priceInTickUpper.price,
			
 
				+    amountA: baseAmount,
			
 
				+    poolInfo,
			
 
				+  });
			
 
				+
			
 
				+  // Add a 2% slippage
			
 
				+  const amountBWithSlippage = new BN(amountB).mul(new BN(10000 * (1 + 0.02))).div(new BN(10000));
			
 
				+
			
 
				+  console.log('========= step 3: User inputs the amount of TokenA and the token type =========');
			
 
				+  console.log('Amount of TokenA to be invested =>', Number(baseAmount.toString()) / 10 ** poolInfo.mintDecimalsA);
			
 
				+  console.log('Estimated amount of TokenB needed =>', Number(amountB.toString()) / 10 ** poolInfo.mintDecimalsB);
			
 
				+
			
 
				+  // Signer callback, later this can be implemented with a wallet plugin
			
 
				+  const signerCallback: SignerCallback = async (tx) => {
			
 
				+    tx.sign([userKeypair]);
			
 
				+    return tx;
			
 
				+  };
			
 
				+
			
 
				+  console.log('======= step 4: After confirming that there is no error, start creating a position =======');
			
 
				+  const txid = await chain.createPosition({
			
 
				+    userAddress: userAddress,
			
 
				+    poolInfo,
			
 
				+    tickLower: priceInTickLower.tick,
			
 
				+    tickUpper: priceInTickUpper.tick,
			
 
				+    base,
			
 
				+    baseAmount,
			
 
				+    otherAmountMax: amountBWithSlippage,
			
 
				+    signerCallback,
			
 
				+  });
			
 
				+
			
 
				+  console.log('Create position successfully, txid:', txid);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/10_create_position_side_tokenB.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/10_create_position_side_tokenB.ts
@@ -0,0 +1,82 @@
 
				+/**
			
 
				+ * Create a position
			
 
				+ */
			
 
				+
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { SignerCallback } from '../client/chain/models.js';
			
 
				+import { TickMath } from '../index.js';
			
 
				+
			
 
				+import { userKeypair, userAddress, PoolAddress, chain } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // step 1: User selects the pool
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(PoolAddress.USDC_USDT);
			
 
				+
			
 
				+  console.log('========= step 1: Select the pool =========');
			
 
				+  console.log('Selected pool address:', poolInfo.poolId.toBase58());
			
 
				+
			
 
				+  // step 2: User inputs the price range
			
 
				+  const userStartPrice = '0.8';
			
 
				+  const userEndPrice = '0.9';
			
 
				+
			
 
				+  // Calculate the accurate tick price, and show it to the user
			
 
				+  const priceInTickLower = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userStartPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+  const priceInTickUpper = TickMath.getTickAlignedPriceDetails(
			
 
				+    new Decimal(userEndPrice),
			
 
				+    poolInfo.tickSpacing,
			
 
				+    poolInfo.mintDecimalsA,
			
 
				+    poolInfo.mintDecimalsB
			
 
				+  );
			
 
				+
			
 
				+  console.log('========= step 2: User inputs the price range =========');
			
 
				+  console.log(`User input price range: ${userStartPrice} - ${userEndPrice}`);
			
 
				+  console.log(`Accurate price range: ${priceInTickLower.price.toNumber()} - ${priceInTickUpper.price.toNumber()}`);
			
 
				+
			
 
				+  // step 3: User inputs the amount of TokenB and the token type
			
 
				+  const base = 'MintB';
			
 
				+  const baseAmount = new BN(2 * 10 ** poolInfo.mintDecimalsB);
			
 
				+
			
 
				+  // Calculate the amount of TokenA needed
			
 
				+  const amountA = chain.getAmountAFromAmountB({
			
 
				+    priceLower: priceInTickLower.price,
			
 
				+    priceUpper: priceInTickUpper.price,
			
 
				+    amountB: baseAmount,
			
 
				+    poolInfo,
			
 
				+  });
			
 
				+
			
 
				+  // Add a 2% slippage
			
 
				+  const amountAWithSlippage = new BN(amountA).mul(new BN(10000 * (1 + 0.02))).div(new BN(10000));
			
 
				+
			
 
				+  console.log('========= step 3: User inputs the amount of TokenB and the token type =========');
			
 
				+  console.log('Amount of TokenB to be invested =>', Number(baseAmount.toString()) / 10 ** poolInfo.mintDecimalsB);
			
 
				+  console.log('Estimated amount of TokenA needed =>', Number(amountA.toString()) / 10 ** poolInfo.mintDecimalsA);
			
 
				+
			
 
				+  // Signer callback, later this can be implemented with a wallet plugin
			
 
				+  const signerCallback: SignerCallback = async (tx) => {
			
 
				+    tx.sign([userKeypair]);
			
 
				+    return tx;
			
 
				+  };
			
 
				+
			
 
				+  console.log('======= step 4: After confirming that there is no error, start creating a position =======');
			
 
				+  const txid = await chain.createPosition({
			
 
				+    userAddress: userAddress,
			
 
				+    poolInfo,
			
 
				+    tickLower: priceInTickLower.tick,
			
 
				+    tickUpper: priceInTickUpper.tick,
			
 
				+    base,
			
 
				+    baseAmount,
			
 
				+    otherAmountMax: amountAWithSlippage,
			
 
				+    signerCallback,
			
 
				+  });
			
 
				+
			
 
				+  console.log('Create position successfully, txid:', txid);
			
 
				+}
			
 
				+
			
 
				+main();
			
--- a/src/lib/clmm-sdk/src/playgrounds/11_decrease_liquidity_simulate_amount.ts
+++ b/src/lib/clmm-sdk/src/playgrounds/11_decrease_liquidity_simulate_amount.ts
@@ -0,0 +1,69 @@
 
				+/**
			
 
				+ * Decrease liquidity proportionally, and display the estimated tokenA and tokenB amounts
			
 
				+ */
			
 
				+
			
 
				+import { PublicKey } from '@solana/web3.js';
			
 
				+import BN from 'bn.js';
			
 
				+import { Decimal } from 'decimal.js';
			
 
				+
			
 
				+import { LiquidityMath, SqrtPriceMath } from '../index.js';
			
 
				+
			
 
				+import { chain } from './config.js';
			
 
				+
			
 
				+async function main(): Promise<void> {
			
 
				+  // Change to your own NFT mint address
			
 
				+  const nftMint = new PublicKey('CjouQkvVP5XkABWYQYzCAJMpB3g8yJhADtRcRtEZTj8M');
			
 
				+
			
 
				+  const positionInfo = await chain.getRawPositionInfoByNftMint(nftMint);
			
 
				+
			
 
				+  if (!positionInfo) {
			
 
				+    throw new Error('Position not found');
			
 
				+  }
			
 
				+
			
 
				+  const { liquidity, tickLower, tickUpper } = positionInfo;
			
 
				+
			
 
				+  const decreasePercentage = 50; // decrease 50% of the liquidity
			
 
				+
			
 
				+  const liquidityToDecrease = liquidity.mul(new BN(decreasePercentage)).div(new BN(100));
			
 
				+
			
 
				+  console.log('Current liquidity amount:', liquidity.toString());
			
 
				+  console.log('Liquidity to decrease:', liquidityToDecrease.toString());
			
 
				+
			
 
				+  const sqrtPriceLowerX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickLower);
			
 
				+  const sqrtPriceUpperX64 = SqrtPriceMath.getSqrtPriceX64FromTick(tickUpper);
			
 
				+
			
 
				+  const poolInfo = await chain.getRawPoolInfoByPoolId(positionInfo.poolId);
			
 
				+
			
 
				+  const amounts = LiquidityMath.getAmountsFromLiquidity(
			
 
				+    poolInfo.sqrtPriceX64,
			
 
				+    sqrtPriceLowerX64,
			
 
				+    sqrtPriceUpperX64,
			
 
				+    liquidityToDecrease,
			
 
				+    true
			
 
				+  );
			
 
				+
			
 
				+  console.log(
			
 
				+    'Estimated tokenA amount:',
			
 
				+    new Decimal(amounts.amountA.toString())
			
 
				+      .div(new Decimal(10 ** poolInfo.mintDecimalsA))
			
 
				+      .toFixed(poolInfo.mintDecimalsA)
			
 
				+  );
			
 
				+  console.log(
			
 
				+    'Estimated tokenB amount:',
			
 
				+    new Decimal(amounts.amountB.toString())
			
 
				+      .div(new Decimal(10 ** poolInfo.mintDecimalsB))
			
 
				+      .toFixed(poolInfo.mintDecimalsB)
			
 
				+  );
			
 
				+
			
 
				+  // const txid = chain.decreaseLiquidity({
			
 
				+  //   userAddress,
			
 
				+  //   nftMint,
			
 
				+  //   // Decrease half of the liquidity
			
 
				+  //   liquidity: liquidityToDecrease,
			
 
				+  //   signerCallback,
			
 
				+  // });
			
 
				+
			
 
				+  // console.log(txid);
			
 
				+}
			
 
				+
			
 
				+main();
		`@@ -0,0 +1 @@`
		`+{"better-sqlite3": true, "bigint-buffer": true, "bufferutil": true, "utf-8-validate": true}`